#   1HCT 
_audit_conform.dict_name       mmcif_pdbx.dic 
_audit_conform.dict_version    5.355 
PDB   1HCT         pdb_00001hct 10.2210/pdb1hct/pdb 
WWPDB D_1000173785 ?            ?                   
_pdbx_database_related.db_name        PDB 
_pdbx_database_related.db_id          1HCS 
_pdbx_database_related.details        . 
_pdbx_database_related.content_type   'representative structure' 
_pdbx_database_status.status_code                     REL 
_pdbx_database_status.entry_id                        1HCT 
_pdbx_database_status.recvd_initial_deposition_date   1994-09-02 
_pdbx_database_status.deposit_site                    ? 
_pdbx_database_status.process_site                    BNL 
_pdbx_database_status.SG_entry                        . 
_pdbx_database_status.pdb_format_compatible           Y 
_pdbx_database_status.status_code_mr                  ? 
_pdbx_database_status.status_code_sf                  ? 
_pdbx_database_status.status_code_cs                  ? 
_pdbx_database_status.status_code_nmr_data            ? 
_pdbx_database_status.methods_development_category    ? 
'Gampe Junior, R.T.' 1 
'Xu, R.X.'           2 
primary 'Solution structure of the human pp60c-src SH2 domain complexed with a phosphorylated tyrosine pentapeptide.' Biochemistry 
34  2107  2121 1995 BICHAW US 0006-2960 0033 ? 7532003 10.1021/bi00007a003 
1       'Peptide Inhibitors of Src SH3-Sh2(Slash)Phosphoprotein Interactions' J.Biol.Chem.            269 31711 ?    1994 JBCHA3 
US 0021-9258 0071 ? ?       ?                   
'Nuclear Magnetic Resonance Structure of an Sh2 Domain of Phospholipase C-Gamma1 Complexed with a High Affinity Binding Peptide' 
'Cell(Cambridge,Mass.)' 77  461   ?    1994 CELLB5 US 0092-8674 0998 ? ?       ?                   
'Binding of a High Affinity Phosphotyrosyl Peptide to the Src Sh2 Domain: Crystal Structures of the Complexed and Peptide-Free Forms' 
'Cell(Cambridge,Mass.)' 72  779   ?    1993 CELLB5 US 0092-8674 0998 ? ?       ?                   
4       'Recognition of a High-Affinity Phosphotyrosyl Peptide by the Src Homology-2 Domain of P56Lck' Nature                  362 
87    ?    1993 NATUAS UK 0028-0836 0006 ? ?       ?                   
;Human Cellular Src Gene: Nucleotide Sequence and Derived Amino Acid Sequence of the Region Coding for the Carboxy-Terminal Two-Thirds of Pp60C-Src
Mol.Cell.Biol.          5   1122  ?    1985 MCEBD4 US 0270-7306 2044 ? ?       ?                   
primary 'Xu, R.X.'          1  ? 
primary 'Word, J.M.'        2  ? 
primary 'Davis, D.G.'       3  ? 
primary 'Rink, M.J.'        4  ? 
primary 'Willard Jr., D.H.' 5  ? 
primary 'Gampe Jr., R.T.'   6  ? 
1       'Gilmer, T.'        7  ? 
1       'Rodriguez, M.'     8  ? 
1       'Jordan, S.'        9  ? 
1       'Crosby, R.'        10 ? 
1       'Alligood, K.'      11 ? 
1       'Green, M.'         12 ? 
1       'Kimery, M.'        13 ? 
1       'Wagner, C.'        14 ? 
1       'Kinder, D.'        15 ? 
1       'Charifson, P.'     16 ? 
1       'Hassell, A.M.'     17 ? 
1       'Willard, D.'       18 ? 
1       'Luther, M.'        19 ? 
1       'Rusnak, D.'        20 ? 
1       'Sternbach, D.D.'   21 ? 
1       'Mehrotra, M.'      22 ? 
1       'Peel, M.'          23 ? 
1       'Shampine, L.'      24 ? 
1       'Davis, R.'         25 ? 
1       'Robbins, J.'       26 ? 
1       'Patel, I.R.'       27 ? 
1       'Kassel, D.'        28 ? 
1       'Burkhart, W.'      29 ? 
1       'Moyer, M.'         30 ? 
1       'Bradshaw, T.'      31 ? 
1       'Berman, J.'        32 ? 
2       'Pascal, S.M.'      33 ? 
2       'Singer, A.U.'      34 ? 
2       'Gish, G.'          35 ? 
2       'Yamazaki, T.'      36 ? 
2       'Shoelson, S.E.'    37 ? 
2       'Pawson, T.'        38 ? 
2       'Kay, L.E.'         39 ? 
2       'Forman-Kay, J.D.'  40 ? 
3       'Waksman, G.'       41 ? 
3       'Shoelson, S.E.'    42 ? 
3       'Pant, N.'          43 ? 
3       'Cowburn, D.'       44 ? 
3       'Kuriyan, J.'       45 ? 
4       'Eck, M.J.'         46 ? 
4       'Shoelson, S.E.'    47 ? 
4       'Harrison, S.C.'    48 ? 
5       'Anderson, S.K.'    49 ? 
5       'Gibbs, C.P.'       50 ? 
5       'Tanaka, A.'        51 ? 
5       'Kung, H.J.'        52 ? 
5       'Fugita, D.J.'      53 ? 
_cell.entry_id           1HCT 
_cell.length_a           1.000 
_cell.length_b           1.000 
_cell.length_c           1.000 
_cell.angle_alpha        90.00 
_cell.angle_beta         90.00 
_cell.angle_gamma        90.00 
_cell.Z_PDB              1 
_cell.pdbx_unique_axis   ? 
_symmetry.entry_id                         1HCT 
_symmetry.space_group_name_H-M             'P 1' 
_symmetry.pdbx_full_space_group_name_H-M   ? 
_symmetry.cell_setting                     ? 
_symmetry.Int_Tables_number                1 
1 polymer man ACETYL-PYEEIE-OH 787.705   1 ? ? ? ? 
2 polymer man 'HUMAN SRC'      12303.886 1 ? ? ? ? 
_entity_name_com.entity_id   2        PP60==C-SRC== 
1 'polypeptide(L)' no yes '(ACE)(PTR)EEIE' XYEEIE A ? 
2 'polypeptide(L)' no no  
B ? 
1 1   ACE n 
1 2   PTR n 
1 3   GLU n 
1 4   GLU n 
1 5   ILE n 
1 6   GLU n 
2 1   MET n 
2 2   ASP n 
2 3   SER n 
2 4   ILE n 
2 5   GLN n 
2 6   ALA n 
2 7   GLU n 
2 8   GLU n 
2 9   TRP n 
2 10  TYR n 
2 11  PHE n 
2 12  GLY n 
2 13  LYS n 
2 14  ILE n 
2 15  THR n 
2 16  ARG n 
2 17  ARG n 
2 18  GLU n 
2 19  SER n 
2 20  GLU n 
2 21  ARG n 
2 22  LEU n 
2 23  LEU n 
2 24  LEU n 
2 25  ASN n 
2 26  ALA n 
2 27  GLU n 
2 28  ASN n 
2 29  PRO n 
2 30  ARG n 
2 31  GLY n 
2 32  THR n 
2 33  PHE n 
2 34  LEU n 
2 35  VAL n 
2 36  ARG n 
2 37  GLU n 
2 38  SER n 
2 39  GLU n 
2 40  THR n 
2 41  THR n 
2 42  LYS n 
2 43  GLY n 
2 44  ALA n 
2 45  TYR n 
2 46  CYS n 
2 47  LEU n 
2 48  SER n 
2 49  VAL n 
2 50  SER n 
2 51  ASP n 
2 52  PHE n 
2 53  ASP n 
2 54  ASN n 
2 55  ALA n 
2 56  LYS n 
2 57  GLY n 
2 58  LEU n 
2 59  ASN n 
2 60  VAL n 
2 61  LYS n 
2 62  HIS n 
2 63  TYR n 
2 64  LYS n 
2 65  ILE n 
2 66  ARG n 
2 67  LYS n 
2 68  LEU n 
2 69  ASP n 
2 70  SER n 
2 71  GLY n 
2 72  GLY n 
2 73  PHE n 
2 74  TYR n 
2 75  ILE n 
2 76  THR n 
2 77  SER n 
2 78  ARG n 
2 79  THR n 
2 80  GLN n 
2 81  PHE n 
2 82  ASN n 
2 83  SER n 
2 84  LEU n 
2 85  GLN n 
2 86  GLN n 
2 87  LEU n 
2 88  VAL n 
2 89  ALA n 
2 90  TYR n 
2 91  TYR n 
2 92  SER n 
2 93  LYS n 
2 94  HIS n 
2 95  ALA n 
2 96  ASP n 
2 97  GLY n 
2 98  LEU n 
2 99  CYS n 
2 100 HIS n 
2 101 ARG n 
2 102 LEU n 
2 103 THR n 
2 104 THR n 
2 105 VAL n 
2 106 CYS n 
2 107 PRO n 
_entity_src_gen.entity_id                          2 
_entity_src_gen.pdbx_src_id                        1 
_entity_src_gen.pdbx_alt_source_flag               sample 
_entity_src_gen.pdbx_seq_type                      ? 
_entity_src_gen.pdbx_beg_seq_num                   ? 
_entity_src_gen.pdbx_end_seq_num                   ? 
_entity_src_gen.gene_src_common_name               human 
_entity_src_gen.gene_src_genus                     Homo 
_entity_src_gen.pdbx_gene_src_gene                 'NUCLEOTIDE SEQUENCE A' 
_entity_src_gen.gene_src_species                   ? 
_entity_src_gen.gene_src_strain                    ? 
_entity_src_gen.gene_src_tissue                    ? 
_entity_src_gen.gene_src_tissue_fraction           ? 
_entity_src_gen.gene_src_details                   ? 
_entity_src_gen.pdbx_gene_src_fragment             ? 
_entity_src_gen.pdbx_gene_src_scientific_name      'Homo sapiens' 
_entity_src_gen.pdbx_gene_src_ncbi_taxonomy_id     9606 
_entity_src_gen.pdbx_gene_src_variant              ? 
_entity_src_gen.pdbx_gene_src_cell_line            ? 
_entity_src_gen.pdbx_gene_src_atcc                 ? 
_entity_src_gen.pdbx_gene_src_organ                ? 
_entity_src_gen.pdbx_gene_src_organelle            ? 
_entity_src_gen.pdbx_gene_src_cell                 ? 
_entity_src_gen.pdbx_gene_src_cellular_location    ? 
_entity_src_gen.host_org_common_name               ? 
_entity_src_gen.pdbx_host_org_scientific_name      'Escherichia coli BL21' 
_entity_src_gen.pdbx_host_org_ncbi_taxonomy_id     511693 
_entity_src_gen.host_org_genus                     Escherichia 
_entity_src_gen.pdbx_host_org_gene                 ? 
_entity_src_gen.pdbx_host_org_organ                ? 
_entity_src_gen.host_org_species                   'Escherichia coli' 
_entity_src_gen.pdbx_host_org_tissue               ? 
_entity_src_gen.pdbx_host_org_tissue_fraction      ? 
_entity_src_gen.pdbx_host_org_strain               BL21 
_entity_src_gen.pdbx_host_org_variant              ? 
_entity_src_gen.pdbx_host_org_cell_line            ? 
_entity_src_gen.pdbx_host_org_atcc                 ? 
_entity_src_gen.pdbx_host_org_culture_collection   ? 
_entity_src_gen.pdbx_host_org_cell                 ? 
_entity_src_gen.pdbx_host_org_organelle            ? 
_entity_src_gen.pdbx_host_org_cellular_location    ? 
_entity_src_gen.pdbx_host_org_vector_type          ? 
_entity_src_gen.pdbx_host_org_vector               ? 
_entity_src_gen.host_org_details                   ? 
_entity_src_gen.expression_system_id               ? 
_entity_src_gen.plasmid_name                       ? 
_entity_src_gen.plasmid_details                    ? 
_entity_src_gen.pdbx_description                   ? 
1 UNP SRC_HUMAN 2 P12931 1 
2 PDB 1HCT      1 1HCT   ? ? ? 
1 1 1HCT B 2 ? 107 ? P12931 143 ? 248 ? 141 246 
2 2 1HCT A 1 ? 6   ? 1HCT   100 ? 105 ? 100 105 
ACE non-polymer         . 'ACETYL GROUP'    ?                 'C2 H4 O'        44.053  
ALA 'L-peptide linking' y ALANINE           ?                 'C3 H7 N O2'     89.093  
ARG 'L-peptide linking' y ARGININE          ?                 'C6 H15 N4 O2 1' 175.209 
ASN 'L-peptide linking' y ASPARAGINE        ?                 'C4 H8 N2 O3'    132.118 
ASP 'L-peptide linking' y 'ASPARTIC ACID'   ?                 'C4 H7 N O4'     133.103 
CYS 'L-peptide linking' y CYSTEINE          ?                 'C3 H7 N O2 S'   121.158 
GLN 'L-peptide linking' y GLUTAMINE         ?                 'C5 H10 N2 O3'   146.144 
GLU 'L-peptide linking' y 'GLUTAMIC ACID'   ?                 'C5 H9 N O4'     147.129 
GLY 'peptide linking'   y GLYCINE           ?                 'C2 H5 N O2'     75.067  
HIS 'L-peptide linking' y HISTIDINE         ?                 'C6 H10 N3 O2 1' 156.162 
ILE 'L-peptide linking' y ISOLEUCINE        ?                 'C6 H13 N O2'    131.173 
LEU 'L-peptide linking' y LEUCINE           ?                 'C6 H13 N O2'    131.173 
LYS 'L-peptide linking' y LYSINE            ?                 'C6 H15 N2 O2 1' 147.195 
MET 'L-peptide linking' y METHIONINE        ?                 'C5 H11 N O2 S'  149.211 
PHE 'L-peptide linking' y PHENYLALANINE     ?                 'C9 H11 N O2'    165.189 
PRO 'L-peptide linking' y PROLINE           ?                 'C5 H9 N O2'     115.130 
PTR 'L-peptide linking' n O-PHOSPHOTYROSINE PHOSPHONOTYROSINE 'C9 H12 N O6 P'  261.168 
SER 'L-peptide linking' y SERINE            ?                 'C3 H7 N O3'     105.093 
THR 'L-peptide linking' y THREONINE         ?                 'C4 H9 N O3'     119.119 
TRP 'L-peptide linking' y TRYPTOPHAN        ?                 'C11 H12 N2 O2'  204.225 
TYR 'L-peptide linking' y TYROSINE          ?                 'C9 H11 N O3'    181.189 
VAL 'L-peptide linking' y VALINE            ?                 'C5 H11 N O2'    117.146 
_pdbx_nmr_ensemble.entry_id                             1HCT 
_pdbx_nmr_ensemble.conformers_calculated_total_number   ? 
_pdbx_nmr_ensemble.conformers_submitted_total_number    23 
_pdbx_nmr_ensemble.conformer_selection_criteria         ? 
_pdbx_nmr_software.classification   refinement             X-PLOR 
_pdbx_nmr_software.version          ? 
_pdbx_nmr_software.authors          BRUNGER 
_pdbx_nmr_software.ordinal          1 
_exptl.entry_id          1HCT 
_exptl.method            'SOLUTION NMR' 
_exptl.crystals_number   ? 
_struct.entry_id                  1HCT 
_struct.title                     'NMR STRUCTURE OF THE HUMAN SRC SH2 DOMAIN COMPLEX' 
_struct.pdbx_model_details        ? 
_struct.pdbx_CASP_flag            ? 
_struct.pdbx_model_type_details   ? 
_struct_keywords.entry_id        1HCT 
_struct_keywords.pdbx_keywords   'COMPLEX (SIGNAL TRANSDUCTION/PEPTIDE)' 
A N N 1 ? 
B N N 2 ? 
#   1 
HELX_P HELX_P1 1 ILE B 4  ? ALA B 6  ? ILE B 143 ALA B 145 5 ? 3 
HELX_P HELX_P2 2 ARG B 16 ? LEU B 23 ? ARG B 155 LEU B 162 1 ? 8 
HELX_P HELX_P3 3 LEU B 84 ? TYR B 91 ? LEU B 223 TYR B 230 1 ? 8 
#          HELX_P 
_struct_conf_type.criteria    ? 
_struct_conf_type.reference   ? 
covale1 covale both ? A ACE 1 C ? ? ? 1_555 A PTR 2 N ? ? A ACE 100 A PTR 101 1_555 ? ? ? ? ? ? ? 1.306 ? ? 
covale2 covale both ? A PTR 2 C ? ? ? 1_555 A GLU 3 N ? ? A PTR 101 A GLU 102 1_555 ? ? ? ? ? ? ? 1.305 ? ? 
#          covale 
_struct_conn_type.criteria    ? 
_struct_conn_type.reference   ? 
#               A 
_struct_sheet.type             ? 
_struct_sheet.number_strands   3 
_struct_sheet.details          ? 
A 1 2 ? anti-parallel 
A 2 3 ? anti-parallel 
A 1 PHE B 33 ? GLU B 37 ? PHE B 172 GLU B 176 
A 2 TYR B 45 ? PHE B 52 ? TYR B 184 PHE B 191 
A 3 LEU B 58 ? ILE B 65 ? LEU B 197 ILE B 204 
A 1 2 O LEU B 34 ? O LEU B 173 N SER B 48 ? N SER B 187 
A 2 3 O TYR B 45 ? O TYR B 184 N ILE B 65 ? N ILE B 204 
_database_PDB_matrix.entry_id          1HCT 
_database_PDB_matrix.origx[1][1]       1.000000 
_database_PDB_matrix.origx[1][2]       0.000000 
_database_PDB_matrix.origx[1][3]       0.000000 
_database_PDB_matrix.origx[2][1]       0.000000 
_database_PDB_matrix.origx[2][2]       1.000000 
_database_PDB_matrix.origx[2][3]       0.000000 
_database_PDB_matrix.origx[3][1]       0.000000 
_database_PDB_matrix.origx[3][2]       0.000000 
_database_PDB_matrix.origx[3][3]       1.000000 
_database_PDB_matrix.origx_vector[1]   0.00000 
_database_PDB_matrix.origx_vector[2]   0.00000 
_database_PDB_matrix.origx_vector[3]   0.00000 
_atom_sites.entry_id                    1HCT 
_atom_sites.fract_transf_matrix[1][1]   1.000000 
_atom_sites.fract_transf_matrix[1][2]   0.000000 
_atom_sites.fract_transf_matrix[1][3]   0.000000 
_atom_sites.fract_transf_matrix[2][1]   0.000000 
_atom_sites.fract_transf_matrix[2][2]   1.000000 
_atom_sites.fract_transf_matrix[2][3]   0.000000 
_atom_sites.fract_transf_matrix[3][1]   0.000000 
_atom_sites.fract_transf_matrix[3][2]   0.000000 
_atom_sites.fract_transf_matrix[3][3]   1.000000 
_atom_sites.fract_transf_vector[1]      0.00000 
_atom_sites.fract_transf_vector[2]      0.00000 
_atom_sites.fract_transf_vector[3]      0.00000 
HETATM 1     C C    . ACE A 1 1   ? 0.376   1.933   12.712  1.00 14.10 ? 100 ACE A C    1  
HETATM 2     O O    . ACE A 1 1   ? -0.506  2.761   12.603  1.00 14.64 ? 100 ACE A O    1  
HETATM 3     C CH3  . ACE A 1 1   ? 0.809   1.411   14.084  1.00 14.17 ? 100 ACE A CH3  1  
HETATM 4     H H1   . ACE A 1 1   ? 1.693   1.941   14.407  1.00 0.00  ? 100 ACE A H1   1  
HETATM 5     H H2   . ACE A 1 1   ? 0.014   1.569   14.797  1.00 0.00  ? 100 ACE A H2   1  
HETATM 6     H H3   . ACE A 1 1   ? 1.027   0.356   14.015  1.00 0.00  ? 100 ACE A H3   1  
HETATM 7     N N    . PTR A 1 2   ? 0.986   1.449   11.664  1.00 14.28 ? 101 PTR A N    1  
HETATM 8     C CA   . PTR A 1 2   ? 0.612   1.916   10.300  1.00 13.54 ? 101 PTR A CA   1  
HETATM 9     C C    . PTR A 1 2   ? 0.496   3.442   10.288  1.00 14.12 ? 101 PTR A C    1  
HETATM 10    O O    . PTR A 1 2   ? 0.858   4.111   11.235  1.00 13.97 ? 101 PTR A O    1  
HETATM 11    C CB   . PTR A 1 2   ? -0.726  1.294   9.910   1.00 13.83 ? 101 PTR A CB   1  
HETATM 12    C CG   . PTR A 1 2   ? -0.512  -0.167  9.604   1.00 12.91 ? 101 PTR A CG   1  
HETATM 13    C CD1  . PTR A 1 2   ? -0.593  -1.119  10.633  1.00 12.70 ? 101 PTR A CD1  1  
HETATM 14    C CD2  . PTR A 1 2   ? -0.231  -0.572  8.291   1.00 12.17 ? 101 PTR A CD2  1  
HETATM 15    C CE1  . PTR A 1 2   ? -0.393  -2.481  10.347  1.00 11.44 ? 101 PTR A CE1  1  
HETATM 16    C CE2  . PTR A 1 2   ? -0.032  -1.932  8.003   1.00 12.08 ? 101 PTR A CE2  1  
HETATM 17    C CZ   . PTR A 1 2   ? -0.113  -2.887  9.031   1.00 13.78 ? 101 PTR A CZ   1  
HETATM 18    O OH   . PTR A 1 2   ? 0.089   -4.272  8.737   1.00 14.51 ? 101 PTR A OH   1  
HETATM 19    P P    . PTR A 1 2   ? 1.465   -5.005  9.136   1.00 17.94 ? 101 PTR A P    1  
HETATM 20    O O1P  . PTR A 1 2   ? 2.475   -4.296  8.318   1.00 18.17 ? 101 PTR A O1P  1  
HETATM 21    O O2P  . PTR A 1 2   ? 1.220   -6.412  8.746   1.00 15.88 ? 101 PTR A O2P  1  
HETATM 22    O O3P  . PTR A 1 2   ? 1.562   -4.769  10.594  1.00 18.41 ? 101 PTR A O3P  1  
HETATM 23    H H    . PTR A 1 2   ? 1.683   0.769   11.774  1.00 0.00  ? 101 PTR A H    1  
HETATM 24    H HA   . PTR A 1 2   ? 1.367   1.607   9.591   1.00 0.00  ? 101 PTR A HA   1  
HETATM 25    H HB2  . PTR A 1 2   ? -1.424  1.396   10.728  1.00 0.00  ? 101 PTR A HB2  1  
HETATM 26    H HB3  . PTR A 1 2   ? -1.116  1.792   9.035   1.00 0.00  ? 101 PTR A HB3  1  
HETATM 27    H HD1  . PTR A 1 2   ? -0.805  -0.804  11.644  1.00 0.00  ? 101 PTR A HD1  1  
HETATM 28    H HD2  . PTR A 1 2   ? -0.167  0.164   7.504   1.00 0.00  ? 101 PTR A HD2  1  
HETATM 29    H HE1  . PTR A 1 2   ? -0.455  -3.214  11.137  1.00 0.00  ? 101 PTR A HE1  1  
HETATM 30    H HE2  . PTR A 1 2   ? 0.185   -2.244  6.992   1.00 0.00  ? 101 PTR A HE2  1  
ATOM   31    N N    . GLU A 1 3   ? -0.004  3.998   9.219   1.00 15.01 ? 102 GLU A N    1  
ATOM   32    C CA   . GLU A 1 3   ? -0.142  5.479   9.143   1.00 18.67 ? 102 GLU A CA   1  
ATOM   33    C C    . GLU A 1 3   ? -1.590  5.841   8.806   1.00 23.30 ? 102 GLU A C    1  
ATOM   34    O O    . GLU A 1 3   ? -2.187  5.280   7.908   1.00 23.42 ? 102 GLU A O    1  
ATOM   35    C CB   . GLU A 1 3   ? 0.785   6.023   8.054   1.00 18.41 ? 102 GLU A CB   1  
ATOM   36    C CG   . GLU A 1 3   ? 2.115   5.267   8.090   1.00 20.30 ? 102 GLU A CG   1  
ATOM   37    C CD   . GLU A 1 3   ? 2.774   5.456   9.458   1.00 19.75 ? 102 GLU A CD   1  
ATOM   38    O OE1  . GLU A 1 3   ? 2.434   6.417   10.129  1.00 19.69 ? 102 GLU A OE1  1  
ATOM   39    O OE2  . GLU A 1 3   ? 3.607   4.638   9.810   1.00 21.81 ? 102 GLU A OE2  1  
ATOM   40    H H    . GLU A 1 3   ? -0.288  3.440   8.464   1.00 0.00  ? 102 GLU A H    1  
ATOM   41    H HA   . GLU A 1 3   ? 0.126   5.915   10.095  1.00 0.00  ? 102 GLU A HA   1  
ATOM   42    H HB2  . GLU A 1 3   ? 0.321   5.891   7.088   1.00 0.00  ? 102 GLU A HB2  1  
ATOM   43    H HB3  . GLU A 1 3   ? 0.966   7.073   8.227   1.00 0.00  ? 102 GLU A HB3  1  
ATOM   44    H HG2  . GLU A 1 3   ? 1.937   4.216   7.917   1.00 0.00  ? 102 GLU A HG2  1  
ATOM   45    H HG3  . GLU A 1 3   ? 2.769   5.652   7.322   1.00 0.00  ? 102 GLU A HG3  1  
ATOM   46    N N    . GLU A 1 4   ? -2.161  6.773   9.519   1.00 29.30 ? 103 GLU A N    1  
ATOM   47    C CA   . GLU A 1 4   ? -3.570  7.169   9.238   1.00 35.63 ? 103 GLU A CA   1  
ATOM   48    C C    . GLU A 1 4   ? -3.593  8.240   8.146   1.00 37.94 ? 103 GLU A C    1  
ATOM   49    O O    . GLU A 1 4   ? -2.655  8.994   7.981   1.00 40.44 ? 103 GLU A O    1  
ATOM   50    C CB   . GLU A 1 4   ? -4.207  7.727   10.513  1.00 38.84 ? 103 GLU A CB   1  
ATOM   51    C CG   . GLU A 1 4   ? -4.865  6.589   11.295  1.00 44.99 ? 103 GLU A CG   1  
ATOM   52    C CD   . GLU A 1 4   ? -5.279  7.093   12.679  1.00 50.48 ? 103 GLU A CD   1  
ATOM   53    O OE1  . GLU A 1 4   ? -4.822  8.157   13.061  1.00 53.04 ? 103 GLU A OE1  1  
ATOM   54    O OE2  . GLU A 1 4   ? -6.048  6.406   13.332  1.00 53.57 ? 103 GLU A OE2  1  
ATOM   55    H H    . GLU A 1 4   ? -1.662  7.213   10.239  1.00 0.00  ? 103 GLU A H    1  
ATOM   56    H HA   . GLU A 1 4   ? -4.126  6.305   8.906   1.00 0.00  ? 103 GLU A HA   1  
ATOM   57    H HB2  . GLU A 1 4   ? -3.445  8.190   11.123  1.00 0.00  ? 103 GLU A HB2  1  
ATOM   58    H HB3  . GLU A 1 4   ? -4.954  8.460   10.251  1.00 0.00  ? 103 GLU A HB3  1  
ATOM   59    H HG2  . GLU A 1 4   ? -5.738  6.243   10.761  1.00 0.00  ? 103 GLU A HG2  1  
ATOM   60    H HG3  . GLU A 1 4   ? -4.165  5.775   11.406  1.00 0.00  ? 103 GLU A HG3  1  
ATOM   61    N N    . ILE A 1 5   ? -4.660  8.312   7.397   1.00 39.26 ? 104 ILE A N    1  
ATOM   62    C CA   . ILE A 1 5   ? -4.745  9.333   6.315   1.00 40.91 ? 104 ILE A CA   1  
ATOM   63    C C    . ILE A 1 5   ? -5.229  10.659  6.904   1.00 42.72 ? 104 ILE A C    1  
ATOM   64    O O    . ILE A 1 5   ? -6.409  10.948  6.921   1.00 43.33 ? 104 ILE A O    1  
ATOM   65    C CB   . ILE A 1 5   ? -5.733  8.860   5.248   1.00 40.30 ? 104 ILE A CB   1  
ATOM   66    C CG1  . ILE A 1 5   ? -5.159  7.637   4.527   1.00 39.28 ? 104 ILE A CG1  1  
ATOM   67    C CG2  . ILE A 1 5   ? -5.971  9.983   4.237   1.00 41.44 ? 104 ILE A CG2  1  
ATOM   68    C CD1  . ILE A 1 5   ? -3.930  8.051   3.716   1.00 37.66 ? 104 ILE A CD1  1  
ATOM   69    H H    . ILE A 1 5   ? -5.405  7.694   7.547   1.00 0.00  ? 104 ILE A H    1  
ATOM   70    H HA   . ILE A 1 5   ? -3.771  9.469   5.870   1.00 0.00  ? 104 ILE A HA   1  
ATOM   71    H HB   . ILE A 1 5   ? -6.669  8.596   5.718   1.00 0.00  ? 104 ILE A HB   1  
ATOM   72    H HG12 . ILE A 1 5   ? -4.876  6.891   5.256   1.00 0.00  ? 104 ILE A HG12 1  
ATOM   73    H HG13 . ILE A 1 5   ? -5.905  7.228   3.863   1.00 0.00  ? 104 ILE A HG13 1  
ATOM   74    H HG21 . ILE A 1 5   ? -5.021  10.346  3.872   1.00 0.00  ? 104 ILE A HG21 1  
ATOM   75    H HG22 . ILE A 1 5   ? -6.553  9.604   3.409   1.00 0.00  ? 104 ILE A HG22 1  
ATOM   76    H HG23 . ILE A 1 5   ? -6.506  10.790  4.714   1.00 0.00  ? 104 ILE A HG23 1  
ATOM   77    H HD11 . ILE A 1 5   ? -4.205  8.824   3.014   1.00 0.00  ? 104 ILE A HD11 1  
ATOM   78    H HD12 . ILE A 1 5   ? -3.167  8.424   4.382   1.00 0.00  ? 104 ILE A HD12 1  
ATOM   79    H HD13 . ILE A 1 5   ? -3.550  7.195   3.177   1.00 0.00  ? 104 ILE A HD13 1  
ATOM   80    N N    . GLU A 1 6   ? -4.328  11.468  7.389   1.00 0.00  ? 105 GLU A N    1  
ATOM   81    C CA   . GLU A 1 6   ? -4.739  12.775  7.976   1.00 0.00  ? 105 GLU A CA   1  
ATOM   82    C C    . GLU A 1 6   ? -3.811  13.878  7.465   1.00 0.00  ? 105 GLU A C    1  
ATOM   83    O O    . GLU A 1 6   ? -3.852  14.964  8.020   1.00 0.00  ? 105 GLU A O    1  
ATOM   84    C CB   . GLU A 1 6   ? -4.649  12.699  9.502   1.00 0.00  ? 105 GLU A CB   1  
ATOM   85    C CG   . GLU A 1 6   ? -5.811  11.862  10.041  1.00 0.00  ? 105 GLU A CG   1  
ATOM   86    C CD   . GLU A 1 6   ? -6.689  12.730  10.943  1.00 0.00  ? 105 GLU A CD   1  
ATOM   87    O OE1  . GLU A 1 6   ? -6.155  13.320  11.868  1.00 0.00  ? 105 GLU A OE1  1  
ATOM   88    O OE2  . GLU A 1 6   ? -7.882  12.791  10.695  1.00 0.00  ? 105 GLU A OE2  1  
ATOM   89    O OXT  . GLU A 1 6   ? -3.074  13.619  6.527   1.00 0.00  ? 105 GLU A OXT  1  
ATOM   90    H H    . GLU A 1 6   ? -3.381  11.217  7.367   1.00 0.00  ? 105 GLU A H    1  
ATOM   91    H HA   . GLU A 1 6   ? -5.755  12.996  7.686   1.00 0.00  ? 105 GLU A HA   1  
ATOM   92    H HB2  . GLU A 1 6   ? -3.712  12.240  9.784   1.00 0.00  ? 105 GLU A HB2  1  
ATOM   93    H HB3  . GLU A 1 6   ? -4.702  13.694  9.915   1.00 0.00  ? 105 GLU A HB3  1  
ATOM   94    H HG2  . GLU A 1 6   ? -6.399  11.489  9.215   1.00 0.00  ? 105 GLU A HG2  1  
ATOM   95    H HG3  . GLU A 1 6   ? -5.422  11.032  10.611  1.00 0.00  ? 105 GLU A HG3  1  
ATOM   96    N N    . MET B 2 1   ? -6.518  -11.977 -19.114 1.00 0.00  ? 140 MET B N    1  
ATOM   97    C CA   . MET B 2 1   ? -5.937  -13.236 -18.567 1.00 0.00  ? 140 MET B CA   1  
ATOM   98    C C    . MET B 2 1   ? -5.512  -13.012 -17.115 1.00 0.00  ? 140 MET B C    1  
ATOM   99    O O    . MET B 2 1   ? -5.429  -13.938 -16.333 1.00 0.00  ? 140 MET B O    1  
ATOM   100   C CB   . MET B 2 1   ? -4.718  -13.639 -19.400 1.00 0.00  ? 140 MET B CB   1  
ATOM   101   C CG   . MET B 2 1   ? -3.703  -12.495 -19.405 1.00 0.00  ? 140 MET B CG   1  
ATOM   102   S SD   . MET B 2 1   ? -3.761  -11.644 -21.002 1.00 0.00  ? 140 MET B SD   1  
ATOM   103   C CE   . MET B 2 1   ? -3.367  -13.075 -22.036 1.00 0.00  ? 140 MET B CE   1  
ATOM   104   H H1   . MET B 2 1   ? -7.192  -11.580 -18.430 1.00 0.00  ? 140 MET B H1   1  
ATOM   105   H H2   . MET B 2 1   ? -5.755  -11.291 -19.289 1.00 0.00  ? 140 MET B H2   1  
ATOM   106   H H3   . MET B 2 1   ? -7.013  -12.182 -20.006 1.00 0.00  ? 140 MET B H3   1  
ATOM   107   H HA   . MET B 2 1   ? -6.677  -14.022 -18.609 1.00 0.00  ? 140 MET B HA   1  
ATOM   108   H HB2  . MET B 2 1   ? -4.266  -14.521 -18.971 1.00 0.00  ? 140 MET B HB2  1  
ATOM   109   H HB3  . MET B 2 1   ? -5.027  -13.848 -20.413 1.00 0.00  ? 140 MET B HB3  1  
ATOM   110   H HG2  . MET B 2 1   ? -3.942  -11.797 -18.617 1.00 0.00  ? 140 MET B HG2  1  
ATOM   111   H HG3  . MET B 2 1   ? -2.712  -12.892 -19.245 1.00 0.00  ? 140 MET B HG3  1  
ATOM   112   H HE1  . MET B 2 1   ? -2.893  -13.836 -21.431 1.00 0.00  ? 140 MET B HE1  1  
ATOM   113   H HE2  . MET B 2 1   ? -4.273  -13.472 -22.464 1.00 0.00  ? 140 MET B HE2  1  
ATOM   114   H HE3  . MET B 2 1   ? -2.699  -12.771 -22.830 1.00 0.00  ? 140 MET B HE3  1  
ATOM   115   N N    . ASP B 2 2   ? -5.240  -11.790 -16.748 1.00 0.00  ? 141 ASP B N    1  
ATOM   116   C CA   . ASP B 2 2   ? -4.819  -11.509 -15.346 1.00 0.00  ? 141 ASP B CA   1  
ATOM   117   C C    . ASP B 2 2   ? -6.055  -11.439 -14.447 1.00 0.00  ? 141 ASP B C    1  
ATOM   118   O O    . ASP B 2 2   ? -7.175  -11.558 -14.903 1.00 0.00  ? 141 ASP B O    1  
ATOM   119   C CB   . ASP B 2 2   ? -4.074  -10.174 -15.295 1.00 0.00  ? 141 ASP B CB   1  
ATOM   120   C CG   . ASP B 2 2   ? -2.566  -10.430 -15.312 1.00 0.00  ? 141 ASP B CG   1  
ATOM   121   O OD1  . ASP B 2 2   ? -2.163  -11.508 -14.906 1.00 0.00  ? 141 ASP B OD1  1  
ATOM   122   O OD2  . ASP B 2 2   ? -1.839  -9.544  -15.730 1.00 0.00  ? 141 ASP B OD2  1  
ATOM   123   H H    . ASP B 2 2   ? -5.312  -11.057 -17.394 1.00 0.00  ? 141 ASP B H    1  
ATOM   124   H HA   . ASP B 2 2   ? -4.168  -12.299 -15.001 1.00 0.00  ? 141 ASP B HA   1  
ATOM   125   H HB2  . ASP B 2 2   ? -4.348  -9.576  -16.153 1.00 0.00  ? 141 ASP B HB2  1  
ATOM   126   H HB3  . ASP B 2 2   ? -4.338  -9.649  -14.390 1.00 0.00  ? 141 ASP B HB3  1  
ATOM   127   N N    . SER B 2 3   ? -5.860  -11.246 -13.171 1.00 0.00  ? 142 SER B N    1  
ATOM   128   C CA   . SER B 2 3   ? -7.023  -11.167 -12.243 1.00 0.00  ? 142 SER B CA   1  
ATOM   129   C C    . SER B 2 3   ? -6.614  -10.415 -10.975 1.00 0.00  ? 142 SER B C    1  
ATOM   130   O O    . SER B 2 3   ? -5.468  -10.049 -10.802 1.00 0.00  ? 142 SER B O    1  
ATOM   131   C CB   . SER B 2 3   ? -7.477  -12.580 -11.874 1.00 0.00  ? 142 SER B CB   1  
ATOM   132   O OG   . SER B 2 3   ? -7.350  -13.425 -13.010 1.00 0.00  ? 142 SER B OG   1  
ATOM   133   H H    . SER B 2 3   ? -4.949  -11.152 -12.823 1.00 0.00  ? 142 SER B H    1  
ATOM   134   H HA   . SER B 2 3   ? -7.835  -10.643 -12.726 1.00 0.00  ? 142 SER B HA   1  
ATOM   135   H HB2  . SER B 2 3   ? -6.860  -12.962 -11.077 1.00 0.00  ? 142 SER B HB2  1  
ATOM   136   H HB3  . SER B 2 3   ? -8.508  -12.552 -11.546 1.00 0.00  ? 142 SER B HB3  1  
ATOM   137   H HG   . SER B 2 3   ? -8.227  -13.568 -13.373 1.00 0.00  ? 142 SER B HG   1  
ATOM   138   N N    . ILE B 2 4   ? -7.541  -10.181 -10.087 1.00 0.00  ? 143 ILE B N    1  
ATOM   139   C CA   . ILE B 2 4   ? -7.203  -9.452  -8.832  1.00 0.00  ? 143 ILE B CA   1  
ATOM   140   C C    . ILE B 2 4   ? -6.225  -10.288 -8.004  1.00 0.00  ? 143 ILE B C    1  
ATOM   141   O O    . ILE B 2 4   ? -5.568  -9.788  -7.112  1.00 0.00  ? 143 ILE B O    1  
ATOM   142   C CB   . ILE B 2 4   ? -8.479  -9.211  -8.023  1.00 0.00  ? 143 ILE B CB   1  
ATOM   143   C CG1  . ILE B 2 4   ? -8.117  -8.569  -6.682  1.00 0.00  ? 143 ILE B CG1  1  
ATOM   144   C CG2  . ILE B 2 4   ? -9.186  -10.544 -7.775  1.00 0.00  ? 143 ILE B CG2  1  
ATOM   145   C CD1  . ILE B 2 4   ? -9.306  -7.757  -6.166  1.00 0.00  ? 143 ILE B CD1  1  
ATOM   146   H H    . ILE B 2 4   ? -8.459  -10.485 -10.246 1.00 0.00  ? 143 ILE B H    1  
ATOM   147   H HA   . ILE B 2 4   ? -6.748  -8.504  -9.078  1.00 0.00  ? 143 ILE B HA   1  
ATOM   148   H HB   . ILE B 2 4   ? -9.135  -8.553  -8.574  1.00 0.00  ? 143 ILE B HB   1  
ATOM   149   H HG12 . ILE B 2 4   ? -7.870  -9.342  -5.968  1.00 0.00  ? 143 ILE B HG12 1  
ATOM   150   H HG13 . ILE B 2 4   ? -7.267  -7.916  -6.813  1.00 0.00  ? 143 ILE B HG13 1  
ATOM   151   H HG21 . ILE B 2 4   ? -8.778  -11.296 -8.433  1.00 0.00  ? 143 ILE B HG21 1  
ATOM   152   H HG22 . ILE B 2 4   ? -9.037  -10.845 -6.748  1.00 0.00  ? 143 ILE B HG22 1  
ATOM   153   H HG23 . ILE B 2 4   ? -10.243 -10.432 -7.967  1.00 0.00  ? 143 ILE B HG23 1  
ATOM   154   H HD11 . ILE B 2 4   ? -9.909  -7.433  -7.000  1.00 0.00  ? 143 ILE B HD11 1  
ATOM   155   H HD12 . ILE B 2 4   ? -9.902  -8.371  -5.507  1.00 0.00  ? 143 ILE B HD12 1  
ATOM   156   H HD13 . ILE B 2 4   ? -8.945  -6.894  -5.625  1.00 0.00  ? 143 ILE B HD13 1  
ATOM   157   N N    . GLN B 2 5   ? -6.123  -11.557 -8.291  1.00 0.00  ? 144 GLN B N    1  
ATOM   158   C CA   . GLN B 2 5   ? -5.187  -12.422 -7.519  1.00 0.00  ? 144 GLN B CA   1  
ATOM   159   C C    . GLN B 2 5   ? -3.837  -12.481 -8.237  1.00 0.00  ? 144 GLN B C    1  
ATOM   160   O O    . GLN B 2 5   ? -3.056  -13.390 -8.037  1.00 0.00  ? 144 GLN B O    1  
ATOM   161   C CB   . GLN B 2 5   ? -5.769  -13.833 -7.409  1.00 0.00  ? 144 GLN B CB   1  
ATOM   162   C CG   . GLN B 2 5   ? -6.233  -14.304 -8.789  1.00 0.00  ? 144 GLN B CG   1  
ATOM   163   C CD   . GLN B 2 5   ? -6.218  -15.832 -8.839  1.00 0.00  ? 144 GLN B CD   1  
ATOM   164   O OE1  . GLN B 2 5   ? -6.036  -16.483 -7.829  1.00 0.00  ? 144 GLN B OE1  1  
ATOM   165   N NE2  . GLN B 2 5   ? -6.402  -16.437 -9.981  1.00 0.00  ? 144 GLN B NE2  1  
ATOM   166   H H    . GLN B 2 5   ? -6.661  -11.941 -9.014  1.00 0.00  ? 144 GLN B H    1  
ATOM   167   H HA   . GLN B 2 5   ? -5.051  -12.011 -6.529  1.00 0.00  ? 144 GLN B HA   1  
ATOM   168   H HB2  . GLN B 2 5   ? -5.011  -14.507 -7.034  1.00 0.00  ? 144 GLN B HB2  1  
ATOM   169   H HB3  . GLN B 2 5   ? -6.610  -13.825 -6.732  1.00 0.00  ? 144 GLN B HB3  1  
ATOM   170   H HG2  . GLN B 2 5   ? -7.237  -13.946 -8.971  1.00 0.00  ? 144 GLN B HG2  1  
ATOM   171   H HG3  . GLN B 2 5   ? -5.569  -13.914 -9.545  1.00 0.00  ? 144 GLN B HG3  1  
ATOM   172   H HE21 . GLN B 2 5   ? -6.548  -15.912 -10.795 1.00 0.00  ? 144 GLN B HE21 1  
ATOM   173   H HE22 . GLN B 2 5   ? -6.393  -17.416 -10.024 1.00 0.00  ? 144 GLN B HE22 1  
ATOM   174   N N    . ALA B 2 6   ? -3.557  -11.518 -9.072  1.00 42.36 ? 145 ALA B N    1  
ATOM   175   C CA   . ALA B 2 6   ? -2.258  -11.519 -9.802  1.00 39.52 ? 145 ALA B CA   1  
ATOM   176   C C    . ALA B 2 6   ? -2.075  -10.181 -10.520 1.00 36.36 ? 145 ALA B C    1  
ATOM   177   O O    . ALA B 2 6   ? -1.692  -10.130 -11.672 1.00 36.34 ? 145 ALA B O    1  
ATOM   178   C CB   . ALA B 2 6   ? -2.250  -12.654 -10.828 1.00 40.62 ? 145 ALA B CB   1  
ATOM   179   H H    . ALA B 2 6   ? -4.201  -10.794 -9.219  1.00 0.00  ? 145 ALA B H    1  
ATOM   180   H HA   . ALA B 2 6   ? -1.450  -11.664 -9.100  1.00 0.00  ? 145 ALA B HA   1  
ATOM   181   H HB1  . ALA B 2 6   ? -2.719  -13.529 -10.401 1.00 0.00  ? 145 ALA B HB1  1  
ATOM   182   H HB2  . ALA B 2 6   ? -2.795  -12.347 -11.709 1.00 0.00  ? 145 ALA B HB2  1  
ATOM   183   H HB3  . ALA B 2 6   ? -1.231  -12.888 -11.099 1.00 0.00  ? 145 ALA B HB3  1  
ATOM   184   N N    . GLU B 2 7   ? -2.348  -9.095  -9.849  1.00 32.22 ? 146 GLU B N    1  
ATOM   185   C CA   . GLU B 2 7   ? -2.191  -7.761  -10.493 1.00 28.03 ? 146 GLU B CA   1  
ATOM   186   C C    . GLU B 2 7   ? -0.727  -7.325  -10.416 1.00 24.38 ? 146 GLU B C    1  
ATOM   187   O O    . GLU B 2 7   ? 0.086   -7.955  -9.769  1.00 22.48 ? 146 GLU B O    1  
ATOM   188   C CB   . GLU B 2 7   ? -3.066  -6.738  -9.766  1.00 27.81 ? 146 GLU B CB   1  
ATOM   189   C CG   . GLU B 2 7   ? -4.436  -6.664  -10.444 1.00 30.44 ? 146 GLU B CG   1  
ATOM   190   C CD   . GLU B 2 7   ? -4.504  -5.415  -11.324 1.00 31.15 ? 146 GLU B CD   1  
ATOM   191   O OE1  . GLU B 2 7   ? -3.933  -4.409  -10.935 1.00 34.56 ? 146 GLU B OE1  1  
ATOM   192   O OE2  . GLU B 2 7   ? -5.125  -5.485  -12.371 1.00 30.91 ? 146 GLU B OE2  1  
ATOM   193   H H    . GLU B 2 7   ? -2.657  -9.158  -8.921  1.00 0.00  ? 146 GLU B H    1  
ATOM   194   H HA   . GLU B 2 7   ? -2.493  -7.822  -11.527 1.00 0.00  ? 146 GLU B HA   1  
ATOM   195   H HB2  . GLU B 2 7   ? -3.189  -7.037  -8.735  1.00 0.00  ? 146 GLU B HB2  1  
ATOM   196   H HB3  . GLU B 2 7   ? -2.595  -5.767  -9.806  1.00 0.00  ? 146 GLU B HB3  1  
ATOM   197   H HG2  . GLU B 2 7   ? -4.583  -7.544  -11.054 1.00 0.00  ? 146 GLU B HG2  1  
ATOM   198   H HG3  . GLU B 2 7   ? -5.208  -6.614  -9.691  1.00 0.00  ? 146 GLU B HG3  1  
ATOM   199   N N    . GLU B 2 8   ? -0.384  -6.249  -11.070 1.00 21.92 ? 147 GLU B N    1  
ATOM   200   C CA   . GLU B 2 8   ? 1.027   -5.772  -11.034 1.00 21.70 ? 147 GLU B CA   1  
ATOM   201   C C    . GLU B 2 8   ? 1.416   -5.442  -9.591  1.00 19.46 ? 147 GLU B C    1  
ATOM   202   O O    . GLU B 2 8   ? 2.579   -5.300  -9.269  1.00 19.28 ? 147 GLU B O    1  
ATOM   203   C CB   . GLU B 2 8   ? 1.164   -4.518  -11.899 1.00 26.72 ? 147 GLU B CB   1  
ATOM   204   C CG   . GLU B 2 8   ? 1.875   -4.875  -13.206 1.00 37.15 ? 147 GLU B CG   1  
ATOM   205   C CD   . GLU B 2 8   ? 0.894   -4.748  -14.373 1.00 41.71 ? 147 GLU B CD   1  
ATOM   206   O OE1  . GLU B 2 8   ? -0.178  -5.323  -14.285 1.00 45.02 ? 147 GLU B OE1  1  
ATOM   207   O OE2  . GLU B 2 8   ? 1.232   -4.077  -15.334 1.00 46.00 ? 147 GLU B OE2  1  
ATOM   208   H H    . GLU B 2 8   ? -1.055  -5.754  -11.586 1.00 0.00  ? 147 GLU B H    1  
ATOM   209   H HA   . GLU B 2 8   ? 1.678   -6.545  -11.414 1.00 0.00  ? 147 GLU B HA   1  
ATOM   210   H HB2  . GLU B 2 8   ? 0.182   -4.123  -12.119 1.00 0.00  ? 147 GLU B HB2  1  
ATOM   211   H HB3  . GLU B 2 8   ? 1.741   -3.776  -11.369 1.00 0.00  ? 147 GLU B HB3  1  
ATOM   212   H HG2  . GLU B 2 8   ? 2.707   -4.201  -13.358 1.00 0.00  ? 147 GLU B HG2  1  
ATOM   213   H HG3  . GLU B 2 8   ? 2.238   -5.890  -13.153 1.00 0.00  ? 147 GLU B HG3  1  
ATOM   214   N N    . TRP B 2 9   ? 0.453   -5.319  -8.719  1.00 17.10 ? 148 TRP B N    1  
ATOM   215   C CA   . TRP B 2 9   ? 0.770   -4.999  -7.297  1.00 12.75 ? 148 TRP B CA   1  
ATOM   216   C C    . TRP B 2 9   ? 0.204   -6.093  -6.389  1.00 12.19 ? 148 TRP B C    1  
ATOM   217   O O    . TRP B 2 9   ? -0.228  -5.834  -5.283  1.00 11.66 ? 148 TRP B O    1  
ATOM   218   C CB   . TRP B 2 9   ? 0.153   -3.647  -6.914  1.00 14.42 ? 148 TRP B CB   1  
ATOM   219   C CG   . TRP B 2 9   ? -1.130  -3.443  -7.657  1.00 13.12 ? 148 TRP B CG   1  
ATOM   220   C CD1  . TRP B 2 9   ? -1.277  -2.656  -8.748  1.00 13.11 ? 148 TRP B CD1  1  
ATOM   221   C CD2  . TRP B 2 9   ? -2.442  -4.016  -7.385  1.00 12.81 ? 148 TRP B CD2  1  
ATOM   222   N NE1  . TRP B 2 9   ? -2.595  -2.709  -9.165  1.00 12.63 ? 148 TRP B NE1  1  
ATOM   223   C CE2  . TRP B 2 9   ? -3.354  -3.533  -8.358  1.00 13.14 ? 148 TRP B CE2  1  
ATOM   224   C CE3  . TRP B 2 9   ? -2.926  -4.900  -6.397  1.00 10.52 ? 148 TRP B CE3  1  
ATOM   225   C CZ2  . TRP B 2 9   ? -4.700  -3.914  -8.352  1.00 13.39 ? 148 TRP B CZ2  1  
ATOM   226   C CZ3  . TRP B 2 9   ? -4.281  -5.287  -6.388  1.00 12.83 ? 148 TRP B CZ3  1  
ATOM   227   C CH2  . TRP B 2 9   ? -5.165  -4.794  -7.363  1.00 12.53 ? 148 TRP B CH2  1  
ATOM   228   H H    . TRP B 2 9   ? -0.480  -5.438  -8.998  1.00 0.00  ? 148 TRP B H    1  
ATOM   229   H HA   . TRP B 2 9   ? 1.842   -4.951  -7.172  1.00 0.00  ? 148 TRP B HA   1  
ATOM   230   H HB2  . TRP B 2 9   ? -0.042  -3.631  -5.852  1.00 0.00  ? 148 TRP B HB2  1  
ATOM   231   H HB3  . TRP B 2 9   ? 0.844   -2.854  -7.163  1.00 0.00  ? 148 TRP B HB3  1  
ATOM   232   H HD1  . TRP B 2 9   ? -0.493  -2.080  -9.218  1.00 0.00  ? 148 TRP B HD1  1  
ATOM   233   H HE1  . TRP B 2 9   ? -2.965  -2.228  -9.935  1.00 0.00  ? 148 TRP B HE1  1  
ATOM   234   H HE3  . TRP B 2 9   ? -2.254  -5.284  -5.644  1.00 0.00  ? 148 TRP B HE3  1  
ATOM   235   H HZ2  . TRP B 2 9   ? -5.377  -3.534  -9.103  1.00 0.00  ? 148 TRP B HZ2  1  
ATOM   236   H HZ3  . TRP B 2 9   ? -4.641  -5.964  -5.628  1.00 0.00  ? 148 TRP B HZ3  1  
ATOM   237   H HH2  . TRP B 2 9   ? -6.202  -5.093  -7.352  1.00 0.00  ? 148 TRP B HH2  1  
ATOM   238   N N    . TYR B 2 10  ? 0.205   -7.315  -6.847  1.00 11.66 ? 149 TYR B N    1  
ATOM   239   C CA   . TYR B 2 10  ? -0.332  -8.425  -6.009  1.00 13.63 ? 149 TYR B CA   1  
ATOM   240   C C    . TYR B 2 10  ? 0.757   -9.481  -5.805  1.00 14.73 ? 149 TYR B C    1  
ATOM   241   O O    . TYR B 2 10  ? 1.249   -10.070 -6.747  1.00 16.34 ? 149 TYR B O    1  
ATOM   242   C CB   . TYR B 2 10  ? -1.533  -9.059  -6.713  1.00 12.52 ? 149 TYR B CB   1  
ATOM   243   C CG   . TYR B 2 10  ? -2.356  -9.830  -5.709  1.00 15.49 ? 149 TYR B CG   1  
ATOM   244   C CD1  . TYR B 2 10  ? -1.852  -11.016 -5.149  1.00 14.45 ? 149 TYR B CD1  1  
ATOM   245   C CD2  . TYR B 2 10  ? -3.627  -9.361  -5.334  1.00 19.03 ? 149 TYR B CD2  1  
ATOM   246   C CE1  . TYR B 2 10  ? -2.618  -11.733 -4.214  1.00 15.99 ? 149 TYR B CE1  1  
ATOM   247   C CE2  . TYR B 2 10  ? -4.393  -10.078 -4.399  1.00 20.41 ? 149 TYR B CE2  1  
ATOM   248   C CZ   . TYR B 2 10  ? -3.889  -11.263 -3.840  1.00 21.15 ? 149 TYR B CZ   1  
ATOM   249   O OH   . TYR B 2 10  ? -4.641  -11.968 -2.922  1.00 23.67 ? 149 TYR B OH   1  
ATOM   250   H H    . TYR B 2 10  ? 0.559   -7.503  -7.741  1.00 0.00  ? 149 TYR B H    1  
ATOM   251   H HA   . TYR B 2 10  ? -0.640  -8.036  -5.050  1.00 0.00  ? 149 TYR B HA   1  
ATOM   252   H HB2  . TYR B 2 10  ? -2.140  -8.284  -7.158  1.00 0.00  ? 149 TYR B HB2  1  
ATOM   253   H HB3  . TYR B 2 10  ? -1.186  -9.731  -7.483  1.00 0.00  ? 149 TYR B HB3  1  
ATOM   254   H HD1  . TYR B 2 10  ? -0.875  -11.376 -5.437  1.00 0.00  ? 149 TYR B HD1  1  
ATOM   255   H HD2  . TYR B 2 10  ? -4.014  -8.449  -5.764  1.00 0.00  ? 149 TYR B HD2  1  
ATOM   256   H HE1  . TYR B 2 10  ? -2.230  -12.644 -3.784  1.00 0.00  ? 149 TYR B HE1  1  
ATOM   257   H HE2  . TYR B 2 10  ? -5.369  -9.717  -4.111  1.00 0.00  ? 149 TYR B HE2  1  
ATOM   258   H HH   . TYR B 2 10  ? -4.443  -11.622 -2.048  1.00 0.00  ? 149 TYR B HH   1  
ATOM   259   N N    . PHE B 2 11  ? 1.136   -9.725  -4.581  1.00 14.41 ? 150 PHE B N    1  
ATOM   260   C CA   . PHE B 2 11  ? 2.192   -10.742 -4.317  1.00 13.20 ? 150 PHE B CA   1  
ATOM   261   C C    . PHE B 2 11  ? 1.592   -11.906 -3.525  1.00 12.95 ? 150 PHE B C    1  
ATOM   262   O O    . PHE B 2 11  ? 1.967   -13.048 -3.701  1.00 12.44 ? 150 PHE B O    1  
ATOM   263   C CB   . PHE B 2 11  ? 3.323   -10.104 -3.506  1.00 13.34 ? 150 PHE B CB   1  
ATOM   264   C CG   . PHE B 2 11  ? 4.585   -10.077 -4.335  1.00 10.91 ? 150 PHE B CG   1  
ATOM   265   C CD1  . PHE B 2 11  ? 4.824   -9.010  -5.216  1.00 10.43 ? 150 PHE B CD1  1  
ATOM   266   C CD2  . PHE B 2 11  ? 5.521   -11.119 -4.223  1.00 10.09 ? 150 PHE B CD2  1  
ATOM   267   C CE1  . PHE B 2 11  ? 5.999   -8.985  -5.986  1.00 9.38  ? 150 PHE B CE1  1  
ATOM   268   C CE2  . PHE B 2 11  ? 6.696   -11.094 -4.992  1.00 7.94  ? 150 PHE B CE2  1  
ATOM   269   C CZ   . PHE B 2 11  ? 6.935   -10.026 -5.874  1.00 8.81  ? 150 PHE B CZ   1  
ATOM   270   H H    . PHE B 2 11  ? 0.727   -9.239  -3.835  1.00 0.00  ? 150 PHE B H    1  
ATOM   271   H HA   . PHE B 2 11  ? 2.583   -11.108 -5.255  1.00 0.00  ? 150 PHE B HA   1  
ATOM   272   H HB2  . PHE B 2 11  ? 3.047   -9.095  -3.237  1.00 0.00  ? 150 PHE B HB2  1  
ATOM   273   H HB3  . PHE B 2 11  ? 3.493   -10.682 -2.610  1.00 0.00  ? 150 PHE B HB3  1  
ATOM   274   H HD1  . PHE B 2 11  ? 4.104   -8.209  -5.303  1.00 0.00  ? 150 PHE B HD1  1  
ATOM   275   H HD2  . PHE B 2 11  ? 5.337   -11.940 -3.545  1.00 0.00  ? 150 PHE B HD2  1  
ATOM   276   H HE1  . PHE B 2 11  ? 6.183   -8.164  -6.664  1.00 0.00  ? 150 PHE B HE1  1  
ATOM   277   H HE2  . PHE B 2 11  ? 7.416   -11.895 -4.906  1.00 0.00  ? 150 PHE B HE2  1  
ATOM   278   H HZ   . PHE B 2 11  ? 7.839   -10.007 -6.466  1.00 0.00  ? 150 PHE B HZ   1  
ATOM   279   N N    . GLY B 2 12  ? 0.661   -11.625 -2.654  1.00 14.57 ? 151 GLY B N    1  
ATOM   280   C CA   . GLY B 2 12  ? 0.037   -12.715 -1.852  1.00 13.68 ? 151 GLY B CA   1  
ATOM   281   C C    . GLY B 2 12  ? 0.363   -12.511 -0.372  1.00 15.95 ? 151 GLY B C    1  
ATOM   282   O O    . GLY B 2 12  ? 0.534   -11.400 0.090   1.00 16.08 ? 151 GLY B O    1  
ATOM   283   H H    . GLY B 2 12  ? 0.373   -10.698 -2.527  1.00 0.00  ? 151 GLY B H    1  
ATOM   284   H HA2  . GLY B 2 12  ? -1.035  -12.695 -1.992  1.00 0.00  ? 151 GLY B HA2  1  
ATOM   285   H HA3  . GLY B 2 12  ? 0.425   -13.668 -2.175  1.00 0.00  ? 151 GLY B HA3  1  
ATOM   286   N N    . LYS B 2 13  ? 0.452   -13.576 0.375   1.00 14.92 ? 152 LYS B N    1  
ATOM   287   C CA   . LYS B 2 13  ? 0.768   -13.446 1.826   1.00 16.57 ? 152 LYS B CA   1  
ATOM   288   C C    . LYS B 2 13  ? 2.283   -13.507 2.025   1.00 15.79 ? 152 LYS B C    1  
ATOM   289   O O    . LYS B 2 13  ? 2.893   -14.552 1.908   1.00 15.62 ? 152 LYS B O    1  
ATOM   290   C CB   . LYS B 2 13  ? 0.106   -14.590 2.597   1.00 19.39 ? 152 LYS B CB   1  
ATOM   291   C CG   . LYS B 2 13  ? 0.005   -14.217 4.077   1.00 26.20 ? 152 LYS B CG   1  
ATOM   292   C CD   . LYS B 2 13  ? 0.029   -15.489 4.928   1.00 32.70 ? 152 LYS B CD   1  
ATOM   293   C CE   . LYS B 2 13  ? 1.421   -15.669 5.537   1.00 38.73 ? 152 LYS B CE   1  
ATOM   294   N NZ   . LYS B 2 13  ? 1.343   -16.624 6.678   1.00 43.61 ? 152 LYS B NZ   1  
ATOM   295   H H    . LYS B 2 13  ? 0.311   -14.462 -0.018  1.00 0.00  ? 152 LYS B H    1  
ATOM   296   H HA   . LYS B 2 13  ? 0.394   -12.501 2.193   1.00 0.00  ? 152 LYS B HA   1  
ATOM   297   H HB2  . LYS B 2 13  ? -0.884  -14.766 2.200   1.00 0.00  ? 152 LYS B HB2  1  
ATOM   298   H HB3  . LYS B 2 13  ? 0.700   -15.485 2.493   1.00 0.00  ? 152 LYS B HB3  1  
ATOM   299   H HG2  . LYS B 2 13  ? 0.840   -13.586 4.347   1.00 0.00  ? 152 LYS B HG2  1  
ATOM   300   H HG3  . LYS B 2 13  ? -0.919  -13.686 4.253   1.00 0.00  ? 152 LYS B HG3  1  
ATOM   301   H HD2  . LYS B 2 13  ? -0.703  -15.407 5.718   1.00 0.00  ? 152 LYS B HD2  1  
ATOM   302   H HD3  . LYS B 2 13  ? -0.203  -16.341 4.308   1.00 0.00  ? 152 LYS B HD3  1  
ATOM   303   H HE2  . LYS B 2 13  ? 2.094   -16.058 4.788   1.00 0.00  ? 152 LYS B HE2  1  
ATOM   304   H HE3  . LYS B 2 13  ? 1.786   -14.716 5.889   1.00 0.00  ? 152 LYS B HE3  1  
ATOM   305   H HZ1  . LYS B 2 13  ? 0.374   -16.633 7.057   1.00 0.00  ? 152 LYS B HZ1  1  
ATOM   306   H HZ2  . LYS B 2 13  ? 1.597   -17.577 6.351   1.00 0.00  ? 152 LYS B HZ2  1  
ATOM   307   H HZ3  . LYS B 2 13  ? 2.005   -16.329 7.424   1.00 0.00  ? 152 LYS B HZ3  1  
ATOM   308   N N    . ILE B 2 14  ? 2.896   -12.396 2.327   1.00 16.90 ? 153 ILE B N    1  
ATOM   309   C CA   . ILE B 2 14  ? 4.371   -12.391 2.535   1.00 16.60 ? 153 ILE B CA   1  
ATOM   310   C C    . ILE B 2 14  ? 4.675   -12.211 4.023   1.00 17.59 ? 153 ILE B C    1  
ATOM   311   O O    . ILE B 2 14  ? 3.792   -11.964 4.821   1.00 21.20 ? 153 ILE B O    1  
ATOM   312   C CB   . ILE B 2 14  ? 4.994   -11.239 1.745   1.00 15.36 ? 153 ILE B CB   1  
ATOM   313   C CG1  . ILE B 2 14  ? 4.148   -9.977  1.934   1.00 14.56 ? 153 ILE B CG1  1  
ATOM   314   C CG2  . ILE B 2 14  ? 5.041   -11.603 0.261   1.00 15.80 ? 153 ILE B CG2  1  
ATOM   315   C CD1  . ILE B 2 14  ? 5.004   -8.741  1.653   1.00 13.00 ? 153 ILE B CD1  1  
ATOM   316   H H    . ILE B 2 14  ? 2.386   -11.564 2.418   1.00 0.00  ? 153 ILE B H    1  
ATOM   317   H HA   . ILE B 2 14  ? 4.787   -13.328 2.193   1.00 0.00  ? 153 ILE B HA   1  
ATOM   318   H HB   . ILE B 2 14  ? 5.998   -11.059 2.103   1.00 0.00  ? 153 ILE B HB   1  
ATOM   319   H HG12 . ILE B 2 14  ? 3.311   -10.000 1.250   1.00 0.00  ? 153 ILE B HG12 1  
ATOM   320   H HG13 . ILE B 2 14  ? 3.783   -9.937  2.949   1.00 0.00  ? 153 ILE B HG13 1  
ATOM   321   H HG21 . ILE B 2 14  ? 5.193   -12.667 0.156   1.00 0.00  ? 153 ILE B HG21 1  
ATOM   322   H HG22 . ILE B 2 14  ? 4.108   -11.325 -0.208  1.00 0.00  ? 153 ILE B HG22 1  
ATOM   323   H HG23 . ILE B 2 14  ? 5.854   -11.075 -0.214  1.00 0.00  ? 153 ILE B HG23 1  
ATOM   324   H HD11 . ILE B 2 14  ? 6.049   -9.010  1.695   1.00 0.00  ? 153 ILE B HD11 1  
ATOM   325   H HD12 . ILE B 2 14  ? 4.770   -8.356  0.672   1.00 0.00  ? 153 ILE B HD12 1  
ATOM   326   H HD13 . ILE B 2 14  ? 4.797   -7.984  2.395   1.00 0.00  ? 153 ILE B HD13 1  
ATOM   327   N N    . THR B 2 15  ? 5.917   -12.332 4.405   1.00 16.79 ? 154 THR B N    1  
ATOM   328   C CA   . THR B 2 15  ? 6.273   -12.167 5.842   1.00 16.02 ? 154 THR B CA   1  
ATOM   329   C C    . THR B 2 15  ? 6.512   -10.685 6.140   1.00 15.06 ? 154 THR B C    1  
ATOM   330   O O    . THR B 2 15  ? 6.528   -9.858  5.250   1.00 14.17 ? 154 THR B O    1  
ATOM   331   C CB   . THR B 2 15  ? 7.545   -12.961 6.147   1.00 18.43 ? 154 THR B CB   1  
ATOM   332   O OG1  . THR B 2 15  ? 8.656   -12.333 5.522   1.00 22.52 ? 154 THR B OG1  1  
ATOM   333   C CG2  . THR B 2 15  ? 7.398   -14.388 5.617   1.00 19.67 ? 154 THR B CG2  1  
ATOM   334   H H    . THR B 2 15  ? 6.614   -12.531 3.746   1.00 0.00  ? 154 THR B H    1  
ATOM   335   H HA   . THR B 2 15  ? 5.464   -12.532 6.457   1.00 0.00  ? 154 THR B HA   1  
ATOM   336   H HB   . THR B 2 15  ? 7.703   -12.993 7.214   1.00 0.00  ? 154 THR B HB   1  
ATOM   337   H HG1  . THR B 2 15  ? 8.499   -12.327 4.575   1.00 0.00  ? 154 THR B HG1  1  
ATOM   338   H HG21 . THR B 2 15  ? 6.356   -14.670 5.627   1.00 0.00  ? 154 THR B HG21 1  
ATOM   339   H HG22 . THR B 2 15  ? 7.775   -14.438 4.606   1.00 0.00  ? 154 THR B HG22 1  
ATOM   340   H HG23 . THR B 2 15  ? 7.960   -15.065 6.244   1.00 0.00  ? 154 THR B HG23 1  
ATOM   341   N N    . ARG B 2 16  ? 6.698   -10.343 7.385   1.00 15.92 ? 155 ARG B N    1  
ATOM   342   C CA   . ARG B 2 16  ? 6.934   -8.915  7.739   1.00 14.63 ? 155 ARG B CA   1  
ATOM   343   C C    . ARG B 2 16  ? 8.364   -8.524  7.358   1.00 15.69 ? 155 ARG B C    1  
ATOM   344   O O    . ARG B 2 16  ? 8.593   -7.512  6.726   1.00 13.45 ? 155 ARG B O    1  
ATOM   345   C CB   . ARG B 2 16  ? 6.738   -8.725  9.244   1.00 13.07 ? 155 ARG B CB   1  
ATOM   346   C CG   . ARG B 2 16  ? 7.097   -7.288  9.629   1.00 14.81 ? 155 ARG B CG   1  
ATOM   347   C CD   . ARG B 2 16  ? 6.995   -7.125  11.146  1.00 13.27 ? 155 ARG B CD   1  
ATOM   348   N NE   . ARG B 2 16  ? 7.910   -8.094  11.812  1.00 16.05 ? 155 ARG B NE   1  
ATOM   349   C CZ   . ARG B 2 16  ? 8.967   -7.664  12.445  1.00 8.86  ? 155 ARG B CZ   1  
ATOM   350   N NH1  . ARG B 2 16  ? 9.927   -7.076  11.786  1.00 12.78 ? 155 ARG B NH1  1  
ATOM   351   N NH2  . ARG B 2 16  ? 9.063   -7.822  13.737  1.00 8.73  ? 155 ARG B NH2  1  
ATOM   352   H H    . ARG B 2 16  ? 6.680   -11.026 8.088   1.00 0.00  ? 155 ARG B H    1  
ATOM   353   H HA   . ARG B 2 16  ? 6.235   -8.291  7.203   1.00 0.00  ? 155 ARG B HA   1  
ATOM   354   H HB2  . ARG B 2 16  ? 5.707   -8.920  9.500   1.00 0.00  ? 155 ARG B HB2  1  
ATOM   355   H HB3  . ARG B 2 16  ? 7.378   -9.409  9.780   1.00 0.00  ? 155 ARG B HB3  1  
ATOM   356   H HG2  . ARG B 2 16  ? 8.106   -7.071  9.309   1.00 0.00  ? 155 ARG B HG2  1  
ATOM   357   H HG3  . ARG B 2 16  ? 6.412   -6.605  9.149   1.00 0.00  ? 155 ARG B HG3  1  
ATOM   358   H HD2  . ARG B 2 16  ? 7.276   -6.119  11.420  1.00 0.00  ? 155 ARG B HD2  1  
ATOM   359   H HD3  . ARG B 2 16  ? 5.979   -7.313  11.462  1.00 0.00  ? 155 ARG B HD3  1  
ATOM   360   H HE   . ARG B 2 16  ? 7.717   -9.055  11.776  1.00 0.00  ? 155 ARG B HE   1  
ATOM   361   H HH11 . ARG B 2 16  ? 9.853   -6.955  10.796  1.00 0.00  ? 155 ARG B HH11 1  
ATOM   362   H HH12 . ARG B 2 16  ? 10.737  -6.746  12.271  1.00 0.00  ? 155 ARG B HH12 1  
ATOM   363   H HH21 . ARG B 2 16  ? 8.327   -8.272  14.242  1.00 0.00  ? 155 ARG B HH21 1  
ATOM   364   H HH22 . ARG B 2 16  ? 9.873   -7.492  14.222  1.00 0.00  ? 155 ARG B HH22 1  
ATOM   365   N N    . ARG B 2 17  ? 9.327   -9.319  7.737   1.00 16.92 ? 156 ARG B N    1  
ATOM   366   C CA   . ARG B 2 17  ? 10.740  -8.992  7.397   1.00 18.61 ? 156 ARG B CA   1  
ATOM   367   C C    . ARG B 2 17  ? 10.864  -8.771  5.888   1.00 17.01 ? 156 ARG B C    1  
ATOM   368   O O    . ARG B 2 17  ? 11.477  -7.823  5.438   1.00 17.04 ? 156 ARG B O    1  
ATOM   369   C CB   . ARG B 2 17  ? 11.647  -10.150 7.819   1.00 24.11 ? 156 ARG B CB   1  
ATOM   370   C CG   . ARG B 2 17  ? 13.065  -9.628  8.055   1.00 33.87 ? 156 ARG B CG   1  
ATOM   371   C CD   . ARG B 2 17  ? 13.695  -9.236  6.717   1.00 41.26 ? 156 ARG B CD   1  
ATOM   372   N NE   . ARG B 2 17  ? 15.170  -9.437  6.783   1.00 49.98 ? 156 ARG B NE   1  
ATOM   373   C CZ   . ARG B 2 17  ? 15.664  -10.645 6.778   1.00 51.87 ? 156 ARG B CZ   1  
ATOM   374   N NH1  . ARG B 2 17  ? 15.900  -11.248 5.645   1.00 52.15 ? 156 ARG B NH1  1  
ATOM   375   N NH2  . ARG B 2 17  ? 15.923  -11.249 7.905   1.00 53.57 ? 156 ARG B NH2  1  
ATOM   376   H H    . ARG B 2 17  ? 9.121   -10.130 8.247   1.00 0.00  ? 156 ARG B H    1  
ATOM   377   H HA   . ARG B 2 17  ? 11.038  -8.094  7.918   1.00 0.00  ? 156 ARG B HA   1  
ATOM   378   H HB2  . ARG B 2 17  ? 11.268  -10.590 8.730   1.00 0.00  ? 156 ARG B HB2  1  
ATOM   379   H HB3  . ARG B 2 17  ? 11.665  -10.895 7.038   1.00 0.00  ? 156 ARG B HB3  1  
ATOM   380   H HG2  . ARG B 2 17  ? 13.027  -8.764  8.702   1.00 0.00  ? 156 ARG B HG2  1  
ATOM   381   H HG3  . ARG B 2 17  ? 13.661  -10.400 8.518   1.00 0.00  ? 156 ARG B HG3  1  
ATOM   382   H HD2  . ARG B 2 17  ? 13.282  -9.852  5.931   1.00 0.00  ? 156 ARG B HD2  1  
ATOM   383   H HD3  . ARG B 2 17  ? 13.482  -8.198  6.509   1.00 0.00  ? 156 ARG B HD3  1  
ATOM   384   H HE   . ARG B 2 17  ? 15.768  -8.663  6.831   1.00 0.00  ? 156 ARG B HE   1  
ATOM   385   H HH11 . ARG B 2 17  ? 15.702  -10.785 4.781   1.00 0.00  ? 156 ARG B HH11 1  
ATOM   386   H HH12 . ARG B 2 17  ? 16.279  -12.174 5.641   1.00 0.00  ? 156 ARG B HH12 1  
ATOM   387   H HH21 . ARG B 2 17  ? 15.742  -10.787 8.773   1.00 0.00  ? 156 ARG B HH21 1  
ATOM   388   H HH22 . ARG B 2 17  ? 16.302  -12.175 7.901   1.00 0.00  ? 156 ARG B HH22 1  
ATOM   389   N N    . GLU B 2 18  ? 10.287  -9.639  5.103   1.00 15.73 ? 157 GLU B N    1  
ATOM   390   C CA   . GLU B 2 18  ? 10.372  -9.477  3.624   1.00 15.26 ? 157 GLU B CA   1  
ATOM   391   C C    . GLU B 2 18  ? 9.618   -8.214  3.205   1.00 14.10 ? 157 GLU B C    1  
ATOM   392   O O    . GLU B 2 18  ? 9.939   -7.590  2.213   1.00 15.48 ? 157 GLU B O    1  
ATOM   393   C CB   . GLU B 2 18  ? 9.746   -10.695 2.940   1.00 19.30 ? 157 GLU B CB   1  
ATOM   394   C CG   . GLU B 2 18  ? 10.289  -10.815 1.515   1.00 28.11 ? 157 GLU B CG   1  
ATOM   395   C CD   . GLU B 2 18  ? 10.781  -12.244 1.275   1.00 29.65 ? 157 GLU B CD   1  
ATOM   396   O OE1  . GLU B 2 18  ? 11.908  -12.530 1.640   1.00 28.63 ? 157 GLU B OE1  1  
ATOM   397   O OE2  . GLU B 2 18  ? 10.021  -13.026 0.729   1.00 31.13 ? 157 GLU B OE2  1  
ATOM   398   H H    . GLU B 2 18  ? 9.797   -10.396 5.486   1.00 0.00  ? 157 GLU B H    1  
ATOM   399   H HA   . GLU B 2 18  ? 11.408  -9.393  3.330   1.00 0.00  ? 157 GLU B HA   1  
ATOM   400   H HB2  . GLU B 2 18  ? 9.993   -11.587 3.498   1.00 0.00  ? 157 GLU B HB2  1  
ATOM   401   H HB3  . GLU B 2 18  ? 8.673   -10.576 2.906   1.00 0.00  ? 157 GLU B HB3  1  
ATOM   402   H HG2  . GLU B 2 18  ? 9.505   -10.580 0.810   1.00 0.00  ? 157 GLU B HG2  1  
ATOM   403   H HG3  . GLU B 2 18  ? 11.110  -10.127 1.383   1.00 0.00  ? 157 GLU B HG3  1  
ATOM   404   N N    . SER B 2 19  ? 8.619   -7.831  3.951   1.00 11.43 ? 158 SER B N    1  
ATOM   405   C CA   . SER B 2 19  ? 7.847   -6.607  3.593   1.00 9.58  ? 158 SER B CA   1  
ATOM   406   C C    . SER B 2 19  ? 8.779   -5.394  3.612   1.00 10.15 ? 158 SER B C    1  
ATOM   407   O O    . SER B 2 19  ? 9.002   -4.754  2.603   1.00 12.31 ? 158 SER B O    1  
ATOM   408   C CB   . SER B 2 19  ? 6.721   -6.400  4.607   1.00 8.90  ? 158 SER B CB   1  
ATOM   409   O OG   . SER B 2 19  ? 5.558   -5.946  3.929   1.00 11.55 ? 158 SER B OG   1  
ATOM   410   H H    . SER B 2 19  ? 8.376   -8.349  4.747   1.00 0.00  ? 158 SER B H    1  
ATOM   411   H HA   . SER B 2 19  ? 7.426   -6.723  2.606   1.00 0.00  ? 158 SER B HA   1  
ATOM   412   H HB2  . SER B 2 19  ? 6.503   -7.332  5.101   1.00 0.00  ? 158 SER B HB2  1  
ATOM   413   H HB3  . SER B 2 19  ? 7.031   -5.670  5.343   1.00 0.00  ? 158 SER B HB3  1  
ATOM   414   H HG   . SER B 2 19  ? 5.836   -5.348  3.230   1.00 0.00  ? 158 SER B HG   1  
ATOM   415   N N    . GLU B 2 20  ? 9.326   -5.072  4.752   1.00 11.35 ? 159 GLU B N    1  
ATOM   416   C CA   . GLU B 2 20  ? 10.243  -3.903  4.835   1.00 12.85 ? 159 GLU B CA   1  
ATOM   417   C C    . GLU B 2 20  ? 11.498  -4.179  4.004   1.00 15.16 ? 159 GLU B C    1  
ATOM   418   O O    . GLU B 2 20  ? 12.242  -3.280  3.671   1.00 13.16 ? 159 GLU B O    1  
ATOM   419   C CB   . GLU B 2 20  ? 10.637  -3.669  6.294   1.00 13.71 ? 159 GLU B CB   1  
ATOM   420   C CG   . GLU B 2 20  ? 9.636   -2.713  6.947   1.00 16.00 ? 159 GLU B CG   1  
ATOM   421   C CD   . GLU B 2 20  ? 9.586   -2.977  8.452   1.00 19.40 ? 159 GLU B CD   1  
ATOM   422   O OE1  . GLU B 2 20  ? 9.099   -4.028  8.834   1.00 21.73 ? 159 GLU B OE1  1  
ATOM   423   O OE2  . GLU B 2 20  ? 10.037  -2.123  9.199   1.00 26.69 ? 159 GLU B OE2  1  
ATOM   424   H H    . GLU B 2 20  ? 9.135   -5.600  5.555   1.00 0.00  ? 159 GLU B H    1  
ATOM   425   H HA   . GLU B 2 20  ? 9.743   -3.025  4.452   1.00 0.00  ? 159 GLU B HA   1  
ATOM   426   H HB2  . GLU B 2 20  ? 10.634  -4.611  6.823   1.00 0.00  ? 159 GLU B HB2  1  
ATOM   427   H HB3  . GLU B 2 20  ? 11.624  -3.236  6.335   1.00 0.00  ? 159 GLU B HB3  1  
ATOM   428   H HG2  . GLU B 2 20  ? 9.944   -1.693  6.768   1.00 0.00  ? 159 GLU B HG2  1  
ATOM   429   H HG3  . GLU B 2 20  ? 8.656   -2.873  6.522   1.00 0.00  ? 159 GLU B HG3  1  
ATOM   430   N N    . ARG B 2 21  ? 11.739  -5.416  3.667   1.00 15.73 ? 160 ARG B N    1  
ATOM   431   C CA   . ARG B 2 21  ? 12.945  -5.748  2.858   1.00 17.77 ? 160 ARG B CA   1  
ATOM   432   C C    . ARG B 2 21  ? 12.643  -5.523  1.375   1.00 17.96 ? 160 ARG B C    1  
ATOM   433   O O    . ARG B 2 21  ? 13.535  -5.349  0.569   1.00 17.67 ? 160 ARG B O    1  
ATOM   434   C CB   . ARG B 2 21  ? 13.320  -7.211  3.078   1.00 21.81 ? 160 ARG B CB   1  
ATOM   435   C CG   . ARG B 2 21  ? 14.808  -7.408  2.789   1.00 30.59 ? 160 ARG B CG   1  
ATOM   436   C CD   . ARG B 2 21  ? 14.987  -7.831  1.332   1.00 37.74 ? 160 ARG B CD   1  
ATOM   437   N NE   . ARG B 2 21  ? 15.258  -9.294  1.269   1.00 43.93 ? 160 ARG B NE   1  
ATOM   438   C CZ   . ARG B 2 21  ? 15.719  -9.826  0.170   1.00 48.64 ? 160 ARG B CZ   1  
ATOM   439   N NH1  . ARG B 2 21  ? 14.900  -10.139 -0.797  1.00 50.79 ? 160 ARG B NH1  1  
ATOM   440   N NH2  . ARG B 2 21  ? 16.999  -10.043 0.038   1.00 51.68 ? 160 ARG B NH2  1  
ATOM   441   H H    . ARG B 2 21  ? 11.125  -6.127  3.946   1.00 0.00  ? 160 ARG B H    1  
ATOM   442   H HA   . ARG B 2 21  ? 13.766  -5.120  3.157   1.00 0.00  ? 160 ARG B HA   1  
ATOM   443   H HB2  . ARG B 2 21  ? 13.111  -7.488  4.099   1.00 0.00  ? 160 ARG B HB2  1  
ATOM   444   H HB3  . ARG B 2 21  ? 12.743  -7.828  2.411   1.00 0.00  ? 160 ARG B HB3  1  
ATOM   445   H HG2  . ARG B 2 21  ? 15.335  -6.482  2.965   1.00 0.00  ? 160 ARG B HG2  1  
ATOM   446   H HG3  . ARG B 2 21  ? 15.202  -8.177  3.437   1.00 0.00  ? 160 ARG B HG3  1  
ATOM   447   H HD2  . ARG B 2 21  ? 14.086  -7.607  0.781   1.00 0.00  ? 160 ARG B HD2  1  
ATOM   448   H HD3  . ARG B 2 21  ? 15.817  -7.292  0.902   1.00 0.00  ? 160 ARG B HD3  1  
ATOM   449   H HE   . ARG B 2 21  ? 15.089  -9.858  2.053   1.00 0.00  ? 160 ARG B HE   1  
ATOM   450   H HH11 . ARG B 2 21  ? 13.920  -9.972  -0.696  1.00 0.00  ? 160 ARG B HH11 1  
ATOM   451   H HH12 . ARG B 2 21  ? 15.254  -10.546 -1.639  1.00 0.00  ? 160 ARG B HH12 1  
ATOM   452   H HH21 . ARG B 2 21  ? 17.626  -9.802  0.779   1.00 0.00  ? 160 ARG B HH21 1  
ATOM   453   H HH22 . ARG B 2 21  ? 17.353  -10.450 -0.804  1.00 0.00  ? 160 ARG B HH22 1  
ATOM   454   N N    . LEU B 2 22  ? 11.391  -5.529  1.010   1.00 16.19 ? 161 LEU B N    1  
ATOM   455   C CA   . LEU B 2 22  ? 11.030  -5.321  -0.420  1.00 12.63 ? 161 LEU B CA   1  
ATOM   456   C C    . LEU B 2 22  ? 10.903  -3.824  -0.704  1.00 13.41 ? 161 LEU B C    1  
ATOM   457   O O    . LEU B 2 22  ? 11.206  -3.359  -1.784  1.00 14.12 ? 161 LEU B O    1  
ATOM   458   C CB   . LEU B 2 22  ? 9.694   -6.008  -0.711  1.00 10.23 ? 161 LEU B CB   1  
ATOM   459   C CG   . LEU B 2 22  ? 9.937   -7.475  -1.071  1.00 11.74 ? 161 LEU B CG   1  
ATOM   460   C CD1  . LEU B 2 22  ? 8.609   -8.138  -1.441  1.00 10.85 ? 161 LEU B CD1  1  
ATOM   461   C CD2  . LEU B 2 22  ? 10.895  -7.559  -2.261  1.00 15.84 ? 161 LEU B CD2  1  
ATOM   462   H H    . LEU B 2 22  ? 10.688  -5.673  1.676   1.00 0.00  ? 161 LEU B H    1  
ATOM   463   H HA   . LEU B 2 22  ? 11.798  -5.743  -1.050  1.00 0.00  ? 161 LEU B HA   1  
ATOM   464   H HB2  . LEU B 2 22  ? 9.064   -5.952  0.165   1.00 0.00  ? 161 LEU B HB2  1  
ATOM   465   H HB3  . LEU B 2 22  ? 9.207   -5.512  -1.537  1.00 0.00  ? 161 LEU B HB3  1  
ATOM   466   H HG   . LEU B 2 22  ? 10.369  -7.986  -0.222  1.00 0.00  ? 161 LEU B HG   1  
ATOM   467   H HD11 . LEU B 2 22  ? 7.963   -7.412  -1.911  1.00 0.00  ? 161 LEU B HD11 1  
ATOM   468   H HD12 . LEU B 2 22  ? 8.792   -8.954  -2.124  1.00 0.00  ? 161 LEU B HD12 1  
ATOM   469   H HD13 . LEU B 2 22  ? 8.134   -8.516  -0.547  1.00 0.00  ? 161 LEU B HD13 1  
ATOM   470   H HD21 . LEU B 2 22  ? 10.777  -6.682  -2.880  1.00 0.00  ? 161 LEU B HD21 1  
ATOM   471   H HD22 . LEU B 2 22  ? 11.912  -7.612  -1.902  1.00 0.00  ? 161 LEU B HD22 1  
ATOM   472   H HD23 . LEU B 2 22  ? 10.672  -8.442  -2.842  1.00 0.00  ? 161 LEU B HD23 1  
ATOM   473   N N    . LEU B 2 23  ? 10.451  -3.066  0.256   1.00 12.10 ? 162 LEU B N    1  
ATOM   474   C CA   . LEU B 2 23  ? 10.299  -1.601  0.037   1.00 13.70 ? 162 LEU B CA   1  
ATOM   475   C C    . LEU B 2 23  ? 11.601  -0.886  0.408   1.00 15.43 ? 162 LEU B C    1  
ATOM   476   O O    . LEU B 2 23  ? 11.969  0.102   -0.196  1.00 15.50 ? 162 LEU B O    1  
ATOM   477   C CB   . LEU B 2 23  ? 9.154   -1.076  0.904   1.00 13.91 ? 162 LEU B CB   1  
ATOM   478   C CG   . LEU B 2 23  ? 7.844   -1.734  0.465   1.00 12.97 ? 162 LEU B CG   1  
ATOM   479   C CD1  . LEU B 2 23  ? 6.897   -1.842  1.662   1.00 9.03  ? 162 LEU B CD1  1  
ATOM   480   C CD2  . LEU B 2 23  ? 7.188   -0.884  -0.625  1.00 11.59 ? 162 LEU B CD2  1  
ATOM   481   H H    . LEU B 2 23  ? 10.208  -3.460  1.120   1.00 0.00  ? 162 LEU B H    1  
ATOM   482   H HA   . LEU B 2 23  ? 10.074  -1.417  -1.004  1.00 0.00  ? 162 LEU B HA   1  
ATOM   483   H HB2  . LEU B 2 23  ? 9.349   -1.314  1.940   1.00 0.00  ? 162 LEU B HB2  1  
ATOM   484   H HB3  . LEU B 2 23  ? 9.074   -0.006  0.788   1.00 0.00  ? 162 LEU B HB3  1  
ATOM   485   H HG   . LEU B 2 23  ? 8.051   -2.723  0.078   1.00 0.00  ? 162 LEU B HG   1  
ATOM   486   H HD11 . LEU B 2 23  ? 7.426   -2.269  2.502   1.00 0.00  ? 162 LEU B HD11 1  
ATOM   487   H HD12 . LEU B 2 23  ? 6.536   -0.859  1.925   1.00 0.00  ? 162 LEU B HD12 1  
ATOM   488   H HD13 . LEU B 2 23  ? 6.061   -2.475  1.403   1.00 0.00  ? 162 LEU B HD13 1  
ATOM   489   H HD21 . LEU B 2 23  ? 7.507   0.143   -0.521  1.00 0.00  ? 162 LEU B HD21 1  
ATOM   490   H HD22 . LEU B 2 23  ? 7.481   -1.255  -1.596  1.00 0.00  ? 162 LEU B HD22 1  
ATOM   491   H HD23 . LEU B 2 23  ? 6.114   -0.939  -0.527  1.00 0.00  ? 162 LEU B HD23 1  
ATOM   492   N N    . LEU B 2 24  ? 12.306  -1.377  1.392   1.00 17.97 ? 163 LEU B N    1  
ATOM   493   C CA   . LEU B 2 24  ? 13.584  -0.721  1.789   1.00 23.68 ? 163 LEU B CA   1  
ATOM   494   C C    . LEU B 2 24  ? 14.672  -1.056  0.766   1.00 29.76 ? 163 LEU B C    1  
ATOM   495   O O    . LEU B 2 24  ? 15.779  -0.561  0.842   1.00 34.43 ? 163 LEU B O    1  
ATOM   496   C CB   . LEU B 2 24  ? 14.013  -1.225  3.168   1.00 20.30 ? 163 LEU B CB   1  
ATOM   497   C CG   . LEU B 2 24  ? 13.006  -0.760  4.220   1.00 19.42 ? 163 LEU B CG   1  
ATOM   498   C CD1  . LEU B 2 24  ? 13.467  -1.215  5.606   1.00 19.86 ? 163 LEU B CD1  1  
ATOM   499   C CD2  . LEU B 2 24  ? 12.908  0.767   4.193   1.00 19.28 ? 163 LEU B CD2  1  
ATOM   500   H H    . LEU B 2 24  ? 11.998  -2.176  1.866   1.00 0.00  ? 163 LEU B H    1  
ATOM   501   H HA   . LEU B 2 24  ? 13.443  0.349   1.824   1.00 0.00  ? 163 LEU B HA   1  
ATOM   502   H HB2  . LEU B 2 24  ? 14.056  -2.304  3.159   1.00 0.00  ? 163 LEU B HB2  1  
ATOM   503   H HB3  . LEU B 2 24  ? 14.987  -0.829  3.407   1.00 0.00  ? 163 LEU B HB3  1  
ATOM   504   H HG   . LEU B 2 24  ? 12.038  -1.189  4.004   1.00 0.00  ? 163 LEU B HG   1  
ATOM   505   H HD11 . LEU B 2 24  ? 14.436  -0.790  5.820   1.00 0.00  ? 163 LEU B HD11 1  
ATOM   506   H HD12 . LEU B 2 24  ? 12.756  -0.884  6.348   1.00 0.00  ? 163 LEU B HD12 1  
ATOM   507   H HD13 . LEU B 2 24  ? 13.534  -2.293  5.627   1.00 0.00  ? 163 LEU B HD13 1  
ATOM   508   H HD21 . LEU B 2 24  ? 13.897  1.193   4.273   1.00 0.00  ? 163 LEU B HD21 1  
ATOM   509   H HD22 . LEU B 2 24  ? 12.455  1.083   3.265   1.00 0.00  ? 163 LEU B HD22 1  
ATOM   510   H HD23 . LEU B 2 24  ? 12.303  1.104   5.022   1.00 0.00  ? 163 LEU B HD23 1  
ATOM   511   N N    . ASN B 2 25  ? 14.370  -1.894  -0.191  1.00 33.44 ? 164 ASN B N    1  
ATOM   512   C CA   . ASN B 2 25  ? 15.389  -2.257  -1.214  1.00 37.75 ? 164 ASN B CA   1  
ATOM   513   C C    . ASN B 2 25  ? 16.090  -0.989  -1.703  1.00 40.49 ? 164 ASN B C    1  
ATOM   514   O O    . ASN B 2 25  ? 15.509  -0.169  -2.385  1.00 41.14 ? 164 ASN B O    1  
ATOM   515   C CB   . ASN B 2 25  ? 14.705  -2.949  -2.394  1.00 39.08 ? 164 ASN B CB   1  
ATOM   516   C CG   . ASN B 2 25  ? 15.208  -4.390  -2.504  1.00 42.87 ? 164 ASN B CG   1  
ATOM   517   O OD1  . ASN B 2 25  ? 16.376  -4.655  -2.300  1.00 47.61 ? 164 ASN B OD1  1  
ATOM   518   N ND2  . ASN B 2 25  ? 14.369  -5.338  -2.820  1.00 46.52 ? 164 ASN B ND2  1  
ATOM   519   H H    . ASN B 2 25  ? 13.474  -2.284  -0.238  1.00 0.00  ? 164 ASN B H    1  
ATOM   520   H HA   . ASN B 2 25  ? 16.117  -2.925  -0.777  1.00 0.00  ? 164 ASN B HA   1  
ATOM   521   H HB2  . ASN B 2 25  ? 13.635  -2.951  -2.239  1.00 0.00  ? 164 ASN B HB2  1  
ATOM   522   H HB3  . ASN B 2 25  ? 14.935  -2.419  -3.306  1.00 0.00  ? 164 ASN B HB3  1  
ATOM   523   H HD21 . ASN B 2 25  ? 13.424  -5.122  -2.985  1.00 0.00  ? 164 ASN B HD21 1  
ATOM   524   H HD22 . ASN B 2 25  ? 14.685  -6.268  -2.893  1.00 0.00  ? 164 ASN B HD22 1  
ATOM   525   N N    . ALA B 2 26  ? 17.337  -0.822  -1.358  1.00 41.13 ? 165 ALA B N    1  
ATOM   526   C CA   . ALA B 2 26  ? 18.077  0.392   -1.802  1.00 40.91 ? 165 ALA B CA   1  
ATOM   527   C C    . ALA B 2 26  ? 17.889  0.587   -3.308  1.00 39.78 ? 165 ALA B C    1  
ATOM   528   O O    . ALA B 2 26  ? 18.030  1.678   -3.824  1.00 42.37 ? 165 ALA B O    1  
ATOM   529   C CB   . ALA B 2 26  ? 19.566  0.223   -1.491  1.00 43.50 ? 165 ALA B CB   1  
ATOM   530   H H    . ALA B 2 26  ? 17.785  -1.496  -0.806  1.00 0.00  ? 165 ALA B H    1  
ATOM   531   H HA   . ALA B 2 26  ? 17.697  1.256   -1.277  1.00 0.00  ? 165 ALA B HA   1  
ATOM   532   H HB1  . ALA B 2 26  ? 19.767  -0.810  -1.248  1.00 0.00  ? 165 ALA B HB1  1  
ATOM   533   H HB2  . ALA B 2 26  ? 20.149  0.510   -2.353  1.00 0.00  ? 165 ALA B HB2  1  
ATOM   534   H HB3  . ALA B 2 26  ? 19.831  0.848   -0.651  1.00 0.00  ? 165 ALA B HB3  1  
ATOM   535   N N    . GLU B 2 27  ? 17.573  -0.462  -4.019  1.00 36.31 ? 166 GLU B N    1  
ATOM   536   C CA   . GLU B 2 27  ? 17.378  -0.336  -5.490  1.00 32.86 ? 166 GLU B CA   1  
ATOM   537   C C    . GLU B 2 27  ? 15.913  -0.003  -5.793  1.00 28.56 ? 166 GLU B C    1  
ATOM   538   O O    . GLU B 2 27  ? 15.374  -0.405  -6.804  1.00 27.16 ? 166 GLU B O    1  
ATOM   539   C CB   . GLU B 2 27  ? 17.747  -1.660  -6.158  1.00 35.96 ? 166 GLU B CB   1  
ATOM   540   C CG   . GLU B 2 27  ? 19.231  -1.955  -5.925  1.00 44.79 ? 166 GLU B CG   1  
ATOM   541   C CD   . GLU B 2 27  ? 20.056  -1.360  -7.066  1.00 50.54 ? 166 GLU B CD   1  
ATOM   542   O OE1  . GLU B 2 27  ? 20.193  -2.023  -8.081  1.00 52.17 ? 166 GLU B OE1  1  
ATOM   543   O OE2  . GLU B 2 27  ? 20.538  -0.250  -6.906  1.00 54.06 ? 166 GLU B OE2  1  
ATOM   544   H H    . GLU B 2 27  ? 17.467  -1.334  -3.587  1.00 0.00  ? 166 GLU B H    1  
ATOM   545   H HA   . GLU B 2 27  ? 18.013  0.449   -5.872  1.00 0.00  ? 166 GLU B HA   1  
ATOM   546   H HB2  . GLU B 2 27  ? 17.150  -2.454  -5.735  1.00 0.00  ? 166 GLU B HB2  1  
ATOM   547   H HB3  . GLU B 2 27  ? 17.558  -1.593  -7.217  1.00 0.00  ? 166 GLU B HB3  1  
ATOM   548   H HG2  . GLU B 2 27  ? 19.541  -1.517  -4.987  1.00 0.00  ? 166 GLU B HG2  1  
ATOM   549   H HG3  . GLU B 2 27  ? 19.384  -3.023  -5.891  1.00 0.00  ? 166 GLU B HG3  1  
ATOM   550   N N    . ASN B 2 28  ? 15.267  0.730   -4.927  1.00 24.51 ? 167 ASN B N    1  
ATOM   551   C CA   . ASN B 2 28  ? 13.840  1.088   -5.169  1.00 21.82 ? 167 ASN B CA   1  
ATOM   552   C C    . ASN B 2 28  ? 13.696  2.616   -5.184  1.00 19.62 ? 167 ASN B C    1  
ATOM   553   O O    . ASN B 2 28  ? 14.337  3.298   -4.410  1.00 20.78 ? 167 ASN B O    1  
ATOM   554   C CB   . ASN B 2 28  ? 12.970  0.510   -4.049  1.00 20.91 ? 167 ASN B CB   1  
ATOM   555   C CG   . ASN B 2 28  ? 12.437  -0.862  -4.466  1.00 21.84 ? 167 ASN B CG   1  
ATOM   556   O OD1  . ASN B 2 28  ? 12.764  -1.358  -5.526  1.00 20.75 ? 167 ASN B OD1  1  
ATOM   557   N ND2  . ASN B 2 28  ? 11.622  -1.500  -3.671  1.00 24.01 ? 167 ASN B ND2  1  
ATOM   558   H H    . ASN B 2 28  ? 15.719  1.046   -4.119  1.00 0.00  ? 167 ASN B H    1  
ATOM   559   H HA   . ASN B 2 28  ? 13.525  0.681   -6.118  1.00 0.00  ? 167 ASN B HA   1  
ATOM   560   H HB2  . ASN B 2 28  ? 13.562  0.408   -3.151  1.00 0.00  ? 167 ASN B HB2  1  
ATOM   561   H HB3  . ASN B 2 28  ? 12.140  1.173   -3.860  1.00 0.00  ? 167 ASN B HB3  1  
ATOM   562   H HD21 . ASN B 2 28  ? 11.358  -1.096  -2.813  1.00 0.00  ? 167 ASN B HD21 1  
ATOM   563   H HD22 . ASN B 2 28  ? 11.273  -2.383  -3.930  1.00 0.00  ? 167 ASN B HD22 1  
ATOM   564   N N    . PRO B 2 29  ? 12.856  3.112   -6.063  1.00 18.42 ? 168 PRO B N    1  
ATOM   565   C CA   . PRO B 2 29  ? 12.612  4.559   -6.190  1.00 16.88 ? 168 PRO B CA   1  
ATOM   566   C C    . PRO B 2 29  ? 11.663  5.038   -5.088  1.00 16.36 ? 168 PRO B C    1  
ATOM   567   O O    . PRO B 2 29  ? 10.971  4.254   -4.469  1.00 15.23 ? 168 PRO B O    1  
ATOM   568   C CB   . PRO B 2 29  ? 11.958  4.694   -7.568  1.00 18.00 ? 168 PRO B CB   1  
ATOM   569   C CG   . PRO B 2 29  ? 11.350  3.310   -7.899  1.00 17.15 ? 168 PRO B CG   1  
ATOM   570   C CD   . PRO B 2 29  ? 12.076  2.284   -7.008  1.00 16.33 ? 168 PRO B CD   1  
ATOM   571   H HA   . PRO B 2 29  ? 13.539  5.109   -6.165  1.00 0.00  ? 168 PRO B HA   1  
ATOM   572   H HB2  . PRO B 2 29  ? 11.182  5.447   -7.536  1.00 0.00  ? 168 PRO B HB2  1  
ATOM   573   H HB3  . PRO B 2 29  ? 12.698  4.952   -8.308  1.00 0.00  ? 168 PRO B HB3  1  
ATOM   574   H HG2  . PRO B 2 29  ? 10.290  3.311   -7.680  1.00 0.00  ? 168 PRO B HG2  1  
ATOM   575   H HG3  . PRO B 2 29  ? 11.514  3.071   -8.938  1.00 0.00  ? 168 PRO B HG3  1  
ATOM   576   H HD2  . PRO B 2 29  ? 11.359  1.672   -6.477  1.00 0.00  ? 168 PRO B HD2  1  
ATOM   577   H HD3  . PRO B 2 29  ? 12.737  1.670   -7.599  1.00 0.00  ? 168 PRO B HD3  1  
ATOM   578   N N    . ARG B 2 30  ? 11.621  6.318   -4.839  1.00 16.48 ? 169 ARG B N    1  
ATOM   579   C CA   . ARG B 2 30  ? 10.714  6.842   -3.780  1.00 15.86 ? 169 ARG B CA   1  
ATOM   580   C C    . ARG B 2 30  ? 9.291   6.939   -4.333  1.00 13.88 ? 169 ARG B C    1  
ATOM   581   O O    . ARG B 2 30  ? 9.003   7.749   -5.191  1.00 15.48 ? 169 ARG B O    1  
ATOM   582   C CB   . ARG B 2 30  ? 11.187  8.229   -3.341  1.00 15.75 ? 169 ARG B CB   1  
ATOM   583   C CG   . ARG B 2 30  ? 10.231  8.782   -2.281  1.00 19.73 ? 169 ARG B CG   1  
ATOM   584   C CD   . ARG B 2 30  ? 10.074  10.292  -2.471  1.00 22.87 ? 169 ARG B CD   1  
ATOM   585   N NE   . ARG B 2 30  ? 9.767   10.584  -3.899  1.00 21.47 ? 169 ARG B NE   1  
ATOM   586   C CZ   . ARG B 2 30  ? 10.291  11.630  -4.479  1.00 20.61 ? 169 ARG B CZ   1  
ATOM   587   N NH1  . ARG B 2 30  ? 11.531  11.957  -4.238  1.00 23.69 ? 169 ARG B NH1  1  
ATOM   588   N NH2  . ARG B 2 30  ? 9.575   12.348  -5.301  1.00 22.31 ? 169 ARG B NH2  1  
ATOM   589   H H    . ARG B 2 30  ? 12.185  6.935   -5.351  1.00 0.00  ? 169 ARG B H    1  
ATOM   590   H HA   . ARG B 2 30  ? 10.725  6.172   -2.932  1.00 0.00  ? 169 ARG B HA   1  
ATOM   591   H HB2  . ARG B 2 30  ? 12.182  8.156   -2.927  1.00 0.00  ? 169 ARG B HB2  1  
ATOM   592   H HB3  . ARG B 2 30  ? 11.199  8.892   -4.193  1.00 0.00  ? 169 ARG B HB3  1  
ATOM   593   H HG2  . ARG B 2 30  ? 9.268   8.303   -2.382  1.00 0.00  ? 169 ARG B HG2  1  
ATOM   594   H HG3  . ARG B 2 30  ? 10.631  8.584   -1.299  1.00 0.00  ? 169 ARG B HG3  1  
ATOM   595   H HD2  . ARG B 2 30  ? 9.267   10.650  -1.849  1.00 0.00  ? 169 ARG B HD2  1  
ATOM   596   H HD3  . ARG B 2 30  ? 10.992  10.787  -2.191  1.00 0.00  ? 169 ARG B HD3  1  
ATOM   597   H HE   . ARG B 2 30  ? 9.171   9.992   -4.404  1.00 0.00  ? 169 ARG B HE   1  
ATOM   598   H HH11 . ARG B 2 30  ? 12.081  11.406  -3.610  1.00 0.00  ? 169 ARG B HH11 1  
ATOM   599   H HH12 . ARG B 2 30  ? 11.932  12.759  -4.682  1.00 0.00  ? 169 ARG B HH12 1  
ATOM   600   H HH21 . ARG B 2 30  ? 8.625   12.097  -5.488  1.00 0.00  ? 169 ARG B HH21 1  
ATOM   601   H HH22 . ARG B 2 30  ? 9.976   13.150  -5.744  1.00 0.00  ? 169 ARG B HH22 1  
ATOM   602   N N    . GLY B 2 31  ? 8.399   6.119   -3.850  1.00 11.61 ? 170 GLY B N    1  
ATOM   603   C CA   . GLY B 2 31  ? 6.996   6.164   -4.351  1.00 10.78 ? 170 GLY B CA   1  
ATOM   604   C C    . GLY B 2 31  ? 6.530   4.752   -4.717  1.00 11.90 ? 170 GLY B C    1  
ATOM   605   O O    . GLY B 2 31  ? 5.402   4.546   -5.118  1.00 11.93 ? 170 GLY B O    1  
ATOM   606   H H    . GLY B 2 31  ? 8.651   5.472   -3.159  1.00 0.00  ? 170 GLY B H    1  
ATOM   607   H HA2  . GLY B 2 31  ? 6.353   6.569   -3.582  1.00 0.00  ? 170 GLY B HA2  1  
ATOM   608   H HA3  . GLY B 2 31  ? 6.947   6.793   -5.227  1.00 0.00  ? 170 GLY B HA3  1  
ATOM   609   N N    . THR B 2 32  ? 7.387   3.775   -4.582  1.00 11.18 ? 171 THR B N    1  
ATOM   610   C CA   . THR B 2 32  ? 6.986   2.380   -4.922  1.00 10.98 ? 171 THR B CA   1  
ATOM   611   C C    . THR B 2 32  ? 6.062   1.837   -3.830  1.00 10.39 ? 171 THR B C    1  
ATOM   612   O O    . THR B 2 32  ? 6.233   2.121   -2.661  1.00 11.11 ? 171 THR B O    1  
ATOM   613   C CB   . THR B 2 32  ? 8.235   1.500   -5.018  1.00 12.81 ? 171 THR B CB   1  
ATOM   614   O OG1  . THR B 2 32  ? 9.211   2.150   -5.822  1.00 15.73 ? 171 THR B OG1  1  
ATOM   615   C CG2  . THR B 2 32  ? 7.865   0.153   -5.643  1.00 10.54 ? 171 THR B CG2  1  
ATOM   616   H H    . THR B 2 32  ? 8.293   3.957   -4.257  1.00 0.00  ? 171 THR B H    1  
ATOM   617   H HA   . THR B 2 32  ? 6.467   2.375   -5.869  1.00 0.00  ? 171 THR B HA   1  
ATOM   618   H HB   . THR B 2 32  ? 8.636   1.335   -4.030  1.00 0.00  ? 171 THR B HB   1  
ATOM   619   H HG1  . THR B 2 32  ? 9.101   1.848   -6.727  1.00 0.00  ? 171 THR B HG1  1  
ATOM   620   H HG21 . THR B 2 32  ? 6.900   -0.162  -5.274  1.00 0.00  ? 171 THR B HG21 1  
ATOM   621   H HG22 . THR B 2 32  ? 7.824   0.254   -6.717  1.00 0.00  ? 171 THR B HG22 1  
ATOM   622   H HG23 . THR B 2 32  ? 8.610   -0.583  -5.378  1.00 0.00  ? 171 THR B HG23 1  
ATOM   623   N N    . PHE B 2 33  ? 5.083   1.057   -4.199  1.00 9.86  ? 172 PHE B N    1  
ATOM   624   C CA   . PHE B 2 33  ? 4.152   0.498   -3.179  1.00 10.31 ? 172 PHE B CA   1  
ATOM   625   C C    . PHE B 2 33  ? 3.791   -0.942  -3.548  1.00 9.74  ? 172 PHE B C    1  
ATOM   626   O O    . PHE B 2 33  ? 4.216   -1.460  -4.561  1.00 10.89 ? 172 PHE B O    1  
ATOM   627   C CB   . PHE B 2 33  ? 2.878   1.344   -3.131  1.00 8.42  ? 172 PHE B CB   1  
ATOM   628   C CG   . PHE B 2 33  ? 2.130   1.204   -4.435  1.00 10.33 ? 172 PHE B CG   1  
ATOM   629   C CD1  . PHE B 2 33  ? 1.191   0.171   -4.599  1.00 10.22 ? 172 PHE B CD1  1  
ATOM   630   C CD2  . PHE B 2 33  ? 2.372   2.106   -5.485  1.00 9.32  ? 172 PHE B CD2  1  
ATOM   631   C CE1  . PHE B 2 33  ? 0.494   0.040   -5.812  1.00 9.66  ? 172 PHE B CE1  1  
ATOM   632   C CE2  . PHE B 2 33  ? 1.675   1.975   -6.699  1.00 10.82 ? 172 PHE B CE2  1  
ATOM   633   C CZ   . PHE B 2 33  ? 0.737   0.942   -6.862  1.00 11.64 ? 172 PHE B CZ   1  
ATOM   634   H H    . PHE B 2 33  ? 4.961   0.839   -5.147  1.00 0.00  ? 172 PHE B H    1  
ATOM   635   H HA   . PHE B 2 33  ? 4.629   0.512   -2.211  1.00 0.00  ? 172 PHE B HA   1  
ATOM   636   H HB2  . PHE B 2 33  ? 2.252   1.004   -2.319  1.00 0.00  ? 172 PHE B HB2  1  
ATOM   637   H HB3  . PHE B 2 33  ? 3.139   2.379   -2.976  1.00 0.00  ? 172 PHE B HB3  1  
ATOM   638   H HD1  . PHE B 2 33  ? 1.004   -0.522  -3.792  1.00 0.00  ? 172 PHE B HD1  1  
ATOM   639   H HD2  . PHE B 2 33  ? 3.093   2.899   -5.360  1.00 0.00  ? 172 PHE B HD2  1  
ATOM   640   H HE1  . PHE B 2 33  ? -0.227  -0.753  -5.938  1.00 0.00  ? 172 PHE B HE1  1  
ATOM   641   H HE2  . PHE B 2 33  ? 1.861   2.668   -7.506  1.00 0.00  ? 172 PHE B HE2  1  
ATOM   642   H HZ   . PHE B 2 33  ? 0.201   0.841   -7.795  1.00 0.00  ? 172 PHE B HZ   1  
ATOM   643   N N    . LEU B 2 34  ? 3.008   -1.591  -2.731  1.00 8.06  ? 173 LEU B N    1  
ATOM   644   C CA   . LEU B 2 34  ? 2.617   -2.997  -3.032  1.00 6.70  ? 173 LEU B CA   1  
ATOM   645   C C    . LEU B 2 34  ? 1.359   -3.356  -2.238  1.00 8.22  ? 173 LEU B C    1  
ATOM   646   O O    . LEU B 2 34  ? 1.133   -2.853  -1.155  1.00 8.04  ? 173 LEU B O    1  
ATOM   647   C CB   . LEU B 2 34  ? 3.756   -3.940  -2.637  1.00 7.47  ? 173 LEU B CB   1  
ATOM   648   C CG   . LEU B 2 34  ? 3.986   -3.858  -1.127  1.00 8.31  ? 173 LEU B CG   1  
ATOM   649   C CD1  . LEU B 2 34  ? 3.290   -5.034  -0.440  1.00 7.11  ? 173 LEU B CD1  1  
ATOM   650   C CD2  . LEU B 2 34  ? 5.488   -3.917  -0.838  1.00 7.67  ? 173 LEU B CD2  1  
ATOM   651   H H    . LEU B 2 34  ? 2.677   -1.153  -1.920  1.00 0.00  ? 173 LEU B H    1  
ATOM   652   H HA   . LEU B 2 34  ? 2.417   -3.097  -4.088  1.00 0.00  ? 173 LEU B HA   1  
ATOM   653   H HB2  . LEU B 2 34  ? 3.495   -4.952  -2.908  1.00 0.00  ? 173 LEU B HB2  1  
ATOM   654   H HB3  . LEU B 2 34  ? 4.659   -3.650  -3.153  1.00 0.00  ? 173 LEU B HB3  1  
ATOM   655   H HG   . LEU B 2 34  ? 3.580   -2.930  -0.751  1.00 0.00  ? 173 LEU B HG   1  
ATOM   656   H HD11 . LEU B 2 34  ? 3.065   -5.796  -1.171  1.00 0.00  ? 173 LEU B HD11 1  
ATOM   657   H HD12 . LEU B 2 34  ? 3.940   -5.444  0.319   1.00 0.00  ? 173 LEU B HD12 1  
ATOM   658   H HD13 . LEU B 2 34  ? 2.373   -4.692  0.018   1.00 0.00  ? 173 LEU B HD13 1  
ATOM   659   H HD21 . LEU B 2 34  ? 5.971   -4.548  -1.568  1.00 0.00  ? 173 LEU B HD21 1  
ATOM   660   H HD22 . LEU B 2 34  ? 5.904   -2.921  -0.891  1.00 0.00  ? 173 LEU B HD22 1  
ATOM   661   H HD23 . LEU B 2 34  ? 5.649   -4.321  0.151   1.00 0.00  ? 173 LEU B HD23 1  
ATOM   662   N N    . VAL B 2 35  ? 0.539   -4.222  -2.767  1.00 9.95  ? 174 VAL B N    1  
ATOM   663   C CA   . VAL B 2 35  ? -0.704  -4.611  -2.042  1.00 10.61 ? 174 VAL B CA   1  
ATOM   664   C C    . VAL B 2 35  ? -0.593  -6.065  -1.579  1.00 10.97 ? 174 VAL B C    1  
ATOM   665   O O    . VAL B 2 35  ? -0.888  -6.985  -2.316  1.00 13.68 ? 174 VAL B O    1  
ATOM   666   C CB   . VAL B 2 35  ? -1.906  -4.465  -2.976  1.00 8.85  ? 174 VAL B CB   1  
ATOM   667   C CG1  . VAL B 2 35  ? -3.190  -4.803  -2.215  1.00 7.48  ? 174 VAL B CG1  1  
ATOM   668   C CG2  . VAL B 2 35  ? -1.982  -3.024  -3.487  1.00 7.46  ? 174 VAL B CG2  1  
ATOM   669   H H    . VAL B 2 35  ? 0.739   -4.616  -3.641  1.00 0.00  ? 174 VAL B H    1  
ATOM   670   H HA   . VAL B 2 35  ? -0.836  -3.968  -1.183  1.00 0.00  ? 174 VAL B HA   1  
ATOM   671   H HB   . VAL B 2 35  ? -1.795  -5.140  -3.812  1.00 0.00  ? 174 VAL B HB   1  
ATOM   672   H HG11 . VAL B 2 35  ? -3.057  -4.577  -1.168  1.00 0.00  ? 174 VAL B HG11 1  
ATOM   673   H HG12 . VAL B 2 35  ? -4.007  -4.217  -2.609  1.00 0.00  ? 174 VAL B HG12 1  
ATOM   674   H HG13 . VAL B 2 35  ? -3.411  -5.854  -2.332  1.00 0.00  ? 174 VAL B HG13 1  
ATOM   675   H HG21 . VAL B 2 35  ? -1.122  -2.473  -3.137  1.00 0.00  ? 174 VAL B HG21 1  
ATOM   676   H HG22 . VAL B 2 35  ? -1.994  -3.025  -4.567  1.00 0.00  ? 174 VAL B HG22 1  
ATOM   677   H HG23 . VAL B 2 35  ? -2.883  -2.558  -3.117  1.00 0.00  ? 174 VAL B HG23 1  
ATOM   678   N N    . ARG B 2 36  ? -0.171  -6.281  -0.363  1.00 12.04 ? 175 ARG B N    1  
ATOM   679   C CA   . ARG B 2 36  ? -0.044  -7.676  0.144   1.00 13.07 ? 175 ARG B CA   1  
ATOM   680   C C    . ARG B 2 36  ? -1.343  -8.086  0.841   1.00 15.49 ? 175 ARG B C    1  
ATOM   681   O O    . ARG B 2 36  ? -2.242  -7.289  1.020   1.00 11.34 ? 175 ARG B O    1  
ATOM   682   C CB   . ARG B 2 36  ? 1.116   -7.756  1.139   1.00 10.24 ? 175 ARG B CB   1  
ATOM   683   C CG   . ARG B 2 36  ? 0.879   -6.768  2.282   1.00 10.97 ? 175 ARG B CG   1  
ATOM   684   C CD   . ARG B 2 36  ? 1.554   -7.286  3.553   1.00 8.81  ? 175 ARG B CD   1  
ATOM   685   N NE   . ARG B 2 36  ? 2.429   -6.222  4.120   1.00 7.82  ? 175 ARG B NE   1  
ATOM   686   C CZ   . ARG B 2 36  ? 1.906   -5.106  4.548   1.00 8.03  ? 175 ARG B CZ   1  
ATOM   687   N NH1  . ARG B 2 36  ? 1.333   -5.061  5.719   1.00 7.60  ? 175 ARG B NH1  1  
ATOM   688   N NH2  . ARG B 2 36  ? 1.956   -4.035  3.804   1.00 11.06 ? 175 ARG B NH2  1  
ATOM   689   H H    . ARG B 2 36  ? 0.061   -5.526  0.217   1.00 0.00  ? 175 ARG B H    1  
ATOM   690   H HA   . ARG B 2 36  ? 0.145   -8.344  -0.684  1.00 0.00  ? 175 ARG B HA   1  
ATOM   691   H HB2  . ARG B 2 36  ? 1.179   -8.759  1.536   1.00 0.00  ? 175 ARG B HB2  1  
ATOM   692   H HB3  . ARG B 2 36  ? 2.038   -7.509  0.636   1.00 0.00  ? 175 ARG B HB3  1  
ATOM   693   H HG2  . ARG B 2 36  ? 1.296   -5.806  2.018   1.00 0.00  ? 175 ARG B HG2  1  
ATOM   694   H HG3  . ARG B 2 36  ? -0.181  -6.665  2.456   1.00 0.00  ? 175 ARG B HG3  1  
ATOM   695   H HD2  . ARG B 2 36  ? 0.800   -7.556  4.277   1.00 0.00  ? 175 ARG B HD2  1  
ATOM   696   H HD3  . ARG B 2 36  ? 2.151   -8.154  3.314   1.00 0.00  ? 175 ARG B HD3  1  
ATOM   697   H HE   . ARG B 2 36  ? 3.398   -6.361  4.173   1.00 0.00  ? 175 ARG B HE   1  
ATOM   698   H HH11 . ARG B 2 36  ? 1.296   -5.882  6.290   1.00 0.00  ? 175 ARG B HH11 1  
ATOM   699   H HH12 . ARG B 2 36  ? 0.932   -4.206  6.047   1.00 0.00  ? 175 ARG B HH12 1  
ATOM   700   H HH21 . ARG B 2 36  ? 2.395   -4.070  2.906   1.00 0.00  ? 175 ARG B HH21 1  
ATOM   701   H HH22 . ARG B 2 36  ? 1.555   -3.179  4.131   1.00 0.00  ? 175 ARG B HH22 1  
ATOM   702   N N    . GLU B 2 37  ? -1.448  -9.326  1.236   1.00 20.91 ? 176 GLU B N    1  
ATOM   703   C CA   . GLU B 2 37  ? -2.689  -9.787  1.920   1.00 26.31 ? 176 GLU B CA   1  
ATOM   704   C C    . GLU B 2 37  ? -2.591  -9.479  3.416   1.00 29.76 ? 176 GLU B C    1  
ATOM   705   O O    . GLU B 2 37  ? -1.514  -9.400  3.974   1.00 30.61 ? 176 GLU B O    1  
ATOM   706   C CB   . GLU B 2 37  ? -2.853  -11.295 1.719   1.00 25.39 ? 176 GLU B CB   1  
ATOM   707   C CG   . GLU B 2 37  ? -4.341  -11.643 1.650   1.00 29.84 ? 176 GLU B CG   1  
ATOM   708   C CD   . GLU B 2 37  ? -4.655  -12.280 0.295   1.00 32.50 ? 176 GLU B CD   1  
ATOM   709   O OE1  . GLU B 2 37  ? -3.834  -13.046 -0.181  1.00 34.32 ? 176 GLU B OE1  1  
ATOM   710   O OE2  . GLU B 2 37  ? -5.711  -11.990 -0.243  1.00 36.79 ? 176 GLU B OE2  1  
ATOM   711   H H    . GLU B 2 37  ? -0.712  -9.953  1.081   1.00 0.00  ? 176 GLU B H    1  
ATOM   712   H HA   . GLU B 2 37  ? -3.542  -9.273  1.503   1.00 0.00  ? 176 GLU B HA   1  
ATOM   713   H HB2  . GLU B 2 37  ? -2.370  -11.588 0.797   1.00 0.00  ? 176 GLU B HB2  1  
ATOM   714   H HB3  . GLU B 2 37  ? -2.400  -11.820 2.546   1.00 0.00  ? 176 GLU B HB3  1  
ATOM   715   H HG2  . GLU B 2 37  ? -4.584  -12.337 2.441   1.00 0.00  ? 176 GLU B HG2  1  
ATOM   716   H HG3  . GLU B 2 37  ? -4.927  -10.744 1.767   1.00 0.00  ? 176 GLU B HG3  1  
ATOM   717   N N    . SER B 2 38  ? -3.707  -9.306  4.070   1.00 36.14 ? 177 SER B N    1  
ATOM   718   C CA   . SER B 2 38  ? -3.677  -9.004  5.528   1.00 41.98 ? 177 SER B CA   1  
ATOM   719   C C    . SER B 2 38  ? -2.741  -9.987  6.234   1.00 43.00 ? 177 SER B C    1  
ATOM   720   O O    . SER B 2 38  ? -2.787  -11.179 6.000   1.00 43.66 ? 177 SER B O    1  
ATOM   721   C CB   . SER B 2 38  ? -5.086  -9.138  6.105   1.00 45.78 ? 177 SER B CB   1  
ATOM   722   O OG   . SER B 2 38  ? -5.544  -10.471 5.922   1.00 51.84 ? 177 SER B OG   1  
ATOM   723   H H    . SER B 2 38  ? -4.564  -9.375  3.601   1.00 0.00  ? 177 SER B H    1  
ATOM   724   H HA   . SER B 2 38  ? -3.320  -7.996  5.680   1.00 0.00  ? 177 SER B HA   1  
ATOM   725   H HB2  . SER B 2 38  ? -5.070  -8.910  7.158   1.00 0.00  ? 177 SER B HB2  1  
ATOM   726   H HB3  . SER B 2 38  ? -5.748  -8.446  5.600   1.00 0.00  ? 177 SER B HB3  1  
ATOM   727   H HG   . SER B 2 38  ? -5.211  -10.785 5.078   1.00 0.00  ? 177 SER B HG   1  
ATOM   728   N N    . GLU B 2 39  ? -1.892  -9.498  7.095   1.00 23.97 ? 178 GLU B N    1  
ATOM   729   C CA   . GLU B 2 39  ? -0.953  -10.404 7.813   1.00 25.52 ? 178 GLU B CA   1  
ATOM   730   C C    . GLU B 2 39  ? -1.173  -10.279 9.322   1.00 30.02 ? 178 GLU B C    1  
ATOM   731   O O    . GLU B 2 39  ? -1.288  -11.262 10.026  1.00 31.55 ? 178 GLU B O    1  
ATOM   732   C CB   . GLU B 2 39  ? 0.488   -10.016 7.474   1.00 23.29 ? 178 GLU B CB   1  
ATOM   733   C CG   . GLU B 2 39  ? 1.080   -11.041 6.505   1.00 29.79 ? 178 GLU B CG   1  
ATOM   734   C CD   . GLU B 2 39  ? 1.761   -10.312 5.345   1.00 33.17 ? 178 GLU B CD   1  
ATOM   735   O OE1  . GLU B 2 39  ? 2.856   -9.813  5.547   1.00 39.84 ? 178 GLU B OE1  1  
ATOM   736   O OE2  . GLU B 2 39  ? 1.177   -10.265 4.276   1.00 21.15 ? 178 GLU B OE2  1  
ATOM   737   H H    . GLU B 2 39  ? -1.871  -8.533  7.268   1.00 0.00  ? 178 GLU B H    1  
ATOM   738   H HA   . GLU B 2 39  ? -1.133  -11.424 7.506   1.00 0.00  ? 178 GLU B HA   1  
ATOM   739   H HB2  . GLU B 2 39  ? 0.498   -9.038  7.016   1.00 0.00  ? 178 GLU B HB2  1  
ATOM   740   H HB3  . GLU B 2 39  ? 1.077   -9.997  8.378   1.00 0.00  ? 178 GLU B HB3  1  
ATOM   741   H HG2  . GLU B 2 39  ? 1.805   -11.650 7.024   1.00 0.00  ? 178 GLU B HG2  1  
ATOM   742   H HG3  . GLU B 2 39  ? 0.291   -11.669 6.118   1.00 0.00  ? 178 GLU B HG3  1  
ATOM   743   N N    . THR B 2 40  ? -1.228  -9.076  9.825   1.00 26.98 ? 179 THR B N    1  
ATOM   744   C CA   . THR B 2 40  ? -1.436  -8.890  11.287  1.00 31.67 ? 179 THR B CA   1  
ATOM   745   C C    . THR B 2 40  ? -2.823  -8.294  11.538  1.00 34.54 ? 179 THR B C    1  
ATOM   746   O O    . THR B 2 40  ? -3.074  -7.695  12.565  1.00 34.85 ? 179 THR B O    1  
ATOM   747   C CB   . THR B 2 40  ? -0.367  -7.941  11.832  1.00 26.17 ? 179 THR B CB   1  
ATOM   748   O OG1  . THR B 2 40  ? -0.140  -6.899  10.893  1.00 28.58 ? 179 THR B OG1  1  
ATOM   749   C CG2  . THR B 2 40  ? 0.932   -8.712  12.065  1.00 35.55 ? 179 THR B CG2  1  
ATOM   750   H H    . THR B 2 40  ? -1.130  -8.295  9.242   1.00 0.00  ? 179 THR B H    1  
ATOM   751   H HA   . THR B 2 40  ? -1.358  -9.844  11.787  1.00 0.00  ? 179 THR B HA   1  
ATOM   752   H HB   . THR B 2 40  ? -0.703  -7.518  12.764  1.00 0.00  ? 179 THR B HB   1  
ATOM   753   H HG1  . THR B 2 40  ? -0.758  -6.189  11.083  1.00 0.00  ? 179 THR B HG1  1  
ATOM   754   H HG21 . THR B 2 40  ? 1.147   -9.325  11.202  1.00 0.00  ? 179 THR B HG21 1  
ATOM   755   H HG22 . THR B 2 40  ? 1.742   -8.015  12.222  1.00 0.00  ? 179 THR B HG22 1  
ATOM   756   H HG23 . THR B 2 40  ? 0.826   -9.341  12.937  1.00 0.00  ? 179 THR B HG23 1  
ATOM   757   N N    . THR B 2 41  ? -3.727  -8.452  10.610  1.00 27.03 ? 180 THR B N    1  
ATOM   758   C CA   . THR B 2 41  ? -5.095  -7.894  10.802  1.00 25.08 ? 180 THR B CA   1  
ATOM   759   C C    . THR B 2 41  ? -6.130  -8.889  10.276  1.00 30.09 ? 180 THR B C    1  
ATOM   760   O O    . THR B 2 41  ? -5.811  -10.010 9.934   1.00 30.04 ? 180 THR B O    1  
ATOM   761   C CB   . THR B 2 41  ? -5.226  -6.577  10.029  1.00 29.37 ? 180 THR B CB   1  
ATOM   762   O OG1  . THR B 2 41  ? -3.956  -5.945  9.954   1.00 38.10 ? 180 THR B OG1  1  
ATOM   763   C CG2  . THR B 2 41  ? -6.212  -5.657  10.751  1.00 40.88 ? 180 THR B CG2  1  
ATOM   764   H H    . THR B 2 41  ? -3.506  -8.939  9.789   1.00 0.00  ? 180 THR B H    1  
ATOM   765   H HA   . THR B 2 41  ? -5.268  -7.714  11.852  1.00 0.00  ? 180 THR B HA   1  
ATOM   766   H HB   . THR B 2 41  ? -5.592  -6.776  9.031   1.00 0.00  ? 180 THR B HB   1  
ATOM   767   H HG1  . THR B 2 41  ? -3.753  -5.795  9.028   1.00 0.00  ? 180 THR B HG1  1  
ATOM   768   H HG21 . THR B 2 41  ? -6.373  -6.019  11.755  1.00 0.00  ? 180 THR B HG21 1  
ATOM   769   H HG22 . THR B 2 41  ? -5.807  -4.656  10.790  1.00 0.00  ? 180 THR B HG22 1  
ATOM   770   H HG23 . THR B 2 41  ? -7.150  -5.645  10.217  1.00 0.00  ? 180 THR B HG23 1  
ATOM   771   N N    . LYS B 2 42  ? -7.366  -8.480  10.202  1.00 32.42 ? 181 LYS B N    1  
ATOM   772   C CA   . LYS B 2 42  ? -8.427  -9.389  9.688   1.00 38.97 ? 181 LYS B CA   1  
ATOM   773   C C    . LYS B 2 42  ? -8.039  -9.873  8.298   1.00 35.28 ? 181 LYS B C    1  
ATOM   774   O O    . LYS B 2 42  ? -6.910  -9.727  7.872   1.00 34.92 ? 181 LYS B O    1  
ATOM   775   C CB   . LYS B 2 42  ? -9.752  -8.622  9.622   1.00 51.02 ? 181 LYS B CB   1  
ATOM   776   C CG   . LYS B 2 42  ? -10.342 -8.502  11.029  1.00 72.35 ? 181 LYS B CG   1  
ATOM   777   C CD   . LYS B 2 42  ? -11.838 -8.817  10.984  1.00 84.05 ? 181 LYS B CD   1  
ATOM   778   C CE   . LYS B 2 42  ? -12.221 -9.655  12.205  1.00 88.20 ? 181 LYS B CE   1  
ATOM   779   N NZ   . LYS B 2 42  ? -13.357 -10.554 11.854  1.00 87.98 ? 181 LYS B NZ   1  
ATOM   780   H H    . LYS B 2 42  ? -7.595  -7.568  10.477  1.00 0.00  ? 181 LYS B H    1  
ATOM   781   H HA   . LYS B 2 42  ? -8.535  -10.237 10.333  1.00 0.00  ? 181 LYS B HA   1  
ATOM   782   H HB2  . LYS B 2 42  ? -9.576  -7.635  9.220   1.00 0.00  ? 181 LYS B HB2  1  
ATOM   783   H HB3  . LYS B 2 42  ? -10.447 -9.149  8.988   1.00 0.00  ? 181 LYS B HB3  1  
ATOM   784   H HG2  . LYS B 2 42  ? -9.846  -9.201  11.687  1.00 0.00  ? 181 LYS B HG2  1  
ATOM   785   H HG3  . LYS B 2 42  ? -10.198 -7.497  11.396  1.00 0.00  ? 181 LYS B HG3  1  
ATOM   786   H HD2  . LYS B 2 42  ? -12.400 -7.894  10.988  1.00 0.00  ? 181 LYS B HD2  1  
ATOM   787   H HD3  . LYS B 2 42  ? -12.063 -9.372  10.085  1.00 0.00  ? 181 LYS B HD3  1  
ATOM   788   H HE2  . LYS B 2 42  ? -11.374 -10.249 12.514  1.00 0.00  ? 181 LYS B HE2  1  
ATOM   789   H HE3  . LYS B 2 42  ? -12.516 -9.001  13.012  1.00 0.00  ? 181 LYS B HE3  1  
ATOM   790   H HZ1  . LYS B 2 42  ? -13.729 -10.291 10.918  1.00 0.00  ? 181 LYS B HZ1  1  
ATOM   791   H HZ2  . LYS B 2 42  ? -13.026 -11.539 11.832  1.00 0.00  ? 181 LYS B HZ2  1  
ATOM   792   H HZ3  . LYS B 2 42  ? -14.108 -10.458 12.566  1.00 0.00  ? 181 LYS B HZ3  1  
ATOM   793   N N    . GLY B 2 43  ? -8.962  -10.444 7.586   1.00 38.03 ? 182 GLY B N    1  
ATOM   794   C CA   . GLY B 2 43  ? -8.651  -10.931 6.213   1.00 30.70 ? 182 GLY B CA   1  
ATOM   795   C C    . GLY B 2 43  ? -8.735  -9.761  5.224   1.00 29.58 ? 182 GLY B C    1  
ATOM   796   O O    . GLY B 2 43  ? -9.211  -9.907  4.116   1.00 31.67 ? 182 GLY B O    1  
ATOM   797   H H    . GLY B 2 43  ? -9.862  -10.553 7.954   1.00 0.00  ? 182 GLY B H    1  
ATOM   798   H HA2  . GLY B 2 43  ? -7.653  -11.348 6.197   1.00 0.00  ? 182 GLY B HA2  1  
ATOM   799   H HA3  . GLY B 2 43  ? -9.363  -11.690 5.928   1.00 0.00  ? 182 GLY B HA3  1  
ATOM   800   N N    . ALA B 2 44  ? -8.277  -8.600  5.618   1.00 35.86 ? 183 ALA B N    1  
ATOM   801   C CA   . ALA B 2 44  ? -8.331  -7.423  4.708   1.00 32.70 ? 183 ALA B CA   1  
ATOM   802   C C    . ALA B 2 44  ? -7.053  -7.371  3.868   1.00 28.65 ? 183 ALA B C    1  
ATOM   803   O O    . ALA B 2 44  ? -6.448  -8.384  3.579   1.00 29.39 ? 183 ALA B O    1  
ATOM   804   C CB   . ALA B 2 44  ? -8.437  -6.147  5.548   1.00 31.44 ? 183 ALA B CB   1  
ATOM   805   H H    . ALA B 2 44  ? -7.901  -8.499  6.513   1.00 0.00  ? 183 ALA B H    1  
ATOM   806   H HA   . ALA B 2 44  ? -9.190  -7.502  4.060   1.00 0.00  ? 183 ALA B HA   1  
ATOM   807   H HB1  . ALA B 2 44  ? -9.171  -6.289  6.327   1.00 0.00  ? 183 ALA B HB1  1  
ATOM   808   H HB2  . ALA B 2 44  ? -7.477  -5.930  5.995   1.00 0.00  ? 183 ALA B HB2  1  
ATOM   809   H HB3  . ALA B 2 44  ? -8.734  -5.324  4.917   1.00 0.00  ? 183 ALA B HB3  1  
ATOM   810   N N    . TYR B 2 45  ? -6.636  -6.198  3.474   1.00 24.43 ? 184 TYR B N    1  
ATOM   811   C CA   . TYR B 2 45  ? -5.397  -6.085  2.654   1.00 19.69 ? 184 TYR B CA   1  
ATOM   812   C C    . TYR B 2 45  ? -4.451  -5.069  3.299   1.00 15.67 ? 184 TYR B C    1  
ATOM   813   O O    . TYR B 2 45  ? -4.752  -4.489  4.323   1.00 11.54 ? 184 TYR B O    1  
ATOM   814   C CB   . TYR B 2 45  ? -5.761  -5.620  1.242   1.00 20.89 ? 184 TYR B CB   1  
ATOM   815   C CG   . TYR B 2 45  ? -6.674  -6.635  0.598   1.00 21.46 ? 184 TYR B CG   1  
ATOM   816   C CD1  . TYR B 2 45  ? -8.063  -6.556  0.796   1.00 21.81 ? 184 TYR B CD1  1  
ATOM   817   C CD2  . TYR B 2 45  ? -6.136  -7.659  -0.199  1.00 23.38 ? 184 TYR B CD2  1  
ATOM   818   C CE1  . TYR B 2 45  ? -8.913  -7.501  0.198   1.00 21.77 ? 184 TYR B CE1  1  
ATOM   819   C CE2  . TYR B 2 45  ? -6.986  -8.604  -0.798  1.00 24.77 ? 184 TYR B CE2  1  
ATOM   820   C CZ   . TYR B 2 45  ? -8.374  -8.525  -0.599  1.00 25.72 ? 184 TYR B CZ   1  
ATOM   821   O OH   . TYR B 2 45  ? -9.209  -9.453  -1.187  1.00 27.17 ? 184 TYR B OH   1  
ATOM   822   H H    . TYR B 2 45  ? -7.137  -5.392  3.717   1.00 0.00  ? 184 TYR B H    1  
ATOM   823   H HA   . TYR B 2 45  ? -4.910  -7.047  2.602   1.00 0.00  ? 184 TYR B HA   1  
ATOM   824   H HB2  . TYR B 2 45  ? -6.263  -4.665  1.296   1.00 0.00  ? 184 TYR B HB2  1  
ATOM   825   H HB3  . TYR B 2 45  ? -4.861  -5.521  0.653   1.00 0.00  ? 184 TYR B HB3  1  
ATOM   826   H HD1  . TYR B 2 45  ? -8.477  -5.769  1.409   1.00 0.00  ? 184 TYR B HD1  1  
ATOM   827   H HD2  . TYR B 2 45  ? -5.068  -7.720  -0.351  1.00 0.00  ? 184 TYR B HD2  1  
ATOM   828   H HE1  . TYR B 2 45  ? -9.981  -7.440  0.350   1.00 0.00  ? 184 TYR B HE1  1  
ATOM   829   H HE2  . TYR B 2 45  ? -6.571  -9.391  -1.410  1.00 0.00  ? 184 TYR B HE2  1  
ATOM   830   H HH   . TYR B 2 45  ? -8.775  -9.785  -1.977  1.00 0.00  ? 184 TYR B HH   1  
ATOM   831   N N    . CYS B 2 46  ? -3.308  -4.849  2.708   1.00 12.49 ? 185 CYS B N    1  
ATOM   832   C CA   . CYS B 2 46  ? -2.346  -3.871  3.290   1.00 13.07 ? 185 CYS B CA   1  
ATOM   833   C C    . CYS B 2 46  ? -1.575  -3.179  2.163   1.00 11.90 ? 185 CYS B C    1  
ATOM   834   O O    . CYS B 2 46  ? -0.800  -3.795  1.459   1.00 11.52 ? 185 CYS B O    1  
ATOM   835   C CB   . CYS B 2 46  ? -1.362  -4.605  4.205   1.00 13.05 ? 185 CYS B CB   1  
ATOM   836   S SG   . CYS B 2 46  ? -1.985  -4.579  5.904   1.00 27.90 ? 185 CYS B SG   1  
ATOM   837   H H    . CYS B 2 46  ? -3.082  -5.327  1.883   1.00 0.00  ? 185 CYS B H    1  
ATOM   838   H HA   . CYS B 2 46  ? -2.886  -3.132  3.862   1.00 0.00  ? 185 CYS B HA   1  
ATOM   839   H HB2  . CYS B 2 46  ? -1.258  -5.628  3.875   1.00 0.00  ? 185 CYS B HB2  1  
ATOM   840   H HB3  . CYS B 2 46  ? -0.401  -4.115  4.166   1.00 0.00  ? 185 CYS B HB3  1  
ATOM   841   H HG   . CYS B 2 46  ? -2.810  -4.089  5.911   1.00 0.00  ? 185 CYS B HG   1  
ATOM   842   N N    . LEU B 2 47  ? -1.783  -1.903  1.987   1.00 10.41 ? 186 LEU B N    1  
ATOM   843   C CA   . LEU B 2 47  ? -1.062  -1.172  0.907   1.00 10.82 ? 186 LEU B CA   1  
ATOM   844   C C    . LEU B 2 47  ? 0.149   -0.450  1.502   1.00 10.91 ? 186 LEU B C    1  
ATOM   845   O O    . LEU B 2 47  ? 0.017   0.559   2.166   1.00 11.30 ? 186 LEU B O    1  
ATOM   846   C CB   . LEU B 2 47  ? -2.003  -0.148  0.268   1.00 8.57  ? 186 LEU B CB   1  
ATOM   847   C CG   . LEU B 2 47  ? -1.222  0.722   -0.716  1.00 8.23  ? 186 LEU B CG   1  
ATOM   848   C CD1  . LEU B 2 47  ? -0.767  -0.130  -1.903  1.00 10.17 ? 186 LEU B CD1  1  
ATOM   849   C CD2  . LEU B 2 47  ? -2.121  1.854   -1.219  1.00 8.76  ? 186 LEU B CD2  1  
ATOM   850   H H    . LEU B 2 47  ? -2.412  -1.424  2.567   1.00 0.00  ? 186 LEU B H    1  
ATOM   851   H HA   . LEU B 2 47  ? -0.730  -1.874  0.156   1.00 0.00  ? 186 LEU B HA   1  
ATOM   852   H HB2  . LEU B 2 47  ? -2.794  -0.665  -0.256  1.00 0.00  ? 186 LEU B HB2  1  
ATOM   853   H HB3  . LEU B 2 47  ? -2.430  0.477   1.038   1.00 0.00  ? 186 LEU B HB3  1  
ATOM   854   H HG   . LEU B 2 47  ? -0.357  1.139   -0.221  1.00 0.00  ? 186 LEU B HG   1  
ATOM   855   H HD11 . LEU B 2 47  ? -0.153  -0.944  -1.546  1.00 0.00  ? 186 LEU B HD11 1  
ATOM   856   H HD12 . LEU B 2 47  ? -1.632  -0.528  -2.412  1.00 0.00  ? 186 LEU B HD12 1  
ATOM   857   H HD13 . LEU B 2 47  ? -0.195  0.480   -2.586  1.00 0.00  ? 186 LEU B HD13 1  
ATOM   858   H HD21 . LEU B 2 47  ? -2.492  2.420   -0.377  1.00 0.00  ? 186 LEU B HD21 1  
ATOM   859   H HD22 . LEU B 2 47  ? -1.554  2.504   -1.868  1.00 0.00  ? 186 LEU B HD22 1  
ATOM   860   H HD23 . LEU B 2 47  ? -2.954  1.436   -1.766  1.00 0.00  ? 186 LEU B HD23 1  
ATOM   861   N N    . SER B 2 48  ? 1.328   -0.958  1.269   1.00 10.50 ? 187 SER B N    1  
ATOM   862   C CA   . SER B 2 48  ? 2.545   -0.300  1.822   1.00 9.18  ? 187 SER B CA   1  
ATOM   863   C C    . SER B 2 48  ? 3.190   0.569   0.741   1.00 8.50  ? 187 SER B C    1  
ATOM   864   O O    . SER B 2 48  ? 3.013   0.342   -0.440  1.00 9.53  ? 187 SER B O    1  
ATOM   865   C CB   . SER B 2 48  ? 3.539   -1.367  2.279   1.00 7.49  ? 187 SER B CB   1  
ATOM   866   O OG   . SER B 2 48  ? 3.179   -1.818  3.579   1.00 5.18  ? 187 SER B OG   1  
ATOM   867   H H    . SER B 2 48  ? 1.413   -1.772  0.731   1.00 0.00  ? 187 SER B H    1  
ATOM   868   H HA   . SER B 2 48  ? 2.268   0.319   2.663   1.00 0.00  ? 187 SER B HA   1  
ATOM   869   H HB2  . SER B 2 48  ? 3.516   -2.200  1.596   1.00 0.00  ? 187 SER B HB2  1  
ATOM   870   H HB3  . SER B 2 48  ? 4.535   -0.945  2.297   1.00 0.00  ? 187 SER B HB3  1  
ATOM   871   H HG   . SER B 2 48  ? 3.857   -2.427  3.880   1.00 0.00  ? 187 SER B HG   1  
ATOM   872   N N    . VAL B 2 49  ? 3.938   1.563   1.133   1.00 11.78 ? 188 VAL B N    1  
ATOM   873   C CA   . VAL B 2 49  ? 4.594   2.445   0.126   1.00 12.79 ? 188 VAL B CA   1  
ATOM   874   C C    . VAL B 2 49  ? 6.032   2.732   0.560   1.00 14.65 ? 188 VAL B C    1  
ATOM   875   O O    . VAL B 2 49  ? 6.448   2.373   1.644   1.00 14.43 ? 188 VAL B O    1  
ATOM   876   C CB   . VAL B 2 49  ? 3.820   3.760   0.020   1.00 12.22 ? 188 VAL B CB   1  
ATOM   877   C CG1  . VAL B 2 49  ? 4.196   4.469   -1.282  1.00 11.34 ? 188 VAL B CG1  1  
ATOM   878   C CG2  . VAL B 2 49  ? 2.317   3.468   0.025   1.00 12.23 ? 188 VAL B CG2  1  
ATOM   879   H H    . VAL B 2 49  ? 4.069   1.730   2.090   1.00 0.00  ? 188 VAL B H    1  
ATOM   880   H HA   . VAL B 2 49  ? 4.599   1.951   -0.834  1.00 0.00  ? 188 VAL B HA   1  
ATOM   881   H HB   . VAL B 2 49  ? 4.069   4.393   0.859   1.00 0.00  ? 188 VAL B HB   1  
ATOM   882   H HG11 . VAL B 2 49  ? 4.476   3.736   -2.024  1.00 0.00  ? 188 VAL B HG11 1  
ATOM   883   H HG12 . VAL B 2 49  ? 3.349   5.037   -1.640  1.00 0.00  ? 188 VAL B HG12 1  
ATOM   884   H HG13 . VAL B 2 49  ? 5.026   5.136   -1.103  1.00 0.00  ? 188 VAL B HG13 1  
ATOM   885   H HG21 . VAL B 2 49  ? 2.116   2.606   -0.593  1.00 0.00  ? 188 VAL B HG21 1  
ATOM   886   H HG22 . VAL B 2 49  ? 1.993   3.270   1.036   1.00 0.00  ? 188 VAL B HG22 1  
ATOM   887   H HG23 . VAL B 2 49  ? 1.783   4.322   -0.364  1.00 0.00  ? 188 VAL B HG23 1  
ATOM   888   N N    . SER B 2 50  ? 6.796   3.378   -0.277  1.00 14.39 ? 189 SER B N    1  
ATOM   889   C CA   . SER B 2 50  ? 8.206   3.688   0.088   1.00 13.97 ? 189 SER B CA   1  
ATOM   890   C C    . SER B 2 50  ? 8.405   5.205   0.107   1.00 14.32 ? 189 SER B C    1  
ATOM   891   O O    . SER B 2 50  ? 7.738   5.936   -0.597  1.00 13.16 ? 189 SER B O    1  
ATOM   892   C CB   . SER B 2 50  ? 9.150   3.064   -0.940  1.00 12.52 ? 189 SER B CB   1  
ATOM   893   O OG   . SER B 2 50  ? 8.693   3.380   -2.248  1.00 13.11 ? 189 SER B OG   1  
ATOM   894   H H    . SER B 2 50  ? 6.442   3.659   -1.147  1.00 0.00  ? 189 SER B H    1  
ATOM   895   H HA   . SER B 2 50  ? 8.422   3.285   1.067   1.00 0.00  ? 189 SER B HA   1  
ATOM   896   H HB2  . SER B 2 50  ? 10.143  3.457   -0.807  1.00 0.00  ? 189 SER B HB2  1  
ATOM   897   H HB3  . SER B 2 50  ? 9.169   1.990   -0.804  1.00 0.00  ? 189 SER B HB3  1  
ATOM   898   H HG   . SER B 2 50  ? 8.314   2.585   -2.631  1.00 0.00  ? 189 SER B HG   1  
ATOM   899   N N    . ASP B 2 51  ? 9.319   5.683   0.906   1.00 17.22 ? 190 ASP B N    1  
ATOM   900   C CA   . ASP B 2 51  ? 9.559   7.151   0.968   1.00 20.71 ? 190 ASP B CA   1  
ATOM   901   C C    . ASP B 2 51  ? 11.048  7.413   1.200   1.00 19.82 ? 190 ASP B C    1  
ATOM   902   O O    . ASP B 2 51  ? 11.768  6.567   1.693   1.00 20.14 ? 190 ASP B O    1  
ATOM   903   C CB   . ASP B 2 51  ? 8.749   7.754   2.118   1.00 25.05 ? 190 ASP B CB   1  
ATOM   904   C CG   . ASP B 2 51  ? 8.599   9.261   1.901   1.00 26.93 ? 190 ASP B CG   1  
ATOM   905   O OD1  . ASP B 2 51  ? 8.008   9.640   0.904   1.00 31.13 ? 190 ASP B OD1  1  
ATOM   906   O OD2  . ASP B 2 51  ? 9.077   10.010  2.737   1.00 30.74 ? 190 ASP B OD2  1  
ATOM   907   H H    . ASP B 2 51  ? 9.846   5.075   1.466   1.00 0.00  ? 190 ASP B H    1  
ATOM   908   H HA   . ASP B 2 51  ? 9.255   7.605   0.036   1.00 0.00  ? 190 ASP B HA   1  
ATOM   909   H HB2  . ASP B 2 51  ? 7.772   7.295   2.149   1.00 0.00  ? 190 ASP B HB2  1  
ATOM   910   H HB3  . ASP B 2 51  ? 9.261   7.576   3.051   1.00 0.00  ? 190 ASP B HB3  1  
ATOM   911   N N    . PHE B 2 52  ? 11.517  8.579   0.847   1.00 21.67 ? 191 PHE B N    1  
ATOM   912   C CA   . PHE B 2 52  ? 12.960  8.891   1.048   1.00 24.27 ? 191 PHE B CA   1  
ATOM   913   C C    . PHE B 2 52  ? 13.096  10.222  1.789   1.00 28.02 ? 191 PHE B C    1  
ATOM   914   O O    . PHE B 2 52  ? 12.156  10.985  1.893   1.00 25.66 ? 191 PHE B O    1  
ATOM   915   C CB   . PHE B 2 52  ? 13.653  8.990   -0.313  1.00 23.13 ? 191 PHE B CB   1  
ATOM   916   C CG   . PHE B 2 52  ? 15.081  9.441   -0.121  1.00 21.13 ? 191 PHE B CG   1  
ATOM   917   C CD1  . PHE B 2 52  ? 16.080  8.501   0.181   1.00 18.20 ? 191 PHE B CD1  1  
ATOM   918   C CD2  . PHE B 2 52  ? 15.410  10.801  -0.246  1.00 20.50 ? 191 PHE B CD2  1  
ATOM   919   C CE1  . PHE B 2 52  ? 17.409  8.920   0.358   1.00 16.51 ? 191 PHE B CE1  1  
ATOM   920   C CE2  . PHE B 2 52  ? 16.740  11.221  -0.068  1.00 19.46 ? 191 PHE B CE2  1  
ATOM   921   C CZ   . PHE B 2 52  ? 17.739  10.281  0.234   1.00 17.79 ? 191 PHE B CZ   1  
ATOM   922   H H    . PHE B 2 52  ? 10.920  9.248   0.451   1.00 0.00  ? 191 PHE B H    1  
ATOM   923   H HA   . PHE B 2 52  ? 13.420  8.107   1.629   1.00 0.00  ? 191 PHE B HA   1  
ATOM   924   H HB2  . PHE B 2 52  ? 13.642  8.022   -0.793  1.00 0.00  ? 191 PHE B HB2  1  
ATOM   925   H HB3  . PHE B 2 52  ? 13.131  9.705   -0.932  1.00 0.00  ? 191 PHE B HB3  1  
ATOM   926   H HD1  . PHE B 2 52  ? 15.827  7.455   0.276   1.00 0.00  ? 191 PHE B HD1  1  
ATOM   927   H HD2  . PHE B 2 52  ? 14.642  11.524  -0.477  1.00 0.00  ? 191 PHE B HD2  1  
ATOM   928   H HE1  . PHE B 2 52  ? 18.177  8.198   0.590   1.00 0.00  ? 191 PHE B HE1  1  
ATOM   929   H HE2  . PHE B 2 52  ? 16.993  12.267  -0.164  1.00 0.00  ? 191 PHE B HE2  1  
ATOM   930   H HZ   . PHE B 2 52  ? 18.760  10.603  0.370   1.00 0.00  ? 191 PHE B HZ   1  
ATOM   931   N N    . ASP B 2 53  ? 14.260  10.508  2.306   1.00 32.66 ? 192 ASP B N    1  
ATOM   932   C CA   . ASP B 2 53  ? 14.454  11.790  3.040   1.00 38.82 ? 192 ASP B CA   1  
ATOM   933   C C    . ASP B 2 53  ? 15.948  12.029  3.266   1.00 41.14 ? 192 ASP B C    1  
ATOM   934   O O    . ASP B 2 53  ? 16.750  11.119  3.193   1.00 38.49 ? 192 ASP B O    1  
ATOM   935   C CB   . ASP B 2 53  ? 13.740  11.717  4.391   1.00 42.78 ? 192 ASP B CB   1  
ATOM   936   C CG   . ASP B 2 53  ? 12.667  12.805  4.461   1.00 45.03 ? 192 ASP B CG   1  
ATOM   937   O OD1  . ASP B 2 53  ? 12.233  13.250  3.411   1.00 46.40 ? 192 ASP B OD1  1  
ATOM   938   O OD2  . ASP B 2 53  ? 12.297  13.174  5.564   1.00 49.15 ? 192 ASP B OD2  1  
ATOM   939   H H    . ASP B 2 53  ? 15.006  9.879   2.211   1.00 0.00  ? 192 ASP B H    1  
ATOM   940   H HA   . ASP B 2 53  ? 14.043  12.603  2.460   1.00 0.00  ? 192 ASP B HA   1  
ATOM   941   H HB2  . ASP B 2 53  ? 13.278  10.746  4.502   1.00 0.00  ? 192 ASP B HB2  1  
ATOM   942   H HB3  . ASP B 2 53  ? 14.455  11.868  5.185   1.00 0.00  ? 192 ASP B HB3  1  
ATOM   943   N N    . ASN B 2 54  ? 16.328  13.247  3.538   1.00 45.91 ? 193 ASN B N    1  
ATOM   944   C CA   . ASN B 2 54  ? 17.768  13.546  3.766   1.00 50.53 ? 193 ASN B CA   1  
ATOM   945   C C    . ASN B 2 54  ? 18.099  13.377  5.251   1.00 51.37 ? 193 ASN B C    1  
ATOM   946   O O    . ASN B 2 54  ? 19.083  13.895  5.740   1.00 52.38 ? 193 ASN B O    1  
ATOM   947   C CB   . ASN B 2 54  ? 18.064  14.985  3.339   1.00 54.84 ? 193 ASN B CB   1  
ATOM   948   C CG   . ASN B 2 54  ? 19.522  15.096  2.893   1.00 60.46 ? 193 ASN B CG   1  
ATOM   949   O OD1  . ASN B 2 54  ? 20.335  14.252  3.216   1.00 63.78 ? 193 ASN B OD1  1  
ATOM   950   N ND2  . ASN B 2 54  ? 19.892  16.109  2.157   1.00 62.09 ? 193 ASN B ND2  1  
ATOM   951   H H    . ASN B 2 54  ? 15.667  13.966  3.590   1.00 0.00  ? 193 ASN B H    1  
ATOM   952   H HA   . ASN B 2 54  ? 18.370  12.868  3.183   1.00 0.00  ? 193 ASN B HA   1  
ATOM   953   H HB2  . ASN B 2 54  ? 17.413  15.258  2.520   1.00 0.00  ? 193 ASN B HB2  1  
ATOM   954   H HB3  . ASN B 2 54  ? 17.893  15.650  4.172   1.00 0.00  ? 193 ASN B HB3  1  
ATOM   955   H HD21 . ASN B 2 54  ? 19.233  16.792  1.896   1.00 0.00  ? 193 ASN B HD21 1  
ATOM   956   H HD22 . ASN B 2 54  ? 20.828  16.188  1.865   1.00 0.00  ? 193 ASN B HD22 1  
ATOM   957   N N    . ALA B 2 55  ? 17.286  12.656  5.973   1.00 51.03 ? 194 ALA B N    1  
ATOM   958   C CA   . ALA B 2 55  ? 17.557  12.457  7.424   1.00 49.87 ? 194 ALA B CA   1  
ATOM   959   C C    . ALA B 2 55  ? 18.479  11.251  7.612   1.00 48.78 ? 194 ALA B C    1  
ATOM   960   O O    . ALA B 2 55  ? 19.467  11.316  8.316   1.00 50.16 ? 194 ALA B O    1  
ATOM   961   C CB   . ALA B 2 55  ? 16.238  12.210  8.160   1.00 50.70 ? 194 ALA B CB   1  
ATOM   962   H H    . ALA B 2 55  ? 16.497  12.246  5.561   1.00 0.00  ? 194 ALA B H    1  
ATOM   963   H HA   . ALA B 2 55  ? 18.033  13.339  7.826   1.00 0.00  ? 194 ALA B HA   1  
ATOM   964   H HB1  . ALA B 2 55  ? 15.502  11.836  7.464   1.00 0.00  ? 194 ALA B HB1  1  
ATOM   965   H HB2  . ALA B 2 55  ? 16.394  11.483  8.944   1.00 0.00  ? 194 ALA B HB2  1  
ATOM   966   H HB3  . ALA B 2 55  ? 15.888  13.136  8.592   1.00 0.00  ? 194 ALA B HB3  1  
ATOM   967   N N    . LYS B 2 56  ? 18.165  10.148  6.988   1.00 45.35 ? 195 LYS B N    1  
ATOM   968   C CA   . LYS B 2 56  ? 19.026  8.941   7.134   1.00 41.76 ? 195 LYS B CA   1  
ATOM   969   C C    . LYS B 2 56  ? 19.029  8.150   5.824   1.00 38.59 ? 195 LYS B C    1  
ATOM   970   O O    . LYS B 2 56  ? 20.047  7.645   5.395   1.00 39.85 ? 195 LYS B O    1  
ATOM   971   C CB   . LYS B 2 56  ? 18.480  8.059   8.258   1.00 42.95 ? 195 LYS B CB   1  
ATOM   972   C CG   . LYS B 2 56  ? 18.940  8.611   9.609   1.00 45.27 ? 195 LYS B CG   1  
ATOM   973   C CD   . LYS B 2 56  ? 20.372  8.152   9.888   1.00 47.56 ? 195 LYS B CD   1  
ATOM   974   C CE   . LYS B 2 56  ? 20.757  8.521   11.321  1.00 50.16 ? 195 LYS B CE   1  
ATOM   975   N NZ   . LYS B 2 56  ? 20.259  7.472   12.255  1.00 50.69 ? 195 LYS B NZ   1  
ATOM   976   H H    . LYS B 2 56  ? 17.364  10.114  6.424   1.00 0.00  ? 195 LYS B H    1  
ATOM   977   H HA   . LYS B 2 56  ? 20.034  9.245   7.373   1.00 0.00  ? 195 LYS B HA   1  
ATOM   978   H HB2  . LYS B 2 56  ? 17.401  8.053   8.218   1.00 0.00  ? 195 LYS B HB2  1  
ATOM   979   H HB3  . LYS B 2 56  ? 18.851  7.052   8.138   1.00 0.00  ? 195 LYS B HB3  1  
ATOM   980   H HG2  . LYS B 2 56  ? 18.904  9.691   9.587   1.00 0.00  ? 195 LYS B HG2  1  
ATOM   981   H HG3  . LYS B 2 56  ? 18.288  8.244   10.388  1.00 0.00  ? 195 LYS B HG3  1  
ATOM   982   H HD2  . LYS B 2 56  ? 20.437  7.080   9.761   1.00 0.00  ? 195 LYS B HD2  1  
ATOM   983   H HD3  . LYS B 2 56  ? 21.047  8.638   9.200   1.00 0.00  ? 195 LYS B HD3  1  
ATOM   984   H HE2  . LYS B 2 56  ? 21.832  8.592   11.399  1.00 0.00  ? 195 LYS B HE2  1  
ATOM   985   H HE3  . LYS B 2 56  ? 20.314  9.472   11.579  1.00 0.00  ? 195 LYS B HE3  1  
ATOM   986   H HZ1  . LYS B 2 56  ? 19.689  6.781   11.728  1.00 0.00  ? 195 LYS B HZ1  1  
ATOM   987   H HZ2  . LYS B 2 56  ? 21.068  6.990   12.698  1.00 0.00  ? 195 LYS B HZ2  1  
ATOM   988   H HZ3  . LYS B 2 56  ? 19.672  7.913   12.991  1.00 0.00  ? 195 LYS B HZ3  1  
ATOM   989   N N    . GLY B 2 57  ? 17.897  8.035   5.185   1.00 34.40 ? 196 GLY B N    1  
ATOM   990   C CA   . GLY B 2 57  ? 17.839  7.273   3.906   1.00 29.38 ? 196 GLY B CA   1  
ATOM   991   C C    . GLY B 2 57  ? 16.387  7.146   3.447   1.00 25.82 ? 196 GLY B C    1  
ATOM   992   O O    . GLY B 2 57  ? 15.694  8.127   3.263   1.00 25.14 ? 196 GLY B O    1  
ATOM   993   H H    . GLY B 2 57  ? 17.085  8.448   5.547   1.00 0.00  ? 196 GLY B H    1  
ATOM   994   H HA2  . GLY B 2 57  ? 18.411  7.791   3.151   1.00 0.00  ? 196 GLY B HA2  1  
ATOM   995   H HA3  . GLY B 2 57  ? 18.251  6.287   4.056   1.00 0.00  ? 196 GLY B HA3  1  
ATOM   996   N N    . LEU B 2 58  ? 15.923  5.943   3.265   1.00 25.09 ? 197 LEU B N    1  
ATOM   997   C CA   . LEU B 2 58  ? 14.514  5.744   2.821   1.00 24.92 ? 197 LEU B CA   1  
ATOM   998   C C    . LEU B 2 58  ? 13.799  4.799   3.788   1.00 23.75 ? 197 LEU B C    1  
ATOM   999   O O    . LEU B 2 58  ? 14.320  3.767   4.163   1.00 23.93 ? 197 LEU B O    1  
ATOM   1000  C CB   . LEU B 2 58  ? 14.488  5.150   1.410   1.00 25.84 ? 197 LEU B CB   1  
ATOM   1001  C CG   . LEU B 2 58  ? 15.368  3.900   1.349   1.00 30.07 ? 197 LEU B CG   1  
ATOM   1002  C CD1  . LEU B 2 58  ? 14.543  2.671   1.734   1.00 29.71 ? 197 LEU B CD1  1  
ATOM   1003  C CD2  . LEU B 2 58  ? 15.899  3.731   -0.074  1.00 30.59 ? 197 LEU B CD2  1  
ATOM   1004  H H    . LEU B 2 58  ? 16.503  5.171   3.425   1.00 0.00  ? 197 LEU B H    1  
ATOM   1005  H HA   . LEU B 2 58  ? 14.007  6.697   2.813   1.00 0.00  ? 197 LEU B HA   1  
ATOM   1006  H HB2  . LEU B 2 58  ? 13.473  4.885   1.152   1.00 0.00  ? 197 LEU B HB2  1  
ATOM   1007  H HB3  . LEU B 2 58  ? 14.857  5.881   0.706   1.00 0.00  ? 197 LEU B HB3  1  
ATOM   1008  H HG   . LEU B 2 58  ? 16.196  4.006   2.032   1.00 0.00  ? 197 LEU B HG   1  
ATOM   1009  H HD11 . LEU B 2 58  ? 13.564  2.984   2.064   1.00 0.00  ? 197 LEU B HD11 1  
ATOM   1010  H HD12 . LEU B 2 58  ? 14.444  2.022   0.876   1.00 0.00  ? 197 LEU B HD12 1  
ATOM   1011  H HD13 . LEU B 2 58  ? 15.040  2.140   2.532   1.00 0.00  ? 197 LEU B HD13 1  
ATOM   1012  H HD21 . LEU B 2 58  ? 16.028  4.703   -0.527  1.00 0.00  ? 197 LEU B HD21 1  
ATOM   1013  H HD22 . LEU B 2 58  ? 16.848  3.218   -0.045  1.00 0.00  ? 197 LEU B HD22 1  
ATOM   1014  H HD23 . LEU B 2 58  ? 15.194  3.155   -0.654  1.00 0.00  ? 197 LEU B HD23 1  
ATOM   1015  N N    . ASN B 2 59  ? 12.608  5.144   4.194   1.00 21.78 ? 198 ASN B N    1  
ATOM   1016  C CA   . ASN B 2 59  ? 11.857  4.268   5.137   1.00 19.17 ? 198 ASN B CA   1  
ATOM   1017  C C    . ASN B 2 59  ? 10.636  3.683   4.423   1.00 16.90 ? 198 ASN B C    1  
ATOM   1018  O O    . ASN B 2 59  ? 10.499  3.791   3.221   1.00 15.60 ? 198 ASN B O    1  
ATOM   1019  C CB   . ASN B 2 59  ? 11.397  5.091   6.343   1.00 18.45 ? 198 ASN B CB   1  
ATOM   1020  C CG   . ASN B 2 59  ? 12.573  5.905   6.886   1.00 20.04 ? 198 ASN B CG   1  
ATOM   1021  O OD1  . ASN B 2 59  ? 13.073  5.630   7.958   1.00 23.65 ? 198 ASN B OD1  1  
ATOM   1022  N ND2  . ASN B 2 59  ? 13.038  6.904   6.187   1.00 21.55 ? 198 ASN B ND2  1  
ATOM   1023  H H    . ASN B 2 59  ? 12.207  5.980   3.878   1.00 0.00  ? 198 ASN B H    1  
ATOM   1024  H HA   . ASN B 2 59  ? 12.498  3.466   5.472   1.00 0.00  ? 198 ASN B HA   1  
ATOM   1025  H HB2  . ASN B 2 59  ? 10.604  5.760   6.040   1.00 0.00  ? 198 ASN B HB2  1  
ATOM   1026  H HB3  . ASN B 2 59  ? 11.034  4.429   7.114   1.00 0.00  ? 198 ASN B HB3  1  
ATOM   1027  H HD21 . ASN B 2 59  ? 12.632  7.128   5.319   1.00 0.00  ? 198 ASN B HD21 1  
ATOM   1028  H HD22 . ASN B 2 59  ? 13.795  7.432   6.529   1.00 0.00  ? 198 ASN B HD22 1  
ATOM   1029  N N    . VAL B 2 60  ? 9.748   3.064   5.153   1.00 14.62 ? 199 VAL B N    1  
ATOM   1030  C CA   . VAL B 2 60  ? 8.540   2.475   4.509   1.00 11.82 ? 199 VAL B CA   1  
ATOM   1031  C C    . VAL B 2 60  ? 7.295   2.845   5.315   1.00 10.68 ? 199 VAL B C    1  
ATOM   1032  O O    . VAL B 2 60  ? 7.260   2.704   6.522   1.00 13.24 ? 199 VAL B O    1  
ATOM   1033  C CB   . VAL B 2 60  ? 8.675   0.953   4.461   1.00 9.61  ? 199 VAL B CB   1  
ATOM   1034  C CG1  . VAL B 2 60  ? 7.475   0.358   3.725   1.00 11.94 ? 199 VAL B CG1  1  
ATOM   1035  C CG2  . VAL B 2 60  ? 9.960   0.580   3.722   1.00 10.00 ? 199 VAL B CG2  1  
ATOM   1036  H H    . VAL B 2 60  ? 9.875   2.987   6.121   1.00 0.00  ? 199 VAL B H    1  
ATOM   1037  H HA   . VAL B 2 60  ? 8.446   2.859   3.504   1.00 0.00  ? 199 VAL B HA   1  
ATOM   1038  H HB   . VAL B 2 60  ? 8.710   0.563   5.468   1.00 0.00  ? 199 VAL B HB   1  
ATOM   1039  H HG11 . VAL B 2 60  ? 6.566   0.807   4.096   1.00 0.00  ? 199 VAL B HG11 1  
ATOM   1040  H HG12 . VAL B 2 60  ? 7.567   0.555   2.667   1.00 0.00  ? 199 VAL B HG12 1  
ATOM   1041  H HG13 . VAL B 2 60  ? 7.444   -0.709  3.891   1.00 0.00  ? 199 VAL B HG13 1  
ATOM   1042  H HG21 . VAL B 2 60  ? 10.662  1.397   3.789   1.00 0.00  ? 199 VAL B HG21 1  
ATOM   1043  H HG22 . VAL B 2 60  ? 10.389  -0.302  4.171   1.00 0.00  ? 199 VAL B HG22 1  
ATOM   1044  H HG23 . VAL B 2 60  ? 9.734   0.383   2.684   1.00 0.00  ? 199 VAL B HG23 1  
ATOM   1045  N N    . LYS B 2 61  ? 6.269   3.312   4.658   1.00 11.30 ? 200 LYS B N    1  
ATOM   1046  C CA   . LYS B 2 61  ? 5.025   3.682   5.386   1.00 11.14 ? 200 LYS B CA   1  
ATOM   1047  C C    . LYS B 2 61  ? 3.946   2.635   5.102   1.00 8.78  ? 200 LYS B C    1  
ATOM   1048  O O    . LYS B 2 61  ? 3.466   2.509   3.993   1.00 9.63  ? 200 LYS B O    1  
ATOM   1049  C CB   . LYS B 2 61  ? 4.543   5.055   4.914   1.00 11.27 ? 200 LYS B CB   1  
ATOM   1050  C CG   . LYS B 2 61  ? 5.238   6.146   5.731   1.00 16.97 ? 200 LYS B CG   1  
ATOM   1051  C CD   . LYS B 2 61  ? 4.688   7.515   5.327   1.00 21.04 ? 200 LYS B CD   1  
ATOM   1052  C CE   . LYS B 2 61  ? 5.599   8.614   5.877   1.00 28.12 ? 200 LYS B CE   1  
ATOM   1053  N NZ   . LYS B 2 61  ? 5.554   8.597   7.366   1.00 32.40 ? 200 LYS B NZ   1  
ATOM   1054  H H    . LYS B 2 61  ? 6.316   3.413   3.684   1.00 0.00  ? 200 LYS B H    1  
ATOM   1055  H HA   . LYS B 2 61  ? 5.224   3.715   6.447   1.00 0.00  ? 200 LYS B HA   1  
ATOM   1056  H HB2  . LYS B 2 61  ? 4.782   5.180   3.867   1.00 0.00  ? 200 LYS B HB2  1  
ATOM   1057  H HB3  . LYS B 2 61  ? 3.476   5.129   5.053   1.00 0.00  ? 200 LYS B HB3  1  
ATOM   1058  H HG2  . LYS B 2 61  ? 5.054   5.980   6.783   1.00 0.00  ? 200 LYS B HG2  1  
ATOM   1059  H HG3  . LYS B 2 61  ? 6.300   6.117   5.542   1.00 0.00  ? 200 LYS B HG3  1  
ATOM   1060  H HD2  . LYS B 2 61  ? 4.650   7.583   4.250   1.00 0.00  ? 200 LYS B HD2  1  
ATOM   1061  H HD3  . LYS B 2 61  ? 3.694   7.638   5.732   1.00 0.00  ? 200 LYS B HD3  1  
ATOM   1062  H HE2  . LYS B 2 61  ? 6.612   8.441   5.545   1.00 0.00  ? 200 LYS B HE2  1  
ATOM   1063  H HE3  . LYS B 2 61  ? 5.262   9.575   5.517   1.00 0.00  ? 200 LYS B HE3  1  
ATOM   1064  H HZ1  . LYS B 2 61  ? 5.440   7.619   7.699   1.00 0.00  ? 200 LYS B HZ1  1  
ATOM   1065  H HZ2  . LYS B 2 61  ? 6.440   8.991   7.744   1.00 0.00  ? 200 LYS B HZ2  1  
ATOM   1066  H HZ3  . LYS B 2 61  ? 4.751   9.169   7.696   1.00 0.00  ? 200 LYS B HZ3  1  
ATOM   1067  N N    . HIS B 2 62  ? 3.566   1.880   6.095   1.00 7.82  ? 201 HIS B N    1  
ATOM   1068  C CA   . HIS B 2 62  ? 2.524   0.837   5.881   1.00 7.41  ? 201 HIS B CA   1  
ATOM   1069  C C    . HIS B 2 62  ? 1.134   1.464   6.000   1.00 9.79  ? 201 HIS B C    1  
ATOM   1070  O O    . HIS B 2 62  ? 0.805   2.086   6.990   1.00 10.36 ? 201 HIS B O    1  
ATOM   1071  C CB   . HIS B 2 62  ? 2.678   -0.260  6.936   1.00 6.15  ? 201 HIS B CB   1  
ATOM   1072  C CG   . HIS B 2 62  ? 3.921   -1.058  6.655   1.00 5.80  ? 201 HIS B CG   1  
ATOM   1073  N ND1  . HIS B 2 62  ? 3.875   -2.396  6.298   1.00 7.97  ? 201 HIS B ND1  1  
ATOM   1074  C CD2  . HIS B 2 62  ? 5.252   -0.721  6.676   1.00 7.69  ? 201 HIS B CD2  1  
ATOM   1075  C CE1  . HIS B 2 62  ? 5.142   -2.812  6.121   1.00 7.75  ? 201 HIS B CE1  1  
ATOM   1076  N NE2  . HIS B 2 62  ? 6.021   -1.830  6.339   1.00 6.51  ? 201 HIS B NE2  1  
ATOM   1077  H H    . HIS B 2 62  ? 3.968   1.996   6.980   1.00 0.00  ? 201 HIS B H    1  
ATOM   1078  H HA   . HIS B 2 62  ? 2.642   0.407   4.897   1.00 0.00  ? 201 HIS B HA   1  
ATOM   1079  H HB2  . HIS B 2 62  ? 2.752   0.191   7.915   1.00 0.00  ? 201 HIS B HB2  1  
ATOM   1080  H HB3  . HIS B 2 62  ? 1.818   -0.913  6.904   1.00 0.00  ? 201 HIS B HB3  1  
ATOM   1081  H HD1  . HIS B 2 62  ? 3.067   -2.940  6.194   1.00 0.00  ? 201 HIS B HD1  1  
ATOM   1082  H HD2  . HIS B 2 62  ? 5.643   0.256   6.918   1.00 0.00  ? 201 HIS B HD2  1  
ATOM   1083  H HE1  . HIS B 2 62  ? 5.415   -3.818  5.837   1.00 0.00  ? 201 HIS B HE1  1  
ATOM   1084  N N    . TYR B 2 63  ? 0.313   1.301   4.999   1.00 10.61 ? 202 TYR B N    1  
ATOM   1085  C CA   . TYR B 2 63  ? -1.057  1.882   5.055   1.00 10.61 ? 202 TYR B CA   1  
ATOM   1086  C C    . TYR B 2 63  ? -2.085  0.751   5.033   1.00 10.67 ? 202 TYR B C    1  
ATOM   1087  O O    . TYR B 2 63  ? -2.583  0.371   3.992   1.00 11.97 ? 202 TYR B O    1  
ATOM   1088  C CB   . TYR B 2 63  ? -1.276  2.793   3.848   1.00 10.02 ? 202 TYR B CB   1  
ATOM   1089  C CG   . TYR B 2 63  ? -0.794  4.186   4.175   1.00 10.20 ? 202 TYR B CG   1  
ATOM   1090  C CD1  . TYR B 2 63  ? -1.668  5.108   4.776   1.00 10.92 ? 202 TYR B CD1  1  
ATOM   1091  C CD2  . TYR B 2 63  ? 0.527   4.560   3.880   1.00 9.08  ? 202 TYR B CD2  1  
ATOM   1092  C CE1  . TYR B 2 63  ? -1.220  6.405   5.081   1.00 11.72 ? 202 TYR B CE1  1  
ATOM   1093  C CE2  . TYR B 2 63  ? 0.976   5.856   4.185   1.00 11.32 ? 202 TYR B CE2  1  
ATOM   1094  C CZ   . TYR B 2 63  ? 0.102   6.778   4.785   1.00 12.88 ? 202 TYR B CZ   1  
ATOM   1095  O OH   . TYR B 2 63  ? 0.542   8.051   5.085   1.00 13.22 ? 202 TYR B OH   1  
ATOM   1096  H H    . TYR B 2 63  ? 0.597   0.792   4.211   1.00 0.00  ? 202 TYR B H    1  
ATOM   1097  H HA   . TYR B 2 63  ? -1.169  2.453   5.965   1.00 0.00  ? 202 TYR B HA   1  
ATOM   1098  H HB2  . TYR B 2 63  ? -0.724  2.409   3.002   1.00 0.00  ? 202 TYR B HB2  1  
ATOM   1099  H HB3  . TYR B 2 63  ? -2.328  2.823   3.608   1.00 0.00  ? 202 TYR B HB3  1  
ATOM   1100  H HD1  . TYR B 2 63  ? -2.684  4.821   5.003   1.00 0.00  ? 202 TYR B HD1  1  
ATOM   1101  H HD2  . TYR B 2 63  ? 1.199   3.851   3.418   1.00 0.00  ? 202 TYR B HD2  1  
ATOM   1102  H HE1  . TYR B 2 63  ? -1.891  7.113   5.543   1.00 0.00  ? 202 TYR B HE1  1  
ATOM   1103  H HE2  . TYR B 2 63  ? 1.991   6.144   3.958   1.00 0.00  ? 202 TYR B HE2  1  
ATOM   1104  H HH   . TYR B 2 63  ? 0.231   8.643   4.396   1.00 0.00  ? 202 TYR B HH   1  
ATOM   1105  N N    . LYS B 2 64  ? -2.405  0.207   6.174   1.00 11.16 ? 203 LYS B N    1  
ATOM   1106  C CA   . LYS B 2 64  ? -3.398  -0.902  6.218   1.00 13.85 ? 203 LYS B CA   1  
ATOM   1107  C C    . LYS B 2 64  ? -4.629  -0.522  5.394   1.00 13.44 ? 203 LYS B C    1  
ATOM   1108  O O    . LYS B 2 64  ? -5.170  0.558   5.530   1.00 12.80 ? 203 LYS B O    1  
ATOM   1109  C CB   . LYS B 2 64  ? -3.816  -1.156  7.668   1.00 19.04 ? 203 LYS B CB   1  
ATOM   1110  C CG   . LYS B 2 64  ? -4.194  0.169   8.332   1.00 23.92 ? 203 LYS B CG   1  
ATOM   1111  C CD   . LYS B 2 64  ? -5.165  -0.095  9.485   1.00 29.39 ? 203 LYS B CD   1  
ATOM   1112  C CE   . LYS B 2 64  ? -4.533  0.364   10.801  1.00 31.37 ? 203 LYS B CE   1  
ATOM   1113  N NZ   . LYS B 2 64  ? -5.107  1.682   11.194  1.00 36.57 ? 203 LYS B NZ   1  
ATOM   1114  H H    . LYS B 2 64  ? -1.990  0.526   7.002   1.00 0.00  ? 203 LYS B H    1  
ATOM   1115  H HA   . LYS B 2 64  ? -2.955  -1.798  5.809   1.00 0.00  ? 203 LYS B HA   1  
ATOM   1116  H HB2  . LYS B 2 64  ? -4.666  -1.823  7.685   1.00 0.00  ? 203 LYS B HB2  1  
ATOM   1117  H HB3  . LYS B 2 64  ? -2.995  -1.606  8.206   1.00 0.00  ? 203 LYS B HB3  1  
ATOM   1118  H HG2  . LYS B 2 64  ? -3.303  0.647   8.713   1.00 0.00  ? 203 LYS B HG2  1  
ATOM   1119  H HG3  . LYS B 2 64  ? -4.666  0.814   7.607   1.00 0.00  ? 203 LYS B HG3  1  
ATOM   1120  H HD2  . LYS B 2 64  ? -6.082  0.451   9.315   1.00 0.00  ? 203 LYS B HD2  1  
ATOM   1121  H HD3  . LYS B 2 64  ? -5.379  -1.151  9.540   1.00 0.00  ? 203 LYS B HD3  1  
ATOM   1122  H HE2  . LYS B 2 64  ? -4.740  -0.363  11.572  1.00 0.00  ? 203 LYS B HE2  1  
ATOM   1123  H HE3  . LYS B 2 64  ? -3.465  0.460   10.673  1.00 0.00  ? 203 LYS B HE3  1  
ATOM   1124  H HZ1  . LYS B 2 64  ? -6.145  1.629   11.172  1.00 0.00  ? 203 LYS B HZ1  1  
ATOM   1125  H HZ2  . LYS B 2 64  ? -4.792  1.924   12.156  1.00 0.00  ? 203 LYS B HZ2  1  
ATOM   1126  H HZ3  . LYS B 2 64  ? -4.786  2.413   10.529  1.00 0.00  ? 203 LYS B HZ3  1  
ATOM   1127  N N    . ILE B 2 65  ? -5.080  -1.404  4.544   1.00 14.05 ? 204 ILE B N    1  
ATOM   1128  C CA   . ILE B 2 65  ? -6.280  -1.097  3.718   1.00 13.51 ? 204 ILE B CA   1  
ATOM   1129  C C    . ILE B 2 65  ? -7.529  -1.546  4.478   1.00 14.04 ? 204 ILE B C    1  
ATOM   1130  O O    . ILE B 2 65  ? -7.690  -2.707  4.798   1.00 15.82 ? 204 ILE B O    1  
ATOM   1131  C CB   . ILE B 2 65  ? -6.187  -1.842  2.384   1.00 12.30 ? 204 ILE B CB   1  
ATOM   1132  C CG1  . ILE B 2 65  ? -5.100  -1.199  1.520   1.00 11.29 ? 204 ILE B CG1  1  
ATOM   1133  C CG2  . ILE B 2 65  ? -7.528  -1.761  1.651   1.00 14.21 ? 204 ILE B CG2  1  
ATOM   1134  C CD1  . ILE B 2 65  ? -4.773  -2.121  0.344   1.00 13.89 ? 204 ILE B CD1  1  
ATOM   1135  H H    . ILE B 2 65  ? -4.631  -2.271  4.454   1.00 0.00  ? 204 ILE B H    1  
ATOM   1136  H HA   . ILE B 2 65  ? -6.332  -0.033  3.536   1.00 0.00  ? 204 ILE B HA   1  
ATOM   1137  H HB   . ILE B 2 65  ? -5.938  -2.877  2.567   1.00 0.00  ? 204 ILE B HB   1  
ATOM   1138  H HG12 . ILE B 2 65  ? -5.452  -0.248  1.147   1.00 0.00  ? 204 ILE B HG12 1  
ATOM   1139  H HG13 . ILE B 2 65  ? -4.212  -1.047  2.114   1.00 0.00  ? 204 ILE B HG13 1  
ATOM   1140  H HG21 . ILE B 2 65  ? -8.176  -1.064  2.162   1.00 0.00  ? 204 ILE B HG21 1  
ATOM   1141  H HG22 . ILE B 2 65  ? -7.365  -1.425  0.638   1.00 0.00  ? 204 ILE B HG22 1  
ATOM   1142  H HG23 . ILE B 2 65  ? -7.990  -2.737  1.637   1.00 0.00  ? 204 ILE B HG23 1  
ATOM   1143  H HD11 . ILE B 2 65  ? -5.232  -3.086  0.505   1.00 0.00  ? 204 ILE B HD11 1  
ATOM   1144  H HD12 . ILE B 2 65  ? -5.154  -1.689  -0.569  1.00 0.00  ? 204 ILE B HD12 1  
ATOM   1145  H HD13 . ILE B 2 65  ? -3.702  -2.241  0.267   1.00 0.00  ? 204 ILE B HD13 1  
ATOM   1146  N N    . ARG B 2 66  ? -8.407  -0.632  4.781   1.00 15.56 ? 205 ARG B N    1  
ATOM   1147  C CA   . ARG B 2 66  ? -9.638  -0.999  5.534   1.00 13.76 ? 205 ARG B CA   1  
ATOM   1148  C C    . ARG B 2 66  ? -10.567 -1.829  4.652   1.00 13.72 ? 205 ARG B C    1  
ATOM   1149  O O    . ARG B 2 66  ? -10.373 -1.949  3.458   1.00 13.25 ? 205 ARG B O    1  
ATOM   1150  C CB   . ARG B 2 66  ? -10.356 0.273   5.977   1.00 15.23 ? 205 ARG B CB   1  
ATOM   1151  C CG   . ARG B 2 66  ? -9.342  1.215   6.619   1.00 20.69 ? 205 ARG B CG   1  
ATOM   1152  C CD   . ARG B 2 66  ? -10.061 2.177   7.566   1.00 28.70 ? 205 ARG B CD   1  
ATOM   1153  N NE   . ARG B 2 66  ? -9.547  1.986   8.951   1.00 38.45 ? 205 ARG B NE   1  
ATOM   1154  C CZ   . ARG B 2 66  ? -10.119 1.125   9.748   1.00 41.91 ? 205 ARG B CZ   1  
ATOM   1155  N NH1  . ARG B 2 66  ? -11.161 1.479   10.449  1.00 44.96 ? 205 ARG B NH1  1  
ATOM   1156  N NH2  . ARG B 2 66  ? -9.649  -0.089  9.842   1.00 41.78 ? 205 ARG B NH2  1  
ATOM   1157  H H    . ARG B 2 66  ? -8.252  0.300   4.522   1.00 0.00  ? 205 ARG B H    1  
ATOM   1158  H HA   . ARG B 2 66  ? -9.364  -1.576  6.405   1.00 0.00  ? 205 ARG B HA   1  
ATOM   1159  H HB2  . ARG B 2 66  ? -10.806 0.752   5.119   1.00 0.00  ? 205 ARG B HB2  1  
ATOM   1160  H HB3  . ARG B 2 66  ? -11.122 0.024   6.697   1.00 0.00  ? 205 ARG B HB3  1  
ATOM   1161  H HG2  . ARG B 2 66  ? -8.618  0.635   7.173   1.00 0.00  ? 205 ARG B HG2  1  
ATOM   1162  H HG3  . ARG B 2 66  ? -8.840  1.778   5.848   1.00 0.00  ? 205 ARG B HG3  1  
ATOM   1163  H HD2  . ARG B 2 66  ? -9.881  3.194   7.252   1.00 0.00  ? 205 ARG B HD2  1  
ATOM   1164  H HD3  . ARG B 2 66  ? -11.122 1.977   7.546   1.00 0.00  ? 205 ARG B HD3  1  
ATOM   1165  H HE   . ARG B 2 66  ? -8.778  2.508   9.265   1.00 0.00  ? 205 ARG B HE   1  
ATOM   1166  H HH11 . ARG B 2 66  ? -11.521 2.409   10.376  1.00 0.00  ? 205 ARG B HH11 1  
ATOM   1167  H HH12 . ARG B 2 66  ? -11.600 0.819   11.059  1.00 0.00  ? 205 ARG B HH12 1  
ATOM   1168  H HH21 . ARG B 2 66  ? -8.851  -0.359  9.305   1.00 0.00  ? 205 ARG B HH21 1  
ATOM   1169  H HH22 . ARG B 2 66  ? -10.089 -0.748  10.452  1.00 0.00  ? 205 ARG B HH22 1  
ATOM   1170  N N    . LYS B 2 67  ? -11.578 -2.401  5.241   1.00 14.89 ? 206 LYS B N    1  
ATOM   1171  C CA   . LYS B 2 67  ? -12.535 -3.232  4.455   1.00 18.13 ? 206 LYS B CA   1  
ATOM   1172  C C    . LYS B 2 67  ? -13.962 -2.962  4.936   1.00 17.74 ? 206 LYS B C    1  
ATOM   1173  O O    . LYS B 2 67  ? -14.300 -3.209  6.077   1.00 18.39 ? 206 LYS B O    1  
ATOM   1174  C CB   . LYS B 2 67  ? -12.203 -4.714  4.652   1.00 21.97 ? 206 LYS B CB   1  
ATOM   1175  C CG   . LYS B 2 67  ? -13.298 -5.572  4.015   1.00 27.97 ? 206 LYS B CG   1  
ATOM   1176  C CD   . LYS B 2 67  ? -12.658 -6.721  3.232   1.00 32.27 ? 206 LYS B CD   1  
ATOM   1177  C CE   . LYS B 2 67  ? -13.090 -8.056  3.842   1.00 33.99 ? 206 LYS B CE   1  
ATOM   1178  N NZ   . LYS B 2 67  ? -11.898 -8.934  4.008   1.00 35.74 ? 206 LYS B NZ   1  
ATOM   1179  H H    . LYS B 2 67  ? -11.707 -2.283  6.205   1.00 0.00  ? 206 LYS B H    1  
ATOM   1180  H HA   . LYS B 2 67  ? -12.454 -2.983  3.409   1.00 0.00  ? 206 LYS B HA   1  
ATOM   1181  H HB2  . LYS B 2 67  ? -11.254 -4.935  4.185   1.00 0.00  ? 206 LYS B HB2  1  
ATOM   1182  H HB3  . LYS B 2 67  ? -12.145 -4.933  5.707   1.00 0.00  ? 206 LYS B HB3  1  
ATOM   1183  H HG2  . LYS B 2 67  ? -13.936 -5.974  4.789   1.00 0.00  ? 206 LYS B HG2  1  
ATOM   1184  H HG3  . LYS B 2 67  ? -13.886 -4.965  3.343   1.00 0.00  ? 206 LYS B HG3  1  
ATOM   1185  H HD2  . LYS B 2 67  ? -12.977 -6.675  2.201   1.00 0.00  ? 206 LYS B HD2  1  
ATOM   1186  H HD3  . LYS B 2 67  ? -11.583 -6.636  3.282   1.00 0.00  ? 206 LYS B HD3  1  
ATOM   1187  H HE2  . LYS B 2 67  ? -13.546 -7.881  4.805   1.00 0.00  ? 206 LYS B HE2  1  
ATOM   1188  H HE3  . LYS B 2 67  ? -13.803 -8.536  3.188   1.00 0.00  ? 206 LYS B HE3  1  
ATOM   1189  H HZ1  . LYS B 2 67  ? -11.296 -8.864  3.162   1.00 0.00  ? 206 LYS B HZ1  1  
ATOM   1190  H HZ2  . LYS B 2 67  ? -11.359 -8.633  4.844   1.00 0.00  ? 206 LYS B HZ2  1  
ATOM   1191  H HZ3  . LYS B 2 67  ? -12.207 -9.918  4.134   1.00 0.00  ? 206 LYS B HZ3  1  
ATOM   1192  N N    . LEU B 2 68  ? -14.805 -2.459  4.075   1.00 17.31 ? 207 LEU B N    1  
ATOM   1193  C CA   . LEU B 2 68  ? -16.209 -2.179  4.484   1.00 19.33 ? 207 LEU B CA   1  
ATOM   1194  C C    . LEU B 2 68  ? -16.947 -3.502  4.702   1.00 21.64 ? 207 LEU B C    1  
ATOM   1195  O O    . LEU B 2 68  ? -16.895 -4.394  3.878   1.00 21.80 ? 207 LEU B O    1  
ATOM   1196  C CB   . LEU B 2 68  ? -16.910 -1.381  3.383   1.00 19.68 ? 207 LEU B CB   1  
ATOM   1197  C CG   . LEU B 2 68  ? -16.129 -0.096  3.101   1.00 19.58 ? 207 LEU B CG   1  
ATOM   1198  C CD1  . LEU B 2 68  ? -16.587 0.498   1.768   1.00 16.81 ? 207 LEU B CD1  1  
ATOM   1199  C CD2  . LEU B 2 68  ? -16.386 0.913   4.223   1.00 16.39 ? 207 LEU B CD2  1  
ATOM   1200  H H    . LEU B 2 68  ? -14.514 -2.269  3.159   1.00 0.00  ? 207 LEU B H    1  
ATOM   1201  H HA   . LEU B 2 68  ? -16.211 -1.608  5.401   1.00 0.00  ? 207 LEU B HA   1  
ATOM   1202  H HB2  . LEU B 2 68  ? -16.960 -1.977  2.483   1.00 0.00  ? 207 LEU B HB2  1  
ATOM   1203  H HB3  . LEU B 2 68  ? -17.909 -1.129  3.702   1.00 0.00  ? 207 LEU B HB3  1  
ATOM   1204  H HG   . LEU B 2 68  ? -15.073 -0.321  3.051   1.00 0.00  ? 207 LEU B HG   1  
ATOM   1205  H HD11 . LEU B 2 68  ? -16.648 -0.285  1.027   1.00 0.00  ? 207 LEU B HD11 1  
ATOM   1206  H HD12 . LEU B 2 68  ? -17.559 0.953   1.892   1.00 0.00  ? 207 LEU B HD12 1  
ATOM   1207  H HD13 . LEU B 2 68  ? -15.878 1.246   1.445   1.00 0.00  ? 207 LEU B HD13 1  
ATOM   1208  H HD21 . LEU B 2 68  ? -17.398 0.800   4.584   1.00 0.00  ? 207 LEU B HD21 1  
ATOM   1209  H HD22 . LEU B 2 68  ? -15.693 0.736   5.032   1.00 0.00  ? 207 LEU B HD22 1  
ATOM   1210  H HD23 . LEU B 2 68  ? -16.248 1.915   3.844   1.00 0.00  ? 207 LEU B HD23 1  
ATOM   1211  N N    . ASP B 2 69  ? -17.633 -3.638  5.804   1.00 24.31 ? 208 ASP B N    1  
ATOM   1212  C CA   . ASP B 2 69  ? -18.370 -4.905  6.068   1.00 27.33 ? 208 ASP B CA   1  
ATOM   1213  C C    . ASP B 2 69  ? -19.354 -5.170  4.927   1.00 28.23 ? 208 ASP B C    1  
ATOM   1214  O O    . ASP B 2 69  ? -19.818 -6.277  4.738   1.00 28.17 ? 208 ASP B O    1  
ATOM   1215  C CB   . ASP B 2 69  ? -19.138 -4.786  7.387   1.00 32.44 ? 208 ASP B CB   1  
ATOM   1216  C CG   . ASP B 2 69  ? -18.508 -5.711  8.430   1.00 36.84 ? 208 ASP B CG   1  
ATOM   1217  O OD1  . ASP B 2 69  ? -17.378 -6.121  8.224   1.00 40.11 ? 208 ASP B OD1  1  
ATOM   1218  O OD2  . ASP B 2 69  ? -19.167 -5.994  9.417   1.00 41.58 ? 208 ASP B OD2  1  
ATOM   1219  H H    . ASP B 2 69  ? -17.662 -2.907  6.456   1.00 0.00  ? 208 ASP B H    1  
ATOM   1220  H HA   . ASP B 2 69  ? -17.668 -5.723  6.134   1.00 0.00  ? 208 ASP B HA   1  
ATOM   1221  H HB2  . ASP B 2 69  ? -19.095 -3.764  7.737   1.00 0.00  ? 208 ASP B HB2  1  
ATOM   1222  H HB3  . ASP B 2 69  ? -20.168 -5.071  7.231   1.00 0.00  ? 208 ASP B HB3  1  
ATOM   1223  N N    . SER B 2 70  ? -19.677 -4.162  4.164   1.00 30.57 ? 209 SER B N    1  
ATOM   1224  C CA   . SER B 2 70  ? -20.624 -4.348  3.040   1.00 30.81 ? 209 SER B CA   1  
ATOM   1225  C C    . SER B 2 70  ? -19.925 -5.092  1.899   1.00 31.86 ? 209 SER B C    1  
ATOM   1226  O O    . SER B 2 70  ? -20.492 -5.968  1.277   1.00 34.96 ? 209 SER B O    1  
ATOM   1227  C CB   . SER B 2 70  ? -21.080 -2.978  2.555   1.00 29.35 ? 209 SER B CB   1  
ATOM   1228  O OG   . SER B 2 70  ? -20.047 -2.028  2.784   1.00 27.77 ? 209 SER B OG   1  
ATOM   1229  H H    . SER B 2 70  ? -19.295 -3.277  4.329   1.00 0.00  ? 209 SER B H    1  
ATOM   1230  H HA   . SER B 2 70  ? -21.479 -4.914  3.372   1.00 0.00  ? 209 SER B HA   1  
ATOM   1231  H HB2  . SER B 2 70  ? -21.287 -3.026  1.509   1.00 0.00  ? 209 SER B HB2  1  
ATOM   1232  H HB3  . SER B 2 70  ? -21.976 -2.688  3.087   1.00 0.00  ? 209 SER B HB3  1  
ATOM   1233  H HG   . SER B 2 70  ? -19.690 -1.767  1.932   1.00 0.00  ? 209 SER B HG   1  
ATOM   1234  N N    . GLY B 2 71  ? -18.697 -4.750  1.621   1.00 31.91 ? 210 GLY B N    1  
ATOM   1235  C CA   . GLY B 2 71  ? -17.962 -5.437  0.521   1.00 30.37 ? 210 GLY B CA   1  
ATOM   1236  C C    . GLY B 2 71  ? -17.103 -4.421  -0.233  1.00 29.39 ? 210 GLY B C    1  
ATOM   1237  O O    . GLY B 2 71  ? -17.331 -4.141  -1.393  1.00 32.51 ? 210 GLY B O    1  
ATOM   1238  H H    . GLY B 2 71  ? -18.257 -4.041  2.135   1.00 0.00  ? 210 GLY B H    1  
ATOM   1239  H HA2  . GLY B 2 71  ? -17.329 -6.207  0.939   1.00 0.00  ? 210 GLY B HA2  1  
ATOM   1240  H HA3  . GLY B 2 71  ? -18.669 -5.883  -0.162  1.00 0.00  ? 210 GLY B HA3  1  
ATOM   1241  N N    . GLY B 2 72  ? -16.117 -3.867  0.417   1.00 27.09 ? 211 GLY B N    1  
ATOM   1242  C CA   . GLY B 2 72  ? -15.244 -2.869  -0.264  1.00 22.75 ? 211 GLY B CA   1  
ATOM   1243  C C    . GLY B 2 72  ? -14.021 -2.583  0.608   1.00 20.54 ? 211 GLY B C    1  
ATOM   1244  O O    . GLY B 2 72  ? -13.658 -3.369  1.460   1.00 21.66 ? 211 GLY B O    1  
ATOM   1245  H H    . GLY B 2 72  ? -15.950 -4.107  1.352   1.00 0.00  ? 211 GLY B H    1  
ATOM   1246  H HA2  . GLY B 2 72  ? -14.924 -3.263  -1.218  1.00 0.00  ? 211 GLY B HA2  1  
ATOM   1247  H HA3  . GLY B 2 72  ? -15.795 -1.953  -0.417  1.00 0.00  ? 211 GLY B HA3  1  
ATOM   1248  N N    . PHE B 2 73  ? -13.382 -1.465  0.402   1.00 18.17 ? 212 PHE B N    1  
ATOM   1249  C CA   . PHE B 2 73  ? -12.182 -1.133  1.221   1.00 17.54 ? 212 PHE B CA   1  
ATOM   1250  C C    . PHE B 2 73  ? -12.070 0.385   1.355   1.00 15.84 ? 212 PHE B C    1  
ATOM   1251  O O    . PHE B 2 73  ? -12.757 1.127   0.685   1.00 18.26 ? 212 PHE B O    1  
ATOM   1252  C CB   . PHE B 2 73  ? -10.922 -1.679  0.541   1.00 16.88 ? 212 PHE B CB   1  
ATOM   1253  C CG   . PHE B 2 73  ? -11.245 -2.972  -0.174  1.00 18.16 ? 212 PHE B CG   1  
ATOM   1254  C CD1  . PHE B 2 73  ? -11.310 -4.177  0.546   1.00 18.64 ? 212 PHE B CD1  1  
ATOM   1255  C CD2  . PHE B 2 73  ? -11.480 -2.967  -1.559  1.00 18.25 ? 212 PHE B CD2  1  
ATOM   1256  C CE1  . PHE B 2 73  ? -11.611 -5.377  -0.120  1.00 19.59 ? 212 PHE B CE1  1  
ATOM   1257  C CE2  . PHE B 2 73  ? -11.780 -4.167  -2.225  1.00 18.17 ? 212 PHE B CE2  1  
ATOM   1258  C CZ   . PHE B 2 73  ? -11.845 -5.372  -1.506  1.00 18.19 ? 212 PHE B CZ   1  
ATOM   1259  H H    . PHE B 2 73  ? -13.691 -0.842  -0.290  1.00 0.00  ? 212 PHE B H    1  
ATOM   1260  H HA   . PHE B 2 73  ? -12.283 -1.572  2.200   1.00 0.00  ? 212 PHE B HA   1  
ATOM   1261  H HB2  . PHE B 2 73  ? -10.558 -0.956  -0.173  1.00 0.00  ? 212 PHE B HB2  1  
ATOM   1262  H HB3  . PHE B 2 73  ? -10.163 -1.862  1.287   1.00 0.00  ? 212 PHE B HB3  1  
ATOM   1263  H HD1  . PHE B 2 73  ? -11.130 -4.181  1.611   1.00 0.00  ? 212 PHE B HD1  1  
ATOM   1264  H HD2  . PHE B 2 73  ? -11.429 -2.041  -2.112  1.00 0.00  ? 212 PHE B HD2  1  
ATOM   1265  H HE1  . PHE B 2 73  ? -11.662 -6.304  0.433   1.00 0.00  ? 212 PHE B HE1  1  
ATOM   1266  H HE2  . PHE B 2 73  ? -11.960 -4.164  -3.290  1.00 0.00  ? 212 PHE B HE2  1  
ATOM   1267  H HZ   . PHE B 2 73  ? -12.076 -6.295  -2.018  1.00 0.00  ? 212 PHE B HZ   1  
ATOM   1268  N N    . TYR B 2 74  ? -11.209 0.854   2.214   1.00 14.56 ? 213 TYR B N    1  
ATOM   1269  C CA   . TYR B 2 74  ? -11.062 2.326   2.378   1.00 12.35 ? 213 TYR B CA   1  
ATOM   1270  C C    . TYR B 2 74  ? -9.985  2.626   3.424   1.00 12.92 ? 213 TYR B C    1  
ATOM   1271  O O    . TYR B 2 74  ? -10.260 2.753   4.600   1.00 12.14 ? 213 TYR B O    1  
ATOM   1272  C CB   . TYR B 2 74  ? -12.401 2.928   2.819   1.00 12.55 ? 213 TYR B CB   1  
ATOM   1273  C CG   . TYR B 2 74  ? -12.769 2.409   4.188   1.00 14.01 ? 213 TYR B CG   1  
ATOM   1274  C CD1  . TYR B 2 74  ? -13.058 1.047   4.371   1.00 13.18 ? 213 TYR B CD1  1  
ATOM   1275  C CD2  . TYR B 2 74  ? -12.818 3.290   5.281   1.00 13.49 ? 213 TYR B CD2  1  
ATOM   1276  C CE1  . TYR B 2 74  ? -13.395 0.566   5.647   1.00 14.46 ? 213 TYR B CE1  1  
ATOM   1277  C CE2  . TYR B 2 74  ? -13.155 2.811   6.556   1.00 13.06 ? 213 TYR B CE2  1  
ATOM   1278  C CZ   . TYR B 2 74  ? -13.443 1.448   6.740   1.00 15.80 ? 213 TYR B CZ   1  
ATOM   1279  O OH   . TYR B 2 74  ? -13.775 0.976   7.994   1.00 18.90 ? 213 TYR B OH   1  
ATOM   1280  H H    . TYR B 2 74  ? -10.660 0.241   2.748   1.00 0.00  ? 213 TYR B H    1  
ATOM   1281  H HA   . TYR B 2 74  ? -10.771 2.762   1.433   1.00 0.00  ? 213 TYR B HA   1  
ATOM   1282  H HB2  . TYR B 2 74  ? -12.317 4.004   2.855   1.00 0.00  ? 213 TYR B HB2  1  
ATOM   1283  H HB3  . TYR B 2 74  ? -13.170 2.652   2.113   1.00 0.00  ? 213 TYR B HB3  1  
ATOM   1284  H HD1  . TYR B 2 74  ? -13.021 0.369   3.531   1.00 0.00  ? 213 TYR B HD1  1  
ATOM   1285  H HD2  . TYR B 2 74  ? -12.596 4.337   5.140   1.00 0.00  ? 213 TYR B HD2  1  
ATOM   1286  H HE1  . TYR B 2 74  ? -13.616 -0.481  5.789   1.00 0.00  ? 213 TYR B HE1  1  
ATOM   1287  H HE2  . TYR B 2 74  ? -13.191 3.490   7.396   1.00 0.00  ? 213 TYR B HE2  1  
ATOM   1288  H HH   . TYR B 2 74  ? -13.168 0.266   8.213   1.00 0.00  ? 213 TYR B HH   1  
ATOM   1289  N N    . ILE B 2 75  ? -8.756  2.748   3.004   1.00 13.74 ? 214 ILE B N    1  
ATOM   1290  C CA   . ILE B 2 75  ? -7.670  3.049   3.976   1.00 13.80 ? 214 ILE B CA   1  
ATOM   1291  C C    . ILE B 2 75  ? -8.118  4.208   4.873   1.00 14.16 ? 214 ILE B C    1  
ATOM   1292  O O    . ILE B 2 75  ? -7.672  4.348   5.994   1.00 12.50 ? 214 ILE B O    1  
ATOM   1293  C CB   . ILE B 2 75  ? -6.395  3.424   3.208   1.00 10.15 ? 214 ILE B CB   1  
ATOM   1294  C CG1  . ILE B 2 75  ? -5.740  2.148   2.678   1.00 9.57  ? 214 ILE B CG1  1  
ATOM   1295  C CG2  . ILE B 2 75  ? -5.412  4.148   4.134   1.00 8.37  ? 214 ILE B CG2  1  
ATOM   1296  C CD1  . ILE B 2 75  ? -4.732  2.506   1.584   1.00 7.18  ? 214 ILE B CD1  1  
ATOM   1297  H H    . ILE B 2 75  ? -8.550  2.649   2.051   1.00 0.00  ? 214 ILE B H    1  
ATOM   1298  H HA   . ILE B 2 75  ? -7.481  2.176   4.584   1.00 0.00  ? 214 ILE B HA   1  
ATOM   1299  H HB   . ILE B 2 75  ? -6.651  4.068   2.377   1.00 0.00  ? 214 ILE B HB   1  
ATOM   1300  H HG12 . ILE B 2 75  ? -5.232  1.643   3.487   1.00 0.00  ? 214 ILE B HG12 1  
ATOM   1301  H HG13 . ILE B 2 75  ? -6.499  1.498   2.268   1.00 0.00  ? 214 ILE B HG13 1  
ATOM   1302  H HG21 . ILE B 2 75  ? -5.467  3.719   5.123   1.00 0.00  ? 214 ILE B HG21 1  
ATOM   1303  H HG22 . ILE B 2 75  ? -4.408  4.038   3.750   1.00 0.00  ? 214 ILE B HG22 1  
ATOM   1304  H HG23 . ILE B 2 75  ? -5.666  5.196   4.181   1.00 0.00  ? 214 ILE B HG23 1  
ATOM   1305  H HD11 . ILE B 2 75  ? -4.835  3.550   1.328   1.00 0.00  ? 214 ILE B HD11 1  
ATOM   1306  H HD12 . ILE B 2 75  ? -3.731  2.320   1.942   1.00 0.00  ? 214 ILE B HD12 1  
ATOM   1307  H HD13 . ILE B 2 75  ? -4.920  1.901   0.709   1.00 0.00  ? 214 ILE B HD13 1  
ATOM   1308  N N    . THR B 2 76  ? -9.006  5.032   4.386   1.00 15.77 ? 215 THR B N    1  
ATOM   1309  C CA   . THR B 2 76  ? -9.496  6.174   5.206   1.00 18.20 ? 215 THR B CA   1  
ATOM   1310  C C    . THR B 2 76  ? -11.015 6.279   5.063   1.00 17.81 ? 215 THR B C    1  
ATOM   1311  O O    . THR B 2 76  ? -11.583 5.860   4.075   1.00 15.56 ? 215 THR B O    1  
ATOM   1312  C CB   . THR B 2 76  ? -8.844  7.470   4.719   1.00 20.21 ? 215 THR B CB   1  
ATOM   1313  O OG1  . THR B 2 76  ? -9.279  8.551   5.533   1.00 26.81 ? 215 THR B OG1  1  
ATOM   1314  C CG2  . THR B 2 76  ? -9.243  7.728   3.266   1.00 22.31 ? 215 THR B CG2  1  
ATOM   1315  H H    . THR B 2 76  ? -9.356  4.896   3.482   1.00 0.00  ? 215 THR B H    1  
ATOM   1316  H HA   . THR B 2 76  ? -9.244  6.007   6.243   1.00 0.00  ? 215 THR B HA   1  
ATOM   1317  H HB   . THR B 2 76  ? -7.771  7.379   4.783   1.00 0.00  ? 215 THR B HB   1  
ATOM   1318  H HG1  . THR B 2 76  ? -8.685  8.614   6.284   1.00 0.00  ? 215 THR B HG1  1  
ATOM   1319  H HG21 . THR B 2 76  ? -9.915  6.951   2.934   1.00 0.00  ? 215 THR B HG21 1  
ATOM   1320  H HG22 . THR B 2 76  ? -9.736  8.686   3.192   1.00 0.00  ? 215 THR B HG22 1  
ATOM   1321  H HG23 . THR B 2 76  ? -8.360  7.729   2.645   1.00 0.00  ? 215 THR B HG23 1  
ATOM   1322  N N    . SER B 2 77  ? -11.676 6.830   6.042   1.00 18.97 ? 216 SER B N    1  
ATOM   1323  C CA   . SER B 2 77  ? -13.160 6.955   5.964   1.00 18.71 ? 216 SER B CA   1  
ATOM   1324  C C    . SER B 2 77  ? -13.544 7.919   4.838   1.00 18.69 ? 216 SER B C    1  
ATOM   1325  O O    . SER B 2 77  ? -14.700 8.040   4.483   1.00 20.53 ? 216 SER B O    1  
ATOM   1326  C CB   . SER B 2 77  ? -13.694 7.489   7.293   1.00 20.19 ? 216 SER B CB   1  
ATOM   1327  O OG   . SER B 2 77  ? -13.545 8.902   7.324   1.00 22.41 ? 216 SER B OG   1  
ATOM   1328  H H    . SER B 2 77  ? -11.199 7.158   6.833   1.00 0.00  ? 216 SER B H    1  
ATOM   1329  H HA   . SER B 2 77  ? -13.592 5.985   5.768   1.00 0.00  ? 216 SER B HA   1  
ATOM   1330  H HB2  . SER B 2 77  ? -14.738 7.241   7.389   1.00 0.00  ? 216 SER B HB2  1  
ATOM   1331  H HB3  . SER B 2 77  ? -13.143 7.040   8.108   1.00 0.00  ? 216 SER B HB3  1  
ATOM   1332  H HG   . SER B 2 77  ? -14.368 9.281   7.641   1.00 0.00  ? 216 SER B HG   1  
ATOM   1333  N N    . ARG B 2 78  ? -12.590 8.611   4.275   1.00 0.00  ? 217 ARG B N    1  
ATOM   1334  C CA   . ARG B 2 78  ? -12.915 9.567   3.178   1.00 0.00  ? 217 ARG B CA   1  
ATOM   1335  C C    . ARG B 2 78  ? -12.499 8.971   1.830   1.00 0.00  ? 217 ARG B C    1  
ATOM   1336  O O    . ARG B 2 78  ? -12.384 9.669   0.843   1.00 0.00  ? 217 ARG B O    1  
ATOM   1337  C CB   . ARG B 2 78  ? -12.163 10.879  3.408   1.00 0.00  ? 217 ARG B CB   1  
ATOM   1338  C CG   . ARG B 2 78  ? -13.065 12.056  3.032   1.00 0.00  ? 217 ARG B CG   1  
ATOM   1339  C CD   . ARG B 2 78  ? -13.771 12.579  4.284   1.00 0.00  ? 217 ARG B CD   1  
ATOM   1340  N NE   . ARG B 2 78  ? -15.232 12.697  4.017   1.00 0.00  ? 217 ARG B NE   1  
ATOM   1341  C CZ   . ARG B 2 78  ? -16.071 12.796  5.012   1.00 0.00  ? 217 ARG B CZ   1  
ATOM   1342  N NH1  . ARG B 2 78  ? -15.743 13.477  6.076   1.00 0.00  ? 217 ARG B NH1  1  
ATOM   1343  N NH2  . ARG B 2 78  ? -17.237 12.215  4.943   1.00 0.00  ? 217 ARG B NH2  1  
ATOM   1344  H H    . ARG B 2 78  ? -11.664 8.505   4.576   1.00 0.00  ? 217 ARG B H    1  
ATOM   1345  H HA   . ARG B 2 78  ? -13.977 9.759   3.173   1.00 0.00  ? 217 ARG B HA   1  
ATOM   1346  H HB2  . ARG B 2 78  ? -11.884 10.956  4.449   1.00 0.00  ? 217 ARG B HB2  1  
ATOM   1347  H HB3  . ARG B 2 78  ? -11.275 10.898  2.795   1.00 0.00  ? 217 ARG B HB3  1  
ATOM   1348  H HG2  . ARG B 2 78  ? -12.465 12.844  2.599   1.00 0.00  ? 217 ARG B HG2  1  
ATOM   1349  H HG3  . ARG B 2 78  ? -13.802 11.729  2.315   1.00 0.00  ? 217 ARG B HG3  1  
ATOM   1350  H HD2  . ARG B 2 78  ? -13.608 11.893  5.102   1.00 0.00  ? 217 ARG B HD2  1  
ATOM   1351  H HD3  . ARG B 2 78  ? -13.372 13.549  4.543   1.00 0.00  ? 217 ARG B HD3  1  
ATOM   1352  H HE   . ARG B 2 78  ? -15.563 12.700  3.095   1.00 0.00  ? 217 ARG B HE   1  
ATOM   1353  H HH11 . ARG B 2 78  ? -14.849 13.923  6.129   1.00 0.00  ? 217 ARG B HH11 1  
ATOM   1354  H HH12 . ARG B 2 78  ? -16.385 13.553  6.839   1.00 0.00  ? 217 ARG B HH12 1  
ATOM   1355  H HH21 . ARG B 2 78  ? -17.488 11.692  4.128   1.00 0.00  ? 217 ARG B HH21 1  
ATOM   1356  H HH22 . ARG B 2 78  ? -17.879 12.291  5.705   1.00 0.00  ? 217 ARG B HH22 1  
ATOM   1357  N N    . THR B 2 79  ? -12.274 7.687   1.778   1.00 23.45 ? 218 THR B N    1  
ATOM   1358  C CA   . THR B 2 79  ? -11.869 7.054   0.491   1.00 23.59 ? 218 THR B CA   1  
ATOM   1359  C C    . THR B 2 79  ? -12.362 5.606   0.452   1.00 19.84 ? 218 THR B C    1  
ATOM   1360  O O    . THR B 2 79  ? -11.706 4.704   0.935   1.00 20.24 ? 218 THR B O    1  
ATOM   1361  C CB   . THR B 2 79  ? -10.343 7.077   0.368   1.00 26.45 ? 218 THR B CB   1  
ATOM   1362  O OG1  . THR B 2 79  ? -9.859  8.357   0.748   1.00 30.31 ? 218 THR B OG1  1  
ATOM   1363  C CG2  . THR B 2 79  ? -9.942  6.785   -1.078  1.00 27.38 ? 218 THR B CG2  1  
ATOM   1364  H H    . THR B 2 79  ? -12.374 7.139   2.584   1.00 0.00  ? 218 THR B H    1  
ATOM   1365  H HA   . THR B 2 79  ? -12.303 7.603   -0.331  1.00 0.00  ? 218 THR B HA   1  
ATOM   1366  H HB   . THR B 2 79  ? -9.918  6.324   1.014   1.00 0.00  ? 218 THR B HB   1  
ATOM   1367  H HG1  . THR B 2 79  ? -8.947  8.427   0.457   1.00 0.00  ? 218 THR B HG1  1  
ATOM   1368  H HG21 . THR B 2 79  ? -10.423 5.877   -1.409  1.00 0.00  ? 218 THR B HG21 1  
ATOM   1369  H HG22 . THR B 2 79  ? -10.248 7.606   -1.710  1.00 0.00  ? 218 THR B HG22 1  
ATOM   1370  H HG23 . THR B 2 79  ? -8.870  6.666   -1.137  1.00 0.00  ? 218 THR B HG23 1  
ATOM   1371  N N    . GLN B 2 80  ? -13.510 5.375   -0.122  1.00 18.30 ? 219 GLN B N    1  
ATOM   1372  C CA   . GLN B 2 80  ? -14.042 3.985   -0.195  1.00 20.11 ? 219 GLN B CA   1  
ATOM   1373  C C    . GLN B 2 80  ? -14.101 3.542   -1.658  1.00 19.45 ? 219 GLN B C    1  
ATOM   1374  O O    . GLN B 2 80  ? -14.433 4.312   -2.538  1.00 20.30 ? 219 GLN B O    1  
ATOM   1375  C CB   . GLN B 2 80  ? -15.447 3.944   0.410   1.00 20.56 ? 219 GLN B CB   1  
ATOM   1376  C CG   . GLN B 2 80  ? -15.406 4.495   1.837   1.00 23.60 ? 219 GLN B CG   1  
ATOM   1377  C CD   . GLN B 2 80  ? -16.831 4.766   2.321   1.00 19.08 ? 219 GLN B CD   1  
ATOM   1378  O OE1  . GLN B 2 80  ? -17.317 4.105   3.217   1.00 17.99 ? 219 GLN B OE1  1  
ATOM   1379  N NE2  . GLN B 2 80  ? -17.527 5.719   1.763   1.00 17.08 ? 219 GLN B NE2  1  
ATOM   1380  H H    . GLN B 2 80  ? -14.022 6.116   -0.508  1.00 0.00  ? 219 GLN B H    1  
ATOM   1381  H HA   . GLN B 2 80  ? -13.393 3.320   0.355   1.00 0.00  ? 219 GLN B HA   1  
ATOM   1382  H HB2  . GLN B 2 80  ? -16.115 4.545   -0.190  1.00 0.00  ? 219 GLN B HB2  1  
ATOM   1383  H HB3  . GLN B 2 80  ? -15.801 2.924   0.430   1.00 0.00  ? 219 GLN B HB3  1  
ATOM   1384  H HG2  . GLN B 2 80  ? -14.935 3.773   2.488   1.00 0.00  ? 219 GLN B HG2  1  
ATOM   1385  H HG3  . GLN B 2 80  ? -14.842 5.415   1.851   1.00 0.00  ? 219 GLN B HG3  1  
ATOM   1386  H HE21 . GLN B 2 80  ? -17.132 6.254   1.037   1.00 0.00  ? 219 GLN B HE21 1  
ATOM   1387  H HE22 . GLN B 2 80  ? -18.444 5.901   2.069   1.00 0.00  ? 219 GLN B HE22 1  
ATOM   1388  N N    . PHE B 2 81  ? -13.778 2.307   -1.926  1.00 18.96 ? 220 PHE B N    1  
ATOM   1389  C CA   . PHE B 2 81  ? -13.811 1.814   -3.330  1.00 17.73 ? 220 PHE B CA   1  
ATOM   1390  C C    . PHE B 2 81  ? -14.357 0.388   -3.355  1.00 17.76 ? 220 PHE B C    1  
ATOM   1391  O O    . PHE B 2 81  ? -14.460 -0.267  -2.336  1.00 19.11 ? 220 PHE B O    1  
ATOM   1392  C CB   . PHE B 2 81  ? -12.395 1.827   -3.909  1.00 14.17 ? 220 PHE B CB   1  
ATOM   1393  C CG   . PHE B 2 81  ? -11.973 3.252   -4.178  1.00 14.07 ? 220 PHE B CG   1  
ATOM   1394  C CD1  . PHE B 2 81  ? -12.679 4.030   -5.110  1.00 14.01 ? 220 PHE B CD1  1  
ATOM   1395  C CD2  . PHE B 2 81  ? -10.873 3.800   -3.495  1.00 12.87 ? 220 PHE B CD2  1  
ATOM   1396  C CE1  . PHE B 2 81  ? -12.286 5.356   -5.360  1.00 11.11 ? 220 PHE B CE1  1  
ATOM   1397  C CE2  . PHE B 2 81  ? -10.480 5.125   -3.746  1.00 13.31 ? 220 PHE B CE2  1  
ATOM   1398  C CZ   . PHE B 2 81  ? -11.186 5.903   -4.678  1.00 13.09 ? 220 PHE B CZ   1  
ATOM   1399  H H    . PHE B 2 81  ? -13.511 1.704   -1.203  1.00 0.00  ? 220 PHE B H    1  
ATOM   1400  H HA   . PHE B 2 81  ? -14.449 2.451   -3.924  1.00 0.00  ? 220 PHE B HA   1  
ATOM   1401  H HB2  . PHE B 2 81  ? -11.714 1.376   -3.203  1.00 0.00  ? 220 PHE B HB2  1  
ATOM   1402  H HB3  . PHE B 2 81  ? -12.379 1.268   -4.832  1.00 0.00  ? 220 PHE B HB3  1  
ATOM   1403  H HD1  . PHE B 2 81  ? -13.524 3.610   -5.635  1.00 0.00  ? 220 PHE B HD1  1  
ATOM   1404  H HD2  . PHE B 2 81  ? -10.330 3.202   -2.778  1.00 0.00  ? 220 PHE B HD2  1  
ATOM   1405  H HE1  . PHE B 2 81  ? -12.829 5.954   -6.077  1.00 0.00  ? 220 PHE B HE1  1  
ATOM   1406  H HE2  . PHE B 2 81  ? -9.635  5.546   -3.221  1.00 0.00  ? 220 PHE B HE2  1  
ATOM   1407  H HZ   . PHE B 2 81  ? -10.884 6.922   -4.871  1.00 0.00  ? 220 PHE B HZ   1  
ATOM   1408  N N    . ASN B 2 82  ? -14.709 -0.097  -4.511  1.00 20.00 ? 221 ASN B N    1  
ATOM   1409  C CA   . ASN B 2 82  ? -15.252 -1.481  -4.603  1.00 21.48 ? 221 ASN B CA   1  
ATOM   1410  C C    . ASN B 2 82  ? -14.239 -2.387  -5.306  1.00 22.18 ? 221 ASN B C    1  
ATOM   1411  O O    . ASN B 2 82  ? -14.565 -3.472  -5.745  1.00 24.56 ? 221 ASN B O    1  
ATOM   1412  C CB   . ASN B 2 82  ? -16.559 -1.462  -5.398  1.00 26.12 ? 221 ASN B CB   1  
ATOM   1413  C CG   . ASN B 2 82  ? -17.649 -2.187  -4.605  1.00 28.62 ? 221 ASN B CG   1  
ATOM   1414  O OD1  . ASN B 2 82  ? -17.385 -2.744  -3.558  1.00 32.09 ? 221 ASN B OD1  1  
ATOM   1415  N ND2  . ASN B 2 82  ? -18.871 -2.203  -5.062  1.00 31.44 ? 221 ASN B ND2  1  
ATOM   1416  H H    . ASN B 2 82  ? -14.618 0.451   -5.318  1.00 0.00  ? 221 ASN B H    1  
ATOM   1417  H HA   . ASN B 2 82  ? -15.442 -1.858  -3.609  1.00 0.00  ? 221 ASN B HA   1  
ATOM   1418  H HB2  . ASN B 2 82  ? -16.859 -0.439  -5.572  1.00 0.00  ? 221 ASN B HB2  1  
ATOM   1419  H HB3  . ASN B 2 82  ? -16.413 -1.961  -6.344  1.00 0.00  ? 221 ASN B HB3  1  
ATOM   1420  H HD21 . ASN B 2 82  ? -19.084 -1.751  -5.910  1.00 0.00  ? 221 ASN B HD21 1  
ATOM   1421  H HD22 . ASN B 2 82  ? -19.577 -2.667  -4.558  1.00 0.00  ? 221 ASN B HD22 1  
ATOM   1422  N N    . SER B 2 83  ? -13.012 -1.956  -5.415  1.00 20.04 ? 222 SER B N    1  
ATOM   1423  C CA   . SER B 2 83  ? -11.986 -2.801  -6.089  1.00 17.84 ? 222 SER B CA   1  
ATOM   1424  C C    . SER B 2 83  ? -10.591 -2.379  -5.626  1.00 17.08 ? 222 SER B C    1  
ATOM   1425  O O    . SER B 2 83  ? -10.205 -1.233  -5.749  1.00 17.94 ? 222 SER B O    1  
ATOM   1426  C CB   . SER B 2 83  ? -12.094 -2.626  -7.603  1.00 15.42 ? 222 SER B CB   1  
ATOM   1427  O OG   . SER B 2 83  ? -12.568 -1.318  -7.893  1.00 19.15 ? 222 SER B OG   1  
ATOM   1428  H H    . SER B 2 83  ? -12.764 -1.078  -5.054  1.00 0.00  ? 222 SER B H    1  
ATOM   1429  H HA   . SER B 2 83  ? -12.151 -3.838  -5.834  1.00 0.00  ? 222 SER B HA   1  
ATOM   1430  H HB2  . SER B 2 83  ? -11.123 -2.759  -8.052  1.00 0.00  ? 222 SER B HB2  1  
ATOM   1431  H HB3  . SER B 2 83  ? -12.776 -3.365  -8.002  1.00 0.00  ? 222 SER B HB3  1  
ATOM   1432  H HG   . SER B 2 83  ? -12.490 -1.177  -8.840  1.00 0.00  ? 222 SER B HG   1  
ATOM   1433  N N    . LEU B 2 84  ? -9.831  -3.298  -5.096  1.00 17.11 ? 223 LEU B N    1  
ATOM   1434  C CA   . LEU B 2 84  ? -8.460  -2.953  -4.626  1.00 16.96 ? 223 LEU B CA   1  
ATOM   1435  C C    . LEU B 2 84  ? -7.753  -2.114  -5.693  1.00 17.05 ? 223 LEU B C    1  
ATOM   1436  O O    . LEU B 2 84  ? -6.966  -1.241  -5.388  1.00 18.74 ? 223 LEU B O    1  
ATOM   1437  C CB   . LEU B 2 84  ? -7.667  -4.238  -4.379  1.00 15.68 ? 223 LEU B CB   1  
ATOM   1438  C CG   . LEU B 2 84  ? -7.869  -4.694  -2.934  1.00 18.50 ? 223 LEU B CG   1  
ATOM   1439  C CD1  . LEU B 2 84  ? -7.352  -6.125  -2.772  1.00 17.89 ? 223 LEU B CD1  1  
ATOM   1440  C CD2  . LEU B 2 84  ? -7.096  -3.765  -1.996  1.00 17.50 ? 223 LEU B CD2  1  
ATOM   1441  H H    . LEU B 2 84  ? -10.162 -4.216  -5.007  1.00 0.00  ? 223 LEU B H    1  
ATOM   1442  H HA   . LEU B 2 84  ? -8.525  -2.387  -3.708  1.00 0.00  ? 223 LEU B HA   1  
ATOM   1443  H HB2  . LEU B 2 84  ? -8.012  -5.009  -5.053  1.00 0.00  ? 223 LEU B HB2  1  
ATOM   1444  H HB3  . LEU B 2 84  ? -6.617  -4.052  -4.552  1.00 0.00  ? 223 LEU B HB3  1  
ATOM   1445  H HG   . LEU B 2 84  ? -8.921  -4.661  -2.690  1.00 0.00  ? 223 LEU B HG   1  
ATOM   1446  H HD11 . LEU B 2 84  ? -6.304  -6.161  -3.031  1.00 0.00  ? 223 LEU B HD11 1  
ATOM   1447  H HD12 . LEU B 2 84  ? -7.481  -6.440  -1.747  1.00 0.00  ? 223 LEU B HD12 1  
ATOM   1448  H HD13 . LEU B 2 84  ? -7.907  -6.783  -3.424  1.00 0.00  ? 223 LEU B HD13 1  
ATOM   1449  H HD21 . LEU B 2 84  ? -6.831  -2.860  -2.523  1.00 0.00  ? 223 LEU B HD21 1  
ATOM   1450  H HD22 . LEU B 2 84  ? -7.713  -3.518  -1.145  1.00 0.00  ? 223 LEU B HD22 1  
ATOM   1451  H HD23 . LEU B 2 84  ? -6.198  -4.260  -1.657  1.00 0.00  ? 223 LEU B HD23 1  
ATOM   1452  N N    . GLN B 2 85  ? -8.026  -2.373  -6.943  1.00 17.04 ? 224 GLN B N    1  
ATOM   1453  C CA   . GLN B 2 85  ? -7.368  -1.590  -8.025  1.00 17.80 ? 224 GLN B CA   1  
ATOM   1454  C C    . GLN B 2 85  ? -7.841  -0.137  -7.962  1.00 17.42 ? 224 GLN B C    1  
ATOM   1455  O O    . GLN B 2 85  ? -7.056  0.786   -8.039  1.00 17.16 ? 224 GLN B O    1  
ATOM   1456  C CB   . GLN B 2 85  ? -7.735  -2.185  -9.387  1.00 21.63 ? 224 GLN B CB   1  
ATOM   1457  C CG   . GLN B 2 85  ? -7.771  -3.712  -9.289  1.00 27.99 ? 224 GLN B CG   1  
ATOM   1458  C CD   . GLN B 2 85  ? -9.204  -4.203  -9.500  1.00 31.34 ? 224 GLN B CD   1  
ATOM   1459  O OE1  . GLN B 2 85  ? -10.053 -3.458  -9.948  1.00 31.30 ? 224 GLN B OE1  1  
ATOM   1460  N NE2  . GLN B 2 85  ? -9.511  -5.433  -9.195  1.00 33.99 ? 224 GLN B NE2  1  
ATOM   1461  H H    . GLN B 2 85  ? -8.664  -3.082  -7.168  1.00 0.00  ? 224 GLN B H    1  
ATOM   1462  H HA   . GLN B 2 85  ? -6.296  -1.625  -7.894  1.00 0.00  ? 224 GLN B HA   1  
ATOM   1463  H HB2  . GLN B 2 85  ? -8.706  -1.820  -9.689  1.00 0.00  ? 224 GLN B HB2  1  
ATOM   1464  H HB3  . GLN B 2 85  ? -6.997  -1.891  -10.119 1.00 0.00  ? 224 GLN B HB3  1  
ATOM   1465  H HG2  . GLN B 2 85  ? -7.128  -4.136  -10.047 1.00 0.00  ? 224 GLN B HG2  1  
ATOM   1466  H HG3  . GLN B 2 85  ? -7.427  -4.019  -8.313  1.00 0.00  ? 224 GLN B HG3  1  
ATOM   1467  H HE21 . GLN B 2 85  ? -8.822  -6.035  -8.832  1.00 0.00  ? 224 GLN B HE21 1  
ATOM   1468  H HE22 . GLN B 2 85  ? -10.430 -5.757  -9.328  1.00 0.00  ? 224 GLN B HE22 1  
ATOM   1469  N N    . GLN B 2 86  ? -9.122  0.074   -7.823  1.00 17.93 ? 225 GLN B N    1  
ATOM   1470  C CA   . GLN B 2 86  ? -9.645  1.468   -7.755  1.00 17.77 ? 225 GLN B CA   1  
ATOM   1471  C C    . GLN B 2 86  ? -8.895  2.240   -6.667  1.00 14.93 ? 225 GLN B C    1  
ATOM   1472  O O    . GLN B 2 86  ? -8.398  3.324   -6.894  1.00 15.44 ? 225 GLN B O    1  
ATOM   1473  C CB   . GLN B 2 86  ? -11.137 1.436   -7.421  1.00 23.54 ? 225 GLN B CB   1  
ATOM   1474  C CG   . GLN B 2 86  ? -11.804 2.716   -7.927  1.00 32.83 ? 225 GLN B CG   1  
ATOM   1475  C CD   . GLN B 2 86  ? -13.322 2.588   -7.791  1.00 37.70 ? 225 GLN B CD   1  
ATOM   1476  O OE1  . GLN B 2 86  ? -13.809 1.872   -6.939  1.00 41.31 ? 225 GLN B OE1  1  
ATOM   1477  N NE2  . GLN B 2 86  ? -14.097 3.257   -8.601  1.00 38.92 ? 225 GLN B NE2  1  
ATOM   1478  H H    . GLN B 2 86  ? -9.739  -0.684  -7.763  1.00 0.00  ? 225 GLN B H    1  
ATOM   1479  H HA   . GLN B 2 86  ? -9.499  1.954   -8.708  1.00 0.00  ? 225 GLN B HA   1  
ATOM   1480  H HB2  . GLN B 2 86  ? -11.593 0.579   -7.896  1.00 0.00  ? 225 GLN B HB2  1  
ATOM   1481  H HB3  . GLN B 2 86  ? -11.264 1.364   -6.352  1.00 0.00  ? 225 GLN B HB3  1  
ATOM   1482  H HG2  . GLN B 2 86  ? -11.459 3.557   -7.342  1.00 0.00  ? 225 GLN B HG2  1  
ATOM   1483  H HG3  . GLN B 2 86  ? -11.549 2.870   -8.965  1.00 0.00  ? 225 GLN B HG3  1  
ATOM   1484  H HE21 . GLN B 2 86  ? -13.704 3.835   -9.289  1.00 0.00  ? 225 GLN B HE21 1  
ATOM   1485  H HE22 . GLN B 2 86  ? -15.070 3.181   -8.522  1.00 0.00  ? 225 GLN B HE22 1  
ATOM   1486  N N    . LEU B 2 87  ? -8.811  1.689   -5.487  1.00 13.83 ? 226 LEU B N    1  
ATOM   1487  C CA   . LEU B 2 87  ? -8.092  2.392   -4.385  1.00 13.09 ? 226 LEU B CA   1  
ATOM   1488  C C    . LEU B 2 87  ? -6.635  2.626   -4.794  1.00 11.87 ? 226 LEU B C    1  
ATOM   1489  O O    . LEU B 2 87  ? -6.044  3.638   -4.471  1.00 12.13 ? 226 LEU B O    1  
ATOM   1490  C CB   . LEU B 2 87  ? -8.140  1.530   -3.120  1.00 12.56 ? 226 LEU B CB   1  
ATOM   1491  C CG   . LEU B 2 87  ? -7.242  2.139   -2.040  1.00 13.63 ? 226 LEU B CG   1  
ATOM   1492  C CD1  . LEU B 2 87  ? -7.791  1.778   -0.659  1.00 13.34 ? 226 LEU B CD1  1  
ATOM   1493  C CD2  . LEU B 2 87  ? -5.824  1.581   -2.182  1.00 14.36 ? 226 LEU B CD2  1  
ATOM   1494  H H    . LEU B 2 87  ? -9.221  0.813   -5.324  1.00 0.00  ? 226 LEU B H    1  
ATOM   1495  H HA   . LEU B 2 87  ? -8.568  3.342   -4.192  1.00 0.00  ? 226 LEU B HA   1  
ATOM   1496  H HB2  . LEU B 2 87  ? -9.156  1.482   -2.757  1.00 0.00  ? 226 LEU B HB2  1  
ATOM   1497  H HB3  . LEU B 2 87  ? -7.794  0.534   -3.351  1.00 0.00  ? 226 LEU B HB3  1  
ATOM   1498  H HG   . LEU B 2 87  ? -7.222  3.214   -2.147  1.00 0.00  ? 226 LEU B HG   1  
ATOM   1499  H HD11 . LEU B 2 87  ? -8.771  1.336   -0.765  1.00 0.00  ? 226 LEU B HD11 1  
ATOM   1500  H HD12 . LEU B 2 87  ? -7.127  1.072   -0.181  1.00 0.00  ? 226 LEU B HD12 1  
ATOM   1501  H HD13 . LEU B 2 87  ? -7.862  2.670   -0.055  1.00 0.00  ? 226 LEU B HD13 1  
ATOM   1502  H HD21 . LEU B 2 87  ? -5.872  0.553   -2.509  1.00 0.00  ? 226 LEU B HD21 1  
ATOM   1503  H HD22 . LEU B 2 87  ? -5.278  2.164   -2.909  1.00 0.00  ? 226 LEU B HD22 1  
ATOM   1504  H HD23 . LEU B 2 87  ? -5.320  1.632   -1.228  1.00 0.00  ? 226 LEU B HD23 1  
ATOM   1505  N N    . VAL B 2 88  ? -6.051  1.696   -5.500  1.00 11.28 ? 227 VAL B N    1  
ATOM   1506  C CA   . VAL B 2 88  ? -4.633  1.862   -5.927  1.00 13.23 ? 227 VAL B CA   1  
ATOM   1507  C C    . VAL B 2 88  ? -4.535  2.966   -6.982  1.00 13.64 ? 227 VAL B C    1  
ATOM   1508  O O    . VAL B 2 88  ? -3.494  3.564   -7.172  1.00 15.96 ? 227 VAL B O    1  
ATOM   1509  C CB   . VAL B 2 88  ? -4.122  0.545   -6.516  1.00 9.89  ? 227 VAL B CB   1  
ATOM   1510  C CG1  . VAL B 2 88  ? -2.736  0.761   -7.125  1.00 9.85  ? 227 VAL B CG1  1  
ATOM   1511  C CG2  . VAL B 2 88  ? -4.031  -0.506  -5.407  1.00 9.58  ? 227 VAL B CG2  1  
ATOM   1512  H H    . VAL B 2 88  ? -6.546  0.886   -5.749  1.00 0.00  ? 227 VAL B H    1  
ATOM   1513  H HA   . VAL B 2 88  ? -4.030  2.129   -5.071  1.00 0.00  ? 227 VAL B HA   1  
ATOM   1514  H HB   . VAL B 2 88  ? -4.803  0.206   -7.282  1.00 0.00  ? 227 VAL B HB   1  
ATOM   1515  H HG11 . VAL B 2 88  ? -2.299  1.660   -6.717  1.00 0.00  ? 227 VAL B HG11 1  
ATOM   1516  H HG12 . VAL B 2 88  ? -2.105  -0.084  -6.892  1.00 0.00  ? 227 VAL B HG12 1  
ATOM   1517  H HG13 . VAL B 2 88  ? -2.825  0.859   -8.197  1.00 0.00  ? 227 VAL B HG13 1  
ATOM   1518  H HG21 . VAL B 2 88  ? -4.990  -0.599  -4.920  1.00 0.00  ? 227 VAL B HG21 1  
ATOM   1519  H HG22 . VAL B 2 88  ? -3.751  -1.457  -5.835  1.00 0.00  ? 227 VAL B HG22 1  
ATOM   1520  H HG23 . VAL B 2 88  ? -3.288  -0.204  -4.684  1.00 0.00  ? 227 VAL B HG23 1  
ATOM   1521  N N    . ALA B 2 89  ? -5.608  3.243   -7.671  1.00 16.21 ? 228 ALA B N    1  
ATOM   1522  C CA   . ALA B 2 89  ? -5.570  4.309   -8.712  1.00 16.05 ? 228 ALA B CA   1  
ATOM   1523  C C    . ALA B 2 89  ? -5.682  5.679   -8.041  1.00 16.38 ? 228 ALA B C    1  
ATOM   1524  O O    . ALA B 2 89  ? -4.901  6.573   -8.297  1.00 17.42 ? 228 ALA B O    1  
ATOM   1525  C CB   . ALA B 2 89  ? -6.737  4.119   -9.683  1.00 17.50 ? 228 ALA B CB   1  
ATOM   1526  H H    . ALA B 2 89  ? -6.439  2.751   -7.504  1.00 0.00  ? 228 ALA B H    1  
ATOM   1527  H HA   . ALA B 2 89  ? -4.637  4.250   -9.254  1.00 0.00  ? 228 ALA B HA   1  
ATOM   1528  H HB1  . ALA B 2 89  ? -6.951  3.066   -9.787  1.00 0.00  ? 228 ALA B HB1  1  
ATOM   1529  H HB2  . ALA B 2 89  ? -7.609  4.628   -9.302  1.00 0.00  ? 228 ALA B HB2  1  
ATOM   1530  H HB3  . ALA B 2 89  ? -6.473  4.529   -10.647 1.00 0.00  ? 228 ALA B HB3  1  
ATOM   1531  N N    . TYR B 2 90  ? -6.648  5.851   -7.181  1.00 17.24 ? 229 TYR B N    1  
ATOM   1532  C CA   . TYR B 2 90  ? -6.806  7.161   -6.493  1.00 15.90 ? 229 TYR B CA   1  
ATOM   1533  C C    . TYR B 2 90  ? -5.480  7.553   -5.842  1.00 15.53 ? 229 TYR B C    1  
ATOM   1534  O O    . TYR B 2 90  ? -4.957  8.625   -6.075  1.00 15.40 ? 229 TYR B O    1  
ATOM   1535  C CB   . TYR B 2 90  ? -7.888  7.047   -5.418  1.00 17.41 ? 229 TYR B CB   1  
ATOM   1536  C CG   . TYR B 2 90  ? -8.464  8.413   -5.136  1.00 19.62 ? 229 TYR B CG   1  
ATOM   1537  C CD1  . TYR B 2 90  ? -8.874  9.236   -6.199  1.00 20.00 ? 229 TYR B CD1  1  
ATOM   1538  C CD2  . TYR B 2 90  ? -8.590  8.862   -3.811  1.00 19.06 ? 229 TYR B CD2  1  
ATOM   1539  C CE1  . TYR B 2 90  ? -9.409  10.508  -5.936  1.00 22.03 ? 229 TYR B CE1  1  
ATOM   1540  C CE2  . TYR B 2 90  ? -9.126  10.134  -3.548  1.00 20.67 ? 229 TYR B CE2  1  
ATOM   1541  C CZ   . TYR B 2 90  ? -9.536  10.957  -4.610  1.00 22.97 ? 229 TYR B CZ   1  
ATOM   1542  O OH   . TYR B 2 90  ? -10.062 12.206  -4.352  1.00 24.81 ? 229 TYR B OH   1  
ATOM   1543  H H    . TYR B 2 90  ? -7.267  5.117   -6.986  1.00 0.00  ? 229 TYR B H    1  
ATOM   1544  H HA   . TYR B 2 90  ? -7.091  7.914   -7.213  1.00 0.00  ? 229 TYR B HA   1  
ATOM   1545  H HB2  . TYR B 2 90  ? -8.672  6.389   -5.765  1.00 0.00  ? 229 TYR B HB2  1  
ATOM   1546  H HB3  . TYR B 2 90  ? -7.456  6.645   -4.513  1.00 0.00  ? 229 TYR B HB3  1  
ATOM   1547  H HD1  . TYR B 2 90  ? -8.777  8.891   -7.217  1.00 0.00  ? 229 TYR B HD1  1  
ATOM   1548  H HD2  . TYR B 2 90  ? -8.276  8.230   -2.994  1.00 0.00  ? 229 TYR B HD2  1  
ATOM   1549  H HE1  . TYR B 2 90  ? -9.724  11.141  -6.752  1.00 0.00  ? 229 TYR B HE1  1  
ATOM   1550  H HE2  . TYR B 2 90  ? -9.223  10.479  -2.529  1.00 0.00  ? 229 TYR B HE2  1  
ATOM   1551  H HH   . TYR B 2 90  ? -9.399  12.861  -4.584  1.00 0.00  ? 229 TYR B HH   1  
ATOM   1552  N N    . TYR B 2 91  ? -4.928  6.693   -5.030  1.00 15.18 ? 230 TYR B N    1  
ATOM   1553  C CA   . TYR B 2 91  ? -3.633  7.023   -4.371  1.00 16.33 ? 230 TYR B CA   1  
ATOM   1554  C C    . TYR B 2 91  ? -2.550  7.196   -5.438  1.00 16.83 ? 230 TYR B C    1  
ATOM   1555  O O    . TYR B 2 91  ? -1.559  7.865   -5.229  1.00 16.71 ? 230 TYR B O    1  
ATOM   1556  C CB   . TYR B 2 91  ? -3.239  5.892   -3.419  1.00 14.52 ? 230 TYR B CB   1  
ATOM   1557  C CG   . TYR B 2 91  ? -4.191  5.865   -2.247  1.00 16.10 ? 230 TYR B CG   1  
ATOM   1558  C CD1  . TYR B 2 91  ? -4.569  7.065   -1.620  1.00 15.88 ? 230 TYR B CD1  1  
ATOM   1559  C CD2  . TYR B 2 91  ? -4.700  4.640   -1.783  1.00 17.17 ? 230 TYR B CD2  1  
ATOM   1560  C CE1  . TYR B 2 91  ? -5.456  7.040   -0.531  1.00 17.12 ? 230 TYR B CE1  1  
ATOM   1561  C CE2  . TYR B 2 91  ? -5.586  4.615   -0.693  1.00 17.84 ? 230 TYR B CE2  1  
ATOM   1562  C CZ   . TYR B 2 91  ? -5.964  5.814   -0.067  1.00 17.32 ? 230 TYR B CZ   1  
ATOM   1563  O OH   . TYR B 2 91  ? -6.835  5.789   1.003   1.00 19.89 ? 230 TYR B OH   1  
ATOM   1564  H H    . TYR B 2 91  ? -5.364  5.831   -4.855  1.00 0.00  ? 230 TYR B H    1  
ATOM   1565  H HA   . TYR B 2 91  ? -3.737  7.943   -3.814  1.00 0.00  ? 230 TYR B HA   1  
ATOM   1566  H HB2  . TYR B 2 91  ? -3.285  4.948   -3.943  1.00 0.00  ? 230 TYR B HB2  1  
ATOM   1567  H HB3  . TYR B 2 91  ? -2.233  6.056   -3.061  1.00 0.00  ? 230 TYR B HB3  1  
ATOM   1568  H HD1  . TYR B 2 91  ? -4.179  8.007   -1.976  1.00 0.00  ? 230 TYR B HD1  1  
ATOM   1569  H HD2  . TYR B 2 91  ? -4.409  3.719   -2.264  1.00 0.00  ? 230 TYR B HD2  1  
ATOM   1570  H HE1  . TYR B 2 91  ? -5.747  7.962   -0.049  1.00 0.00  ? 230 TYR B HE1  1  
ATOM   1571  H HE2  . TYR B 2 91  ? -5.977  3.673   -0.337  1.00 0.00  ? 230 TYR B HE2  1  
ATOM   1572  H HH   . TYR B 2 91  ? -7.197  6.672   1.112   1.00 0.00  ? 230 TYR B HH   1  
ATOM   1573  N N    . SER B 2 92  ? -2.735  6.599   -6.585  1.00 17.92 ? 231 SER B N    1  
ATOM   1574  C CA   . SER B 2 92  ? -1.721  6.728   -7.670  1.00 22.15 ? 231 SER B CA   1  
ATOM   1575  C C    . SER B 2 92  ? -2.049  7.946   -8.538  1.00 22.66 ? 231 SER B C    1  
ATOM   1576  O O    . SER B 2 92  ? -1.763  7.971   -9.719  1.00 24.35 ? 231 SER B O    1  
ATOM   1577  C CB   . SER B 2 92  ? -1.744  5.468   -8.536  1.00 21.66 ? 231 SER B CB   1  
ATOM   1578  O OG   . SER B 2 92  ? -0.827  4.517   -8.011  1.00 28.41 ? 231 SER B OG   1  
ATOM   1579  H H    . SER B 2 92  ? -3.543  6.066   -6.733  1.00 0.00  ? 231 SER B H    1  
ATOM   1580  H HA   . SER B 2 92  ? -0.740  6.850   -7.236  1.00 0.00  ? 231 SER B HA   1  
ATOM   1581  H HB2  . SER B 2 92  ? -2.734  5.044   -8.531  1.00 0.00  ? 231 SER B HB2  1  
ATOM   1582  H HB3  . SER B 2 92  ? -1.472  5.725   -9.550  1.00 0.00  ? 231 SER B HB3  1  
ATOM   1583  H HG   . SER B 2 92  ? 0.055   4.766   -8.298  1.00 0.00  ? 231 SER B HG   1  
ATOM   1584  N N    . LYS B 2 93  ? -2.649  8.954   -7.967  1.00 24.70 ? 232 LYS B N    1  
ATOM   1585  C CA   . LYS B 2 93  ? -2.995  10.163  -8.765  1.00 27.78 ? 232 LYS B CA   1  
ATOM   1586  C C    . LYS B 2 93  ? -2.976  11.399  -7.863  1.00 29.48 ? 232 LYS B C    1  
ATOM   1587  O O    . LYS B 2 93  ? -2.499  12.450  -8.244  1.00 31.78 ? 232 LYS B O    1  
ATOM   1588  C CB   . LYS B 2 93  ? -4.389  9.995   -9.357  1.00 28.95 ? 232 LYS B CB   1  
ATOM   1589  C CG   . LYS B 2 93  ? -4.422  10.580  -10.770 1.00 35.04 ? 232 LYS B CG   1  
ATOM   1590  C CD   . LYS B 2 93  ? -4.399  9.443   -11.794 1.00 42.20 ? 232 LYS B CD   1  
ATOM   1591  C CE   . LYS B 2 93  ? -3.108  9.517   -12.610 1.00 46.43 ? 232 LYS B CE   1  
ATOM   1592  N NZ   . LYS B 2 93  ? -3.440  9.538   -14.063 1.00 50.42 ? 232 LYS B NZ   1  
ATOM   1593  H H    . LYS B 2 93  ? -2.874  8.917   -7.015  1.00 0.00  ? 232 LYS B H    1  
ATOM   1594  H HA   . LYS B 2 93  ? -2.279  10.287  -9.563  1.00 0.00  ? 232 LYS B HA   1  
ATOM   1595  H HB2  . LYS B 2 93  ? -4.642  8.945   -9.393  1.00 0.00  ? 232 LYS B HB2  1  
ATOM   1596  H HB3  . LYS B 2 93  ? -5.097  10.515  -8.737  1.00 0.00  ? 232 LYS B HB3  1  
ATOM   1597  H HG2  . LYS B 2 93  ? -5.323  11.162  -10.897 1.00 0.00  ? 232 LYS B HG2  1  
ATOM   1598  H HG3  . LYS B 2 93  ? -3.560  11.213  -10.918 1.00 0.00  ? 232 LYS B HG3  1  
ATOM   1599  H HD2  . LYS B 2 93  ? -4.446  8.494   -11.278 1.00 0.00  ? 232 LYS B HD2  1  
ATOM   1600  H HD3  . LYS B 2 93  ? -5.247  9.536   -12.455 1.00 0.00  ? 232 LYS B HD3  1  
ATOM   1601  H HE2  . LYS B 2 93  ? -2.569  10.416  -12.351 1.00 0.00  ? 232 LYS B HE2  1  
ATOM   1602  H HE3  . LYS B 2 93  ? -2.495  8.655   -12.394 1.00 0.00  ? 232 LYS B HE3  1  
ATOM   1603  H HZ1  . LYS B 2 93  ? -4.031  10.367  -14.272 1.00 0.00  ? 232 LYS B HZ1  1  
ATOM   1604  H HZ2  . LYS B 2 93  ? -2.561  9.590   -14.618 1.00 0.00  ? 232 LYS B HZ2  1  
ATOM   1605  H HZ3  . LYS B 2 93  ? -3.958  8.673   -14.313 1.00 0.00  ? 232 LYS B HZ3  1  
ATOM   1606  N N    . HIS B 2 94  ? -3.491  11.282  -6.672  1.00 31.24 ? 233 HIS B N    1  
ATOM   1607  C CA   . HIS B 2 94  ? -3.503  12.448  -5.746  1.00 31.51 ? 233 HIS B CA   1  
ATOM   1608  C C    . HIS B 2 94  ? -3.230  11.965  -4.321  1.00 28.20 ? 233 HIS B C    1  
ATOM   1609  O O    . HIS B 2 94  ? -4.041  11.290  -3.719  1.00 29.72 ? 233 HIS B O    1  
ATOM   1610  C CB   . HIS B 2 94  ? -4.871  13.131  -5.801  1.00 33.74 ? 233 HIS B CB   1  
ATOM   1611  C CG   . HIS B 2 94  ? -5.198  13.484  -7.226  1.00 39.30 ? 233 HIS B CG   1  
ATOM   1612  N ND1  . HIS B 2 94  ? -4.580  14.533  -7.889  1.00 40.06 ? 233 HIS B ND1  1  
ATOM   1613  C CD2  . HIS B 2 94  ? -6.078  12.937  -8.127  1.00 39.81 ? 233 HIS B CD2  1  
ATOM   1614  C CE1  . HIS B 2 94  ? -5.092  14.584  -9.132  1.00 41.81 ? 233 HIS B CE1  1  
ATOM   1615  N NE2  . HIS B 2 94  ? -6.009  13.633  -9.331  1.00 42.50 ? 233 HIS B NE2  1  
ATOM   1616  H H    . HIS B 2 94  ? -3.871  10.425  -6.384  1.00 0.00  ? 233 HIS B H    1  
ATOM   1617  H HA   . HIS B 2 94  ? -2.737  13.150  -6.042  1.00 0.00  ? 233 HIS B HA   1  
ATOM   1618  H HB2  . HIS B 2 94  ? -5.623  12.460  -5.414  1.00 0.00  ? 233 HIS B HB2  1  
ATOM   1619  H HB3  . HIS B 2 94  ? -4.848  14.030  -5.204  1.00 0.00  ? 233 HIS B HB3  1  
ATOM   1620  H HD1  . HIS B 2 94  ? -3.895  15.129  -7.519  1.00 0.00  ? 233 HIS B HD1  1  
ATOM   1621  H HD2  . HIS B 2 94  ? -6.725  12.095  -7.932  1.00 0.00  ? 233 HIS B HD2  1  
ATOM   1622  H HE1  . HIS B 2 94  ? -4.797  15.306  -9.879  1.00 0.00  ? 233 HIS B HE1  1  
ATOM   1623  N N    . ALA B 2 95  ? -2.093  12.303  -3.777  1.00 24.22 ? 234 ALA B N    1  
ATOM   1624  C CA   . ALA B 2 95  ? -1.769  11.860  -2.392  1.00 22.83 ? 234 ALA B CA   1  
ATOM   1625  C C    . ALA B 2 95  ? -2.978  12.103  -1.485  1.00 24.43 ? 234 ALA B C    1  
ATOM   1626  O O    . ALA B 2 95  ? -3.182  11.411  -0.508  1.00 23.70 ? 234 ALA B O    1  
ATOM   1627  C CB   . ALA B 2 95  ? -0.571  12.656  -1.871  1.00 19.43 ? 234 ALA B CB   1  
ATOM   1628  H H    . ALA B 2 95  ? -1.452  12.846  -4.281  1.00 0.00  ? 234 ALA B H    1  
ATOM   1629  H HA   . ALA B 2 95  ? -1.527  10.807  -2.398  1.00 0.00  ? 234 ALA B HA   1  
ATOM   1630  H HB1  . ALA B 2 95  ? 0.243   12.585  -2.577  1.00 0.00  ? 234 ALA B HB1  1  
ATOM   1631  H HB2  . ALA B 2 95  ? -0.852  13.692  -1.748  1.00 0.00  ? 234 ALA B HB2  1  
ATOM   1632  H HB3  . ALA B 2 95  ? -0.258  12.253  -0.919  1.00 0.00  ? 234 ALA B HB3  1  
ATOM   1633  N N    . ASP B 2 96  ? -3.781  13.082  -1.801  1.00 27.21 ? 235 ASP B N    1  
ATOM   1634  C CA   . ASP B 2 96  ? -4.975  13.367  -0.956  1.00 29.29 ? 235 ASP B CA   1  
ATOM   1635  C C    . ASP B 2 96  ? -4.541  13.517  0.503   1.00 28.86 ? 235 ASP B C    1  
ATOM   1636  O O    . ASP B 2 96  ? -5.246  13.130  1.414   1.00 29.80 ? 235 ASP B O    1  
ATOM   1637  C CB   . ASP B 2 96  ? -5.972  12.213  -1.076  1.00 35.17 ? 235 ASP B CB   1  
ATOM   1638  C CG   . ASP B 2 96  ? -6.442  12.093  -2.528  1.00 40.61 ? 235 ASP B CG   1  
ATOM   1639  O OD1  . ASP B 2 96  ? -6.799  13.109  -3.100  1.00 45.11 ? 235 ASP B OD1  1  
ATOM   1640  O OD2  . ASP B 2 96  ? -6.435  10.986  -3.042  1.00 46.14 ? 235 ASP B OD2  1  
ATOM   1641  H H    . ASP B 2 96  ? -3.600  13.629  -2.593  1.00 0.00  ? 235 ASP B H    1  
ATOM   1642  H HA   . ASP B 2 96  ? -5.441  14.283  -1.289  1.00 0.00  ? 235 ASP B HA   1  
ATOM   1643  H HB2  . ASP B 2 96  ? -5.495  11.292  -0.774  1.00 0.00  ? 235 ASP B HB2  1  
ATOM   1644  H HB3  . ASP B 2 96  ? -6.823  12.404  -0.440  1.00 0.00  ? 235 ASP B HB3  1  
ATOM   1645  N N    . GLY B 2 97  ? -3.383  14.074  0.732   1.00 27.14 ? 236 GLY B N    1  
ATOM   1646  C CA   . GLY B 2 97  ? -2.903  14.248  2.132   1.00 25.64 ? 236 GLY B CA   1  
ATOM   1647  C C    . GLY B 2 97  ? -2.088  13.023  2.549   1.00 24.14 ? 236 GLY B C    1  
ATOM   1648  O O    . GLY B 2 97  ? -1.902  12.758  3.720   1.00 24.47 ? 236 GLY B O    1  
ATOM   1649  H H    . GLY B 2 97  ? -2.829  14.379  -0.017  1.00 0.00  ? 236 GLY B H    1  
ATOM   1650  H HA2  . GLY B 2 97  ? -2.284  15.132  2.192   1.00 0.00  ? 236 GLY B HA2  1  
ATOM   1651  H HA3  . GLY B 2 97  ? -3.750  14.355  2.793   1.00 0.00  ? 236 GLY B HA3  1  
ATOM   1652  N N    . LEU B 2 98  ? -1.600  12.272  1.599   1.00 20.92 ? 237 LEU B N    1  
ATOM   1653  C CA   . LEU B 2 98  ? -0.797  11.065  1.943   1.00 19.13 ? 237 LEU B CA   1  
ATOM   1654  C C    . LEU B 2 98  ? 0.682   11.444  2.031   1.00 18.42 ? 237 LEU B C    1  
ATOM   1655  O O    . LEU B 2 98  ? 1.035   12.606  2.056   1.00 19.85 ? 237 LEU B O    1  
ATOM   1656  C CB   . LEU B 2 98  ? -0.987  9.998   0.863   1.00 19.72 ? 237 LEU B CB   1  
ATOM   1657  C CG   . LEU B 2 98  ? -2.018  8.971   1.336   1.00 21.67 ? 237 LEU B CG   1  
ATOM   1658  C CD1  . LEU B 2 98  ? -2.856  8.502   0.146   1.00 17.09 ? 237 LEU B CD1  1  
ATOM   1659  C CD2  . LEU B 2 98  ? -1.295  7.771   1.953   1.00 22.76 ? 237 LEU B CD2  1  
ATOM   1660  H H    . LEU B 2 98  ? -1.761  12.503  0.660   1.00 0.00  ? 237 LEU B H    1  
ATOM   1661  H HA   . LEU B 2 98  ? -1.125  10.675  2.896   1.00 0.00  ? 237 LEU B HA   1  
ATOM   1662  H HB2  . LEU B 2 98  ? -1.334  10.465  -0.047  1.00 0.00  ? 237 LEU B HB2  1  
ATOM   1663  H HB3  . LEU B 2 98  ? -0.047  9.501   0.677   1.00 0.00  ? 237 LEU B HB3  1  
ATOM   1664  H HG   . LEU B 2 98  ? -2.664  9.424   2.074   1.00 0.00  ? 237 LEU B HG   1  
ATOM   1665  H HD11 . LEU B 2 98  ? -2.244  8.491   -0.744  1.00 0.00  ? 237 LEU B HD11 1  
ATOM   1666  H HD12 . LEU B 2 98  ? -3.228  7.506   0.338   1.00 0.00  ? 237 LEU B HD12 1  
ATOM   1667  H HD13 . LEU B 2 98  ? -3.687  9.176   0.003   1.00 0.00  ? 237 LEU B HD13 1  
ATOM   1668  H HD21 . LEU B 2 98  ? -0.231  7.875   1.802   1.00 0.00  ? 237 LEU B HD21 1  
ATOM   1669  H HD22 . LEU B 2 98  ? -1.506  7.730   3.012   1.00 0.00  ? 237 LEU B HD22 1  
ATOM   1670  H HD23 . LEU B 2 98  ? -1.640  6.863   1.482   1.00 0.00  ? 237 LEU B HD23 1  
ATOM   1671  N N    . CYS B 2 99  ? 1.550   10.470  2.080   1.00 18.29 ? 238 CYS B N    1  
ATOM   1672  C CA   . CYS B 2 99  ? 3.004   10.771  2.169   1.00 17.21 ? 238 CYS B CA   1  
ATOM   1673  C C    . CYS B 2 99  ? 3.595   10.883  0.761   1.00 18.80 ? 238 CYS B C    1  
ATOM   1674  O O    . CYS B 2 99  ? 4.658   11.439  0.568   1.00 19.09 ? 238 CYS B O    1  
ATOM   1675  C CB   . CYS B 2 99  ? 3.704   9.642   2.924   1.00 17.49 ? 238 CYS B CB   1  
ATOM   1676  S SG   . CYS B 2 99  ? 3.321   8.060   2.133   1.00 18.25 ? 238 CYS B SG   1  
ATOM   1677  H H    . CYS B 2 99  ? 1.244   9.540   2.061   1.00 0.00  ? 238 CYS B H    1  
ATOM   1678  H HA   . CYS B 2 99  ? 3.149   11.702  2.697   1.00 0.00  ? 238 CYS B HA   1  
ATOM   1679  H HB2  . CYS B 2 99  ? 4.770   9.804   2.905   1.00 0.00  ? 238 CYS B HB2  1  
ATOM   1680  H HB3  . CYS B 2 99  ? 3.360   9.625   3.948   1.00 0.00  ? 238 CYS B HB3  1  
ATOM   1681  H HG   . CYS B 2 99  ? 4.094   7.782   1.635   1.00 0.00  ? 238 CYS B HG   1  
ATOM   1682  N N    . HIS B 2 100 ? 2.919   10.356  -0.224  1.00 17.96 ? 239 HIS B N    1  
ATOM   1683  C CA   . HIS B 2 100 ? 3.452   10.432  -1.614  1.00 18.41 ? 239 HIS B CA   1  
ATOM   1684  C C    . HIS B 2 100 ? 2.433   9.842   -2.591  1.00 18.79 ? 239 HIS B C    1  
ATOM   1685  O O    . HIS B 2 100 ? 1.610   9.025   -2.228  1.00 19.28 ? 239 HIS B O    1  
ATOM   1686  C CB   . HIS B 2 100 ? 4.757   9.638   -1.699  1.00 18.77 ? 239 HIS B CB   1  
ATOM   1687  C CG   . HIS B 2 100 ? 5.653   10.250  -2.740  1.00 18.40 ? 239 HIS B CG   1  
ATOM   1688  N ND1  . HIS B 2 100 ? 5.369   10.178  -4.095  1.00 18.53 ? 239 HIS B ND1  1  
ATOM   1689  C CD2  . HIS B 2 100 ? 6.831   10.948  -2.640  1.00 19.51 ? 239 HIS B CD2  1  
ATOM   1690  C CE1  . HIS B 2 100 ? 6.355   10.817  -4.750  1.00 19.04 ? 239 HIS B CE1  1  
ATOM   1691  N NE2  . HIS B 2 100 ? 7.272   11.306  -3.910  1.00 20.02 ? 239 HIS B NE2  1  
ATOM   1692  H H    . HIS B 2 100 ? 2.065   9.908   -0.049  1.00 0.00  ? 239 HIS B H    1  
ATOM   1693  H HA   . HIS B 2 100 ? 3.642   11.464  -1.871  1.00 0.00  ? 239 HIS B HA   1  
ATOM   1694  H HB2  . HIS B 2 100 ? 5.254   9.658   -0.740  1.00 0.00  ? 239 HIS B HB2  1  
ATOM   1695  H HB3  . HIS B 2 100 ? 4.538   8.615   -1.969  1.00 0.00  ? 239 HIS B HB3  1  
ATOM   1696  H HD1  . HIS B 2 100 ? 4.594   9.739   -4.502  1.00 0.00  ? 239 HIS B HD1  1  
ATOM   1697  H HD2  . HIS B 2 100 ? 7.339   11.182  -1.716  1.00 0.00  ? 239 HIS B HD2  1  
ATOM   1698  H HE1  . HIS B 2 100 ? 6.400   10.923  -5.824  1.00 0.00  ? 239 HIS B HE1  1  
ATOM   1699  N N    . ARG B 2 101 ? 2.484   10.247  -3.831  1.00 19.17 ? 240 ARG B N    1  
ATOM   1700  C CA   . ARG B 2 101 ? 1.523   9.710   -4.835  1.00 20.76 ? 240 ARG B CA   1  
ATOM   1701  C C    . ARG B 2 101 ? 2.020   8.360   -5.353  1.00 18.50 ? 240 ARG B C    1  
ATOM   1702  O O    . ARG B 2 101 ? 3.067   8.267   -5.963  1.00 17.06 ? 240 ARG B O    1  
ATOM   1703  C CB   . ARG B 2 101 ? 1.415   10.675  -6.009  1.00 25.30 ? 240 ARG B CB   1  
ATOM   1704  C CG   . ARG B 2 101 ? 0.276   10.221  -6.921  1.00 30.23 ? 240 ARG B CG   1  
ATOM   1705  C CD   . ARG B 2 101 ? -0.135  11.380  -7.819  1.00 37.22 ? 240 ARG B CD   1  
ATOM   1706  N NE   . ARG B 2 101 ? 1.078   11.993  -8.430  1.00 43.41 ? 240 ARG B NE   1  
ATOM   1707  C CZ   . ARG B 2 101 ? 1.326   11.818  -9.699  1.00 45.15 ? 240 ARG B CZ   1  
ATOM   1708  N NH1  . ARG B 2 101 ? 1.465   10.612  -10.177 1.00 46.15 ? 240 ARG B NH1  1  
ATOM   1709  N NH2  . ARG B 2 101 ? 1.434   12.850  -10.491 1.00 46.50 ? 240 ARG B NH2  1  
ATOM   1710  H H    . ARG B 2 101 ? 3.158   10.906  -4.102  1.00 0.00  ? 240 ARG B H    1  
ATOM   1711  H HA   . ARG B 2 101 ? 0.549   9.592   -4.385  1.00 0.00  ? 240 ARG B HA   1  
ATOM   1712  H HB2  . ARG B 2 101 ? 1.212   11.670  -5.641  1.00 0.00  ? 240 ARG B HB2  1  
ATOM   1713  H HB3  . ARG B 2 101 ? 2.341   10.675  -6.564  1.00 0.00  ? 240 ARG B HB3  1  
ATOM   1714  H HG2  . ARG B 2 101 ? 0.604   9.390   -7.529  1.00 0.00  ? 240 ARG B HG2  1  
ATOM   1715  H HG3  . ARG B 2 101 ? -0.571  9.916   -6.322  1.00 0.00  ? 240 ARG B HG3  1  
ATOM   1716  H HD2  . ARG B 2 101 ? -0.783  11.014  -8.597  1.00 0.00  ? 240 ARG B HD2  1  
ATOM   1717  H HD3  . ARG B 2 101 ? -0.655  12.120  -7.228  1.00 0.00  ? 240 ARG B HD3  1  
ATOM   1718  H HE   . ARG B 2 101 ? 1.688   12.527  -7.880  1.00 0.00  ? 240 ARG B HE   1  
ATOM   1719  H HH11 . ARG B 2 101 ? 1.381   9.821   -9.571  1.00 0.00  ? 240 ARG B HH11 1  
ATOM   1720  H HH12 . ARG B 2 101 ? 1.654   10.478  -11.150 1.00 0.00  ? 240 ARG B HH12 1  
ATOM   1721  H HH21 . ARG B 2 101 ? 1.326   13.775  -10.125 1.00 0.00  ? 240 ARG B HH21 1  
ATOM   1722  H HH22 . ARG B 2 101 ? 1.624   12.716  -11.464 1.00 0.00  ? 240 ARG B HH22 1  
ATOM   1723  N N    . LEU B 2 102 ? 1.275   7.315   -5.128  1.00 16.42 ? 241 LEU B N    1  
ATOM   1724  C CA   . LEU B 2 102 ? 1.702   5.977   -5.622  1.00 16.95 ? 241 LEU B CA   1  
ATOM   1725  C C    . LEU B 2 102 ? 2.147   6.101   -7.082  1.00 18.53 ? 241 LEU B C    1  
ATOM   1726  O O    . LEU B 2 102 ? 1.429   6.619   -7.914  1.00 19.32 ? 241 LEU B O    1  
ATOM   1727  C CB   . LEU B 2 102 ? 0.522   5.010   -5.530  1.00 12.02 ? 241 LEU B CB   1  
ATOM   1728  C CG   . LEU B 2 102 ? 0.052   4.909   -4.077  1.00 10.93 ? 241 LEU B CG   1  
ATOM   1729  C CD1  . LEU B 2 102 ? -0.969  3.778   -3.946  1.00 7.07  ? 241 LEU B CD1  1  
ATOM   1730  C CD2  . LEU B 2 102 ? 1.250   4.619   -3.170  1.00 9.30  ? 241 LEU B CD2  1  
ATOM   1731  H H    . LEU B 2 102 ? 0.430   7.411   -4.642  1.00 0.00  ? 241 LEU B H    1  
ATOM   1732  H HA   . LEU B 2 102 ? 2.521   5.611   -5.021  1.00 0.00  ? 241 LEU B HA   1  
ATOM   1733  H HB2  . LEU B 2 102 ? -0.287  5.378   -6.144  1.00 0.00  ? 241 LEU B HB2  1  
ATOM   1734  H HB3  . LEU B 2 102 ? 0.826   4.034   -5.877  1.00 0.00  ? 241 LEU B HB3  1  
ATOM   1735  H HG   . LEU B 2 102 ? -0.407  5.842   -3.783  1.00 0.00  ? 241 LEU B HG   1  
ATOM   1736  H HD11 . LEU B 2 102 ? -1.452  3.616   -4.898  1.00 0.00  ? 241 LEU B HD11 1  
ATOM   1737  H HD12 . LEU B 2 102 ? -0.466  2.872   -3.640  1.00 0.00  ? 241 LEU B HD12 1  
ATOM   1738  H HD13 . LEU B 2 102 ? -1.710  4.045   -3.207  1.00 0.00  ? 241 LEU B HD13 1  
ATOM   1739  H HD21 . LEU B 2 102 ? 1.911   3.919   -3.659  1.00 0.00  ? 241 LEU B HD21 1  
ATOM   1740  H HD22 . LEU B 2 102 ? 1.782   5.538   -2.972  1.00 0.00  ? 241 LEU B HD22 1  
ATOM   1741  H HD23 . LEU B 2 102 ? 0.903   4.197   -2.239  1.00 0.00  ? 241 LEU B HD23 1  
ATOM   1742  N N    . THR B 2 103 ? 3.327   5.641   -7.403  1.00 20.81 ? 242 THR B N    1  
ATOM   1743  C CA   . THR B 2 103 ? 3.802   5.751   -8.812  1.00 20.89 ? 242 THR B CA   1  
ATOM   1744  C C    . THR B 2 103 ? 4.404   4.421   -9.273  1.00 21.74 ? 242 THR B C    1  
ATOM   1745  O O    . THR B 2 103 ? 4.246   4.022   -10.410 1.00 24.76 ? 242 THR B O    1  
ATOM   1746  C CB   . THR B 2 103 ? 4.867   6.847   -8.906  1.00 20.18 ? 242 THR B CB   1  
ATOM   1747  O OG1  . THR B 2 103 ? 5.793   6.698   -7.838  1.00 22.88 ? 242 THR B OG1  1  
ATOM   1748  C CG2  . THR B 2 103 ? 4.200   8.220   -8.817  1.00 19.22 ? 242 THR B CG2  1  
ATOM   1749  H H    . THR B 2 103 ? 3.899   5.232   -6.720  1.00 0.00  ? 242 THR B H    1  
ATOM   1750  H HA   . THR B 2 103 ? 2.970   6.008   -9.451  1.00 0.00  ? 242 THR B HA   1  
ATOM   1751  H HB   . THR B 2 103 ? 5.387   6.765   -9.848  1.00 0.00  ? 242 THR B HB   1  
ATOM   1752  H HG1  . THR B 2 103 ? 5.367   6.997   -7.032  1.00 0.00  ? 242 THR B HG1  1  
ATOM   1753  H HG21 . THR B 2 103 ? 3.149   8.125   -9.048  1.00 0.00  ? 242 THR B HG21 1  
ATOM   1754  H HG22 . THR B 2 103 ? 4.315   8.613   -7.818  1.00 0.00  ? 242 THR B HG22 1  
ATOM   1755  H HG23 . THR B 2 103 ? 4.664   8.892   -9.524  1.00 0.00  ? 242 THR B HG23 1  
ATOM   1756  N N    . THR B 2 104 ? 5.100   3.733   -8.410  1.00 20.71 ? 243 THR B N    1  
ATOM   1757  C CA   . THR B 2 104 ? 5.713   2.437   -8.821  1.00 18.86 ? 243 THR B CA   1  
ATOM   1758  C C    . THR B 2 104 ? 5.155   1.299   -7.964  1.00 18.56 ? 243 THR B C    1  
ATOM   1759  O O    . THR B 2 104 ? 4.351   1.509   -7.078  1.00 18.28 ? 243 THR B O    1  
ATOM   1760  C CB   . THR B 2 104 ? 7.231   2.514   -8.640  1.00 20.42 ? 243 THR B CB   1  
ATOM   1761  O OG1  . THR B 2 104 ? 7.677   3.827   -8.947  1.00 20.70 ? 243 THR B OG1  1  
ATOM   1762  C CG2  . THR B 2 104 ? 7.909   1.510   -9.574  1.00 16.38 ? 243 THR B CG2  1  
ATOM   1763  H H    . THR B 2 104 ? 5.225   4.070   -7.498  1.00 0.00  ? 243 THR B H    1  
ATOM   1764  H HA   . THR B 2 104 ? 5.486   2.247   -9.859  1.00 0.00  ? 243 THR B HA   1  
ATOM   1765  H HB   . THR B 2 104 ? 7.484   2.276   -7.618  1.00 0.00  ? 243 THR B HB   1  
ATOM   1766  H HG1  . THR B 2 104 ? 7.599   3.953   -9.896  1.00 0.00  ? 243 THR B HG1  1  
ATOM   1767  H HG21 . THR B 2 104 ? 7.275   1.330   -10.430 1.00 0.00  ? 243 THR B HG21 1  
ATOM   1768  H HG22 . THR B 2 104 ? 8.856   1.910   -9.905  1.00 0.00  ? 243 THR B HG22 1  
ATOM   1769  H HG23 . THR B 2 104 ? 8.074   0.582   -9.047  1.00 0.00  ? 243 THR B HG23 1  
ATOM   1770  N N    . VAL B 2 105 ? 5.581   0.093   -8.226  1.00 16.29 ? 244 VAL B N    1  
ATOM   1771  C CA   . VAL B 2 105 ? 5.084   -1.069  -7.435  1.00 16.81 ? 244 VAL B CA   1  
ATOM   1772  C C    . VAL B 2 105 ? 6.274   -1.923  -6.991  1.00 16.74 ? 244 VAL B C    1  
ATOM   1773  O O    . VAL B 2 105 ? 7.393   -1.713  -7.415  1.00 17.40 ? 244 VAL B O    1  
ATOM   1774  C CB   . VAL B 2 105 ? 4.150   -1.912  -8.304  1.00 17.29 ? 244 VAL B CB   1  
ATOM   1775  C CG1  . VAL B 2 105 ? 3.387   -2.903  -7.424  1.00 17.99 ? 244 VAL B CG1  1  
ATOM   1776  C CG2  . VAL B 2 105 ? 3.155   -0.995  -9.020  1.00 17.19 ? 244 VAL B CG2  1  
ATOM   1777  H H    . VAL B 2 105 ? 6.230   -0.049  -8.946  1.00 0.00  ? 244 VAL B H    1  
ATOM   1778  H HA   . VAL B 2 105 ? 4.548   -0.714  -6.567  1.00 0.00  ? 244 VAL B HA   1  
ATOM   1779  H HB   . VAL B 2 105 ? 4.732   -2.455  -9.035  1.00 0.00  ? 244 VAL B HB   1  
ATOM   1780  H HG11 . VAL B 2 105 ? 3.080   -2.412  -6.512  1.00 0.00  ? 244 VAL B HG11 1  
ATOM   1781  H HG12 . VAL B 2 105 ? 2.515   -3.257  -7.953  1.00 0.00  ? 244 VAL B HG12 1  
ATOM   1782  H HG13 . VAL B 2 105 ? 4.028   -3.739  -7.185  1.00 0.00  ? 244 VAL B HG13 1  
ATOM   1783  H HG21 . VAL B 2 105 ? 3.246   0.008   -8.631  1.00 0.00  ? 244 VAL B HG21 1  
ATOM   1784  H HG22 . VAL B 2 105 ? 3.366   -0.992  -10.079 1.00 0.00  ? 244 VAL B HG22 1  
ATOM   1785  H HG23 . VAL B 2 105 ? 2.150   -1.355  -8.854  1.00 0.00  ? 244 VAL B HG23 1  
ATOM   1786  N N    . CYS B 2 106 ? 6.043   -2.886  -6.142  1.00 15.40 ? 245 CYS B N    1  
ATOM   1787  C CA   . CYS B 2 106 ? 7.163   -3.752  -5.676  1.00 16.70 ? 245 CYS B CA   1  
ATOM   1788  C C    . CYS B 2 106 ? 7.641   -4.631  -6.842  1.00 16.64 ? 245 CYS B C    1  
ATOM   1789  O O    . CYS B 2 106 ? 6.833   -5.169  -7.572  1.00 17.47 ? 245 CYS B O    1  
ATOM   1790  C CB   . CYS B 2 106 ? 6.671   -4.643  -4.532  1.00 15.93 ? 245 CYS B CB   1  
ATOM   1791  S SG   . CYS B 2 106 ? 7.957   -5.840  -4.096  1.00 18.24 ? 245 CYS B SG   1  
ATOM   1792  H H    . CYS B 2 106 ? 5.133   -3.041  -5.812  1.00 0.00  ? 245 CYS B H    1  
ATOM   1793  H HA   . CYS B 2 106 ? 7.973   -3.131  -5.328  1.00 0.00  ? 245 CYS B HA   1  
ATOM   1794  H HB2  . CYS B 2 106 ? 6.445   -4.030  -3.672  1.00 0.00  ? 245 CYS B HB2  1  
ATOM   1795  H HB3  . CYS B 2 106 ? 5.780   -5.168  -4.843  1.00 0.00  ? 245 CYS B HB3  1  
ATOM   1796  H HG   . CYS B 2 106 ? 8.466   -6.030  -4.887  1.00 0.00  ? 245 CYS B HG   1  
ATOM   1797  N N    . PRO B 2 107 ? 8.941   -4.754  -6.986  1.00 18.63 ? 246 PRO B N    1  
ATOM   1798  C CA   . PRO B 2 107 ? 9.541   -5.565  -8.061  1.00 19.52 ? 246 PRO B CA   1  
ATOM   1799  C C    . PRO B 2 107 ? 9.475   -7.054  -7.707  1.00 19.33 ? 246 PRO B C    1  
ATOM   1800  O O    . PRO B 2 107 ? 10.512  -7.696  -7.735  1.00 19.97 ? 246 PRO B O    1  
ATOM   1801  C CB   . PRO B 2 107 ? 10.992  -5.080  -8.113  1.00 18.97 ? 246 PRO B CB   1  
ATOM   1802  C CG   . PRO B 2 107 ? 11.292  -4.454  -6.731  1.00 18.88 ? 246 PRO B CG   1  
ATOM   1803  C CD   . PRO B 2 107 ? 9.931   -4.102  -6.101  1.00 17.74 ? 246 PRO B CD   1  
ATOM   1804  O OXT  . PRO B 2 107 ? 8.388   -7.525  -7.415  1.00 0.00  ? 246 PRO B OXT  1  
ATOM   1805  H HA   . PRO B 2 107 ? 9.053   -5.373  -9.003  1.00 0.00  ? 246 PRO B HA   1  
ATOM   1806  H HB2  . PRO B 2 107 ? 11.655  -5.915  -8.299  1.00 0.00  ? 246 PRO B HB2  1  
ATOM   1807  H HB3  . PRO B 2 107 ? 11.107  -4.334  -8.883  1.00 0.00  ? 246 PRO B HB3  1  
ATOM   1808  H HG2  . PRO B 2 107 ? 11.819  -5.166  -6.110  1.00 0.00  ? 246 PRO B HG2  1  
ATOM   1809  H HG3  . PRO B 2 107 ? 11.881  -3.558  -6.850  1.00 0.00  ? 246 PRO B HG3  1  
ATOM   1810  H HD2  . PRO B 2 107 ? 9.867   -4.500  -5.098  1.00 0.00  ? 246 PRO B HD2  1  
ATOM   1811  H HD3  . PRO B 2 107 ? 9.780   -3.034  -6.098  1.00 0.00  ? 246 PRO B HD3  1  
HETATM 1812  C C    . ACE A 1 1   ? 1.067   0.769   12.018  1.00 14.10 ? 100 ACE A C    2  
HETATM 1813  O O    . ACE A 1 1   ? 2.067   0.918   11.343  1.00 14.64 ? 100 ACE A O    2  
HETATM 1814  C CH3  . ACE A 1 1   ? 1.154   0.294   13.471  1.00 14.17 ? 100 ACE A CH3  2  
HETATM 1815  H H1   . ACE A 1 1   ? 1.306   -0.776  13.491  1.00 0.00  ? 100 ACE A H1   2  
HETATM 1816  H H2   . ACE A 1 1   ? 1.981   0.784   13.961  1.00 0.00  ? 100 ACE A H2   2  
HETATM 1817  H H3   . ACE A 1 1   ? 0.235   0.537   13.984  1.00 0.00  ? 100 ACE A H3   2  
HETATM 1818  N N    . PTR A 1 2   ? -0.120  1.008   11.533  1.00 14.28 ? 101 PTR A N    2  
HETATM 1819  C CA   . PTR A 1 2   ? -0.268  1.473   10.124  1.00 13.54 ? 101 PTR A CA   2  
HETATM 1820  C C    . PTR A 1 2   ? -0.469  2.990   10.106  1.00 14.12 ? 101 PTR A C    2  
HETATM 1821  O O    . PTR A 1 2   ? -1.068  3.558   10.998  1.00 13.97 ? 101 PTR A O    2  
HETATM 1822  C CB   . PTR A 1 2   ? -1.480  0.790   9.486   1.00 13.83 ? 101 PTR A CB   2  
HETATM 1823  C CG   . PTR A 1 2   ? -1.135  -0.639  9.143   1.00 12.91 ? 101 PTR A CG   2  
HETATM 1824  C CD1  . PTR A 1 2   ? -0.507  -0.936  7.921   1.00 12.17 ? 101 PTR A CD1  2  
HETATM 1825  C CD2  . PTR A 1 2   ? -1.443  -1.672  10.043  1.00 12.70 ? 101 PTR A CD2  2  
HETATM 1826  C CE1  . PTR A 1 2   ? -0.187  -2.266  7.601   1.00 12.08 ? 101 PTR A CE1  2  
HETATM 1827  C CE2  . PTR A 1 2   ? -1.124  -3.002  9.722   1.00 11.44 ? 101 PTR A CE2  2  
HETATM 1828  C CZ   . PTR A 1 2   ? -0.496  -3.300  8.501   1.00 13.78 ? 101 PTR A CZ   2  
HETATM 1829  O OH   . PTR A 1 2   ? -0.171  -4.654  8.174   1.00 14.51 ? 101 PTR A OH   2  
HETATM 1830  P P    . PTR A 1 2   ? 1.294   -5.246  8.478   1.00 17.94 ? 101 PTR A P    2  
HETATM 1831  O O1P  . PTR A 1 2   ? 1.018   -6.654  8.842   1.00 18.17 ? 101 PTR A O1P  2  
HETATM 1832  O O2P  . PTR A 1 2   ? 1.777   -4.396  9.589   1.00 15.88 ? 101 PTR A O2P  2  
HETATM 1833  O O3P  . PTR A 1 2   ? 2.005   -5.061  7.194   1.00 18.41 ? 101 PTR A O3P  2  
HETATM 1834  H H    . PTR A 1 2   ? -0.913  0.881   12.093  1.00 0.00  ? 101 PTR A H    2  
HETATM 1835  H HA   . PTR A 1 2   ? 0.621   1.220   9.566   1.00 0.00  ? 101 PTR A HA   2  
HETATM 1836  H HB2  . PTR A 1 2   ? -2.308  0.804   10.181  1.00 0.00  ? 101 PTR A HB2  2  
HETATM 1837  H HB3  . PTR A 1 2   ? -1.758  1.319   8.586   1.00 0.00  ? 101 PTR A HB3  2  
HETATM 1838  H HD1  . PTR A 1 2   ? -0.269  -0.143  7.228   1.00 0.00  ? 101 PTR A HD1  2  
HETATM 1839  H HD2  . PTR A 1 2   ? -1.927  -1.444  10.981  1.00 0.00  ? 101 PTR A HD2  2  
HETATM 1840  H HE1  . PTR A 1 2   ? 0.295   -2.495  6.662   1.00 0.00  ? 101 PTR A HE1  2  
HETATM 1841  H HE2  . PTR A 1 2   ? -1.361  -3.797  10.415  1.00 0.00  ? 101 PTR A HE2  2  
ATOM   1842  N N    . GLU A 1 3   ? 0.029   3.651   9.096   1.00 15.01 ? 102 GLU A N    2  
ATOM   1843  C CA   . GLU A 1 3   ? -0.132  5.130   9.020   1.00 18.67 ? 102 GLU A CA   2  
ATOM   1844  C C    . GLU A 1 3   ? -1.612  5.492   9.157   1.00 23.30 ? 102 GLU A C    2  
ATOM   1845  O O    . GLU A 1 3   ? -2.454  4.638   9.363   1.00 23.42 ? 102 GLU A O    2  
ATOM   1846  C CB   . GLU A 1 3   ? 0.392   5.630   7.672   1.00 18.41 ? 102 GLU A CB   2  
ATOM   1847  C CG   . GLU A 1 3   ? 1.915   5.487   7.631   1.00 20.30 ? 102 GLU A CG   2  
ATOM   1848  C CD   . GLU A 1 3   ? 2.564   6.822   7.999   1.00 19.75 ? 102 GLU A CD   2  
ATOM   1849  O OE1  . GLU A 1 3   ? 2.516   7.727   7.182   1.00 19.69 ? 102 GLU A OE1  2  
ATOM   1850  O OE2  . GLU A 1 3   ? 3.098   6.916   9.092   1.00 21.81 ? 102 GLU A OE2  2  
ATOM   1851  H H    . GLU A 1 3   ? 0.508   3.174   8.388   1.00 0.00  ? 102 GLU A H    2  
ATOM   1852  H HA   . GLU A 1 3   ? 0.427   5.594   9.819   1.00 0.00  ? 102 GLU A HA   2  
ATOM   1853  H HB2  . GLU A 1 3   ? -0.048  5.047   6.877   1.00 0.00  ? 102 GLU A HB2  2  
ATOM   1854  H HB3  . GLU A 1 3   ? 0.127   6.670   7.546   1.00 0.00  ? 102 GLU A HB3  2  
ATOM   1855  H HG2  . GLU A 1 3   ? 2.223   4.728   8.336   1.00 0.00  ? 102 GLU A HG2  2  
ATOM   1856  H HG3  . GLU A 1 3   ? 2.222   5.201   6.637   1.00 0.00  ? 102 GLU A HG3  2  
ATOM   1857  N N    . GLU A 1 4   ? -1.938  6.751   9.048   1.00 29.30 ? 103 GLU A N    2  
ATOM   1858  C CA   . GLU A 1 4   ? -3.363  7.168   9.173   1.00 35.63 ? 103 GLU A CA   2  
ATOM   1859  C C    . GLU A 1 4   ? -3.635  8.347   8.238   1.00 37.94 ? 103 GLU A C    2  
ATOM   1860  O O    . GLU A 1 4   ? -2.877  9.296   8.185   1.00 40.44 ? 103 GLU A O    2  
ATOM   1861  C CB   . GLU A 1 4   ? -3.644  7.588   10.617  1.00 38.84 ? 103 GLU A CB   2  
ATOM   1862  C CG   . GLU A 1 4   ? -3.970  6.350   11.456  1.00 44.99 ? 103 GLU A CG   2  
ATOM   1863  C CD   . GLU A 1 4   ? -5.210  6.624   12.310  1.00 50.48 ? 103 GLU A CD   2  
ATOM   1864  O OE1  . GLU A 1 4   ? -5.203  7.609   13.030  1.00 53.57 ? 103 GLU A OE1  2  
ATOM   1865  O OE2  . GLU A 1 4   ? -6.145  5.844   12.229  1.00 53.04 ? 103 GLU A OE2  2  
ATOM   1866  H H    . GLU A 1 4   ? -1.244  7.424   8.884   1.00 0.00  ? 103 GLU A H    2  
ATOM   1867  H HA   . GLU A 1 4   ? -4.005  6.340   8.907   1.00 0.00  ? 103 GLU A HA   2  
ATOM   1868  H HB2  . GLU A 1 4   ? -2.772  8.079   11.024  1.00 0.00  ? 103 GLU A HB2  2  
ATOM   1869  H HB3  . GLU A 1 4   ? -4.483  8.266   10.638  1.00 0.00  ? 103 GLU A HB3  2  
ATOM   1870  H HG2  . GLU A 1 4   ? -4.161  5.512   10.802  1.00 0.00  ? 103 GLU A HG2  2  
ATOM   1871  H HG3  . GLU A 1 4   ? -3.135  6.121   12.101  1.00 0.00  ? 103 GLU A HG3  2  
ATOM   1872  N N    . ILE A 1 5   ? -4.710  8.298   7.499   1.00 39.26 ? 104 ILE A N    2  
ATOM   1873  C CA   . ILE A 1 5   ? -5.028  9.418   6.569   1.00 40.91 ? 104 ILE A CA   2  
ATOM   1874  C C    . ILE A 1 5   ? -5.799  10.502  7.324   1.00 42.72 ? 104 ILE A C    2  
ATOM   1875  O O    . ILE A 1 5   ? -7.006  10.438  7.460   1.00 43.33 ? 104 ILE A O    2  
ATOM   1876  C CB   . ILE A 1 5   ? -5.883  8.897   5.413   1.00 40.30 ? 104 ILE A CB   2  
ATOM   1877  C CG1  . ILE A 1 5   ? -5.055  7.934   4.559   1.00 39.28 ? 104 ILE A CG1  2  
ATOM   1878  C CG2  . ILE A 1 5   ? -6.344  10.073  4.549   1.00 41.44 ? 104 ILE A CG2  2  
ATOM   1879  C CD1  . ILE A 1 5   ? -3.935  8.706   3.859   1.00 37.66 ? 104 ILE A CD1  2  
ATOM   1880  H H    . ILE A 1 5   ? -5.309  7.524   7.557   1.00 0.00  ? 104 ILE A H    2  
ATOM   1881  H HA   . ILE A 1 5   ? -4.111  9.834   6.180   1.00 0.00  ? 104 ILE A HA   2  
ATOM   1882  H HB   . ILE A 1 5   ? -6.746  8.380   5.808   1.00 0.00  ? 104 ILE A HB   2  
ATOM   1883  H HG12 . ILE A 1 5   ? -4.626  7.170   5.192   1.00 0.00  ? 104 ILE A HG12 2  
ATOM   1884  H HG13 . ILE A 1 5   ? -5.689  7.473   3.818   1.00 0.00  ? 104 ILE A HG13 2  
ATOM   1885  H HG21 . ILE A 1 5   ? -5.487  10.660  4.252   1.00 0.00  ? 104 ILE A HG21 2  
ATOM   1886  H HG22 . ILE A 1 5   ? -6.845  9.698   3.669   1.00 0.00  ? 104 ILE A HG22 2  
ATOM   1887  H HG23 . ILE A 1 5   ? -7.025  10.690  5.115   1.00 0.00  ? 104 ILE A HG23 2  
ATOM   1888  H HD11 . ILE A 1 5   ? -4.363  9.494   3.257   1.00 0.00  ? 104 ILE A HD11 2  
ATOM   1889  H HD12 . ILE A 1 5   ? -3.278  9.137   4.600   1.00 0.00  ? 104 ILE A HD12 2  
ATOM   1890  H HD13 . ILE A 1 5   ? -3.375  8.033   3.228   1.00 0.00  ? 104 ILE A HD13 2  
ATOM   1891  N N    . GLU A 1 6   ? -5.115  11.497  7.817   1.00 0.00  ? 105 GLU A N    2  
ATOM   1892  C CA   . GLU A 1 6   ? -5.811  12.582  8.563   1.00 0.00  ? 105 GLU A CA   2  
ATOM   1893  C C    . GLU A 1 6   ? -5.166  13.928  8.224   1.00 0.00  ? 105 GLU A C    2  
ATOM   1894  O O    . GLU A 1 6   ? -5.053  14.229  7.047   1.00 0.00  ? 105 GLU A O    2  
ATOM   1895  C CB   . GLU A 1 6   ? -5.692  12.324  10.066  1.00 0.00  ? 105 GLU A CB   2  
ATOM   1896  C CG   . GLU A 1 6   ? -6.640  11.191  10.466  1.00 0.00  ? 105 GLU A CG   2  
ATOM   1897  C CD   . GLU A 1 6   ? -8.078  11.714  10.489  1.00 0.00  ? 105 GLU A CD   2  
ATOM   1898  O OE1  . GLU A 1 6   ? -8.388  12.500  11.369  1.00 0.00  ? 105 GLU A OE1  2  
ATOM   1899  O OE2  . GLU A 1 6   ? -8.846  11.318  9.627   1.00 0.00  ? 105 GLU A OE2  2  
ATOM   1900  O OXT  . GLU A 1 6   ? -4.798  14.636  9.147   1.00 0.00  ? 105 GLU A OXT  2  
ATOM   1901  H H    . GLU A 1 6   ? -4.143  11.530  7.697   1.00 0.00  ? 105 GLU A H    2  
ATOM   1902  H HA   . GLU A 1 6   ? -6.854  12.601  8.282   1.00 0.00  ? 105 GLU A HA   2  
ATOM   1903  H HB2  . GLU A 1 6   ? -4.675  12.042  10.302  1.00 0.00  ? 105 GLU A HB2  2  
ATOM   1904  H HB3  . GLU A 1 6   ? -5.954  13.219  10.608  1.00 0.00  ? 105 GLU A HB3  2  
ATOM   1905  H HG2  . GLU A 1 6   ? -6.561  10.386  9.750   1.00 0.00  ? 105 GLU A HG2  2  
ATOM   1906  H HG3  . GLU A 1 6   ? -6.375  10.829  11.447  1.00 0.00  ? 105 GLU A HG3  2  
ATOM   1907  N N    . MET B 2 1   ? -8.281  -7.295  -19.186 1.00 0.00  ? 140 MET B N    2  
ATOM   1908  C CA   . MET B 2 1   ? -7.344  -8.358  -18.726 1.00 0.00  ? 140 MET B CA   2  
ATOM   1909  C C    . MET B 2 1   ? -6.606  -7.879  -17.474 1.00 0.00  ? 140 MET B C    2  
ATOM   1910  O O    . MET B 2 1   ? -5.462  -7.475  -17.533 1.00 0.00  ? 140 MET B O    2  
ATOM   1911  C CB   . MET B 2 1   ? -6.330  -8.659  -19.831 1.00 0.00  ? 140 MET B CB   2  
ATOM   1912  C CG   . MET B 2 1   ? -7.050  -9.281  -21.030 1.00 0.00  ? 140 MET B CG   2  
ATOM   1913  S SD   . MET B 2 1   ? -5.841  -10.089 -22.106 1.00 0.00  ? 140 MET B SD   2  
ATOM   1914  C CE   . MET B 2 1   ? -6.824  -10.043 -23.626 1.00 0.00  ? 140 MET B CE   2  
ATOM   1915  H H1   . MET B 2 1   ? -8.003  -6.384  -18.769 1.00 0.00  ? 140 MET B H1   2  
ATOM   1916  H H2   . MET B 2 1   ? -8.246  -7.228  -20.224 1.00 0.00  ? 140 MET B H2   2  
ATOM   1917  H H3   . MET B 2 1   ? -9.249  -7.533  -18.889 1.00 0.00  ? 140 MET B H3   2  
ATOM   1918  H HA   . MET B 2 1   ? -7.901  -9.254  -18.495 1.00 0.00  ? 140 MET B HA   2  
ATOM   1919  H HB2  . MET B 2 1   ? -5.848  -7.741  -20.137 1.00 0.00  ? 140 MET B HB2  2  
ATOM   1920  H HB3  . MET B 2 1   ? -5.587  -9.350  -19.462 1.00 0.00  ? 140 MET B HB3  2  
ATOM   1921  H HG2  . MET B 2 1   ? -7.765  -10.010 -20.680 1.00 0.00  ? 140 MET B HG2  2  
ATOM   1922  H HG3  . MET B 2 1   ? -7.564  -8.508  -21.581 1.00 0.00  ? 140 MET B HG3  2  
ATOM   1923  H HE1  . MET B 2 1   ? -7.107  -9.021  -23.837 1.00 0.00  ? 140 MET B HE1  2  
ATOM   1924  H HE2  . MET B 2 1   ? -6.240  -10.429 -24.445 1.00 0.00  ? 140 MET B HE2  2  
ATOM   1925  H HE3  . MET B 2 1   ? -7.710  -10.649 -23.499 1.00 0.00  ? 140 MET B HE3  2  
ATOM   1926  N N    . ASP B 2 2   ? -7.251  -7.922  -16.340 1.00 0.00  ? 141 ASP B N    2  
ATOM   1927  C CA   . ASP B 2 2   ? -6.585  -7.470  -15.086 1.00 0.00  ? 141 ASP B CA   2  
ATOM   1928  C C    . ASP B 2 2   ? -7.143  -8.258  -13.899 1.00 0.00  ? 141 ASP B C    2  
ATOM   1929  O O    . ASP B 2 2   ? -7.657  -7.694  -12.954 1.00 0.00  ? 141 ASP B O    2  
ATOM   1930  C CB   . ASP B 2 2   ? -6.851  -5.977  -14.878 1.00 0.00  ? 141 ASP B CB   2  
ATOM   1931  C CG   . ASP B 2 2   ? -5.541  -5.201  -15.012 1.00 0.00  ? 141 ASP B CG   2  
ATOM   1932  O OD1  . ASP B 2 2   ? -4.692  -5.357  -14.150 1.00 0.00  ? 141 ASP B OD1  2  
ATOM   1933  O OD2  . ASP B 2 2   ? -5.408  -4.464  -15.976 1.00 0.00  ? 141 ASP B OD2  2  
ATOM   1934  H H    . ASP B 2 2   ? -8.173  -8.253  -16.314 1.00 0.00  ? 141 ASP B H    2  
ATOM   1935  H HA   . ASP B 2 2   ? -5.522  -7.638  -15.162 1.00 0.00  ? 141 ASP B HA   2  
ATOM   1936  H HB2  . ASP B 2 2   ? -7.555  -5.630  -15.621 1.00 0.00  ? 141 ASP B HB2  2  
ATOM   1937  H HB3  . ASP B 2 2   ? -7.262  -5.819  -13.891 1.00 0.00  ? 141 ASP B HB3  2  
ATOM   1938  N N    . SER B 2 3   ? -7.046  -9.558  -13.940 1.00 0.00  ? 142 SER B N    2  
ATOM   1939  C CA   . SER B 2 3   ? -7.571  -10.381 -12.814 1.00 0.00  ? 142 SER B CA   2  
ATOM   1940  C C    . SER B 2 3   ? -6.968  -9.887  -11.497 1.00 0.00  ? 142 SER B C    2  
ATOM   1941  O O    . SER B 2 3   ? -5.777  -9.669  -11.392 1.00 0.00  ? 142 SER B O    2  
ATOM   1942  C CB   . SER B 2 3   ? -7.189  -11.845 -13.031 1.00 0.00  ? 142 SER B CB   2  
ATOM   1943  O OG   . SER B 2 3   ? -8.268  -12.677 -12.624 1.00 0.00  ? 142 SER B OG   2  
ATOM   1944  H H    . SER B 2 3   ? -6.627  -9.994  -14.712 1.00 0.00  ? 142 SER B H    2  
ATOM   1945  H HA   . SER B 2 3   ? -8.646  -10.290 -12.773 1.00 0.00  ? 142 SER B HA   2  
ATOM   1946  H HB2  . SER B 2 3   ? -6.985  -12.015 -14.075 1.00 0.00  ? 142 SER B HB2  2  
ATOM   1947  H HB3  . SER B 2 3   ? -6.305  -12.075 -12.451 1.00 0.00  ? 142 SER B HB3  2  
ATOM   1948  H HG   . SER B 2 3   ? -8.242  -13.476 -13.153 1.00 0.00  ? 142 SER B HG   2  
ATOM   1949  N N    . ILE B 2 4   ? -7.780  -9.709  -10.493 1.00 0.00  ? 143 ILE B N    2  
ATOM   1950  C CA   . ILE B 2 4   ? -7.253  -9.230  -9.183  1.00 0.00  ? 143 ILE B CA   2  
ATOM   1951  C C    . ILE B 2 4   ? -6.304  -10.279 -8.600  1.00 0.00  ? 143 ILE B C    2  
ATOM   1952  O O    . ILE B 2 4   ? -5.340  -9.957  -7.934  1.00 0.00  ? 143 ILE B O    2  
ATOM   1953  C CB   . ILE B 2 4   ? -8.416  -9.003  -8.217  1.00 0.00  ? 143 ILE B CB   2  
ATOM   1954  C CG1  . ILE B 2 4   ? -7.866  -8.690  -6.824  1.00 0.00  ? 143 ILE B CG1  2  
ATOM   1955  C CG2  . ILE B 2 4   ? -9.281  -10.263 -8.152  1.00 0.00  ? 143 ILE B CG2  2  
ATOM   1956  C CD1  . ILE B 2 4   ? -8.906  -7.897  -6.029  1.00 0.00  ? 143 ILE B CD1  2  
ATOM   1957  H H    . ILE B 2 4   ? -8.738  -9.891  -10.597 1.00 0.00  ? 143 ILE B H    2  
ATOM   1958  H HA   . ILE B 2 4   ? -6.718  -8.303  -9.328  1.00 0.00  ? 143 ILE B HA   2  
ATOM   1959  H HB   . ILE B 2 4   ? -9.016  -8.173  -8.564  1.00 0.00  ? 143 ILE B HB   2  
ATOM   1960  H HG12 . ILE B 2 4   ? -7.647  -9.615  -6.308  1.00 0.00  ? 143 ILE B HG12 2  
ATOM   1961  H HG13 . ILE B 2 4   ? -6.963  -8.106  -6.915  1.00 0.00  ? 143 ILE B HG13 2  
ATOM   1962  H HG21 . ILE B 2 4   ? -9.080  -10.882 -9.015  1.00 0.00  ? 143 ILE B HG21 2  
ATOM   1963  H HG22 . ILE B 2 4   ? -9.047  -10.813 -7.253  1.00 0.00  ? 143 ILE B HG22 2  
ATOM   1964  H HG23 . ILE B 2 4   ? -10.324 -9.984  -8.143  1.00 0.00  ? 143 ILE B HG23 2  
ATOM   1965  H HD11 . ILE B 2 4   ? -9.833  -8.451  -5.998  1.00 0.00  ? 143 ILE B HD11 2  
ATOM   1966  H HD12 . ILE B 2 4   ? -8.547  -7.739  -5.023  1.00 0.00  ? 143 ILE B HD12 2  
ATOM   1967  H HD13 . ILE B 2 4   ? -9.072  -6.943  -6.508  1.00 0.00  ? 143 ILE B HD13 2  
ATOM   1968  N N    . GLN B 2 5   ? -6.569  -11.533 -8.846  1.00 0.00  ? 144 GLN B N    2  
ATOM   1969  C CA   . GLN B 2 5   ? -5.683  -12.602 -8.307  1.00 0.00  ? 144 GLN B CA   2  
ATOM   1970  C C    . GLN B 2 5   ? -4.264  -12.410 -8.846  1.00 0.00  ? 144 GLN B C    2  
ATOM   1971  O O    . GLN B 2 5   ? -3.300  -12.867 -8.264  1.00 0.00  ? 144 GLN B O    2  
ATOM   1972  C CB   . GLN B 2 5   ? -6.212  -13.971 -8.739  1.00 0.00  ? 144 GLN B CB   2  
ATOM   1973  C CG   . GLN B 2 5   ? -6.520  -13.948 -10.237 1.00 0.00  ? 144 GLN B CG   2  
ATOM   1974  C CD   . GLN B 2 5   ? -5.937  -15.198 -10.899 1.00 0.00  ? 144 GLN B CD   2  
ATOM   1975  O OE1  . GLN B 2 5   ? -5.108  -15.873 -10.321 1.00 0.00  ? 144 GLN B OE1  2  
ATOM   1976  N NE2  . GLN B 2 5   ? -6.336  -15.536 -12.094 1.00 0.00  ? 144 GLN B NE2  2  
ATOM   1977  H H    . GLN B 2 5   ? -7.352  -11.772 -9.386  1.00 0.00  ? 144 GLN B H    2  
ATOM   1978  H HA   . GLN B 2 5   ? -5.668  -12.546 -7.228  1.00 0.00  ? 144 GLN B HA   2  
ATOM   1979  H HB2  . GLN B 2 5   ? -5.467  -14.726 -8.535  1.00 0.00  ? 144 GLN B HB2  2  
ATOM   1980  H HB3  . GLN B 2 5   ? -7.114  -14.197 -8.191  1.00 0.00  ? 144 GLN B HB3  2  
ATOM   1981  H HG2  . GLN B 2 5   ? -7.591  -13.929 -10.384 1.00 0.00  ? 144 GLN B HG2  2  
ATOM   1982  H HG3  . GLN B 2 5   ? -6.080  -13.068 -10.682 1.00 0.00  ? 144 GLN B HG3  2  
ATOM   1983  H HE21 . GLN B 2 5   ? -7.004  -14.991 -12.560 1.00 0.00  ? 144 GLN B HE21 2  
ATOM   1984  H HE22 . GLN B 2 5   ? -5.968  -16.334 -12.526 1.00 0.00  ? 144 GLN B HE22 2  
ATOM   1985  N N    . ALA B 2 6   ? -4.128  -11.737 -9.957  1.00 42.36 ? 145 ALA B N    2  
ATOM   1986  C CA   . ALA B 2 6   ? -2.772  -11.518 -10.533 1.00 39.52 ? 145 ALA B CA   2  
ATOM   1987  C C    . ALA B 2 6   ? -2.573  -10.027 -10.818 1.00 36.36 ? 145 ALA B C    2  
ATOM   1988  O O    . ALA B 2 6   ? -2.365  -9.623  -11.945 1.00 36.34 ? 145 ALA B O    2  
ATOM   1989  C CB   . ALA B 2 6   ? -2.638  -12.307 -11.837 1.00 40.62 ? 145 ALA B CB   2  
ATOM   1990  H H    . ALA B 2 6   ? -4.918  -11.377 -10.411 1.00 0.00  ? 145 ALA B H    2  
ATOM   1991  H HA   . ALA B 2 6   ? -2.023  -11.852 -9.831  1.00 0.00  ? 145 ALA B HA   2  
ATOM   1992  H HB1  . ALA B 2 6   ? -3.190  -13.233 -11.755 1.00 0.00  ? 145 ALA B HB1  2  
ATOM   1993  H HB2  . ALA B 2 6   ? -3.034  -11.723 -12.654 1.00 0.00  ? 145 ALA B HB2  2  
ATOM   1994  H HB3  . ALA B 2 6   ? -1.596  -12.524 -12.021 1.00 0.00  ? 145 ALA B HB3  2  
ATOM   1995  N N    . GLU B 2 7   ? -2.635  -9.206  -9.805  1.00 32.22 ? 146 GLU B N    2  
ATOM   1996  C CA   . GLU B 2 7   ? -2.449  -7.743  -10.021 1.00 28.03 ? 146 GLU B CA   2  
ATOM   1997  C C    . GLU B 2 7   ? -0.955  -7.430  -10.127 1.00 24.38 ? 146 GLU B C    2  
ATOM   1998  O O    . GLU B 2 7   ? -0.120  -8.175  -9.653  1.00 22.48 ? 146 GLU B O    2  
ATOM   1999  C CB   . GLU B 2 7   ? -3.050  -6.973  -8.843  1.00 27.81 ? 146 GLU B CB   2  
ATOM   2000  C CG   . GLU B 2 7   ? -4.415  -6.410  -9.244  1.00 30.44 ? 146 GLU B CG   2  
ATOM   2001  C CD   . GLU B 2 7   ? -4.251  -5.481  -10.449 1.00 31.15 ? 146 GLU B CD   2  
ATOM   2002  O OE1  . GLU B 2 7   ? -3.945  -4.319  -10.237 1.00 34.56 ? 146 GLU B OE1  2  
ATOM   2003  O OE2  . GLU B 2 7   ? -4.433  -5.948  -11.560 1.00 30.91 ? 146 GLU B OE2  2  
ATOM   2004  H H    . GLU B 2 7   ? -2.804  -9.551  -8.905  1.00 0.00  ? 146 GLU B H    2  
ATOM   2005  H HA   . GLU B 2 7   ? -2.944  -7.448  -10.934 1.00 0.00  ? 146 GLU B HA   2  
ATOM   2006  H HB2  . GLU B 2 7   ? -3.168  -7.639  -8.000  1.00 0.00  ? 146 GLU B HB2  2  
ATOM   2007  H HB3  . GLU B 2 7   ? -2.393  -6.161  -8.571  1.00 0.00  ? 146 GLU B HB3  2  
ATOM   2008  H HG2  . GLU B 2 7   ? -5.078  -7.224  -9.503  1.00 0.00  ? 146 GLU B HG2  2  
ATOM   2009  H HG3  . GLU B 2 7   ? -4.833  -5.855  -8.418  1.00 0.00  ? 146 GLU B HG3  2  
ATOM   2010  N N    . GLU B 2 8   ? -0.611  -6.334  -10.745 1.00 21.92 ? 147 GLU B N    2  
ATOM   2011  C CA   . GLU B 2 8   ? 0.829   -5.976  -10.881 1.00 21.70 ? 147 GLU B CA   2  
ATOM   2012  C C    . GLU B 2 8   ? 1.408   -5.651  -9.502  1.00 19.46 ? 147 GLU B C    2  
ATOM   2013  O O    . GLU B 2 8   ? 2.603   -5.699  -9.293  1.00 19.28 ? 147 GLU B O    2  
ATOM   2014  C CB   . GLU B 2 8   ? 0.967   -4.755  -11.794 1.00 26.72 ? 147 GLU B CB   2  
ATOM   2015  C CG   . GLU B 2 8   ? 0.298   -3.546  -11.136 1.00 37.15 ? 147 GLU B CG   2  
ATOM   2016  C CD   . GLU B 2 8   ? 0.669   -2.277  -11.904 1.00 41.71 ? 147 GLU B CD   2  
ATOM   2017  O OE1  . GLU B 2 8   ? 0.434   -2.242  -13.102 1.00 46.00 ? 147 GLU B OE1  2  
ATOM   2018  O OE2  . GLU B 2 8   ? 1.182   -1.360  -11.284 1.00 45.02 ? 147 GLU B OE2  2  
ATOM   2019  H H    . GLU B 2 8   ? -1.300  -5.747  -11.121 1.00 0.00  ? 147 GLU B H    2  
ATOM   2020  H HA   . GLU B 2 8   ? 1.367   -6.808  -11.309 1.00 0.00  ? 147 GLU B HA   2  
ATOM   2021  H HB2  . GLU B 2 8   ? 2.014   -4.545  -11.956 1.00 0.00  ? 147 GLU B HB2  2  
ATOM   2022  H HB3  . GLU B 2 8   ? 0.489   -4.957  -12.740 1.00 0.00  ? 147 GLU B HB3  2  
ATOM   2023  H HG2  . GLU B 2 8   ? -0.774  -3.677  -11.150 1.00 0.00  ? 147 GLU B HG2  2  
ATOM   2024  H HG3  . GLU B 2 8   ? 0.636   -3.458  -10.115 1.00 0.00  ? 147 GLU B HG3  2  
ATOM   2025  N N    . TRP B 2 9   ? 0.569   -5.318  -8.559  1.00 17.10 ? 148 TRP B N    2  
ATOM   2026  C CA   . TRP B 2 9   ? 1.074   -4.991  -7.194  1.00 12.75 ? 148 TRP B CA   2  
ATOM   2027  C C    . TRP B 2 9   ? 0.564   -6.033  -6.196  1.00 12.19 ? 148 TRP B C    2  
ATOM   2028  O O    . TRP B 2 9   ? 0.367   -5.746  -5.033  1.00 11.66 ? 148 TRP B O    2  
ATOM   2029  C CB   . TRP B 2 9   ? 0.581   -3.600  -6.777  1.00 14.42 ? 148 TRP B CB   2  
ATOM   2030  C CG   . TRP B 2 9   ? -0.791  -3.360  -7.324  1.00 13.12 ? 148 TRP B CG   2  
ATOM   2031  C CD1  . TRP B 2 9   ? -1.074  -2.584  -8.396  1.00 13.11 ? 148 TRP B CD1  2  
ATOM   2032  C CD2  . TRP B 2 9   ? -2.067  -3.882  -6.848  1.00 12.81 ? 148 TRP B CD2  2  
ATOM   2033  N NE1  . TRP B 2 9   ? -2.442  -2.595  -8.610  1.00 12.63 ? 148 TRP B NE1  2  
ATOM   2034  C CE2  . TRP B 2 9   ? -3.097  -3.380  -7.683  1.00 13.14 ? 148 TRP B CE2  2  
ATOM   2035  C CE3  . TRP B 2 9   ? -2.427  -4.736  -5.783  1.00 10.52 ? 148 TRP B CE3  2  
ATOM   2036  C CZ2  . TRP B 2 9   ? -4.439  -3.713  -7.469  1.00 13.39 ? 148 TRP B CZ2  2  
ATOM   2037  C CZ3  . TRP B 2 9   ? -3.778  -5.072  -5.565  1.00 12.83 ? 148 TRP B CZ3  2  
ATOM   2038  C CH2  . TRP B 2 9   ? -4.781  -4.561  -6.407  1.00 12.53 ? 148 TRP B CH2  2  
ATOM   2039  H H    . TRP B 2 9   ? -0.392  -5.284  -8.747  1.00 0.00  ? 148 TRP B H    2  
ATOM   2040  H HA   . TRP B 2 9   ? 2.154   -5.001  -7.201  1.00 0.00  ? 148 TRP B HA   2  
ATOM   2041  H HB2  . TRP B 2 9   ? 0.552   -3.538  -5.698  1.00 0.00  ? 148 TRP B HB2  2  
ATOM   2042  H HB3  . TRP B 2 9   ? 1.257   -2.849  -7.161  1.00 0.00  ? 148 TRP B HB3  2  
ATOM   2043  H HD1  . TRP B 2 9   ? -0.351  -2.043  -8.988  1.00 0.00  ? 148 TRP B HD1  2  
ATOM   2044  H HE1  . TRP B 2 9   ? -2.906  -2.111  -9.324  1.00 0.00  ? 148 TRP B HE1  2  
ATOM   2045  H HE3  . TRP B 2 9   ? -1.664  -5.133  -5.132  1.00 0.00  ? 148 TRP B HE3  2  
ATOM   2046  H HZ2  . TRP B 2 9   ? -5.207  -3.318  -8.118  1.00 0.00  ? 148 TRP B HZ2  2  
ATOM   2047  H HZ3  . TRP B 2 9   ? -4.043  -5.726  -4.747  1.00 0.00  ? 148 TRP B HZ3  2  
ATOM   2048  H HH2  . TRP B 2 9   ? -5.815  -4.822  -6.235  1.00 0.00  ? 148 TRP B HH2  2  
ATOM   2049  N N    . TYR B 2 10  ? 0.350   -7.241  -6.640  1.00 11.66 ? 149 TYR B N    2  
ATOM   2050  C CA   . TYR B 2 10  ? -0.148  -8.298  -5.715  1.00 13.63 ? 149 TYR B CA   2  
ATOM   2051  C C    . TYR B 2 10  ? 0.926   -9.375  -5.543  1.00 14.73 ? 149 TYR B C    2  
ATOM   2052  O O    . TYR B 2 10  ? 1.446   -9.905  -6.504  1.00 16.34 ? 149 TYR B O    2  
ATOM   2053  C CB   . TYR B 2 10  ? -1.414  -8.929  -6.298  1.00 12.52 ? 149 TYR B CB   2  
ATOM   2054  C CG   . TYR B 2 10  ? -1.955  -9.958  -5.334  1.00 15.49 ? 149 TYR B CG   2  
ATOM   2055  C CD1  . TYR B 2 10  ? -2.657  -9.547  -4.189  1.00 14.45 ? 149 TYR B CD1  2  
ATOM   2056  C CD2  . TYR B 2 10  ? -1.758  -11.326 -5.585  1.00 19.03 ? 149 TYR B CD2  2  
ATOM   2057  C CE1  . TYR B 2 10  ? -3.162  -10.505 -3.294  1.00 15.99 ? 149 TYR B CE1  2  
ATOM   2058  C CE2  . TYR B 2 10  ? -2.262  -12.283 -4.689  1.00 20.41 ? 149 TYR B CE2  2  
ATOM   2059  C CZ   . TYR B 2 10  ? -2.964  -11.873 -3.543  1.00 21.15 ? 149 TYR B CZ   2  
ATOM   2060  O OH   . TYR B 2 10  ? -3.459  -12.815 -2.664  1.00 23.67 ? 149 TYR B OH   2  
ATOM   2061  H H    . TYR B 2 10  ? 0.515   -7.453  -7.583  1.00 0.00  ? 149 TYR B H    2  
ATOM   2062  H HA   . TYR B 2 10  ? -0.374  -7.859  -4.755  1.00 0.00  ? 149 TYR B HA   2  
ATOM   2063  H HB2  . TYR B 2 10  ? -2.157  -8.162  -6.460  1.00 0.00  ? 149 TYR B HB2  2  
ATOM   2064  H HB3  . TYR B 2 10  ? -1.179  -9.406  -7.237  1.00 0.00  ? 149 TYR B HB3  2  
ATOM   2065  H HD1  . TYR B 2 10  ? -2.810  -8.495  -3.996  1.00 0.00  ? 149 TYR B HD1  2  
ATOM   2066  H HD2  . TYR B 2 10  ? -1.218  -11.642 -6.466  1.00 0.00  ? 149 TYR B HD2  2  
ATOM   2067  H HE1  . TYR B 2 10  ? -3.701  -10.189 -2.413  1.00 0.00  ? 149 TYR B HE1  2  
ATOM   2068  H HE2  . TYR B 2 10  ? -2.110  -13.336 -4.881  1.00 0.00  ? 149 TYR B HE2  2  
ATOM   2069  H HH   . TYR B 2 10  ? -2.780  -13.480 -2.527  1.00 0.00  ? 149 TYR B HH   2  
ATOM   2070  N N    . PHE B 2 11  ? 1.266   -9.702  -4.324  1.00 14.41 ? 150 PHE B N    2  
ATOM   2071  C CA   . PHE B 2 11  ? 2.308   -10.743 -4.096  1.00 13.20 ? 150 PHE B CA   2  
ATOM   2072  C C    . PHE B 2 11  ? 1.782   -11.805 -3.124  1.00 12.95 ? 150 PHE B C    2  
ATOM   2073  O O    . PHE B 2 11  ? 2.439   -12.792 -2.859  1.00 12.44 ? 150 PHE B O    2  
ATOM   2074  C CB   . PHE B 2 11  ? 3.560   -10.088 -3.507  1.00 13.34 ? 150 PHE B CB   2  
ATOM   2075  C CG   . PHE B 2 11  ? 4.717   -10.275 -4.459  1.00 10.91 ? 150 PHE B CG   2  
ATOM   2076  C CD1  . PHE B 2 11  ? 4.605   -9.850  -5.794  1.00 10.09 ? 150 PHE B CD1  2  
ATOM   2077  C CD2  . PHE B 2 11  ? 5.906   -10.875 -4.011  1.00 10.43 ? 150 PHE B CD2  2  
ATOM   2078  C CE1  . PHE B 2 11  ? 5.681   -10.025 -6.679  1.00 7.94  ? 150 PHE B CE1  2  
ATOM   2079  C CE2  . PHE B 2 11  ? 6.982   -11.049 -4.896  1.00 9.38  ? 150 PHE B CE2  2  
ATOM   2080  C CZ   . PHE B 2 11  ? 6.871   -10.624 -6.230  1.00 8.81  ? 150 PHE B CZ   2  
ATOM   2081  H H    . PHE B 2 11  ? 0.837   -9.261  -3.562  1.00 0.00  ? 150 PHE B H    2  
ATOM   2082  H HA   . PHE B 2 11  ? 2.558   -11.212 -5.036  1.00 0.00  ? 150 PHE B HA   2  
ATOM   2083  H HB2  . PHE B 2 11  ? 3.379   -9.033  -3.361  1.00 0.00  ? 150 PHE B HB2  2  
ATOM   2084  H HB3  . PHE B 2 11  ? 3.796   -10.548 -2.559  1.00 0.00  ? 150 PHE B HB3  2  
ATOM   2085  H HD1  . PHE B 2 11  ? 3.691   -9.389  -6.138  1.00 0.00  ? 150 PHE B HD1  2  
ATOM   2086  H HD2  . PHE B 2 11  ? 5.992   -11.202 -2.984  1.00 0.00  ? 150 PHE B HD2  2  
ATOM   2087  H HE1  . PHE B 2 11  ? 5.595   -9.698  -7.705  1.00 0.00  ? 150 PHE B HE1  2  
ATOM   2088  H HE2  . PHE B 2 11  ? 7.897   -11.510 -4.551  1.00 0.00  ? 150 PHE B HE2  2  
ATOM   2089  H HZ   . PHE B 2 11  ? 7.698   -10.758 -6.912  1.00 0.00  ? 150 PHE B HZ   2  
ATOM   2090  N N    . GLY B 2 12  ? 0.607   -11.614 -2.588  1.00 14.57 ? 151 GLY B N    2  
ATOM   2091  C CA   . GLY B 2 12  ? 0.051   -12.614 -1.637  1.00 13.68 ? 151 GLY B CA   2  
ATOM   2092  C C    . GLY B 2 12  ? 0.465   -12.246 -0.213  1.00 15.95 ? 151 GLY B C    2  
ATOM   2093  O O    . GLY B 2 12  ? 0.490   -11.090 0.160   1.00 16.08 ? 151 GLY B O    2  
ATOM   2094  H H    . GLY B 2 12  ? 0.091   -10.815 -2.808  1.00 0.00  ? 151 GLY B H    2  
ATOM   2095  H HA2  . GLY B 2 12  ? -1.028  -12.619 -1.710  1.00 0.00  ? 151 GLY B HA2  2  
ATOM   2096  H HA3  . GLY B 2 12  ? 0.434   -13.593 -1.878  1.00 0.00  ? 151 GLY B HA3  2  
ATOM   2097  N N    . LYS B 2 13  ? 0.792   -13.222 0.583   1.00 14.92 ? 152 LYS B N    2  
ATOM   2098  C CA   . LYS B 2 13  ? 1.205   -12.943 1.981   1.00 16.57 ? 152 LYS B CA   2  
ATOM   2099  C C    . LYS B 2 13  ? 2.724   -13.083 2.102   1.00 15.79 ? 152 LYS B C    2  
ATOM   2100  O O    . LYS B 2 13  ? 3.295   -14.089 1.733   1.00 15.62 ? 152 LYS B O    2  
ATOM   2101  C CB   . LYS B 2 13  ? 0.526   -13.938 2.924   1.00 19.39 ? 152 LYS B CB   2  
ATOM   2102  C CG   . LYS B 2 13  ? 0.394   -15.305 2.245   1.00 26.20 ? 152 LYS B CG   2  
ATOM   2103  C CD   . LYS B 2 13  ? 0.031   -16.360 3.292   1.00 32.70 ? 152 LYS B CD   2  
ATOM   2104  C CE   . LYS B 2 13  ? 1.308   -16.886 3.951   1.00 38.73 ? 152 LYS B CE   2  
ATOM   2105  N NZ   . LYS B 2 13  ? 1.059   -18.249 4.499   1.00 43.61 ? 152 LYS B NZ   2  
ATOM   2106  H H    . LYS B 2 13  ? 0.765   -14.141 0.261   1.00 0.00  ? 152 LYS B H    2  
ATOM   2107  H HA   . LYS B 2 13  ? 0.913   -11.937 2.249   1.00 0.00  ? 152 LYS B HA   2  
ATOM   2108  H HB2  . LYS B 2 13  ? 1.122   -14.042 3.811   1.00 0.00  ? 152 LYS B HB2  2  
ATOM   2109  H HB3  . LYS B 2 13  ? -0.455  -13.573 3.187   1.00 0.00  ? 152 LYS B HB3  2  
ATOM   2110  H HG2  . LYS B 2 13  ? -0.381  -15.259 1.494   1.00 0.00  ? 152 LYS B HG2  2  
ATOM   2111  H HG3  . LYS B 2 13  ? 1.333   -15.568 1.781   1.00 0.00  ? 152 LYS B HG3  2  
ATOM   2112  H HD2  . LYS B 2 13  ? -0.607  -15.918 4.043   1.00 0.00  ? 152 LYS B HD2  2  
ATOM   2113  H HD3  . LYS B 2 13  ? -0.487  -17.178 2.813   1.00 0.00  ? 152 LYS B HD3  2  
ATOM   2114  H HE2  . LYS B 2 13  ? 2.099   -16.933 3.217   1.00 0.00  ? 152 LYS B HE2  2  
ATOM   2115  H HE3  . LYS B 2 13  ? 1.599   -16.222 4.751   1.00 0.00  ? 152 LYS B HE3  2  
ATOM   2116  H HZ1  . LYS B 2 13  ? 0.777   -18.887 3.727   1.00 0.00  ? 152 LYS B HZ1  2  
ATOM   2117  H HZ2  . LYS B 2 13  ? 1.927   -18.606 4.946   1.00 0.00  ? 152 LYS B HZ2  2  
ATOM   2118  H HZ3  . LYS B 2 13  ? 0.299   -18.204 5.208   1.00 0.00  ? 152 LYS B HZ3  2  
ATOM   2119  N N    . ILE B 2 14  ? 3.382   -12.081 2.617   1.00 16.90 ? 153 ILE B N    2  
ATOM   2120  C CA   . ILE B 2 14  ? 4.862   -12.159 2.761   1.00 16.60 ? 153 ILE B CA   2  
ATOM   2121  C C    . ILE B 2 14  ? 5.242   -11.949 4.228   1.00 17.59 ? 153 ILE B C    2  
ATOM   2122  O O    . ILE B 2 14  ? 4.395   -11.751 5.076   1.00 21.20 ? 153 ILE B O    2  
ATOM   2123  C CB   . ILE B 2 14  ? 5.517   -11.074 1.903   1.00 15.36 ? 153 ILE B CB   2  
ATOM   2124  C CG1  . ILE B 2 14  ? 5.181   -9.697  2.478   1.00 14.56 ? 153 ILE B CG1  2  
ATOM   2125  C CG2  . ILE B 2 14  ? 4.990   -11.169 0.470   1.00 15.80 ? 153 ILE B CG2  2  
ATOM   2126  C CD1  . ILE B 2 14  ? 6.037   -8.632  1.788   1.00 13.00 ? 153 ILE B CD1  2  
ATOM   2127  H H    . ILE B 2 14  ? 2.903   -11.277 2.909   1.00 0.00  ? 153 ILE B H    2  
ATOM   2128  H HA   . ILE B 2 14  ? 5.205   -13.130 2.437   1.00 0.00  ? 153 ILE B HA   2  
ATOM   2129  H HB   . ILE B 2 14  ? 6.589   -11.215 1.902   1.00 0.00  ? 153 ILE B HB   2  
ATOM   2130  H HG12 . ILE B 2 14  ? 4.134   -9.482  2.311   1.00 0.00  ? 153 ILE B HG12 2  
ATOM   2131  H HG13 . ILE B 2 14  ? 5.385   -9.688  3.538   1.00 0.00  ? 153 ILE B HG13 2  
ATOM   2132  H HG21 . ILE B 2 14  ? 4.494   -12.118 0.331   1.00 0.00  ? 153 ILE B HG21 2  
ATOM   2133  H HG22 . ILE B 2 14  ? 4.289   -10.368 0.291   1.00 0.00  ? 153 ILE B HG22 2  
ATOM   2134  H HG23 . ILE B 2 14  ? 5.814   -11.089 -0.222  1.00 0.00  ? 153 ILE B HG23 2  
ATOM   2135  H HD11 . ILE B 2 14  ? 6.420   -9.026  0.858   1.00 0.00  ? 153 ILE B HD11 2  
ATOM   2136  H HD12 . ILE B 2 14  ? 5.433   -7.760  1.588   1.00 0.00  ? 153 ILE B HD12 2  
ATOM   2137  H HD13 . ILE B 2 14  ? 6.861   -8.362  2.431   1.00 0.00  ? 153 ILE B HD13 2  
ATOM   2138  N N    . THR B 2 15  ? 6.510   -11.989 4.533   1.00 16.79 ? 154 THR B N    2  
ATOM   2139  C CA   . THR B 2 15  ? 6.942   -11.791 5.946   1.00 16.02 ? 154 THR B CA   2  
ATOM   2140  C C    . THR B 2 15  ? 7.148   -10.298 6.211   1.00 15.06 ? 154 THR B C    2  
ATOM   2141  O O    . THR B 2 15  ? 7.116   -9.488  5.306   1.00 14.17 ? 154 THR B O    2  
ATOM   2142  C CB   . THR B 2 15  ? 8.255   -12.540 6.186   1.00 18.43 ? 154 THR B CB   2  
ATOM   2143  O OG1  . THR B 2 15  ? 9.310   -11.867 5.515   1.00 22.52 ? 154 THR B OG1  2  
ATOM   2144  C CG2  . THR B 2 15  ? 8.135   -13.967 5.652   1.00 19.67 ? 154 THR B CG2  2  
ATOM   2145  H H    . THR B 2 15  ? 7.177   -12.149 3.835   1.00 0.00  ? 154 THR B H    2  
ATOM   2146  H HA   . THR B 2 15  ? 6.182   -12.173 6.611   1.00 0.00  ? 154 THR B HA   2  
ATOM   2147  H HB   . THR B 2 15  ? 8.462   -12.573 7.245   1.00 0.00  ? 154 THR B HB   2  
ATOM   2148  H HG1  . THR B 2 15  ? 10.058  -11.816 6.114   1.00 0.00  ? 154 THR B HG1  2  
ATOM   2149  H HG21 . THR B 2 15  ? 7.096   -14.194 5.459   1.00 0.00  ? 154 THR B HG21 2  
ATOM   2150  H HG22 . THR B 2 15  ? 8.699   -14.056 4.734   1.00 0.00  ? 154 THR B HG22 2  
ATOM   2151  H HG23 . THR B 2 15  ? 8.524   -14.660 6.383   1.00 0.00  ? 154 THR B HG23 2  
ATOM   2152  N N    . ARG B 2 16  ? 7.358   -9.928  7.445   1.00 15.92 ? 155 ARG B N    2  
ATOM   2153  C CA   . ARG B 2 16  ? 7.565   -8.487  7.764   1.00 14.63 ? 155 ARG B CA   2  
ATOM   2154  C C    . ARG B 2 16  ? 8.972   -8.065  7.337   1.00 15.69 ? 155 ARG B C    2  
ATOM   2155  O O    . ARG B 2 16  ? 9.191   -6.954  6.897   1.00 13.45 ? 155 ARG B O    2  
ATOM   2156  C CB   . ARG B 2 16  ? 7.401   -8.269  9.270   1.00 13.07 ? 155 ARG B CB   2  
ATOM   2157  C CG   . ARG B 2 16  ? 7.209   -6.779  9.555   1.00 14.81 ? 155 ARG B CG   2  
ATOM   2158  C CD   . ARG B 2 16  ? 8.222   -6.324  10.606  1.00 13.27 ? 155 ARG B CD   2  
ATOM   2159  N NE   . ARG B 2 16  ? 8.224   -7.289  11.742  1.00 16.05 ? 155 ARG B NE   2  
ATOM   2160  C CZ   . ARG B 2 16  ? 9.350   -7.630  12.306  1.00 8.86  ? 155 ARG B CZ   2  
ATOM   2161  N NH1  . ARG B 2 16  ? 10.359  -8.009  11.570  1.00 12.78 ? 155 ARG B NH1  2  
ATOM   2162  N NH2  . ARG B 2 16  ? 9.468   -7.593  13.605  1.00 8.73  ? 155 ARG B NH2  2  
ATOM   2163  H H    . ARG B 2 16  ? 7.379   -10.597 8.160   1.00 0.00  ? 155 ARG B H    2  
ATOM   2164  H HA   . ARG B 2 16  ? 6.834   -7.893  7.234   1.00 0.00  ? 155 ARG B HA   2  
ATOM   2165  H HB2  . ARG B 2 16  ? 6.539   -8.818  9.621   1.00 0.00  ? 155 ARG B HB2  2  
ATOM   2166  H HB3  . ARG B 2 16  ? 8.285   -8.620  9.783   1.00 0.00  ? 155 ARG B HB3  2  
ATOM   2167  H HG2  . ARG B 2 16  ? 7.359   -6.217  8.643   1.00 0.00  ? 155 ARG B HG2  2  
ATOM   2168  H HG3  . ARG B 2 16  ? 6.209   -6.608  9.923   1.00 0.00  ? 155 ARG B HG3  2  
ATOM   2169  H HD2  . ARG B 2 16  ? 9.207   -6.285  10.165  1.00 0.00  ? 155 ARG B HD2  2  
ATOM   2170  H HD3  . ARG B 2 16  ? 7.949   -5.343  10.968  1.00 0.00  ? 155 ARG B HD3  2  
ATOM   2171  H HE   . ARG B 2 16  ? 7.379   -7.666  12.065  1.00 0.00  ? 155 ARG B HE   2  
ATOM   2172  H HH11 . ARG B 2 16  ? 10.269  -8.039  10.575  1.00 0.00  ? 155 ARG B HH11 2  
ATOM   2173  H HH12 . ARG B 2 16  ? 11.223  -8.272  12.002  1.00 0.00  ? 155 ARG B HH12 2  
ATOM   2174  H HH21 . ARG B 2 16  ? 8.695   -7.302  14.169  1.00 0.00  ? 155 ARG B HH21 2  
ATOM   2175  H HH22 . ARG B 2 16  ? 10.331  -7.854  14.037  1.00 0.00  ? 155 ARG B HH22 2  
ATOM   2176  N N    . ARG B 2 17  ? 9.928   -8.945  7.460   1.00 16.92 ? 156 ARG B N    2  
ATOM   2177  C CA   . ARG B 2 17  ? 11.320  -8.593  7.059   1.00 18.61 ? 156 ARG B CA   2  
ATOM   2178  C C    . ARG B 2 17  ? 11.379  -8.400  5.543   1.00 17.01 ? 156 ARG B C    2  
ATOM   2179  O O    . ARG B 2 17  ? 11.825  -7.381  5.055   1.00 17.04 ? 156 ARG B O    2  
ATOM   2180  C CB   . ARG B 2 17  ? 12.269  -9.722  7.467   1.00 24.11 ? 156 ARG B CB   2  
ATOM   2181  C CG   . ARG B 2 17  ? 13.678  -9.160  7.666   1.00 33.87 ? 156 ARG B CG   2  
ATOM   2182  C CD   . ARG B 2 17  ? 14.385  -9.062  6.312   1.00 41.26 ? 156 ARG B CD   2  
ATOM   2183  N NE   . ARG B 2 17  ? 14.611  -10.430 5.770   1.00 49.98 ? 156 ARG B NE   2  
ATOM   2184  C CZ   . ARG B 2 17  ? 15.823  -10.838 5.510   1.00 51.87 ? 156 ARG B CZ   2  
ATOM   2185  N NH1  . ARG B 2 17  ? 16.409  -10.479 4.400   1.00 52.15 ? 156 ARG B NH1  2  
ATOM   2186  N NH2  . ARG B 2 17  ? 16.450  -11.605 6.360   1.00 53.57 ? 156 ARG B NH2  2  
ATOM   2187  H H    . ARG B 2 17  ? 9.731   -9.836  7.816   1.00 0.00  ? 156 ARG B H    2  
ATOM   2188  H HA   . ARG B 2 17  ? 11.616  -7.678  7.551   1.00 0.00  ? 156 ARG B HA   2  
ATOM   2189  H HB2  . ARG B 2 17  ? 11.924  -10.166 8.390   1.00 0.00  ? 156 ARG B HB2  2  
ATOM   2190  H HB3  . ARG B 2 17  ? 12.290  -10.473 6.692   1.00 0.00  ? 156 ARG B HB3  2  
ATOM   2191  H HG2  . ARG B 2 17  ? 13.614  -8.178  8.111   1.00 0.00  ? 156 ARG B HG2  2  
ATOM   2192  H HG3  . ARG B 2 17  ? 14.239  -9.814  8.316   1.00 0.00  ? 156 ARG B HG3  2  
ATOM   2193  H HD2  . ARG B 2 17  ? 13.770  -8.499  5.626   1.00 0.00  ? 156 ARG B HD2  2  
ATOM   2194  H HD3  . ARG B 2 17  ? 15.334  -8.562  6.437   1.00 0.00  ? 156 ARG B HD3  2  
ATOM   2195  H HE   . ARG B 2 17  ? 13.849  -11.025 5.606   1.00 0.00  ? 156 ARG B HE   2  
ATOM   2196  H HH11 . ARG B 2 17  ? 15.928  -9.893  3.748   1.00 0.00  ? 156 ARG B HH11 2  
ATOM   2197  H HH12 . ARG B 2 17  ? 17.337  -10.792 4.201   1.00 0.00  ? 156 ARG B HH12 2  
ATOM   2198  H HH21 . ARG B 2 17  ? 16.001  -11.879 7.210   1.00 0.00  ? 156 ARG B HH21 2  
ATOM   2199  H HH22 . ARG B 2 17  ? 17.379  -11.916 6.161   1.00 0.00  ? 156 ARG B HH22 2  
ATOM   2200  N N    . GLU B 2 18  ? 10.934  -9.372  4.795   1.00 15.73 ? 157 GLU B N    2  
ATOM   2201  C CA   . GLU B 2 18  ? 10.965  -9.247  3.310   1.00 15.26 ? 157 GLU B CA   2  
ATOM   2202  C C    . GLU B 2 18  ? 10.240  -7.968  2.886   1.00 14.10 ? 157 GLU B C    2  
ATOM   2203  O O    . GLU B 2 18  ? 10.708  -7.230  2.041   1.00 15.48 ? 157 GLU B O    2  
ATOM   2204  C CB   . GLU B 2 18  ? 10.269  -10.457 2.683   1.00 19.30 ? 157 GLU B CB   2  
ATOM   2205  C CG   . GLU B 2 18  ? 10.610  -10.527 1.193   1.00 28.11 ? 157 GLU B CG   2  
ATOM   2206  C CD   . GLU B 2 18  ? 10.383  -11.951 0.683   1.00 29.65 ? 157 GLU B CD   2  
ATOM   2207  O OE1  . GLU B 2 18  ? 9.599   -12.660 1.293   1.00 28.63 ? 157 GLU B OE1  2  
ATOM   2208  O OE2  . GLU B 2 18  ? 10.996  -12.309 -0.309  1.00 31.13 ? 157 GLU B OE2  2  
ATOM   2209  H H    . GLU B 2 18  ? 10.580  -10.185 5.210   1.00 0.00  ? 157 GLU B H    2  
ATOM   2210  H HA   . GLU B 2 18  ? 11.990  -9.209  2.974   1.00 0.00  ? 157 GLU B HA   2  
ATOM   2211  H HB2  . GLU B 2 18  ? 10.604  -11.360 3.173   1.00 0.00  ? 157 GLU B HB2  2  
ATOM   2212  H HB3  . GLU B 2 18  ? 9.201   -10.358 2.801   1.00 0.00  ? 157 GLU B HB3  2  
ATOM   2213  H HG2  . GLU B 2 18  ? 9.978   -9.842  0.646   1.00 0.00  ? 157 GLU B HG2  2  
ATOM   2214  H HG3  . GLU B 2 18  ? 11.645  -10.256 1.048   1.00 0.00  ? 157 GLU B HG3  2  
ATOM   2215  N N    . SER B 2 19  ? 9.101   -7.699  3.463   1.00 11.43 ? 158 SER B N    2  
ATOM   2216  C CA   . SER B 2 19  ? 8.346   -6.469  3.089   1.00 9.58  ? 158 SER B CA   2  
ATOM   2217  C C    . SER B 2 19  ? 9.268   -5.250  3.189   1.00 10.15 ? 158 SER B C    2  
ATOM   2218  O O    . SER B 2 19  ? 9.537   -4.582  2.210   1.00 12.31 ? 158 SER B O    2  
ATOM   2219  C CB   . SER B 2 19  ? 7.163   -6.289  4.040   1.00 8.90  ? 158 SER B CB   2  
ATOM   2220  O OG   . SER B 2 19  ? 6.776   -4.922  4.053   1.00 11.55 ? 158 SER B OG   2  
ATOM   2221  H H    . SER B 2 19  ? 8.739   -8.309  4.140   1.00 0.00  ? 158 SER B H    2  
ATOM   2222  H HA   . SER B 2 19  ? 7.983   -6.563  2.077   1.00 0.00  ? 158 SER B HA   2  
ATOM   2223  H HB2  . SER B 2 19  ? 6.333   -6.888  3.703   1.00 0.00  ? 158 SER B HB2  2  
ATOM   2224  H HB3  . SER B 2 19  ? 7.450   -6.603  5.035   1.00 0.00  ? 158 SER B HB3  2  
ATOM   2225  H HG   . SER B 2 19  ? 6.958   -4.570  4.928   1.00 0.00  ? 158 SER B HG   2  
ATOM   2226  N N    . GLU B 2 20  ? 9.753   -4.956  4.364   1.00 11.35 ? 159 GLU B N    2  
ATOM   2227  C CA   . GLU B 2 20  ? 10.652  -3.785  4.528   1.00 12.85 ? 159 GLU B CA   2  
ATOM   2228  C C    . GLU B 2 20  ? 11.938  -4.009  3.730   1.00 15.16 ? 159 GLU B C    2  
ATOM   2229  O O    . GLU B 2 20  ? 12.703  -3.096  3.498   1.00 13.16 ? 159 GLU B O    2  
ATOM   2230  C CB   . GLU B 2 20  ? 10.992  -3.625  6.010   1.00 13.71 ? 159 GLU B CB   2  
ATOM   2231  C CG   . GLU B 2 20  ? 9.701   -3.453  6.812   1.00 16.00 ? 159 GLU B CG   2  
ATOM   2232  C CD   . GLU B 2 20  ? 9.829   -4.184  8.150   1.00 19.40 ? 159 GLU B CD   2  
ATOM   2233  O OE1  . GLU B 2 20  ? 10.908  -4.681  8.429   1.00 21.73 ? 159 GLU B OE1  2  
ATOM   2234  O OE2  . GLU B 2 20  ? 8.847   -4.235  8.871   1.00 26.69 ? 159 GLU B OE2  2  
ATOM   2235  H H    . GLU B 2 20  ? 9.524   -5.503  5.142   1.00 0.00  ? 159 GLU B H    2  
ATOM   2236  H HA   . GLU B 2 20  ? 10.157  -2.895  4.173   1.00 0.00  ? 159 GLU B HA   2  
ATOM   2237  H HB2  . GLU B 2 20  ? 11.518  -4.503  6.355   1.00 0.00  ? 159 GLU B HB2  2  
ATOM   2238  H HB3  . GLU B 2 20  ? 11.613  -2.758  6.142   1.00 0.00  ? 159 GLU B HB3  2  
ATOM   2239  H HG2  . GLU B 2 20  ? 9.526   -2.402  6.992   1.00 0.00  ? 159 GLU B HG2  2  
ATOM   2240  H HG3  . GLU B 2 20  ? 8.872   -3.866  6.257   1.00 0.00  ? 159 GLU B HG3  2  
ATOM   2241  N N    . ARG B 2 21  ? 12.183  -5.220  3.309   1.00 15.73 ? 160 ARG B N    2  
ATOM   2242  C CA   . ARG B 2 21  ? 13.421  -5.502  2.527   1.00 17.77 ? 160 ARG B CA   2  
ATOM   2243  C C    . ARG B 2 21  ? 13.208  -5.101  1.065   1.00 17.96 ? 160 ARG B C    2  
ATOM   2244  O O    . ARG B 2 21  ? 14.144  -4.805  0.351   1.00 17.67 ? 160 ARG B O    2  
ATOM   2245  C CB   . ARG B 2 21  ? 13.737  -6.995  2.602   1.00 21.81 ? 160 ARG B CB   2  
ATOM   2246  C CG   . ARG B 2 21  ? 15.240  -7.190  2.811   1.00 30.59 ? 160 ARG B CG   2  
ATOM   2247  C CD   . ARG B 2 21  ? 15.757  -8.257  1.845   1.00 37.74 ? 160 ARG B CD   2  
ATOM   2248  N NE   . ARG B 2 21  ? 15.447  -7.853  0.444   1.00 43.93 ? 160 ARG B NE   2  
ATOM   2249  C CZ   . ARG B 2 21  ? 16.222  -8.238  -0.532  1.00 48.64 ? 160 ARG B CZ   2  
ATOM   2250  N NH1  . ARG B 2 21  ? 16.056  -9.415  -1.071  1.00 50.79 ? 160 ARG B NH1  2  
ATOM   2251  N NH2  . ARG B 2 21  ? 17.163  -7.448  -0.969  1.00 51.68 ? 160 ARG B NH2  2  
ATOM   2252  H H    . ARG B 2 21  ? 11.555  -5.944  3.507   1.00 0.00  ? 160 ARG B H    2  
ATOM   2253  H HA   . ARG B 2 21  ? 14.243  -4.940  2.938   1.00 0.00  ? 160 ARG B HA   2  
ATOM   2254  H HB2  . ARG B 2 21  ? 13.197  -7.438  3.426   1.00 0.00  ? 160 ARG B HB2  2  
ATOM   2255  H HB3  . ARG B 2 21  ? 13.439  -7.471  1.680   1.00 0.00  ? 160 ARG B HB3  2  
ATOM   2256  H HG2  . ARG B 2 21  ? 15.753  -6.257  2.626   1.00 0.00  ? 160 ARG B HG2  2  
ATOM   2257  H HG3  . ARG B 2 21  ? 15.424  -7.507  3.827   1.00 0.00  ? 160 ARG B HG3  2  
ATOM   2258  H HD2  . ARG B 2 21  ? 16.826  -8.361  1.961   1.00 0.00  ? 160 ARG B HD2  2  
ATOM   2259  H HD3  . ARG B 2 21  ? 15.279  -9.201  2.062   1.00 0.00  ? 160 ARG B HD3  2  
ATOM   2260  H HE   . ARG B 2 21  ? 14.663  -7.298  0.257   1.00 0.00  ? 160 ARG B HE   2  
ATOM   2261  H HH11 . ARG B 2 21  ? 15.335  -10.022 -0.735  1.00 0.00  ? 160 ARG B HH11 2  
ATOM   2262  H HH12 . ARG B 2 21  ? 16.650  -9.710  -1.819  1.00 0.00  ? 160 ARG B HH12 2  
ATOM   2263  H HH21 . ARG B 2 21  ? 17.290  -6.546  -0.556  1.00 0.00  ? 160 ARG B HH21 2  
ATOM   2264  H HH22 . ARG B 2 21  ? 17.756  -7.743  -1.717  1.00 0.00  ? 160 ARG B HH22 2  
ATOM   2265  N N    . LEU B 2 22  ? 11.984  -5.097  0.615   1.00 16.19 ? 161 LEU B N    2  
ATOM   2266  C CA   . LEU B 2 22  ? 11.710  -4.722  -0.801  1.00 12.63 ? 161 LEU B CA   2  
ATOM   2267  C C    . LEU B 2 22  ? 11.524  -3.208  -0.910  1.00 13.41 ? 161 LEU B C    2  
ATOM   2268  O O    . LEU B 2 22  ? 11.847  -2.605  -1.915  1.00 14.12 ? 161 LEU B O    2  
ATOM   2269  C CB   . LEU B 2 22  ? 10.433  -5.421  -1.271  1.00 10.23 ? 161 LEU B CB   2  
ATOM   2270  C CG   . LEU B 2 22  ? 10.782  -6.796  -1.842  1.00 11.74 ? 161 LEU B CG   2  
ATOM   2271  C CD1  . LEU B 2 22  ? 9.511   -7.469  -2.364  1.00 10.85 ? 161 LEU B CD1  2  
ATOM   2272  C CD2  . LEU B 2 22  ? 11.779  -6.631  -2.991  1.00 15.84 ? 161 LEU B CD2  2  
ATOM   2273  H H    . LEU B 2 22  ? 11.244  -5.344  1.207   1.00 0.00  ? 161 LEU B H    2  
ATOM   2274  H HA   . LEU B 2 22  ? 12.538  -5.030  -1.422  1.00 0.00  ? 161 LEU B HA   2  
ATOM   2275  H HB2  . LEU B 2 22  ? 9.760   -5.538  -0.433  1.00 0.00  ? 161 LEU B HB2  2  
ATOM   2276  H HB3  . LEU B 2 22  ? 9.957   -4.824  -2.034  1.00 0.00  ? 161 LEU B HB3  2  
ATOM   2277  H HG   . LEU B 2 22  ? 11.220  -7.408  -1.067  1.00 0.00  ? 161 LEU B HG   2  
ATOM   2278  H HD11 . LEU B 2 22  ? 8.660   -7.115  -1.802  1.00 0.00  ? 161 LEU B HD11 2  
ATOM   2279  H HD12 . LEU B 2 22  ? 9.378   -7.228  -3.408  1.00 0.00  ? 161 LEU B HD12 2  
ATOM   2280  H HD13 . LEU B 2 22  ? 9.599   -8.539  -2.250  1.00 0.00  ? 161 LEU B HD13 2  
ATOM   2281  H HD21 . LEU B 2 22  ? 11.727  -5.622  -3.371  1.00 0.00  ? 161 LEU B HD21 2  
ATOM   2282  H HD22 . LEU B 2 22  ? 12.778  -6.831  -2.632  1.00 0.00  ? 161 LEU B HD22 2  
ATOM   2283  H HD23 . LEU B 2 22  ? 11.535  -7.327  -3.781  1.00 0.00  ? 161 LEU B HD23 2  
ATOM   2284  N N    . LEU B 2 23  ? 10.998  -2.588  0.110   1.00 12.10 ? 162 LEU B N    2  
ATOM   2285  C CA   . LEU B 2 23  ? 10.784  -1.115  0.052   1.00 13.70 ? 162 LEU B CA   2  
ATOM   2286  C C    . LEU B 2 23  ? 12.028  -0.384  0.565   1.00 15.43 ? 162 LEU B C    2  
ATOM   2287  O O    . LEU B 2 23  ? 12.303  0.734   0.176   1.00 15.50 ? 162 LEU B O    2  
ATOM   2288  C CB   . LEU B 2 23  ? 9.576   -0.746  0.914   1.00 13.91 ? 162 LEU B CB   2  
ATOM   2289  C CG   . LEU B 2 23  ? 8.316   -1.377  0.317   1.00 12.97 ? 162 LEU B CG   2  
ATOM   2290  C CD1  . LEU B 2 23  ? 7.308   -1.660  1.431   1.00 9.03  ? 162 LEU B CD1  2  
ATOM   2291  C CD2  . LEU B 2 23  ? 7.696   -0.412  -0.696  1.00 11.59 ? 162 LEU B CD2  2  
ATOM   2292  H H    . LEU B 2 23  ? 10.737  -3.092  0.909   1.00 0.00  ? 162 LEU B H    2  
ATOM   2293  H HA   . LEU B 2 23  ? 10.595  -0.822  -0.970  1.00 0.00  ? 162 LEU B HA   2  
ATOM   2294  H HB2  . LEU B 2 23  ? 9.724   -1.116  1.919   1.00 0.00  ? 162 LEU B HB2  2  
ATOM   2295  H HB3  . LEU B 2 23  ? 9.464   0.327   0.938   1.00 0.00  ? 162 LEU B HB3  2  
ATOM   2296  H HG   . LEU B 2 23  ? 8.578   -2.303  -0.177  1.00 0.00  ? 162 LEU B HG   2  
ATOM   2297  H HD11 . LEU B 2 23  ? 7.205   -0.785  2.056   1.00 0.00  ? 162 LEU B HD11 2  
ATOM   2298  H HD12 . LEU B 2 23  ? 6.350   -1.906  0.996   1.00 0.00  ? 162 LEU B HD12 2  
ATOM   2299  H HD13 . LEU B 2 23  ? 7.656   -2.490  2.029   1.00 0.00  ? 162 LEU B HD13 2  
ATOM   2300  H HD21 . LEU B 2 23  ? 7.816   0.603   -0.347  1.00 0.00  ? 162 LEU B HD21 2  
ATOM   2301  H HD22 . LEU B 2 23  ? 8.190   -0.524  -1.650  1.00 0.00  ? 162 LEU B HD22 2  
ATOM   2302  H HD23 . LEU B 2 23  ? 6.645   -0.633  -0.807  1.00 0.00  ? 162 LEU B HD23 2  
ATOM   2303  N N    . LEU B 2 24  ? 12.783  -1.002  1.434   1.00 17.97 ? 163 LEU B N    2  
ATOM   2304  C CA   . LEU B 2 24  ? 14.004  -0.334  1.962   1.00 23.68 ? 163 LEU B CA   2  
ATOM   2305  C C    . LEU B 2 24  ? 15.183  -0.609  1.025   1.00 29.76 ? 163 LEU B C    2  
ATOM   2306  O O    . LEU B 2 24  ? 16.176  -1.187  1.415   1.00 34.43 ? 163 LEU B O    2  
ATOM   2307  C CB   . LEU B 2 24  ? 14.322  -0.882  3.353   1.00 20.30 ? 163 LEU B CB   2  
ATOM   2308  C CG   . LEU B 2 24  ? 13.160  -0.576  4.300   1.00 19.42 ? 163 LEU B CG   2  
ATOM   2309  C CD1  . LEU B 2 24  ? 13.486  -1.104  5.697   1.00 19.86 ? 163 LEU B CD1  2  
ATOM   2310  C CD2  . LEU B 2 24  ? 12.942  0.938   4.365   1.00 19.28 ? 163 LEU B CD2  2  
ATOM   2311  H H    . LEU B 2 24  ? 12.548  -1.902  1.738   1.00 0.00  ? 163 LEU B H    2  
ATOM   2312  H HA   . LEU B 2 24  ? 13.834  0.731   2.024   1.00 0.00  ? 163 LEU B HA   2  
ATOM   2313  H HB2  . LEU B 2 24  ? 14.471  -1.949  3.295   1.00 0.00  ? 163 LEU B HB2  2  
ATOM   2314  H HB3  . LEU B 2 24  ? 15.218  -0.414  3.726   1.00 0.00  ? 163 LEU B HB3  2  
ATOM   2315  H HG   . LEU B 2 24  ? 12.263  -1.056  3.934   1.00 0.00  ? 163 LEU B HG   2  
ATOM   2316  H HD11 . LEU B 2 24  ? 13.897  -2.100  5.620   1.00 0.00  ? 163 LEU B HD11 2  
ATOM   2317  H HD12 . LEU B 2 24  ? 14.207  -0.454  6.169   1.00 0.00  ? 163 LEU B HD12 2  
ATOM   2318  H HD13 . LEU B 2 24  ? 12.585  -1.132  6.291   1.00 0.00  ? 163 LEU B HD13 2  
ATOM   2319  H HD21 . LEU B 2 24  ? 13.883  1.428   4.565   1.00 0.00  ? 163 LEU B HD21 2  
ATOM   2320  H HD22 . LEU B 2 24  ? 12.547  1.285   3.423   1.00 0.00  ? 163 LEU B HD22 2  
ATOM   2321  H HD23 . LEU B 2 24  ? 12.242  1.166   5.155   1.00 0.00  ? 163 LEU B HD23 2  
ATOM   2322  N N    . ASN B 2 25  ? 15.080  -0.196  -0.209  1.00 33.44 ? 164 ASN B N    2  
ATOM   2323  C CA   . ASN B 2 25  ? 16.193  -0.433  -1.168  1.00 37.75 ? 164 ASN B CA   2  
ATOM   2324  C C    . ASN B 2 25  ? 16.843  0.903   -1.530  1.00 40.49 ? 164 ASN B C    2  
ATOM   2325  O O    . ASN B 2 25  ? 16.183  1.834   -1.946  1.00 41.14 ? 164 ASN B O    2  
ATOM   2326  C CB   . ASN B 2 25  ? 15.644  -1.093  -2.435  1.00 39.08 ? 164 ASN B CB   2  
ATOM   2327  C CG   . ASN B 2 25  ? 16.269  -2.480  -2.601  1.00 42.87 ? 164 ASN B CG   2  
ATOM   2328  O OD1  . ASN B 2 25  ? 16.690  -2.844  -3.680  1.00 47.61 ? 164 ASN B OD1  2  
ATOM   2329  N ND2  . ASN B 2 25  ? 16.347  -3.274  -1.568  1.00 46.52 ? 164 ASN B ND2  2  
ATOM   2330  H H    . ASN B 2 25  ? 14.271  0.270   -0.503  1.00 0.00  ? 164 ASN B H    2  
ATOM   2331  H HA   . ASN B 2 25  ? 16.929  -1.080  -0.714  1.00 0.00  ? 164 ASN B HA   2  
ATOM   2332  H HB2  . ASN B 2 25  ? 14.572  -1.188  -2.356  1.00 0.00  ? 164 ASN B HB2  2  
ATOM   2333  H HB3  . ASN B 2 25  ? 15.890  -0.485  -3.293  1.00 0.00  ? 164 ASN B HB3  2  
ATOM   2334  H HD21 . ASN B 2 25  ? 16.004  -2.978  -0.695  1.00 0.00  ? 164 ASN B HD21 2  
ATOM   2335  H HD22 . ASN B 2 25  ? 16.746  -4.168  -1.666  1.00 0.00  ? 164 ASN B HD22 2  
ATOM   2336  N N    . ALA B 2 26  ? 18.135  1.004   -1.377  1.00 41.13 ? 165 ALA B N    2  
ATOM   2337  C CA   . ALA B 2 26  ? 18.827  2.280   -1.713  1.00 40.91 ? 165 ALA B CA   2  
ATOM   2338  C C    . ALA B 2 26  ? 18.677  2.566   -3.210  1.00 39.78 ? 165 ALA B C    2  
ATOM   2339  O O    . ALA B 2 26  ? 18.954  3.655   -3.672  1.00 42.37 ? 165 ALA B O    2  
ATOM   2340  C CB   . ALA B 2 26  ? 20.313  2.160   -1.365  1.00 43.50 ? 165 ALA B CB   2  
ATOM   2341  H H    . ALA B 2 26  ? 18.649  0.241   -1.041  1.00 0.00  ? 165 ALA B H    2  
ATOM   2342  H HA   . ALA B 2 26  ? 18.389  3.087   -1.146  1.00 0.00  ? 165 ALA B HA   2  
ATOM   2343  H HB1  . ALA B 2 26  ? 20.715  1.262   -1.809  1.00 0.00  ? 165 ALA B HB1  2  
ATOM   2344  H HB2  . ALA B 2 26  ? 20.842  3.020   -1.748  1.00 0.00  ? 165 ALA B HB2  2  
ATOM   2345  H HB3  . ALA B 2 26  ? 20.429  2.115   -0.292  1.00 0.00  ? 165 ALA B HB3  2  
ATOM   2346  N N    . GLU B 2 27  ? 18.239  1.599   -3.970  1.00 36.31 ? 166 GLU B N    2  
ATOM   2347  C CA   . GLU B 2 27  ? 18.074  1.820   -5.434  1.00 32.86 ? 166 GLU B CA   2  
ATOM   2348  C C    . GLU B 2 27  ? 16.585  1.836   -5.784  1.00 28.56 ? 166 GLU B C    2  
ATOM   2349  O O    . GLU B 2 27  ? 16.193  1.505   -6.885  1.00 27.16 ? 166 GLU B O    2  
ATOM   2350  C CB   . GLU B 2 27  ? 18.765  0.691   -6.199  1.00 35.96 ? 166 GLU B CB   2  
ATOM   2351  C CG   . GLU B 2 27  ? 20.250  1.018   -6.364  1.00 44.79 ? 166 GLU B CG   2  
ATOM   2352  C CD   . GLU B 2 27  ? 20.821  0.224   -7.539  1.00 50.54 ? 166 GLU B CD   2  
ATOM   2353  O OE1  . GLU B 2 27  ? 20.305  0.371   -8.635  1.00 54.06 ? 166 GLU B OE1  2  
ATOM   2354  O OE2  . GLU B 2 27  ? 21.765  -0.520  -7.324  1.00 52.17 ? 166 GLU B OE2  2  
ATOM   2355  H H    . GLU B 2 27  ? 18.022  0.728   -3.579  1.00 0.00  ? 166 GLU B H    2  
ATOM   2356  H HA   . GLU B 2 27  ? 18.518  2.765   -5.708  1.00 0.00  ? 166 GLU B HA   2  
ATOM   2357  H HB2  . GLU B 2 27  ? 18.658  -0.234  -5.650  1.00 0.00  ? 166 GLU B HB2  2  
ATOM   2358  H HB3  . GLU B 2 27  ? 18.312  0.585   -7.172  1.00 0.00  ? 166 GLU B HB3  2  
ATOM   2359  H HG2  . GLU B 2 27  ? 20.366  2.076   -6.553  1.00 0.00  ? 166 GLU B HG2  2  
ATOM   2360  H HG3  . GLU B 2 27  ? 20.780  0.753   -5.461  1.00 0.00  ? 166 GLU B HG3  2  
ATOM   2361  N N    . ASN B 2 28  ? 15.750  2.217   -4.856  1.00 24.51 ? 167 ASN B N    2  
ATOM   2362  C CA   . ASN B 2 28  ? 14.288  2.253   -5.140  1.00 21.82 ? 167 ASN B CA   2  
ATOM   2363  C C    . ASN B 2 28  ? 13.837  3.711   -5.297  1.00 19.62 ? 167 ASN B C    2  
ATOM   2364  O O    . ASN B 2 28  ? 14.303  4.577   -4.583  1.00 20.78 ? 167 ASN B O    2  
ATOM   2365  C CB   . ASN B 2 28  ? 13.527  1.606   -3.980  1.00 20.91 ? 167 ASN B CB   2  
ATOM   2366  C CG   . ASN B 2 28  ? 13.250  0.138   -4.306  1.00 21.84 ? 167 ASN B CG   2  
ATOM   2367  O OD1  . ASN B 2 28  ? 13.734  -0.379  -5.293  1.00 20.75 ? 167 ASN B OD1  2  
ATOM   2368  N ND2  . ASN B 2 28  ? 12.486  -0.561  -3.511  1.00 24.01 ? 167 ASN B ND2  2  
ATOM   2369  H H    . ASN B 2 28  ? 16.085  2.480   -3.973  1.00 0.00  ? 167 ASN B H    2  
ATOM   2370  H HA   . ASN B 2 28  ? 14.089  1.709   -6.050  1.00 0.00  ? 167 ASN B HA   2  
ATOM   2371  H HB2  . ASN B 2 28  ? 14.120  1.672   -3.080  1.00 0.00  ? 167 ASN B HB2  2  
ATOM   2372  H HB3  . ASN B 2 28  ? 12.590  2.123   -3.833  1.00 0.00  ? 167 ASN B HB3  2  
ATOM   2373  H HD21 . ASN B 2 28  ? 12.095  -0.141  -2.711  1.00 0.00  ? 167 ASN B HD21 2  
ATOM   2374  H HD22 . ASN B 2 28  ? 12.303  -1.506  -3.712  1.00 0.00  ? 167 ASN B HD22 2  
ATOM   2375  N N    . PRO B 2 29  ? 12.943  3.945   -6.229  1.00 18.42 ? 168 PRO B N    2  
ATOM   2376  C CA   . PRO B 2 29  ? 12.417  5.295   -6.497  1.00 16.88 ? 168 PRO B CA   2  
ATOM   2377  C C    . PRO B 2 29  ? 11.353  5.670   -5.461  1.00 16.36 ? 168 PRO B C    2  
ATOM   2378  O O    . PRO B 2 29  ? 10.455  4.904   -5.175  1.00 15.23 ? 168 PRO B O    2  
ATOM   2379  C CB   . PRO B 2 29  ? 11.796  5.170   -7.890  1.00 18.00 ? 168 PRO B CB   2  
ATOM   2380  C CG   . PRO B 2 29  ? 11.493  3.667   -8.100  1.00 17.15 ? 168 PRO B CG   2  
ATOM   2381  C CD   . PRO B 2 29  ? 12.375  2.895   -7.102  1.00 16.33 ? 168 PRO B CD   2  
ATOM   2382  H HA   . PRO B 2 29  ? 13.214  6.020   -6.510  1.00 0.00  ? 168 PRO B HA   2  
ATOM   2383  H HB2  . PRO B 2 29  ? 10.884  5.748   -7.940  1.00 0.00  ? 168 PRO B HB2  2  
ATOM   2384  H HB3  . PRO B 2 29  ? 12.495  5.508   -8.639  1.00 0.00  ? 168 PRO B HB3  2  
ATOM   2385  H HG2  . PRO B 2 29  ? 10.447  3.471   -7.904  1.00 0.00  ? 168 PRO B HG2  2  
ATOM   2386  H HG3  . PRO B 2 29  ? 11.742  3.376   -9.108  1.00 0.00  ? 168 PRO B HG3  2  
ATOM   2387  H HD2  . PRO B 2 29  ? 11.775  2.203   -6.525  1.00 0.00  ? 168 PRO B HD2  2  
ATOM   2388  H HD3  . PRO B 2 29  ? 13.165  2.372   -7.619  1.00 0.00  ? 168 PRO B HD3  2  
ATOM   2389  N N    . ARG B 2 30  ? 11.446  6.844   -4.901  1.00 16.48 ? 169 ARG B N    2  
ATOM   2390  C CA   . ARG B 2 30  ? 10.439  7.268   -3.888  1.00 15.86 ? 169 ARG B CA   2  
ATOM   2391  C C    . ARG B 2 30  ? 9.037   7.158   -4.492  1.00 13.88 ? 169 ARG B C    2  
ATOM   2392  O O    . ARG B 2 30  ? 8.591   8.029   -5.211  1.00 15.48 ? 169 ARG B O    2  
ATOM   2393  C CB   . ARG B 2 30  ? 10.705  8.719   -3.481  1.00 15.75 ? 169 ARG B CB   2  
ATOM   2394  C CG   . ARG B 2 30  ? 9.619   9.186   -2.510  1.00 19.73 ? 169 ARG B CG   2  
ATOM   2395  C CD   . ARG B 2 30  ? 9.559   10.715  -2.506  1.00 22.87 ? 169 ARG B CD   2  
ATOM   2396  N NE   . ARG B 2 30  ? 10.943  11.267  -2.566  1.00 21.47 ? 169 ARG B NE   2  
ATOM   2397  C CZ   . ARG B 2 30  ? 11.363  11.858  -3.650  1.00 20.61 ? 169 ARG B CZ   2  
ATOM   2398  N NH1  . ARG B 2 30  ? 10.602  12.729  -4.255  1.00 22.31 ? 169 ARG B NH1  2  
ATOM   2399  N NH2  . ARG B 2 30  ? 12.544  11.579  -4.129  1.00 23.69 ? 169 ARG B NH2  2  
ATOM   2400  H H    . ARG B 2 30  ? 12.177  7.449   -5.147  1.00 0.00  ? 169 ARG B H    2  
ATOM   2401  H HA   . ARG B 2 30  ? 10.509  6.631   -3.019  1.00 0.00  ? 169 ARG B HA   2  
ATOM   2402  H HB2  . ARG B 2 30  ? 11.671  8.786   -3.003  1.00 0.00  ? 169 ARG B HB2  2  
ATOM   2403  H HB3  . ARG B 2 30  ? 10.694  9.347   -4.359  1.00 0.00  ? 169 ARG B HB3  2  
ATOM   2404  H HG2  . ARG B 2 30  ? 8.663   8.789   -2.821  1.00 0.00  ? 169 ARG B HG2  2  
ATOM   2405  H HG3  . ARG B 2 30  ? 9.850   8.835   -1.516  1.00 0.00  ? 169 ARG B HG3  2  
ATOM   2406  H HD2  . ARG B 2 30  ? 9.000   11.055  -3.365  1.00 0.00  ? 169 ARG B HD2  2  
ATOM   2407  H HD3  . ARG B 2 30  ? 9.075   11.054  -1.603  1.00 0.00  ? 169 ARG B HD3  2  
ATOM   2408  H HE   . ARG B 2 30  ? 11.537  11.184  -1.790  1.00 0.00  ? 169 ARG B HE   2  
ATOM   2409  H HH11 . ARG B 2 30  ? 9.697   12.943  -3.888  1.00 0.00  ? 169 ARG B HH11 2  
ATOM   2410  H HH12 . ARG B 2 30  ? 10.924  13.183  -5.085  1.00 0.00  ? 169 ARG B HH12 2  
ATOM   2411  H HH21 . ARG B 2 30  ? 13.127  10.912  -3.665  1.00 0.00  ? 169 ARG B HH21 2  
ATOM   2412  H HH22 . ARG B 2 30  ? 12.867  12.033  -4.960  1.00 0.00  ? 169 ARG B HH22 2  
ATOM   2413  N N    . GLY B 2 31  ? 8.339   6.093   -4.205  1.00 11.61 ? 170 GLY B N    2  
ATOM   2414  C CA   . GLY B 2 31  ? 6.966   5.934   -4.763  1.00 10.78 ? 170 GLY B CA   2  
ATOM   2415  C C    . GLY B 2 31  ? 6.655   4.449   -4.953  1.00 11.90 ? 170 GLY B C    2  
ATOM   2416  O O    . GLY B 2 31  ? 5.514   4.059   -5.101  1.00 11.93 ? 170 GLY B O    2  
ATOM   2417  H H    . GLY B 2 31  ? 8.715   5.402   -3.622  1.00 0.00  ? 170 GLY B H    2  
ATOM   2418  H HA2  . GLY B 2 31  ? 6.249   6.369   -4.081  1.00 0.00  ? 170 GLY B HA2  2  
ATOM   2419  H HA3  . GLY B 2 31  ? 6.906   6.435   -5.717  1.00 0.00  ? 170 GLY B HA3  2  
ATOM   2420  N N    . THR B 2 32  ? 7.659   3.613   -4.948  1.00 11.18 ? 171 THR B N    2  
ATOM   2421  C CA   . THR B 2 32  ? 7.411   2.156   -5.126  1.00 10.98 ? 171 THR B CA   2  
ATOM   2422  C C    . THR B 2 32  ? 6.437   1.677   -4.049  1.00 10.39 ? 171 THR B C    2  
ATOM   2423  O O    . THR B 2 32  ? 6.535   2.056   -2.899  1.00 11.11 ? 171 THR B O    2  
ATOM   2424  C CB   . THR B 2 32  ? 8.731   1.391   -4.999  1.00 12.81 ? 171 THR B CB   2  
ATOM   2425  O OG1  . THR B 2 32  ? 9.645   1.860   -5.981  1.00 15.73 ? 171 THR B OG1  2  
ATOM   2426  C CG2  . THR B 2 32  ? 8.479   -0.103  -5.206  1.00 10.54 ? 171 THR B CG2  2  
ATOM   2427  H H    . THR B 2 32  ? 8.573   3.945   -4.826  1.00 0.00  ? 171 THR B H    2  
ATOM   2428  H HA   . THR B 2 32  ? 6.985   1.979   -6.103  1.00 0.00  ? 171 THR B HA   2  
ATOM   2429  H HB   . THR B 2 32  ? 9.146   1.549   -4.014  1.00 0.00  ? 171 THR B HB   2  
ATOM   2430  H HG1  . THR B 2 32  ? 9.457   1.404   -6.803  1.00 0.00  ? 171 THR B HG1  2  
ATOM   2431  H HG21 . THR B 2 32  ? 7.743   -0.239  -5.984  1.00 0.00  ? 171 THR B HG21 2  
ATOM   2432  H HG22 . THR B 2 32  ? 9.401   -0.587  -5.493  1.00 0.00  ? 171 THR B HG22 2  
ATOM   2433  H HG23 . THR B 2 32  ? 8.116   -0.537  -4.286  1.00 0.00  ? 171 THR B HG23 2  
ATOM   2434  N N    . PHE B 2 33  ? 5.493   0.851   -4.409  1.00 9.86  ? 172 PHE B N    2  
ATOM   2435  C CA   . PHE B 2 33  ? 4.515   0.361   -3.399  1.00 10.31 ? 172 PHE B CA   2  
ATOM   2436  C C    . PHE B 2 33  ? 4.122   -1.084  -3.714  1.00 9.74  ? 172 PHE B C    2  
ATOM   2437  O O    . PHE B 2 33  ? 4.550   -1.657  -4.697  1.00 10.89 ? 172 PHE B O    2  
ATOM   2438  C CB   . PHE B 2 33  ? 3.266   1.242   -3.433  1.00 8.42  ? 172 PHE B CB   2  
ATOM   2439  C CG   . PHE B 2 33  ? 2.588   1.104   -4.774  1.00 10.33 ? 172 PHE B CG   2  
ATOM   2440  C CD1  . PHE B 2 33  ? 1.619   0.106   -4.972  1.00 10.22 ? 172 PHE B CD1  2  
ATOM   2441  C CD2  . PHE B 2 33  ? 2.930   1.970   -5.827  1.00 9.32  ? 172 PHE B CD2  2  
ATOM   2442  C CE1  . PHE B 2 33  ? 0.989   -0.024  -6.221  1.00 9.66  ? 172 PHE B CE1  2  
ATOM   2443  C CE2  . PHE B 2 33  ? 2.299   1.841   -7.076  1.00 10.82 ? 172 PHE B CE2  2  
ATOM   2444  C CZ   . PHE B 2 33  ? 1.330   0.843   -7.273  1.00 11.64 ? 172 PHE B CZ   2  
ATOM   2445  H H    . PHE B 2 33  ? 5.425   0.558   -5.342  1.00 0.00  ? 172 PHE B H    2  
ATOM   2446  H HA   . PHE B 2 33  ? 4.959   0.405   -2.416  1.00 0.00  ? 172 PHE B HA   2  
ATOM   2447  H HB2  . PHE B 2 33  ? 2.585   0.935   -2.652  1.00 0.00  ? 172 PHE B HB2  2  
ATOM   2448  H HB3  . PHE B 2 33  ? 3.549   2.273   -3.278  1.00 0.00  ? 172 PHE B HB3  2  
ATOM   2449  H HD1  . PHE B 2 33  ? 1.357   -0.560  -4.163  1.00 0.00  ? 172 PHE B HD1  2  
ATOM   2450  H HD2  . PHE B 2 33  ? 3.674   2.737   -5.675  1.00 0.00  ? 172 PHE B HD2  2  
ATOM   2451  H HE1  . PHE B 2 33  ? 0.245   -0.791  -6.373  1.00 0.00  ? 172 PHE B HE1  2  
ATOM   2452  H HE2  . PHE B 2 33  ? 2.562   2.507   -7.885  1.00 0.00  ? 172 PHE B HE2  2  
ATOM   2453  H HZ   . PHE B 2 33  ? 0.846   0.743   -8.234  1.00 0.00  ? 172 PHE B HZ   2  
ATOM   2454  N N    . LEU B 2 34  ? 3.306   -1.675  -2.885  1.00 8.06  ? 173 LEU B N    2  
ATOM   2455  C CA   . LEU B 2 34  ? 2.876   -3.081  -3.126  1.00 6.70  ? 173 LEU B CA   2  
ATOM   2456  C C    . LEU B 2 34  ? 1.664   -3.397  -2.249  1.00 8.22  ? 173 LEU B C    2  
ATOM   2457  O O    . LEU B 2 34  ? 1.331   -2.657  -1.344  1.00 8.04  ? 173 LEU B O    2  
ATOM   2458  C CB   . LEU B 2 34  ? 4.022   -4.034  -2.777  1.00 7.47  ? 173 LEU B CB   2  
ATOM   2459  C CG   . LEU B 2 34  ? 4.688   -3.580  -1.477  1.00 8.31  ? 173 LEU B CG   2  
ATOM   2460  C CD1  . LEU B 2 34  ? 3.783   -3.925  -0.294  1.00 7.11  ? 173 LEU B CD1  2  
ATOM   2461  C CD2  . LEU B 2 34  ? 6.029   -4.298  -1.316  1.00 7.67  ? 173 LEU B CD2  2  
ATOM   2462  H H    . LEU B 2 34  ? 2.974   -1.191  -2.099  1.00 0.00  ? 173 LEU B H    2  
ATOM   2463  H HA   . LEU B 2 34  ? 2.611   -3.202  -4.166  1.00 0.00  ? 173 LEU B HA   2  
ATOM   2464  H HB2  . LEU B 2 34  ? 3.632   -5.035  -2.654  1.00 0.00  ? 173 LEU B HB2  2  
ATOM   2465  H HB3  . LEU B 2 34  ? 4.751   -4.028  -3.574  1.00 0.00  ? 173 LEU B HB3  2  
ATOM   2466  H HG   . LEU B 2 34  ? 4.848   -2.513  -1.508  1.00 0.00  ? 173 LEU B HG   2  
ATOM   2467  H HD11 . LEU B 2 34  ? 2.967   -4.547  -0.633  1.00 0.00  ? 173 LEU B HD11 2  
ATOM   2468  H HD12 . LEU B 2 34  ? 4.353   -4.457  0.454   1.00 0.00  ? 173 LEU B HD12 2  
ATOM   2469  H HD13 . LEU B 2 34  ? 3.387   -3.016  0.135   1.00 0.00  ? 173 LEU B HD13 2  
ATOM   2470  H HD21 . LEU B 2 34  ? 6.205   -4.931  -2.174  1.00 0.00  ? 173 LEU B HD21 2  
ATOM   2471  H HD22 . LEU B 2 34  ? 6.821   -3.567  -1.239  1.00 0.00  ? 173 LEU B HD22 2  
ATOM   2472  H HD23 . LEU B 2 34  ? 6.009   -4.902  -0.421  1.00 0.00  ? 173 LEU B HD23 2  
ATOM   2473  N N    . VAL B 2 35  ? 1.001   -4.490  -2.506  1.00 9.95  ? 174 VAL B N    2  
ATOM   2474  C CA   . VAL B 2 35  ? -0.190  -4.852  -1.684  1.00 10.61 ? 174 VAL B CA   2  
ATOM   2475  C C    . VAL B 2 35  ? -0.156  -6.350  -1.375  1.00 10.97 ? 174 VAL B C    2  
ATOM   2476  O O    . VAL B 2 35  ? 0.109   -7.163  -2.237  1.00 13.68 ? 174 VAL B O    2  
ATOM   2477  C CB   . VAL B 2 35  ? -1.467  -4.523  -2.458  1.00 8.85  ? 174 VAL B CB   2  
ATOM   2478  C CG1  . VAL B 2 35  ? -2.663  -4.560  -1.504  1.00 7.48  ? 174 VAL B CG1  2  
ATOM   2479  C CG2  . VAL B 2 35  ? -1.351  -3.125  -3.070  1.00 7.46  ? 174 VAL B CG2  2  
ATOM   2480  H H    . VAL B 2 35  ? 1.286   -5.074  -3.239  1.00 0.00  ? 174 VAL B H    2  
ATOM   2481  H HA   . VAL B 2 35  ? -0.173  -4.293  -0.761  1.00 0.00  ? 174 VAL B HA   2  
ATOM   2482  H HB   . VAL B 2 35  ? -1.611  -5.252  -3.242  1.00 0.00  ? 174 VAL B HB   2  
ATOM   2483  H HG11 . VAL B 2 35  ? -2.463  -3.929  -0.652  1.00 0.00  ? 174 VAL B HG11 2  
ATOM   2484  H HG12 . VAL B 2 35  ? -3.543  -4.203  -2.018  1.00 0.00  ? 174 VAL B HG12 2  
ATOM   2485  H HG13 . VAL B 2 35  ? -2.827  -5.575  -1.173  1.00 0.00  ? 174 VAL B HG13 2  
ATOM   2486  H HG21 . VAL B 2 35  ? -0.345  -2.975  -3.435  1.00 0.00  ? 174 VAL B HG21 2  
ATOM   2487  H HG22 . VAL B 2 35  ? -2.048  -3.033  -3.889  1.00 0.00  ? 174 VAL B HG22 2  
ATOM   2488  H HG23 . VAL B 2 35  ? -1.577  -2.384  -2.319  1.00 0.00  ? 174 VAL B HG23 2  
ATOM   2489  N N    . ARG B 2 36  ? -0.424  -6.720  -0.154  1.00 12.04 ? 175 ARG B N    2  
ATOM   2490  C CA   . ARG B 2 36  ? -0.406  -8.168  0.203   1.00 13.07 ? 175 ARG B CA   2  
ATOM   2491  C C    . ARG B 2 36  ? -1.474  -8.451  1.261   1.00 15.49 ? 175 ARG B C    2  
ATOM   2492  O O    . ARG B 2 36  ? -2.000  -7.550  1.884   1.00 11.34 ? 175 ARG B O    2  
ATOM   2493  C CB   . ARG B 2 36  ? 0.972   -8.549  0.755   1.00 10.24 ? 175 ARG B CB   2  
ATOM   2494  C CG   . ARG B 2 36  ? 1.560   -7.373  1.539   1.00 10.97 ? 175 ARG B CG   2  
ATOM   2495  C CD   . ARG B 2 36  ? 2.591   -6.649  0.671   1.00 8.81  ? 175 ARG B CD   2  
ATOM   2496  N NE   . ARG B 2 36  ? 3.566   -7.638  0.130   1.00 7.82  ? 175 ARG B NE   2  
ATOM   2497  C CZ   . ARG B 2 36  ? 4.003   -7.520  -1.095  1.00 8.03  ? 175 ARG B CZ   2  
ATOM   2498  N NH1  . ARG B 2 36  ? 3.178   -7.198  -2.054  1.00 11.06 ? 175 ARG B NH1  2  
ATOM   2499  N NH2  . ARG B 2 36  ? 5.264   -7.724  -1.361  1.00 7.60  ? 175 ARG B NH2  2  
ATOM   2500  H H    . ARG B 2 36  ? -0.636  -6.046  0.529   1.00 0.00  ? 175 ARG B H    2  
ATOM   2501  H HA   . ARG B 2 36  ? -0.613  -8.755  -0.680  1.00 0.00  ? 175 ARG B HA   2  
ATOM   2502  H HB2  . ARG B 2 36  ? 0.873   -9.402  1.409   1.00 0.00  ? 175 ARG B HB2  2  
ATOM   2503  H HB3  . ARG B 2 36  ? 1.631   -8.798  -0.064  1.00 0.00  ? 175 ARG B HB3  2  
ATOM   2504  H HG2  . ARG B 2 36  ? 0.769   -6.687  1.807   1.00 0.00  ? 175 ARG B HG2  2  
ATOM   2505  H HG3  . ARG B 2 36  ? 2.039   -7.740  2.433   1.00 0.00  ? 175 ARG B HG3  2  
ATOM   2506  H HD2  . ARG B 2 36  ? 2.089   -6.154  -0.146  1.00 0.00  ? 175 ARG B HD2  2  
ATOM   2507  H HD3  . ARG B 2 36  ? 3.115   -5.918  1.268   1.00 0.00  ? 175 ARG B HD3  2  
ATOM   2508  H HE   . ARG B 2 36  ? 3.878   -8.377  0.692   1.00 0.00  ? 175 ARG B HE   2  
ATOM   2509  H HH11 . ARG B 2 36  ? 2.211   -7.042  -1.851  1.00 0.00  ? 175 ARG B HH11 2  
ATOM   2510  H HH12 . ARG B 2 36  ? 3.512   -7.108  -2.992  1.00 0.00  ? 175 ARG B HH12 2  
ATOM   2511  H HH21 . ARG B 2 36  ? 5.896   -7.971  -0.627  1.00 0.00  ? 175 ARG B HH21 2  
ATOM   2512  H HH22 . ARG B 2 36  ? 5.598   -7.634  -2.299  1.00 0.00  ? 175 ARG B HH22 2  
ATOM   2513  N N    . GLU B 2 37  ? -1.799  -9.697  1.468   1.00 20.91 ? 176 GLU B N    2  
ATOM   2514  C CA   . GLU B 2 37  ? -2.833  -10.040 2.484   1.00 26.31 ? 176 GLU B CA   2  
ATOM   2515  C C    . GLU B 2 37  ? -2.331  -9.643  3.874   1.00 29.76 ? 176 GLU B C    2  
ATOM   2516  O O    . GLU B 2 37  ? -1.351  -10.168 4.363   1.00 30.61 ? 176 GLU B O    2  
ATOM   2517  C CB   . GLU B 2 37  ? -3.100  -11.546 2.450   1.00 25.39 ? 176 GLU B CB   2  
ATOM   2518  C CG   . GLU B 2 37  ? -4.606  -11.797 2.339   1.00 29.84 ? 176 GLU B CG   2  
ATOM   2519  C CD   . GLU B 2 37  ? -4.865  -12.906 1.317   1.00 32.50 ? 176 GLU B CD   2  
ATOM   2520  O OE1  . GLU B 2 37  ? -4.523  -12.712 0.163   1.00 36.79 ? 176 GLU B OE1  2  
ATOM   2521  O OE2  . GLU B 2 37  ? -5.401  -13.931 1.707   1.00 34.32 ? 176 GLU B OE2  2  
ATOM   2522  H H    . GLU B 2 37  ? -1.364  -10.409 0.954   1.00 0.00  ? 176 GLU B H    2  
ATOM   2523  H HA   . GLU B 2 37  ? -3.745  -9.507  2.264   1.00 0.00  ? 176 GLU B HA   2  
ATOM   2524  H HB2  . GLU B 2 37  ? -2.599  -11.981 1.598   1.00 0.00  ? 176 GLU B HB2  2  
ATOM   2525  H HB3  . GLU B 2 37  ? -2.728  -11.999 3.357   1.00 0.00  ? 176 GLU B HB3  2  
ATOM   2526  H HG2  . GLU B 2 37  ? -4.993  -12.097 3.302   1.00 0.00  ? 176 GLU B HG2  2  
ATOM   2527  H HG3  . GLU B 2 37  ? -5.099  -10.893 2.018   1.00 0.00  ? 176 GLU B HG3  2  
ATOM   2528  N N    . SER B 2 38  ? -2.994  -8.720  4.514   1.00 36.14 ? 177 SER B N    2  
ATOM   2529  C CA   . SER B 2 38  ? -2.553  -8.292  5.871   1.00 41.98 ? 177 SER B CA   2  
ATOM   2530  C C    . SER B 2 38  ? -2.327  -9.528  6.744   1.00 43.00 ? 177 SER B C    2  
ATOM   2531  O O    . SER B 2 38  ? -3.251  -10.243 7.074   1.00 43.66 ? 177 SER B O    2  
ATOM   2532  C CB   . SER B 2 38  ? -3.631  -7.411  6.504   1.00 45.78 ? 177 SER B CB   2  
ATOM   2533  O OG   . SER B 2 38  ? -3.018  -6.279  7.105   1.00 51.84 ? 177 SER B OG   2  
ATOM   2534  H H    . SER B 2 38  ? -3.784  -8.307  4.103   1.00 0.00  ? 177 SER B H    2  
ATOM   2535  H HA   . SER B 2 38  ? -1.632  -7.734  5.791   1.00 0.00  ? 177 SER B HA   2  
ATOM   2536  H HB2  . SER B 2 38  ? -4.320  -7.081  5.746   1.00 0.00  ? 177 SER B HB2  2  
ATOM   2537  H HB3  . SER B 2 38  ? -4.168  -7.982  7.251   1.00 0.00  ? 177 SER B HB3  2  
ATOM   2538  H HG   . SER B 2 38  ? -2.530  -6.579  7.876   1.00 0.00  ? 177 SER B HG   2  
ATOM   2539  N N    . GLU B 2 39  ? -1.105  -9.787  7.120   1.00 23.97 ? 178 GLU B N    2  
ATOM   2540  C CA   . GLU B 2 39  ? -0.828  -10.979 7.970   1.00 25.52 ? 178 GLU B CA   2  
ATOM   2541  C C    . GLU B 2 39  ? -1.557  -10.832 9.308   1.00 30.02 ? 178 GLU B C    2  
ATOM   2542  O O    . GLU B 2 39  ? -1.936  -11.806 9.929   1.00 31.55 ? 178 GLU B O    2  
ATOM   2543  C CB   . GLU B 2 39  ? 0.678   -11.089 8.218   1.00 23.29 ? 178 GLU B CB   2  
ATOM   2544  C CG   . GLU B 2 39  ? 1.368   -11.594 6.950   1.00 29.79 ? 178 GLU B CG   2  
ATOM   2545  C CD   . GLU B 2 39  ? 0.878   -13.008 6.629   1.00 33.17 ? 178 GLU B CD   2  
ATOM   2546  O OE1  . GLU B 2 39  ? 1.403   -13.943 7.211   1.00 39.84 ? 178 GLU B OE1  2  
ATOM   2547  O OE2  . GLU B 2 39  ? -0.016  -13.132 5.807   1.00 21.15 ? 178 GLU B OE2  2  
ATOM   2548  H H    . GLU B 2 39  ? -0.372  -9.199  6.844   1.00 0.00  ? 178 GLU B H    2  
ATOM   2549  H HA   . GLU B 2 39  ? -1.175  -11.868 7.467   1.00 0.00  ? 178 GLU B HA   2  
ATOM   2550  H HB2  . GLU B 2 39  ? 1.072   -10.118 8.481   1.00 0.00  ? 178 GLU B HB2  2  
ATOM   2551  H HB3  . GLU B 2 39  ? 0.860   -11.782 9.025   1.00 0.00  ? 178 GLU B HB3  2  
ATOM   2552  H HG2  . GLU B 2 39  ? 1.133   -10.935 6.126   1.00 0.00  ? 178 GLU B HG2  2  
ATOM   2553  H HG3  . GLU B 2 39  ? 2.437   -11.613 7.103   1.00 0.00  ? 178 GLU B HG3  2  
ATOM   2554  N N    . THR B 2 40  ? -1.757  -9.623  9.756   1.00 26.98 ? 179 THR B N    2  
ATOM   2555  C CA   . THR B 2 40  ? -2.460  -9.414  11.051  1.00 31.67 ? 179 THR B CA   2  
ATOM   2556  C C    . THR B 2 40  ? -3.970  -9.352  10.810  1.00 34.54 ? 179 THR B C    2  
ATOM   2557  O O    . THR B 2 40  ? -4.760  -9.688  11.670  1.00 34.85 ? 179 THR B O    2  
ATOM   2558  C CB   . THR B 2 40  ? -1.989  -8.099  11.677  1.00 26.17 ? 179 THR B CB   2  
ATOM   2559  O OG1  . THR B 2 40  ? -2.700  -7.018  11.090  1.00 28.58 ? 179 THR B OG1  2  
ATOM   2560  C CG2  . THR B 2 40  ? -0.490  -7.921  11.430  1.00 35.55 ? 179 THR B CG2  2  
ATOM   2561  H H    . THR B 2 40  ? -1.444  -8.851  9.242   1.00 0.00  ? 179 THR B H    2  
ATOM   2562  H HA   . THR B 2 40  ? -2.234  -10.232 11.720  1.00 0.00  ? 179 THR B HA   2  
ATOM   2563  H HB   . THR B 2 40  ? -2.174  -8.120  12.737  1.00 0.00  ? 179 THR B HB   2  
ATOM   2564  H HG1  . THR B 2 40  ? -3.216  -6.594  11.780  1.00 0.00  ? 179 THR B HG1  2  
ATOM   2565  H HG21 . THR B 2 40  ? 0.021   -8.851  11.632  1.00 0.00  ? 179 THR B HG21 2  
ATOM   2566  H HG22 . THR B 2 40  ? -0.325  -7.635  10.402  1.00 0.00  ? 179 THR B HG22 2  
ATOM   2567  H HG23 . THR B 2 40  ? -0.106  -7.152  12.084  1.00 0.00  ? 179 THR B HG23 2  
ATOM   2568  N N    . THR B 2 41  ? -4.376  -8.923  9.646   1.00 27.03 ? 180 THR B N    2  
ATOM   2569  C CA   . THR B 2 41  ? -5.836  -8.839  9.351   1.00 25.08 ? 180 THR B CA   2  
ATOM   2570  C C    . THR B 2 41  ? -6.257  -10.045 8.509   1.00 30.09 ? 180 THR B C    2  
ATOM   2571  O O    . THR B 2 41  ? -5.503  -10.540 7.697   1.00 30.04 ? 180 THR B O    2  
ATOM   2572  C CB   . THR B 2 41  ? -6.124  -7.550  8.575   1.00 29.37 ? 180 THR B CB   2  
ATOM   2573  O OG1  . THR B 2 41  ? -5.182  -6.554  8.948   1.00 38.10 ? 180 THR B OG1  2  
ATOM   2574  C CG2  . THR B 2 41  ? -7.538  -7.063  8.895   1.00 40.88 ? 180 THR B CG2  2  
ATOM   2575  H H    . THR B 2 41  ? -3.723  -8.655  8.967   1.00 0.00  ? 180 THR B H    2  
ATOM   2576  H HA   . THR B 2 41  ? -6.392  -8.833  10.276  1.00 0.00  ? 180 THR B HA   2  
ATOM   2577  H HB   . THR B 2 41  ? -6.044  -7.741  7.517   1.00 0.00  ? 180 THR B HB   2  
ATOM   2578  H HG1  . THR B 2 41  ? -5.254  -5.828  8.324   1.00 0.00  ? 180 THR B HG1  2  
ATOM   2579  H HG21 . THR B 2 41  ? -7.777  -7.302  9.921   1.00 0.00  ? 180 THR B HG21 2  
ATOM   2580  H HG22 . THR B 2 41  ? -7.591  -5.994  8.753   1.00 0.00  ? 180 THR B HG22 2  
ATOM   2581  H HG23 . THR B 2 41  ? -8.244  -7.549  8.238   1.00 0.00  ? 180 THR B HG23 2  
ATOM   2582  N N    . LYS B 2 42  ? -7.456  -10.524 8.696   1.00 32.42 ? 181 LYS B N    2  
ATOM   2583  C CA   . LYS B 2 42  ? -7.919  -11.698 7.906   1.00 38.97 ? 181 LYS B CA   2  
ATOM   2584  C C    . LYS B 2 42  ? -9.053  -11.272 6.972   1.00 35.28 ? 181 LYS B C    2  
ATOM   2585  O O    . LYS B 2 42  ? -10.175 -11.072 7.393   1.00 34.92 ? 181 LYS B O    2  
ATOM   2586  C CB   . LYS B 2 42  ? -8.422  -12.786 8.856   1.00 51.02 ? 181 LYS B CB   2  
ATOM   2587  C CG   . LYS B 2 42  ? -8.344  -14.147 8.163   1.00 72.35 ? 181 LYS B CG   2  
ATOM   2588  C CD   . LYS B 2 42  ? -9.592  -14.964 8.499   1.00 84.05 ? 181 LYS B CD   2  
ATOM   2589  C CE   . LYS B 2 42  ? -9.496  -16.340 7.836   1.00 88.20 ? 181 LYS B CE   2  
ATOM   2590  N NZ   . LYS B 2 42  ? -10.118 -16.283 6.482   1.00 87.98 ? 181 LYS B NZ   2  
ATOM   2591  H H    . LYS B 2 42  ? -8.051  -10.112 9.357   1.00 0.00  ? 181 LYS B H    2  
ATOM   2592  H HA   . LYS B 2 42  ? -7.097  -12.084 7.320   1.00 0.00  ? 181 LYS B HA   2  
ATOM   2593  H HB2  . LYS B 2 42  ? -7.810  -12.797 9.746   1.00 0.00  ? 181 LYS B HB2  2  
ATOM   2594  H HB3  . LYS B 2 42  ? -9.447  -12.581 9.127   1.00 0.00  ? 181 LYS B HB3  2  
ATOM   2595  H HG2  . LYS B 2 42  ? -8.284  -14.002 7.093   1.00 0.00  ? 181 LYS B HG2  2  
ATOM   2596  H HG3  . LYS B 2 42  ? -7.467  -14.675 8.504   1.00 0.00  ? 181 LYS B HG3  2  
ATOM   2597  H HD2  . LYS B 2 42  ? -9.666  -15.085 9.570   1.00 0.00  ? 181 LYS B HD2  2  
ATOM   2598  H HD3  . LYS B 2 42  ? -10.468 -14.451 8.133   1.00 0.00  ? 181 LYS B HD3  2  
ATOM   2599  H HE2  . LYS B 2 42  ? -8.458  -16.622 7.743   1.00 0.00  ? 181 LYS B HE2  2  
ATOM   2600  H HE3  . LYS B 2 42  ? -10.015 -17.068 8.440   1.00 0.00  ? 181 LYS B HE3  2  
ATOM   2601  H HZ1  . LYS B 2 42  ? -10.660 -15.401 6.385   1.00 0.00  ? 181 LYS B HZ1  2  
ATOM   2602  H HZ2  . LYS B 2 42  ? -9.372  -16.316 5.757   1.00 0.00  ? 181 LYS B HZ2  2  
ATOM   2603  H HZ3  . LYS B 2 42  ? -10.757 -17.094 6.360   1.00 0.00  ? 181 LYS B HZ3  2  
ATOM   2604  N N    . GLY B 2 43  ? -8.771  -11.132 5.705   1.00 38.03 ? 182 GLY B N    2  
ATOM   2605  C CA   . GLY B 2 43  ? -9.835  -10.720 4.746   1.00 30.70 ? 182 GLY B CA   2  
ATOM   2606  C C    . GLY B 2 43  ? -9.490  -9.355  4.149   1.00 29.58 ? 182 GLY B C    2  
ATOM   2607  O O    . GLY B 2 43  ? -9.944  -9.004  3.078   1.00 31.67 ? 182 GLY B O    2  
ATOM   2608  H H    . GLY B 2 43  ? -7.860  -11.298 5.384   1.00 0.00  ? 182 GLY B H    2  
ATOM   2609  H HA2  . GLY B 2 43  ? -9.910  -11.453 3.956   1.00 0.00  ? 182 GLY B HA2  2  
ATOM   2610  H HA3  . GLY B 2 43  ? -10.779 -10.653 5.265   1.00 0.00  ? 182 GLY B HA3  2  
ATOM   2611  N N    . ALA B 2 44  ? -8.691  -8.581  4.832   1.00 35.86 ? 183 ALA B N    2  
ATOM   2612  C CA   . ALA B 2 44  ? -8.322  -7.240  4.298   1.00 32.70 ? 183 ALA B CA   2  
ATOM   2613  C C    . ALA B 2 44  ? -6.854  -7.247  3.865   1.00 28.65 ? 183 ALA B C    2  
ATOM   2614  O O    . ALA B 2 44  ? -6.016  -7.874  4.484   1.00 29.39 ? 183 ALA B O    2  
ATOM   2615  C CB   . ALA B 2 44  ? -8.528  -6.185  5.386   1.00 31.44 ? 183 ALA B CB   2  
ATOM   2616  H H    . ALA B 2 44  ? -8.335  -8.881  5.694   1.00 0.00  ? 183 ALA B H    2  
ATOM   2617  H HA   . ALA B 2 44  ? -8.946  -7.007  3.448   1.00 0.00  ? 183 ALA B HA   2  
ATOM   2618  H HB1  . ALA B 2 44  ? -9.072  -6.619  6.211   1.00 0.00  ? 183 ALA B HB1  2  
ATOM   2619  H HB2  . ALA B 2 44  ? -7.567  -5.833  5.733   1.00 0.00  ? 183 ALA B HB2  2  
ATOM   2620  H HB3  . ALA B 2 44  ? -9.090  -5.356  4.980   1.00 0.00  ? 183 ALA B HB3  2  
ATOM   2621  N N    . TYR B 2 45  ? -6.536  -6.553  2.807   1.00 24.43 ? 184 TYR B N    2  
ATOM   2622  C CA   . TYR B 2 45  ? -5.124  -6.519  2.334   1.00 19.69 ? 184 TYR B CA   2  
ATOM   2623  C C    . TYR B 2 45  ? -4.415  -5.303  2.933   1.00 15.67 ? 184 TYR B C    2  
ATOM   2624  O O    . TYR B 2 45  ? -4.944  -4.622  3.789   1.00 11.54 ? 184 TYR B O    2  
ATOM   2625  C CB   . TYR B 2 45  ? -5.100  -6.423  0.807   1.00 20.89 ? 184 TYR B CB   2  
ATOM   2626  C CG   . TYR B 2 45  ? -5.912  -7.551  0.210   1.00 21.46 ? 184 TYR B CG   2  
ATOM   2627  C CD1  . TYR B 2 45  ? -6.001  -8.786  0.875   1.00 23.38 ? 184 TYR B CD1  2  
ATOM   2628  C CD2  . TYR B 2 45  ? -6.577  -7.365  -1.015  1.00 21.81 ? 184 TYR B CD2  2  
ATOM   2629  C CE1  . TYR B 2 45  ? -6.754  -9.833  0.318   1.00 24.77 ? 184 TYR B CE1  2  
ATOM   2630  C CE2  . TYR B 2 45  ? -7.330  -8.413  -1.571  1.00 21.77 ? 184 TYR B CE2  2  
ATOM   2631  C CZ   . TYR B 2 45  ? -7.419  -9.646  -0.905  1.00 25.72 ? 184 TYR B CZ   2  
ATOM   2632  O OH   . TYR B 2 45  ? -8.159  -10.674 -1.452  1.00 27.17 ? 184 TYR B OH   2  
ATOM   2633  H H    . TYR B 2 45  ? -7.227  -6.055  2.322   1.00 0.00  ? 184 TYR B H    2  
ATOM   2634  H HA   . TYR B 2 45  ? -4.618  -7.421  2.646   1.00 0.00  ? 184 TYR B HA   2  
ATOM   2635  H HB2  . TYR B 2 45  ? -5.520  -5.476  0.500   1.00 0.00  ? 184 TYR B HB2  2  
ATOM   2636  H HB3  . TYR B 2 45  ? -4.080  -6.492  0.458   1.00 0.00  ? 184 TYR B HB3  2  
ATOM   2637  H HD1  . TYR B 2 45  ? -5.490  -8.929  1.816   1.00 0.00  ? 184 TYR B HD1  2  
ATOM   2638  H HD2  . TYR B 2 45  ? -6.510  -6.417  -1.527  1.00 0.00  ? 184 TYR B HD2  2  
ATOM   2639  H HE1  . TYR B 2 45  ? -6.822  -10.780 0.831   1.00 0.00  ? 184 TYR B HE1  2  
ATOM   2640  H HE2  . TYR B 2 45  ? -7.842  -8.269  -2.512  1.00 0.00  ? 184 TYR B HE2  2  
ATOM   2641  H HH   . TYR B 2 45  ? -7.807  -10.861 -2.325  1.00 0.00  ? 184 TYR B HH   2  
ATOM   2642  N N    . CYS B 2 46  ? -3.220  -5.024  2.489   1.00 12.49 ? 185 CYS B N    2  
ATOM   2643  C CA   . CYS B 2 46  ? -2.479  -3.851  3.032   1.00 13.07 ? 185 CYS B CA   2  
ATOM   2644  C C    . CYS B 2 46  ? -1.652  -3.210  1.917   1.00 11.90 ? 185 CYS B C    2  
ATOM   2645  O O    . CYS B 2 46  ? -0.821  -3.849  1.301   1.00 11.52 ? 185 CYS B O    2  
ATOM   2646  C CB   . CYS B 2 46  ? -1.549  -4.308  4.159   1.00 13.05 ? 185 CYS B CB   2  
ATOM   2647  S SG   . CYS B 2 46  ? -0.738  -5.856  3.686   1.00 27.90 ? 185 CYS B SG   2  
ATOM   2648  H H    . CYS B 2 46  ? -2.811  -5.585  1.798   1.00 0.00  ? 185 CYS B H    2  
ATOM   2649  H HA   . CYS B 2 46  ? -3.183  -3.129  3.418   1.00 0.00  ? 185 CYS B HA   2  
ATOM   2650  H HB2  . CYS B 2 46  ? -0.801  -3.550  4.337   1.00 0.00  ? 185 CYS B HB2  2  
ATOM   2651  H HB3  . CYS B 2 46  ? -2.124  -4.464  5.060   1.00 0.00  ? 185 CYS B HB3  2  
ATOM   2652  H HG   . CYS B 2 46  ? -0.717  -5.899  2.727   1.00 0.00  ? 185 CYS B HG   2  
ATOM   2653  N N    . LEU B 2 47  ? -1.876  -1.952  1.651   1.00 10.41 ? 186 LEU B N    2  
ATOM   2654  C CA   . LEU B 2 47  ? -1.104  -1.266  0.576   1.00 10.82 ? 186 LEU B CA   2  
ATOM   2655  C C    . LEU B 2 47  ? 0.049   -0.476  1.202   1.00 10.91 ? 186 LEU B C    2  
ATOM   2656  O O    . LEU B 2 47  ? -0.149  0.571   1.784   1.00 11.30 ? 186 LEU B O    2  
ATOM   2657  C CB   . LEU B 2 47  ? -2.031  -0.310  -0.183  1.00 8.57  ? 186 LEU B CB   2  
ATOM   2658  C CG   . LEU B 2 47  ? -1.205  0.590   -1.104  1.00 8.23  ? 186 LEU B CG   2  
ATOM   2659  C CD1  . LEU B 2 47  ? -0.532  -0.260  -2.183  1.00 10.17 ? 186 LEU B CD1  2  
ATOM   2660  C CD2  . LEU B 2 47  ? -2.124  1.617   -1.768  1.00 8.76  ? 186 LEU B CD2  2  
ATOM   2661  H H    . LEU B 2 47  ? -2.554  -1.457  2.160   1.00 0.00  ? 186 LEU B H    2  
ATOM   2662  H HA   . LEU B 2 47  ? -0.707  -2.002  -0.108  1.00 0.00  ? 186 LEU B HA   2  
ATOM   2663  H HB2  . LEU B 2 47  ? -2.732  -0.883  -0.772  1.00 0.00  ? 186 LEU B HB2  2  
ATOM   2664  H HB3  . LEU B 2 47  ? -2.572  0.302   0.524   1.00 0.00  ? 186 LEU B HB3  2  
ATOM   2665  H HG   . LEU B 2 47  ? -0.449  1.101   -0.525  1.00 0.00  ? 186 LEU B HG   2  
ATOM   2666  H HD11 . LEU B 2 47  ? -0.147  -1.166  -1.738  1.00 0.00  ? 186 LEU B HD11 2  
ATOM   2667  H HD12 . LEU B 2 47  ? -1.253  -0.512  -2.946  1.00 0.00  ? 186 LEU B HD12 2  
ATOM   2668  H HD13 . LEU B 2 47  ? 0.280   0.297   -2.626  1.00 0.00  ? 186 LEU B HD13 2  
ATOM   2669  H HD21 . LEU B 2 47  ? -3.088  1.607   -1.281  1.00 0.00  ? 186 LEU B HD21 2  
ATOM   2670  H HD22 . LEU B 2 47  ? -1.688  2.602   -1.680  1.00 0.00  ? 186 LEU B HD22 2  
ATOM   2671  H HD23 . LEU B 2 47  ? -2.247  1.370   -2.812  1.00 0.00  ? 186 LEU B HD23 2  
ATOM   2672  N N    . SER B 2 48  ? 1.252   -0.967  1.084   1.00 10.50 ? 187 SER B N    2  
ATOM   2673  C CA   . SER B 2 48  ? 2.415   -0.241  1.671   1.00 9.18  ? 187 SER B CA   2  
ATOM   2674  C C    . SER B 2 48  ? 3.037   0.667   0.608   1.00 8.50  ? 187 SER B C    2  
ATOM   2675  O O    . SER B 2 48  ? 2.792   0.514   -0.572  1.00 9.53  ? 187 SER B O    2  
ATOM   2676  C CB   . SER B 2 48  ? 3.457   -1.250  2.153   1.00 7.49  ? 187 SER B CB   2  
ATOM   2677  O OG   . SER B 2 48  ? 2.803   -2.313  2.833   1.00 5.18  ? 187 SER B OG   2  
ATOM   2678  H H    . SER B 2 48  ? 1.392   -1.812  0.609   1.00 0.00  ? 187 SER B H    2  
ATOM   2679  H HA   . SER B 2 48  ? 2.081   0.359   2.506   1.00 0.00  ? 187 SER B HA   2  
ATOM   2680  H HB2  . SER B 2 48  ? 3.994   -1.648  1.308   1.00 0.00  ? 187 SER B HB2  2  
ATOM   2681  H HB3  . SER B 2 48  ? 4.154   -0.757  2.819   1.00 0.00  ? 187 SER B HB3  2  
ATOM   2682  H HG   . SER B 2 48  ? 3.473   -2.933  3.130   1.00 0.00  ? 187 SER B HG   2  
ATOM   2683  N N    . VAL B 2 49  ? 3.842   1.613   1.015   1.00 11.78 ? 188 VAL B N    2  
ATOM   2684  C CA   . VAL B 2 49  ? 4.476   2.527   0.022   1.00 12.79 ? 188 VAL B CA   2  
ATOM   2685  C C    . VAL B 2 49  ? 5.911   2.841   0.453   1.00 14.65 ? 188 VAL B C    2  
ATOM   2686  O O    . VAL B 2 49  ? 6.292   2.625   1.587   1.00 14.43 ? 188 VAL B O    2  
ATOM   2687  C CB   . VAL B 2 49  ? 3.675   3.827   -0.058  1.00 12.22 ? 188 VAL B CB   2  
ATOM   2688  C CG1  . VAL B 2 49  ? 4.272   4.729   -1.141  1.00 11.34 ? 188 VAL B CG1  2  
ATOM   2689  C CG2  . VAL B 2 49  ? 2.220   3.509   -0.407  1.00 12.23 ? 188 VAL B CG2  2  
ATOM   2690  H H    . VAL B 2 49  ? 4.028   1.721   1.971   1.00 0.00  ? 188 VAL B H    2  
ATOM   2691  H HA   . VAL B 2 49  ? 4.488   2.052   -0.947  1.00 0.00  ? 188 VAL B HA   2  
ATOM   2692  H HB   . VAL B 2 49  ? 3.716   4.334   0.895   1.00 0.00  ? 188 VAL B HB   2  
ATOM   2693  H HG11 . VAL B 2 49  ? 4.625   4.120   -1.961  1.00 0.00  ? 188 VAL B HG11 2  
ATOM   2694  H HG12 . VAL B 2 49  ? 3.516   5.412   -1.498  1.00 0.00  ? 188 VAL B HG12 2  
ATOM   2695  H HG13 . VAL B 2 49  ? 5.097   5.290   -0.726  1.00 0.00  ? 188 VAL B HG13 2  
ATOM   2696  H HG21 . VAL B 2 49  ? 2.191   2.732   -1.158  1.00 0.00  ? 188 VAL B HG21 2  
ATOM   2697  H HG22 . VAL B 2 49  ? 1.701   3.172   0.479   1.00 0.00  ? 188 VAL B HG22 2  
ATOM   2698  H HG23 . VAL B 2 49  ? 1.739   4.397   -0.791  1.00 0.00  ? 188 VAL B HG23 2  
ATOM   2699  N N    . SER B 2 50  ? 6.708   3.354   -0.445  1.00 14.39 ? 189 SER B N    2  
ATOM   2700  C CA   . SER B 2 50  ? 8.118   3.686   -0.091  1.00 13.97 ? 189 SER B CA   2  
ATOM   2701  C C    . SER B 2 50  ? 8.263   5.202   0.057   1.00 14.32 ? 189 SER B C    2  
ATOM   2702  O O    . SER B 2 50  ? 7.480   5.965   -0.475  1.00 13.16 ? 189 SER B O    2  
ATOM   2703  C CB   . SER B 2 50  ? 9.051   3.193   -1.199  1.00 12.52 ? 189 SER B CB   2  
ATOM   2704  O OG   . SER B 2 50  ? 8.453   3.449   -2.464  1.00 13.11 ? 189 SER B OG   2  
ATOM   2705  H H    . SER B 2 50  ? 6.379   3.521   -1.352  1.00 0.00  ? 189 SER B H    2  
ATOM   2706  H HA   . SER B 2 50  ? 8.379   3.205   0.840   1.00 0.00  ? 189 SER B HA   2  
ATOM   2707  H HB2  . SER B 2 50  ? 9.991   3.715   -1.140  1.00 0.00  ? 189 SER B HB2  2  
ATOM   2708  H HB3  . SER B 2 50  ? 9.222   2.132   -1.079  1.00 0.00  ? 189 SER B HB3  2  
ATOM   2709  H HG   . SER B 2 50  ? 9.098   3.238   -3.143  1.00 0.00  ? 189 SER B HG   2  
ATOM   2710  N N    . ASP B 2 51  ? 9.259   5.646   0.775   1.00 17.22 ? 190 ASP B N    2  
ATOM   2711  C CA   . ASP B 2 51  ? 9.450   7.114   0.954   1.00 20.71 ? 190 ASP B CA   2  
ATOM   2712  C C    . ASP B 2 51  ? 10.946  7.427   1.039   1.00 19.82 ? 190 ASP B C    2  
ATOM   2713  O O    . ASP B 2 51  ? 11.739  6.609   1.460   1.00 20.14 ? 190 ASP B O    2  
ATOM   2714  C CB   . ASP B 2 51  ? 8.759   7.564   2.242   1.00 25.05 ? 190 ASP B CB   2  
ATOM   2715  C CG   . ASP B 2 51  ? 8.690   9.092   2.278   1.00 26.93 ? 190 ASP B CG   2  
ATOM   2716  O OD1  . ASP B 2 51  ? 7.822   9.642   1.622   1.00 30.74 ? 190 ASP B OD1  2  
ATOM   2717  O OD2  . ASP B 2 51  ? 9.508   9.686   2.961   1.00 31.13 ? 190 ASP B OD2  2  
ATOM   2718  H H    . ASP B 2 51  ? 9.880   5.015   1.197   1.00 0.00  ? 190 ASP B H    2  
ATOM   2719  H HA   . ASP B 2 51  ? 9.020   7.637   0.113   1.00 0.00  ? 190 ASP B HA   2  
ATOM   2720  H HB2  . ASP B 2 51  ? 7.759   7.156   2.276   1.00 0.00  ? 190 ASP B HB2  2  
ATOM   2721  H HB3  . ASP B 2 51  ? 9.321   7.211   3.095   1.00 0.00  ? 190 ASP B HB3  2  
ATOM   2722  N N    . PHE B 2 52  ? 11.337  8.608   0.643   1.00 21.67 ? 191 PHE B N    2  
ATOM   2723  C CA   . PHE B 2 52  ? 12.780  8.975   0.702   1.00 24.27 ? 191 PHE B CA   2  
ATOM   2724  C C    . PHE B 2 52  ? 12.921  10.427  1.164   1.00 28.02 ? 191 PHE B C    2  
ATOM   2725  O O    . PHE B 2 52  ? 12.148  11.286  0.788   1.00 25.66 ? 191 PHE B O    2  
ATOM   2726  C CB   . PHE B 2 52  ? 13.402  8.818   -0.687  1.00 23.13 ? 191 PHE B CB   2  
ATOM   2727  C CG   . PHE B 2 52  ? 14.815  9.354   -0.670  1.00 21.13 ? 191 PHE B CG   2  
ATOM   2728  C CD1  . PHE B 2 52  ? 15.882  8.509   -0.325  1.00 20.50 ? 191 PHE B CD1  2  
ATOM   2729  C CD2  . PHE B 2 52  ? 15.060  10.698  -1.000  1.00 18.20 ? 191 PHE B CD2  2  
ATOM   2730  C CE1  . PHE B 2 52  ? 17.196  9.007   -0.311  1.00 19.46 ? 191 PHE B CE1  2  
ATOM   2731  C CE2  . PHE B 2 52  ? 16.374  11.196  -0.985  1.00 16.51 ? 191 PHE B CE2  2  
ATOM   2732  C CZ   . PHE B 2 52  ? 17.442  10.351  -0.640  1.00 17.79 ? 191 PHE B CZ   2  
ATOM   2733  H H    . PHE B 2 52  ? 10.681  9.255   0.307   1.00 0.00  ? 191 PHE B H    2  
ATOM   2734  H HA   . PHE B 2 52  ? 13.288  8.324   1.398   1.00 0.00  ? 191 PHE B HA   2  
ATOM   2735  H HB2  . PHE B 2 52  ? 13.417  7.773   -0.960  1.00 0.00  ? 191 PHE B HB2  2  
ATOM   2736  H HB3  . PHE B 2 52  ? 12.818  9.370   -1.408  1.00 0.00  ? 191 PHE B HB3  2  
ATOM   2737  H HD1  . PHE B 2 52  ? 15.694  7.476   -0.073  1.00 0.00  ? 191 PHE B HD1  2  
ATOM   2738  H HD2  . PHE B 2 52  ? 14.239  11.348  -1.265  1.00 0.00  ? 191 PHE B HD2  2  
ATOM   2739  H HE1  . PHE B 2 52  ? 18.017  8.357   -0.045  1.00 0.00  ? 191 PHE B HE1  2  
ATOM   2740  H HE2  . PHE B 2 52  ? 16.563  12.229  -1.238  1.00 0.00  ? 191 PHE B HE2  2  
ATOM   2741  H HZ   . PHE B 2 52  ? 18.451  10.734  -0.628  1.00 0.00  ? 191 PHE B HZ   2  
ATOM   2742  N N    . ASP B 2 53  ? 13.903  10.708  1.977   1.00 32.66 ? 192 ASP B N    2  
ATOM   2743  C CA   . ASP B 2 53  ? 14.094  12.104  2.461   1.00 38.82 ? 192 ASP B CA   2  
ATOM   2744  C C    . ASP B 2 53  ? 15.564  12.498  2.317   1.00 41.14 ? 192 ASP B C    2  
ATOM   2745  O O    . ASP B 2 53  ? 16.433  11.658  2.191   1.00 38.49 ? 192 ASP B O    2  
ATOM   2746  C CB   . ASP B 2 53  ? 13.683  12.196  3.933   1.00 42.78 ? 192 ASP B CB   2  
ATOM   2747  C CG   . ASP B 2 53  ? 13.236  13.625  4.249   1.00 45.03 ? 192 ASP B CG   2  
ATOM   2748  O OD1  . ASP B 2 53  ? 14.088  14.428  4.593   1.00 46.40 ? 192 ASP B OD1  2  
ATOM   2749  O OD2  . ASP B 2 53  ? 12.050  13.890  4.144   1.00 49.15 ? 192 ASP B OD2  2  
ATOM   2750  H H    . ASP B 2 53  ? 14.516  10.000  2.267   1.00 0.00  ? 192 ASP B H    2  
ATOM   2751  H HA   . ASP B 2 53  ? 13.482  12.775  1.875   1.00 0.00  ? 192 ASP B HA   2  
ATOM   2752  H HB2  . ASP B 2 53  ? 12.869  11.512  4.122   1.00 0.00  ? 192 ASP B HB2  2  
ATOM   2753  H HB3  . ASP B 2 53  ? 14.524  11.937  4.557   1.00 0.00  ? 192 ASP B HB3  2  
ATOM   2754  N N    . ASN B 2 54  ? 15.850  13.771  2.333   1.00 45.91 ? 193 ASN B N    2  
ATOM   2755  C CA   . ASN B 2 54  ? 17.261  14.221  2.197   1.00 50.53 ? 193 ASN B CA   2  
ATOM   2756  C C    . ASN B 2 54  ? 17.814  14.601  3.572   1.00 51.37 ? 193 ASN B C    2  
ATOM   2757  O O    . ASN B 2 54  ? 18.271  15.707  3.782   1.00 52.38 ? 193 ASN B O    2  
ATOM   2758  C CB   . ASN B 2 54  ? 17.322  15.435  1.268   1.00 54.84 ? 193 ASN B CB   2  
ATOM   2759  C CG   . ASN B 2 54  ? 17.441  14.964  -0.182  1.00 60.46 ? 193 ASN B CG   2  
ATOM   2760  O OD1  . ASN B 2 54  ? 17.857  13.852  -0.440  1.00 63.78 ? 193 ASN B OD1  2  
ATOM   2761  N ND2  . ASN B 2 54  ? 17.092  15.769  -1.148  1.00 62.09 ? 193 ASN B ND2  2  
ATOM   2762  H H    . ASN B 2 54  ? 15.136  14.430  2.435   1.00 0.00  ? 193 ASN B H    2  
ATOM   2763  H HA   . ASN B 2 54  ? 17.850  13.421  1.781   1.00 0.00  ? 193 ASN B HA   2  
ATOM   2764  H HB2  . ASN B 2 54  ? 16.421  16.021  1.384   1.00 0.00  ? 193 ASN B HB2  2  
ATOM   2765  H HB3  . ASN B 2 54  ? 18.180  16.039  1.520   1.00 0.00  ? 193 ASN B HB3  2  
ATOM   2766  H HD21 . ASN B 2 54  ? 16.756  16.670  -0.938  1.00 0.00  ? 193 ASN B HD21 2  
ATOM   2767  H HD22 . ASN B 2 54  ? 17.166  15.475  -2.084  1.00 0.00  ? 193 ASN B HD22 2  
ATOM   2768  N N    . ALA B 2 55  ? 17.774  13.695  4.510   1.00 51.03 ? 194 ALA B N    2  
ATOM   2769  C CA   . ALA B 2 55  ? 18.297  14.009  5.870   1.00 49.87 ? 194 ALA B CA   2  
ATOM   2770  C C    . ALA B 2 55  ? 18.831  12.730  6.519   1.00 48.78 ? 194 ALA B C    2  
ATOM   2771  O O    . ALA B 2 55  ? 20.019  12.570  6.711   1.00 50.16 ? 194 ALA B O    2  
ATOM   2772  C CB   . ALA B 2 55  ? 17.170  14.584  6.730   1.00 50.70 ? 194 ALA B CB   2  
ATOM   2773  H H    . ALA B 2 55  ? 17.399  12.809  4.321   1.00 0.00  ? 194 ALA B H    2  
ATOM   2774  H HA   . ALA B 2 55  ? 19.095  14.732  5.790   1.00 0.00  ? 194 ALA B HA   2  
ATOM   2775  H HB1  . ALA B 2 55  ? 16.448  15.077  6.095   1.00 0.00  ? 194 ALA B HB1  2  
ATOM   2776  H HB2  . ALA B 2 55  ? 16.687  13.786  7.273   1.00 0.00  ? 194 ALA B HB2  2  
ATOM   2777  H HB3  . ALA B 2 55  ? 17.580  15.299  7.430   1.00 0.00  ? 194 ALA B HB3  2  
ATOM   2778  N N    . LYS B 2 56  ? 17.962  11.819  6.862   1.00 45.35 ? 195 LYS B N    2  
ATOM   2779  C CA   . LYS B 2 56  ? 18.421  10.554  7.499   1.00 41.76 ? 195 LYS B CA   2  
ATOM   2780  C C    . LYS B 2 56  ? 18.488  9.445   6.446   1.00 38.59 ? 195 LYS B C    2  
ATOM   2781  O O    . LYS B 2 56  ? 19.435  8.685   6.390   1.00 39.85 ? 195 LYS B O    2  
ATOM   2782  C CB   . LYS B 2 56  ? 17.437  10.151  8.600   1.00 42.95 ? 195 LYS B CB   2  
ATOM   2783  C CG   . LYS B 2 56  ? 17.793  10.884  9.895   1.00 45.27 ? 195 LYS B CG   2  
ATOM   2784  C CD   . LYS B 2 56  ? 18.612  9.959   10.797  1.00 47.56 ? 195 LYS B CD   2  
ATOM   2785  C CE   . LYS B 2 56  ? 17.896  9.787   12.138  1.00 50.16 ? 195 LYS B CE   2  
ATOM   2786  N NZ   . LYS B 2 56  ? 16.547  9.199   11.910  1.00 50.69 ? 195 LYS B NZ   2  
ATOM   2787  H H    . LYS B 2 56  ? 17.007  11.968  6.699   1.00 0.00  ? 195 LYS B H    2  
ATOM   2788  H HA   . LYS B 2 56  ? 19.400  10.701  7.929   1.00 0.00  ? 195 LYS B HA   2  
ATOM   2789  H HB2  . LYS B 2 56  ? 16.434  10.416  8.299   1.00 0.00  ? 195 LYS B HB2  2  
ATOM   2790  H HB3  . LYS B 2 56  ? 17.495  9.085   8.764   1.00 0.00  ? 195 LYS B HB3  2  
ATOM   2791  H HG2  . LYS B 2 56  ? 18.371  11.766  9.662   1.00 0.00  ? 195 LYS B HG2  2  
ATOM   2792  H HG3  . LYS B 2 56  ? 16.887  11.171  10.406  1.00 0.00  ? 195 LYS B HG3  2  
ATOM   2793  H HD2  . LYS B 2 56  ? 18.720  8.995   10.320  1.00 0.00  ? 195 LYS B HD2  2  
ATOM   2794  H HD3  . LYS B 2 56  ? 19.587  10.390  10.964  1.00 0.00  ? 195 LYS B HD3  2  
ATOM   2795  H HE2  . LYS B 2 56  ? 18.473  9.131   12.773  1.00 0.00  ? 195 LYS B HE2  2  
ATOM   2796  H HE3  . LYS B 2 56  ? 17.793  10.750  12.617  1.00 0.00  ? 195 LYS B HE3  2  
ATOM   2797  H HZ1  . LYS B 2 56  ? 16.403  9.047   10.891  1.00 0.00  ? 195 LYS B HZ1  2  
ATOM   2798  H HZ2  . LYS B 2 56  ? 16.475  8.290   12.410  1.00 0.00  ? 195 LYS B HZ2  2  
ATOM   2799  H HZ3  . LYS B 2 56  ? 15.819  9.848   12.271  1.00 0.00  ? 195 LYS B HZ3  2  
ATOM   2800  N N    . GLY B 2 57  ? 17.491  9.348   5.610   1.00 34.40 ? 196 GLY B N    2  
ATOM   2801  C CA   . GLY B 2 57  ? 17.500  8.288   4.561   1.00 29.38 ? 196 GLY B CA   2  
ATOM   2802  C C    . GLY B 2 57  ? 16.071  8.040   4.074   1.00 25.82 ? 196 GLY B C    2  
ATOM   2803  O O    . GLY B 2 57  ? 15.261  8.943   4.015   1.00 25.14 ? 196 GLY B O    2  
ATOM   2804  H H    . GLY B 2 57  ? 16.737  9.970   5.671   1.00 0.00  ? 196 GLY B H    2  
ATOM   2805  H HA2  . GLY B 2 57  ? 18.115  8.608   3.732   1.00 0.00  ? 196 GLY B HA2  2  
ATOM   2806  H HA3  . GLY B 2 57  ? 17.899  7.374   4.974   1.00 0.00  ? 196 GLY B HA3  2  
ATOM   2807  N N    . LEU B 2 58  ? 15.756  6.823   3.724   1.00 25.09 ? 197 LEU B N    2  
ATOM   2808  C CA   . LEU B 2 58  ? 14.379  6.521   3.241   1.00 24.92 ? 197 LEU B CA   2  
ATOM   2809  C C    . LEU B 2 58  ? 13.630  5.719   4.308   1.00 23.75 ? 197 LEU B C    2  
ATOM   2810  O O    . LEU B 2 58  ? 14.228  5.099   5.166   1.00 23.93 ? 197 LEU B O    2  
ATOM   2811  C CB   . LEU B 2 58  ? 14.456  5.703   1.950   1.00 25.84 ? 197 LEU B CB   2  
ATOM   2812  C CG   . LEU B 2 58  ? 15.426  4.537   2.141   1.00 30.07 ? 197 LEU B CG   2  
ATOM   2813  C CD1  . LEU B 2 58  ? 14.774  3.244   1.646   1.00 29.71 ? 197 LEU B CD1  2  
ATOM   2814  C CD2  . LEU B 2 58  ? 16.703  4.800   1.340   1.00 30.59 ? 197 LEU B CD2  2  
ATOM   2815  H H    . LEU B 2 58  ? 16.424  6.109   3.779   1.00 0.00  ? 197 LEU B H    2  
ATOM   2816  H HA   . LEU B 2 58  ? 13.853  7.445   3.051   1.00 0.00  ? 197 LEU B HA   2  
ATOM   2817  H HB2  . LEU B 2 58  ? 13.476  5.322   1.707   1.00 0.00  ? 197 LEU B HB2  2  
ATOM   2818  H HB3  . LEU B 2 58  ? 14.807  6.332   1.146   1.00 0.00  ? 197 LEU B HB3  2  
ATOM   2819  H HG   . LEU B 2 58  ? 15.670  4.438   3.189   1.00 0.00  ? 197 LEU B HG   2  
ATOM   2820  H HD11 . LEU B 2 58  ? 13.809  3.126   2.114   1.00 0.00  ? 197 LEU B HD11 2  
ATOM   2821  H HD12 . LEU B 2 58  ? 14.650  3.291   0.574   1.00 0.00  ? 197 LEU B HD12 2  
ATOM   2822  H HD13 . LEU B 2 58  ? 15.403  2.404   1.899   1.00 0.00  ? 197 LEU B HD13 2  
ATOM   2823  H HD21 . LEU B 2 58  ? 16.976  5.842   1.430   1.00 0.00  ? 197 LEU B HD21 2  
ATOM   2824  H HD22 . LEU B 2 58  ? 17.503  4.184   1.724   1.00 0.00  ? 197 LEU B HD22 2  
ATOM   2825  H HD23 . LEU B 2 58  ? 16.532  4.562   0.300   1.00 0.00  ? 197 LEU B HD23 2  
ATOM   2826  N N    . ASN B 2 59  ? 12.327  5.727   4.262   1.00 21.78 ? 198 ASN B N    2  
ATOM   2827  C CA   . ASN B 2 59  ? 11.540  4.965   5.273   1.00 19.17 ? 198 ASN B CA   2  
ATOM   2828  C C    . ASN B 2 59  ? 10.401  4.220   4.576   1.00 16.90 ? 198 ASN B C    2  
ATOM   2829  O O    . ASN B 2 59  ? 10.164  4.390   3.396   1.00 15.60 ? 198 ASN B O    2  
ATOM   2830  C CB   . ASN B 2 59  ? 10.961  5.935   6.304   1.00 18.45 ? 198 ASN B CB   2  
ATOM   2831  C CG   . ASN B 2 59  ? 12.015  6.983   6.668   1.00 20.04 ? 198 ASN B CG   2  
ATOM   2832  O OD1  . ASN B 2 59  ? 12.600  6.929   7.732   1.00 23.65 ? 198 ASN B OD1  2  
ATOM   2833  N ND2  . ASN B 2 59  ? 12.283  7.941   5.824   1.00 21.55 ? 198 ASN B ND2  2  
ATOM   2834  H H    . ASN B 2 59  ? 11.864  6.234   3.563   1.00 0.00  ? 198 ASN B H    2  
ATOM   2835  H HA   . ASN B 2 59  ? 12.185  4.254   5.770   1.00 0.00  ? 198 ASN B HA   2  
ATOM   2836  H HB2  . ASN B 2 59  ? 10.092  6.426   5.889   1.00 0.00  ? 198 ASN B HB2  2  
ATOM   2837  H HB3  . ASN B 2 59  ? 10.676  5.390   7.192   1.00 0.00  ? 198 ASN B HB3  2  
ATOM   2838  H HD21 . ASN B 2 59  ? 11.808  7.983   4.963   1.00 0.00  ? 198 ASN B HD21 2  
ATOM   2839  H HD22 . ASN B 2 59  ? 12.959  8.618   6.050   1.00 0.00  ? 198 ASN B HD22 2  
ATOM   2840  N N    . VAL B 2 60  ? 9.692   3.393   5.297   1.00 14.62 ? 199 VAL B N    2  
ATOM   2841  C CA   . VAL B 2 60  ? 8.568   2.638   4.675   1.00 11.82 ? 199 VAL B CA   2  
ATOM   2842  C C    . VAL B 2 60  ? 7.279   2.916   5.451   1.00 10.68 ? 199 VAL B C    2  
ATOM   2843  O O    . VAL B 2 60  ? 7.240   2.821   6.662   1.00 13.24 ? 199 VAL B O    2  
ATOM   2844  C CB   . VAL B 2 60  ? 8.874   1.140   4.719   1.00 9.61  ? 199 VAL B CB   2  
ATOM   2845  C CG1  . VAL B 2 60  ? 7.691   0.361   4.143   1.00 11.94 ? 199 VAL B CG1  2  
ATOM   2846  C CG2  . VAL B 2 60  ? 10.126  0.850   3.888   1.00 10.00 ? 199 VAL B CG2  2  
ATOM   2847  H H    . VAL B 2 60  ? 9.900   3.271   6.247   1.00 0.00  ? 199 VAL B H    2  
ATOM   2848  H HA   . VAL B 2 60  ? 8.447   2.953   3.648   1.00 0.00  ? 199 VAL B HA   2  
ATOM   2849  H HB   . VAL B 2 60  ? 9.041   0.837   5.743   1.00 0.00  ? 199 VAL B HB   2  
ATOM   2850  H HG11 . VAL B 2 60  ? 7.387   0.805   3.208   1.00 0.00  ? 199 VAL B HG11 2  
ATOM   2851  H HG12 . VAL B 2 60  ? 7.982   -0.666  3.977   1.00 0.00  ? 199 VAL B HG12 2  
ATOM   2852  H HG13 . VAL B 2 60  ? 6.867   0.391   4.841   1.00 0.00  ? 199 VAL B HG13 2  
ATOM   2853  H HG21 . VAL B 2 60  ? 10.733  1.740   3.828   1.00 0.00  ? 199 VAL B HG21 2  
ATOM   2854  H HG22 . VAL B 2 60  ? 10.693  0.058   4.356   1.00 0.00  ? 199 VAL B HG22 2  
ATOM   2855  H HG23 . VAL B 2 60  ? 9.834   0.545   2.893   1.00 0.00  ? 199 VAL B HG23 2  
ATOM   2856  N N    . LYS B 2 61  ? 6.224   3.257   4.765   1.00 11.30 ? 200 LYS B N    2  
ATOM   2857  C CA   . LYS B 2 61  ? 4.940   3.538   5.467   1.00 11.14 ? 200 LYS B CA   2  
ATOM   2858  C C    . LYS B 2 61  ? 3.902   2.488   5.066   1.00 8.78  ? 200 LYS B C    2  
ATOM   2859  O O    . LYS B 2 61  ? 3.501   2.400   3.923   1.00 9.63  ? 200 LYS B O    2  
ATOM   2860  C CB   . LYS B 2 61  ? 4.437   4.930   5.077   1.00 11.27 ? 200 LYS B CB   2  
ATOM   2861  C CG   . LYS B 2 61  ? 5.022   5.969   6.038   1.00 16.97 ? 200 LYS B CG   2  
ATOM   2862  C CD   . LYS B 2 61  ? 4.843   7.369   5.449   1.00 21.04 ? 200 LYS B CD   2  
ATOM   2863  C CE   . LYS B 2 61  ? 5.285   8.414   6.475   1.00 28.12 ? 200 LYS B CE   2  
ATOM   2864  N NZ   . LYS B 2 61  ? 6.147   9.431   5.808   1.00 32.40 ? 200 LYS B NZ   2  
ATOM   2865  H H    . LYS B 2 61  ? 6.274   3.327   3.789   1.00 0.00  ? 200 LYS B H    2  
ATOM   2866  H HA   . LYS B 2 61  ? 5.097   3.499   6.534   1.00 0.00  ? 200 LYS B HA   2  
ATOM   2867  H HB2  . LYS B 2 61  ? 4.749   5.156   4.067   1.00 0.00  ? 200 LYS B HB2  2  
ATOM   2868  H HB3  . LYS B 2 61  ? 3.360   4.954   5.137   1.00 0.00  ? 200 LYS B HB3  2  
ATOM   2869  H HG2  . LYS B 2 61  ? 4.510   5.908   6.988   1.00 0.00  ? 200 LYS B HG2  2  
ATOM   2870  H HG3  . LYS B 2 61  ? 6.073   5.772   6.183   1.00 0.00  ? 200 LYS B HG3  2  
ATOM   2871  H HD2  . LYS B 2 61  ? 5.444   7.463   4.556   1.00 0.00  ? 200 LYS B HD2  2  
ATOM   2872  H HD3  . LYS B 2 61  ? 3.804   7.526   5.203   1.00 0.00  ? 200 LYS B HD3  2  
ATOM   2873  H HE2  . LYS B 2 61  ? 4.416   8.898   6.893   1.00 0.00  ? 200 LYS B HE2  2  
ATOM   2874  H HE3  . LYS B 2 61  ? 5.842   7.931   7.264   1.00 0.00  ? 200 LYS B HE3  2  
ATOM   2875  H HZ1  . LYS B 2 61  ? 5.909   9.476   4.797   1.00 0.00  ? 200 LYS B HZ1  2  
ATOM   2876  H HZ2  . LYS B 2 61  ? 5.987   10.361  6.245   1.00 0.00  ? 200 LYS B HZ2  2  
ATOM   2877  H HZ3  . LYS B 2 61  ? 7.146   9.165   5.920   1.00 0.00  ? 200 LYS B HZ3  2  
ATOM   2878  N N    . HIS B 2 62  ? 3.470   1.685   6.000   1.00 7.82  ? 201 HIS B N    2  
ATOM   2879  C CA   . HIS B 2 62  ? 2.464   0.635   5.675   1.00 7.41  ? 201 HIS B CA   2  
ATOM   2880  C C    . HIS B 2 62  ? 1.053   1.214   5.805   1.00 9.79  ? 201 HIS B C    2  
ATOM   2881  O O    . HIS B 2 62  ? 0.676   1.729   6.837   1.00 10.36 ? 201 HIS B O    2  
ATOM   2882  C CB   . HIS B 2 62  ? 2.621   -0.536  6.646   1.00 6.15  ? 201 HIS B CB   2  
ATOM   2883  C CG   . HIS B 2 62  ? 4.056   -0.987  6.660   1.00 5.80  ? 201 HIS B CG   2  
ATOM   2884  N ND1  . HIS B 2 62  ? 4.705   -1.350  7.830   1.00 7.97  ? 201 HIS B ND1  2  
ATOM   2885  C CD2  . HIS B 2 62  ? 4.980   -1.138  5.656   1.00 7.69  ? 201 HIS B CD2  2  
ATOM   2886  C CE1  . HIS B 2 62  ? 5.963   -1.698  7.505   1.00 7.75  ? 201 HIS B CE1  2  
ATOM   2887  N NE2  . HIS B 2 62  ? 6.183   -1.586  6.192   1.00 6.51  ? 201 HIS B NE2  2  
ATOM   2888  H H    . HIS B 2 62  ? 3.810   1.770   6.915   1.00 0.00  ? 201 HIS B H    2  
ATOM   2889  H HA   . HIS B 2 62  ? 2.619   0.288   4.664   1.00 0.00  ? 201 HIS B HA   2  
ATOM   2890  H HB2  . HIS B 2 62  ? 2.332   -0.221  7.639   1.00 0.00  ? 201 HIS B HB2  2  
ATOM   2891  H HB3  . HIS B 2 62  ? 1.989   -1.352  6.330   1.00 0.00  ? 201 HIS B HB3  2  
ATOM   2892  H HD1  . HIS B 2 62  ? 4.318   -1.352  8.730   1.00 0.00  ? 201 HIS B HD1  2  
ATOM   2893  H HD2  . HIS B 2 62  ? 4.800   -0.939  4.610   1.00 0.00  ? 201 HIS B HD2  2  
ATOM   2894  H HE1  . HIS B 2 62  ? 6.705   -2.026  8.218   1.00 0.00  ? 201 HIS B HE1  2  
ATOM   2895  N N    . TYR B 2 63  ? 0.270   1.129   4.765   1.00 10.61 ? 202 TYR B N    2  
ATOM   2896  C CA   . TYR B 2 63  ? -1.117  1.667   4.831   1.00 10.61 ? 202 TYR B CA   2  
ATOM   2897  C C    . TYR B 2 63  ? -2.112  0.512   4.719   1.00 10.67 ? 202 TYR B C    2  
ATOM   2898  O O    . TYR B 2 63  ? -2.524  0.137   3.639   1.00 11.97 ? 202 TYR B O    2  
ATOM   2899  C CB   . TYR B 2 63  ? -1.341  2.648   3.679   1.00 10.02 ? 202 TYR B CB   2  
ATOM   2900  C CG   . TYR B 2 63  ? -0.867  4.022   4.089   1.00 10.20 ? 202 TYR B CG   2  
ATOM   2901  C CD1  . TYR B 2 63  ? -1.738  4.891   4.766   1.00 10.92 ? 202 TYR B CD1  2  
ATOM   2902  C CD2  . TYR B 2 63  ? 0.446   4.429   3.796   1.00 9.08  ? 202 TYR B CD2  2  
ATOM   2903  C CE1  . TYR B 2 63  ? -1.297  6.168   5.151   1.00 11.72 ? 202 TYR B CE1  2  
ATOM   2904  C CE2  . TYR B 2 63  ? 0.887   5.706   4.181   1.00 11.32 ? 202 TYR B CE2  2  
ATOM   2905  C CZ   . TYR B 2 63  ? 0.016   6.576   4.858   1.00 12.88 ? 202 TYR B CZ   2  
ATOM   2906  O OH   . TYR B 2 63  ? 0.449   7.831   5.236   1.00 13.22 ? 202 TYR B OH   2  
ATOM   2907  H H    . TYR B 2 63  ? 0.590   0.706   3.942   1.00 0.00  ? 202 TYR B H    2  
ATOM   2908  H HA   . TYR B 2 63  ? -1.261  2.178   5.773   1.00 0.00  ? 202 TYR B HA   2  
ATOM   2909  H HB2  . TYR B 2 63  ? -0.785  2.319   2.814   1.00 0.00  ? 202 TYR B HB2  2  
ATOM   2910  H HB3  . TYR B 2 63  ? -2.391  2.688   3.438   1.00 0.00  ? 202 TYR B HB3  2  
ATOM   2911  H HD1  . TYR B 2 63  ? -2.746  4.577   4.992   1.00 0.00  ? 202 TYR B HD1  2  
ATOM   2912  H HD2  . TYR B 2 63  ? 1.115   3.760   3.276   1.00 0.00  ? 202 TYR B HD2  2  
ATOM   2913  H HE1  . TYR B 2 63  ? -1.966  6.837   5.671   1.00 0.00  ? 202 TYR B HE1  2  
ATOM   2914  H HE2  . TYR B 2 63  ? 1.895   6.020   3.956   1.00 0.00  ? 202 TYR B HE2  2  
ATOM   2915  H HH   . TYR B 2 63  ? 0.397   8.406   4.470   1.00 0.00  ? 202 TYR B HH   2  
ATOM   2916  N N    . LYS B 2 64  ? -2.496  -0.061  5.825   1.00 11.16 ? 203 LYS B N    2  
ATOM   2917  C CA   . LYS B 2 64  ? -3.458  -1.195  5.780   1.00 13.85 ? 203 LYS B CA   2  
ATOM   2918  C C    . LYS B 2 64  ? -4.767  -0.737  5.134   1.00 13.44 ? 203 LYS B C    2  
ATOM   2919  O O    . LYS B 2 64  ? -5.316  0.291   5.480   1.00 12.80 ? 203 LYS B O    2  
ATOM   2920  C CB   . LYS B 2 64  ? -3.735  -1.691  7.203   1.00 19.04 ? 203 LYS B CB   2  
ATOM   2921  C CG   . LYS B 2 64  ? -4.246  -0.533  8.062   1.00 23.92 ? 203 LYS B CG   2  
ATOM   2922  C CD   . LYS B 2 64  ? -5.519  -0.964  8.793   1.00 29.39 ? 203 LYS B CD   2  
ATOM   2923  C CE   . LYS B 2 64  ? -5.419  -0.569  10.268  1.00 31.37 ? 203 LYS B CE   2  
ATOM   2924  N NZ   . LYS B 2 64  ? -6.525  -1.214  11.031  1.00 36.57 ? 203 LYS B NZ   2  
ATOM   2925  H H    . LYS B 2 64  ? -2.149  0.253   6.687   1.00 0.00  ? 203 LYS B H    2  
ATOM   2926  H HA   . LYS B 2 64  ? -3.034  -2.001  5.198   1.00 0.00  ? 203 LYS B HA   2  
ATOM   2927  H HB2  . LYS B 2 64  ? -4.480  -2.473  7.172   1.00 0.00  ? 203 LYS B HB2  2  
ATOM   2928  H HB3  . LYS B 2 64  ? -2.824  -2.080  7.632   1.00 0.00  ? 203 LYS B HB3  2  
ATOM   2929  H HG2  . LYS B 2 64  ? -3.490  -0.259  8.783   1.00 0.00  ? 203 LYS B HG2  2  
ATOM   2930  H HG3  . LYS B 2 64  ? -4.465  0.315   7.430   1.00 0.00  ? 203 LYS B HG3  2  
ATOM   2931  H HD2  . LYS B 2 64  ? -6.373  -0.476  8.347   1.00 0.00  ? 203 LYS B HD2  2  
ATOM   2932  H HD3  . LYS B 2 64  ? -5.634  -2.034  8.716   1.00 0.00  ? 203 LYS B HD3  2  
ATOM   2933  H HE2  . LYS B 2 64  ? -4.470  -0.898  10.664  1.00 0.00  ? 203 LYS B HE2  2  
ATOM   2934  H HE3  . LYS B 2 64  ? -5.496  0.504   10.360  1.00 0.00  ? 203 LYS B HE3  2  
ATOM   2935  H HZ1  . LYS B 2 64  ? -7.420  -1.092  10.512  1.00 0.00  ? 203 LYS B HZ1  2  
ATOM   2936  H HZ2  . LYS B 2 64  ? -6.325  -2.226  11.144  1.00 0.00  ? 203 LYS B HZ2  2  
ATOM   2937  H HZ3  . LYS B 2 64  ? -6.604  -0.771  11.968  1.00 0.00  ? 203 LYS B HZ3  2  
ATOM   2938  N N    . ILE B 2 65  ? -5.272  -1.495  4.201   1.00 14.05 ? 204 ILE B N    2  
ATOM   2939  C CA   . ILE B 2 65  ? -6.547  -1.111  3.534   1.00 13.51 ? 204 ILE B CA   2  
ATOM   2940  C C    . ILE B 2 65  ? -7.714  -1.717  4.317   1.00 14.04 ? 204 ILE B C    2  
ATOM   2941  O O    . ILE B 2 65  ? -7.845  -2.919  4.426   1.00 15.82 ? 204 ILE B O    2  
ATOM   2942  C CB   . ILE B 2 65  ? -6.544  -1.640  2.096   1.00 12.30 ? 204 ILE B CB   2  
ATOM   2943  C CG1  . ILE B 2 65  ? -5.598  -0.788  1.247   1.00 11.29 ? 204 ILE B CG1  2  
ATOM   2944  C CG2  . ILE B 2 65  ? -7.956  -1.568  1.508   1.00 14.21 ? 204 ILE B CG2  2  
ATOM   2945  C CD1  . ILE B 2 65  ? -5.097  -1.609  0.057   1.00 13.89 ? 204 ILE B CD1  2  
ATOM   2946  H H    . ILE B 2 65  ? -4.814  -2.322  3.941   1.00 0.00  ? 204 ILE B H    2  
ATOM   2947  H HA   . ILE B 2 65  ? -6.642  -0.034  3.523   1.00 0.00  ? 204 ILE B HA   2  
ATOM   2948  H HB   . ILE B 2 65  ? -6.204  -2.665  2.095   1.00 0.00  ? 204 ILE B HB   2  
ATOM   2949  H HG12 . ILE B 2 65  ? -6.124  0.084   0.888   1.00 0.00  ? 204 ILE B HG12 2  
ATOM   2950  H HG13 . ILE B 2 65  ? -4.755  -0.480  1.848   1.00 0.00  ? 204 ILE B HG13 2  
ATOM   2951  H HG21 . ILE B 2 65  ? -8.349  -0.571  1.637   1.00 0.00  ? 204 ILE B HG21 2  
ATOM   2952  H HG22 . ILE B 2 65  ? -7.920  -1.807  0.455   1.00 0.00  ? 204 ILE B HG22 2  
ATOM   2953  H HG23 . ILE B 2 65  ? -8.595  -2.275  2.017   1.00 0.00  ? 204 ILE B HG23 2  
ATOM   2954  H HD11 . ILE B 2 65  ? -5.919  -2.168  -0.366  1.00 0.00  ? 204 ILE B HD11 2  
ATOM   2955  H HD12 . ILE B 2 65  ? -4.690  -0.946  -0.692  1.00 0.00  ? 204 ILE B HD12 2  
ATOM   2956  H HD13 . ILE B 2 65  ? -4.330  -2.293  0.389   1.00 0.00  ? 204 ILE B HD13 2  
ATOM   2957  N N    . ARG B 2 66  ? -8.551  -0.887  4.873   1.00 15.56 ? 205 ARG B N    2  
ATOM   2958  C CA   . ARG B 2 66  ? -9.701  -1.405  5.664   1.00 13.76 ? 205 ARG B CA   2  
ATOM   2959  C C    . ARG B 2 66  ? -10.791 -1.923  4.726   1.00 13.72 ? 205 ARG B C    2  
ATOM   2960  O O    . ARG B 2 66  ? -10.720 -1.768  3.522   1.00 13.25 ? 205 ARG B O    2  
ATOM   2961  C CB   . ARG B 2 66  ? -10.268 -0.281  6.528   1.00 15.23 ? 205 ARG B CB   2  
ATOM   2962  C CG   . ARG B 2 66  ? -9.125  0.412   7.267   1.00 20.69 ? 205 ARG B CG   2  
ATOM   2963  C CD   . ARG B 2 66  ? -9.692  1.264   8.404   1.00 28.70 ? 205 ARG B CD   2  
ATOM   2964  N NE   . ARG B 2 66  ? -8.770  2.401   8.681   1.00 38.45 ? 205 ARG B NE   2  
ATOM   2965  C CZ   . ARG B 2 66  ? -8.843  3.038   9.818   1.00 41.91 ? 205 ARG B CZ   2  
ATOM   2966  N NH1  . ARG B 2 66  ? -9.785  3.920   10.013  1.00 41.78 ? 205 ARG B NH1  2  
ATOM   2967  N NH2  . ARG B 2 66  ? -7.974  2.793   10.760  1.00 44.96 ? 205 ARG B NH2  2  
ATOM   2968  H H    . ARG B 2 66  ? -8.418  0.078   4.778   1.00 0.00  ? 205 ARG B H    2  
ATOM   2969  H HA   . ARG B 2 66  ? -9.365  -2.211  6.300   1.00 0.00  ? 205 ARG B HA   2  
ATOM   2970  H HB2  . ARG B 2 66  ? -10.777 0.434   5.898   1.00 0.00  ? 205 ARG B HB2  2  
ATOM   2971  H HB3  . ARG B 2 66  ? -10.962 -0.691  7.245   1.00 0.00  ? 205 ARG B HB3  2  
ATOM   2972  H HG2  . ARG B 2 66  ? -8.456  -0.333  7.671   1.00 0.00  ? 205 ARG B HG2  2  
ATOM   2973  H HG3  . ARG B 2 66  ? -8.586  1.047   6.579   1.00 0.00  ? 205 ARG B HG3  2  
ATOM   2974  H HD2  . ARG B 2 66  ? -10.661 1.646   8.120   1.00 0.00  ? 205 ARG B HD2  2  
ATOM   2975  H HD3  . ARG B 2 66  ? -9.792  0.658   9.293   1.00 0.00  ? 205 ARG B HD3  2  
ATOM   2976  H HE   . ARG B 2 66  ? -8.110  2.671   8.010   1.00 0.00  ? 205 ARG B HE   2  
ATOM   2977  H HH11 . ARG B 2 66  ? -10.451 4.108   9.290   1.00 0.00  ? 205 ARG B HH11 2  
ATOM   2978  H HH12 . ARG B 2 66  ? -9.840  4.408   10.884  1.00 0.00  ? 205 ARG B HH12 2  
ATOM   2979  H HH21 . ARG B 2 66  ? -7.251  2.116   10.610  1.00 0.00  ? 205 ARG B HH21 2  
ATOM   2980  H HH22 . ARG B 2 66  ? -8.029  3.280   11.631  1.00 0.00  ? 205 ARG B HH22 2  
ATOM   2981  N N    . LYS B 2 67  ? -11.801 -2.536  5.276   1.00 14.89 ? 206 LYS B N    2  
ATOM   2982  C CA   . LYS B 2 67  ? -12.906 -3.072  4.431   1.00 18.13 ? 206 LYS B CA   2  
ATOM   2983  C C    . LYS B 2 67  ? -14.252 -2.757  5.089   1.00 17.74 ? 206 LYS B C    2  
ATOM   2984  O O    . LYS B 2 67  ? -14.520 -3.166  6.202   1.00 18.39 ? 206 LYS B O    2  
ATOM   2985  C CB   . LYS B 2 67  ? -12.744 -4.591  4.289   1.00 21.97 ? 206 LYS B CB   2  
ATOM   2986  C CG   . LYS B 2 67  ? -14.030 -5.203  3.721   1.00 27.97 ? 206 LYS B CG   2  
ATOM   2987  C CD   . LYS B 2 67  ? -13.785 -6.670  3.364   1.00 32.27 ? 206 LYS B CD   2  
ATOM   2988  C CE   . LYS B 2 67  ? -12.999 -6.754  2.054   1.00 33.99 ? 206 LYS B CE   2  
ATOM   2989  N NZ   . LYS B 2 67  ? -11.889 -7.737  2.203   1.00 35.74 ? 206 LYS B NZ   2  
ATOM   2990  H H    . LYS B 2 67  ? -11.832 -2.645  6.249   1.00 0.00  ? 206 LYS B H    2  
ATOM   2991  H HA   . LYS B 2 67  ? -12.867 -2.614  3.455   1.00 0.00  ? 206 LYS B HA   2  
ATOM   2992  H HB2  . LYS B 2 67  ? -11.921 -4.803  3.624   1.00 0.00  ? 206 LYS B HB2  2  
ATOM   2993  H HB3  . LYS B 2 67  ? -12.543 -5.022  5.258   1.00 0.00  ? 206 LYS B HB3  2  
ATOM   2994  H HG2  . LYS B 2 67  ? -14.816 -5.138  4.459   1.00 0.00  ? 206 LYS B HG2  2  
ATOM   2995  H HG3  . LYS B 2 67  ? -14.325 -4.663  2.834   1.00 0.00  ? 206 LYS B HG3  2  
ATOM   2996  H HD2  . LYS B 2 67  ? -13.220 -7.143  4.155   1.00 0.00  ? 206 LYS B HD2  2  
ATOM   2997  H HD3  . LYS B 2 67  ? -14.732 -7.175  3.246   1.00 0.00  ? 206 LYS B HD3  2  
ATOM   2998  H HE2  . LYS B 2 67  ? -13.657 -7.072  1.259   1.00 0.00  ? 206 LYS B HE2  2  
ATOM   2999  H HE3  . LYS B 2 67  ? -12.591 -5.783  1.817   1.00 0.00  ? 206 LYS B HE3  2  
ATOM   3000  H HZ1  . LYS B 2 67  ? -12.154 -8.455  2.908   1.00 0.00  ? 206 LYS B HZ1  2  
ATOM   3001  H HZ2  . LYS B 2 67  ? -11.708 -8.197  1.289   1.00 0.00  ? 206 LYS B HZ2  2  
ATOM   3002  H HZ3  . LYS B 2 67  ? -11.028 -7.244  2.516   1.00 0.00  ? 206 LYS B HZ3  2  
ATOM   3003  N N    . LEU B 2 68  ? -15.103 -2.041  4.409   1.00 17.31 ? 207 LEU B N    2  
ATOM   3004  C CA   . LEU B 2 68  ? -16.433 -1.714  4.993   1.00 19.33 ? 207 LEU B CA   2  
ATOM   3005  C C    . LEU B 2 68  ? -17.282 -2.985  5.042   1.00 21.64 ? 207 LEU B C    2  
ATOM   3006  O O    . LEU B 2 68  ? -17.395 -3.703  4.068   1.00 21.80 ? 207 LEU B O    2  
ATOM   3007  C CB   . LEU B 2 68  ? -17.132 -0.667  4.123   1.00 19.68 ? 207 LEU B CB   2  
ATOM   3008  C CG   . LEU B 2 68  ? -16.421 0.678   4.270   1.00 19.58 ? 207 LEU B CG   2  
ATOM   3009  C CD1  . LEU B 2 68  ? -17.201 1.753   3.511   1.00 16.81 ? 207 LEU B CD1  2  
ATOM   3010  C CD2  . LEU B 2 68  ? -16.346 1.055   5.752   1.00 16.39 ? 207 LEU B CD2  2  
ATOM   3011  H H    . LEU B 2 68  ? -14.872 -1.726  3.510   1.00 0.00  ? 207 LEU B H    2  
ATOM   3012  H HA   . LEU B 2 68  ? -16.303 -1.327  5.993   1.00 0.00  ? 207 LEU B HA   2  
ATOM   3013  H HB2  . LEU B 2 68  ? -17.101 -0.980  3.089   1.00 0.00  ? 207 LEU B HB2  2  
ATOM   3014  H HB3  . LEU B 2 68  ? -18.159 -0.565  4.438   1.00 0.00  ? 207 LEU B HB3  2  
ATOM   3015  H HG   . LEU B 2 68  ? -15.422 0.603   3.864   1.00 0.00  ? 207 LEU B HG   2  
ATOM   3016  H HD11 . LEU B 2 68  ? -18.072 1.309   3.052   1.00 0.00  ? 207 LEU B HD11 2  
ATOM   3017  H HD12 . LEU B 2 68  ? -17.511 2.526   4.198   1.00 0.00  ? 207 LEU B HD12 2  
ATOM   3018  H HD13 . LEU B 2 68  ? -16.570 2.182   2.746   1.00 0.00  ? 207 LEU B HD13 2  
ATOM   3019  H HD21 . LEU B 2 68  ? -17.123 0.536   6.295   1.00 0.00  ? 207 LEU B HD21 2  
ATOM   3020  H HD22 . LEU B 2 68  ? -15.381 0.774   6.147   1.00 0.00  ? 207 LEU B HD22 2  
ATOM   3021  H HD23 . LEU B 2 68  ? -16.483 2.121   5.859   1.00 0.00  ? 207 LEU B HD23 2  
ATOM   3022  N N    . ASP B 2 69  ? -17.877 -3.272  6.165   1.00 24.31 ? 208 ASP B N    2  
ATOM   3023  C CA   . ASP B 2 69  ? -18.712 -4.501  6.268   1.00 27.33 ? 208 ASP B CA   2  
ATOM   3024  C C    . ASP B 2 69  ? -19.805 -4.469  5.197   1.00 28.23 ? 208 ASP B C    2  
ATOM   3025  O O    . ASP B 2 69  ? -20.395 -5.479  4.869   1.00 28.17 ? 208 ASP B O    2  
ATOM   3026  C CB   . ASP B 2 69  ? -19.359 -4.567  7.653   1.00 32.44 ? 208 ASP B CB   2  
ATOM   3027  C CG   . ASP B 2 69  ? -18.302 -4.948  8.692   1.00 36.84 ? 208 ASP B CG   2  
ATOM   3028  O OD1  . ASP B 2 69  ? -17.130 -4.759  8.413   1.00 41.58 ? 208 ASP B OD1  2  
ATOM   3029  O OD2  . ASP B 2 69  ? -18.684 -5.422  9.750   1.00 40.11 ? 208 ASP B OD2  2  
ATOM   3030  H H    . ASP B 2 69  ? -17.772 -2.684  6.942   1.00 0.00  ? 208 ASP B H    2  
ATOM   3031  H HA   . ASP B 2 69  ? -18.089 -5.371  6.120   1.00 0.00  ? 208 ASP B HA   2  
ATOM   3032  H HB2  . ASP B 2 69  ? -19.777 -3.602  7.902   1.00 0.00  ? 208 ASP B HB2  2  
ATOM   3033  H HB3  . ASP B 2 69  ? -20.142 -5.310  7.651   1.00 0.00  ? 208 ASP B HB3  2  
ATOM   3034  N N    . SER B 2 70  ? -20.079 -3.317  4.647   1.00 30.57 ? 209 SER B N    2  
ATOM   3035  C CA   . SER B 2 70  ? -21.126 -3.220  3.602   1.00 30.81 ? 209 SER B CA   2  
ATOM   3036  C C    . SER B 2 70  ? -20.646 -3.919  2.328   1.00 31.86 ? 209 SER B C    2  
ATOM   3037  O O    . SER B 2 70  ? -21.400 -4.596  1.658   1.00 34.96 ? 209 SER B O    2  
ATOM   3038  C CB   . SER B 2 70  ? -21.390 -1.749  3.312   1.00 29.35 ? 209 SER B CB   2  
ATOM   3039  O OG   . SER B 2 70  ? -20.203 -1.002  3.545   1.00 27.77 ? 209 SER B OG   2  
ATOM   3040  H H    . SER B 2 70  ? -19.597 -2.513  4.919   1.00 0.00  ? 209 SER B H    2  
ATOM   3041  H HA   . SER B 2 70  ? -22.034 -3.685  3.950   1.00 0.00  ? 209 SER B HA   2  
ATOM   3042  H HB2  . SER B 2 70  ? -21.676 -1.638  2.289   1.00 0.00  ? 209 SER B HB2  2  
ATOM   3043  H HB3  . SER B 2 70  ? -22.187 -1.391  3.949   1.00 0.00  ? 209 SER B HB3  2  
ATOM   3044  H HG   . SER B 2 70  ? -20.404 -0.321  4.192   1.00 0.00  ? 209 SER B HG   2  
ATOM   3045  N N    . GLY B 2 71  ? -19.395 -3.762  1.990   1.00 31.91 ? 210 GLY B N    2  
ATOM   3046  C CA   . GLY B 2 71  ? -18.868 -4.418  0.760   1.00 30.37 ? 210 GLY B CA   2  
ATOM   3047  C C    . GLY B 2 71  ? -17.943 -3.451  0.021   1.00 29.39 ? 210 GLY B C    2  
ATOM   3048  O O    . GLY B 2 71  ? -17.995 -3.328  -1.187  1.00 32.51 ? 210 GLY B O    2  
ATOM   3049  H H    . GLY B 2 71  ? -18.804 -3.213  2.545   1.00 0.00  ? 210 GLY B H    2  
ATOM   3050  H HA2  . GLY B 2 71  ? -18.319 -5.307  1.036   1.00 0.00  ? 210 GLY B HA2  2  
ATOM   3051  H HA3  . GLY B 2 71  ? -19.690 -4.687  0.115   1.00 0.00  ? 210 GLY B HA3  2  
ATOM   3052  N N    . GLY B 2 72  ? -17.093 -2.763  0.735   1.00 27.09 ? 211 GLY B N    2  
ATOM   3053  C CA   . GLY B 2 72  ? -16.165 -1.805  0.070   1.00 22.75 ? 211 GLY B CA   2  
ATOM   3054  C C    . GLY B 2 72  ? -14.843 -1.757  0.839   1.00 20.54 ? 211 GLY B C    2  
ATOM   3055  O O    . GLY B 2 72  ? -14.534 -2.638  1.616   1.00 21.66 ? 211 GLY B O    2  
ATOM   3056  H H    . GLY B 2 72  ? -17.066 -2.876  1.709   1.00 0.00  ? 211 GLY B H    2  
ATOM   3057  H HA2  . GLY B 2 72  ? -15.981 -2.129  -0.944  1.00 0.00  ? 211 GLY B HA2  2  
ATOM   3058  H HA3  . GLY B 2 72  ? -16.608 -0.821  0.061   1.00 0.00  ? 211 GLY B HA3  2  
ATOM   3059  N N    . PHE B 2 73  ? -14.063 -0.733  0.631   1.00 18.17 ? 212 PHE B N    2  
ATOM   3060  C CA   . PHE B 2 73  ? -12.762 -0.625  1.352   1.00 17.54 ? 212 PHE B CA   2  
ATOM   3061  C C    . PHE B 2 73  ? -12.417 0.852   1.541   1.00 15.84 ? 212 PHE B C    2  
ATOM   3062  O O    . PHE B 2 73  ? -12.997 1.715   0.914   1.00 18.26 ? 212 PHE B O    2  
ATOM   3063  C CB   . PHE B 2 73  ? -11.658 -1.303  0.535   1.00 16.88 ? 212 PHE B CB   2  
ATOM   3064  C CG   . PHE B 2 73  ? -12.215 -2.514  -0.178  1.00 18.16 ? 212 PHE B CG   2  
ATOM   3065  C CD1  . PHE B 2 73  ? -13.052 -2.346  -1.295  1.00 18.64 ? 212 PHE B CD1  2  
ATOM   3066  C CD2  . PHE B 2 73  ? -11.896 -3.804  0.272   1.00 18.25 ? 212 PHE B CD2  2  
ATOM   3067  C CE1  . PHE B 2 73  ? -13.570 -3.471  -1.959  1.00 19.59 ? 212 PHE B CE1  2  
ATOM   3068  C CE2  . PHE B 2 73  ? -12.413 -4.930  -0.392  1.00 18.17 ? 212 PHE B CE2  2  
ATOM   3069  C CZ   . PHE B 2 73  ? -13.250 -4.762  -1.508  1.00 18.19 ? 212 PHE B CZ   2  
ATOM   3070  H H    . PHE B 2 73  ? -14.332 -0.030  0.001   1.00 0.00  ? 212 PHE B H    2  
ATOM   3071  H HA   . PHE B 2 73  ? -12.844 -1.102  2.317   1.00 0.00  ? 212 PHE B HA   2  
ATOM   3072  H HB2  . PHE B 2 73  ? -11.269 -0.606  -0.193  1.00 0.00  ? 212 PHE B HB2  2  
ATOM   3073  H HB3  . PHE B 2 73  ? -10.862 -1.613  1.196   1.00 0.00  ? 212 PHE B HB3  2  
ATOM   3074  H HD1  . PHE B 2 73  ? -13.298 -1.353  -1.642  1.00 0.00  ? 212 PHE B HD1  2  
ATOM   3075  H HD2  . PHE B 2 73  ? -11.252 -3.933  1.131   1.00 0.00  ? 212 PHE B HD2  2  
ATOM   3076  H HE1  . PHE B 2 73  ? -14.213 -3.343  -2.817  1.00 0.00  ? 212 PHE B HE1  2  
ATOM   3077  H HE2  . PHE B 2 73  ? -12.168 -5.922  -0.045  1.00 0.00  ? 212 PHE B HE2  2  
ATOM   3078  H HZ   . PHE B 2 73  ? -13.648 -5.626  -2.019  1.00 0.00  ? 212 PHE B HZ   2  
ATOM   3079  N N    . TYR B 2 74  ? -11.476 1.154   2.392   1.00 14.56 ? 213 TYR B N    2  
ATOM   3080  C CA   . TYR B 2 74  ? -11.102 2.581   2.604   1.00 12.35 ? 213 TYR B CA   2  
ATOM   3081  C C    . TYR B 2 74  ? -9.965  2.672   3.623   1.00 12.92 ? 213 TYR B C    2  
ATOM   3082  O O    . TYR B 2 74  ? -9.962  1.999   4.634   1.00 12.14 ? 213 TYR B O    2  
ATOM   3083  C CB   . TYR B 2 74  ? -12.327 3.375   3.090   1.00 12.55 ? 213 TYR B CB   2  
ATOM   3084  C CG   . TYR B 2 74  ? -12.576 3.135   4.564   1.00 14.01 ? 213 TYR B CG   2  
ATOM   3085  C CD1  . TYR B 2 74  ? -12.504 1.837   5.096   1.00 13.18 ? 213 TYR B CD1  2  
ATOM   3086  C CD2  . TYR B 2 74  ? -12.889 4.219   5.401   1.00 13.49 ? 213 TYR B CD2  2  
ATOM   3087  C CE1  . TYR B 2 74  ? -12.742 1.624   6.465   1.00 14.46 ? 213 TYR B CE1  2  
ATOM   3088  C CE2  . TYR B 2 74  ? -13.125 4.007   6.770   1.00 13.06 ? 213 TYR B CE2  2  
ATOM   3089  C CZ   . TYR B 2 74  ? -13.052 2.709   7.301   1.00 15.80 ? 213 TYR B CZ   2  
ATOM   3090  O OH   . TYR B 2 74  ? -13.287 2.498   8.645   1.00 18.90 ? 213 TYR B OH   2  
ATOM   3091  H H    . TYR B 2 74  ? -11.011 0.444   2.887   1.00 0.00  ? 213 TYR B H    2  
ATOM   3092  H HA   . TYR B 2 74  ? -10.764 2.998   1.666   1.00 0.00  ? 213 TYR B HA   2  
ATOM   3093  H HB2  . TYR B 2 74  ? -12.155 4.428   2.928   1.00 0.00  ? 213 TYR B HB2  2  
ATOM   3094  H HB3  . TYR B 2 74  ? -13.196 3.068   2.528   1.00 0.00  ? 213 TYR B HB3  2  
ATOM   3095  H HD1  . TYR B 2 74  ? -12.262 1.005   4.455   1.00 0.00  ? 213 TYR B HD1  2  
ATOM   3096  H HD2  . TYR B 2 74  ? -12.941 5.219   4.995   1.00 0.00  ? 213 TYR B HD2  2  
ATOM   3097  H HE1  . TYR B 2 74  ? -12.685 0.627   6.873   1.00 0.00  ? 213 TYR B HE1  2  
ATOM   3098  H HE2  . TYR B 2 74  ? -13.362 4.842   7.412   1.00 0.00  ? 213 TYR B HE2  2  
ATOM   3099  H HH   . TYR B 2 74  ? -12.923 3.243   9.129   1.00 0.00  ? 213 TYR B HH   2  
ATOM   3100  N N    . ILE B 2 75  ? -8.997  3.501   3.359   1.00 13.74 ? 214 ILE B N    2  
ATOM   3101  C CA   . ILE B 2 75  ? -7.857  3.644   4.303   1.00 13.80 ? 214 ILE B CA   2  
ATOM   3102  C C    . ILE B 2 75  ? -8.022  4.938   5.106   1.00 14.16 ? 214 ILE B C    2  
ATOM   3103  O O    . ILE B 2 75  ? -7.221  5.251   5.965   1.00 12.50 ? 214 ILE B O    2  
ATOM   3104  C CB   . ILE B 2 75  ? -6.551  3.686   3.503   1.00 10.15 ? 214 ILE B CB   2  
ATOM   3105  C CG1  . ILE B 2 75  ? -6.224  2.279   2.999   1.00 9.57  ? 214 ILE B CG1  2  
ATOM   3106  C CG2  . ILE B 2 75  ? -5.405  4.182   4.391   1.00 8.37  ? 214 ILE B CG2  2  
ATOM   3107  C CD1  . ILE B 2 75  ? -5.221  2.371   1.847   1.00 7.18  ? 214 ILE B CD1  2  
ATOM   3108  H H    . ILE B 2 75  ? -9.020  4.033   2.536   1.00 0.00  ? 214 ILE B H    2  
ATOM   3109  H HA   . ILE B 2 75  ? -7.840  2.801   4.978   1.00 0.00  ? 214 ILE B HA   2  
ATOM   3110  H HB   . ILE B 2 75  ? -6.669  4.352   2.660   1.00 0.00  ? 214 ILE B HB   2  
ATOM   3111  H HG12 . ILE B 2 75  ? -5.796  1.698   3.805   1.00 0.00  ? 214 ILE B HG12 2  
ATOM   3112  H HG13 . ILE B 2 75  ? -7.127  1.802   2.651   1.00 0.00  ? 214 ILE B HG13 2  
ATOM   3113  H HG21 . ILE B 2 75  ? -5.606  3.918   5.419   1.00 0.00  ? 214 ILE B HG21 2  
ATOM   3114  H HG22 . ILE B 2 75  ? -4.480  3.723   4.076   1.00 0.00  ? 214 ILE B HG22 2  
ATOM   3115  H HG23 . ILE B 2 75  ? -5.323  5.255   4.305   1.00 0.00  ? 214 ILE B HG23 2  
ATOM   3116  H HD11 . ILE B 2 75  ? -4.459  3.095   2.092   1.00 0.00  ? 214 ILE B HD11 2  
ATOM   3117  H HD12 . ILE B 2 75  ? -4.763  1.406   1.690   1.00 0.00  ? 214 ILE B HD12 2  
ATOM   3118  H HD13 . ILE B 2 75  ? -5.733  2.677   0.948   1.00 0.00  ? 214 ILE B HD13 2  
ATOM   3119  N N    . THR B 2 76  ? -9.053  5.695   4.836   1.00 15.77 ? 215 THR B N    2  
ATOM   3120  C CA   . THR B 2 76  ? -9.255  6.964   5.589   1.00 18.20 ? 215 THR B CA   2  
ATOM   3121  C C    . THR B 2 76  ? -10.719 7.085   6.018   1.00 17.81 ? 215 THR B C    2  
ATOM   3122  O O    . THR B 2 76  ? -11.380 6.102   6.268   1.00 15.56 ? 215 THR B O    2  
ATOM   3123  C CB   . THR B 2 76  ? -8.852  8.149   4.696   1.00 20.21 ? 215 THR B CB   2  
ATOM   3124  O OG1  . THR B 2 76  ? -8.644  9.301   5.501   1.00 26.81 ? 215 THR B OG1  2  
ATOM   3125  C CG2  . THR B 2 76  ? -9.950  8.429   3.666   1.00 22.31 ? 215 THR B CG2  2  
ATOM   3126  H H    . THR B 2 76  ? -9.688  5.430   4.138   1.00 0.00  ? 215 THR B H    2  
ATOM   3127  H HA   . THR B 2 76  ? -8.636  6.956   6.467   1.00 0.00  ? 215 THR B HA   2  
ATOM   3128  H HB   . THR B 2 76  ? -7.937  7.907   4.177   1.00 0.00  ? 215 THR B HB   2  
ATOM   3129  H HG1  . THR B 2 76  ? -8.834  10.075  4.965   1.00 0.00  ? 215 THR B HG1  2  
ATOM   3130  H HG21 . THR B 2 76  ? -10.519 7.528   3.493   1.00 0.00  ? 215 THR B HG21 2  
ATOM   3131  H HG22 . THR B 2 76  ? -10.604 9.203   4.038   1.00 0.00  ? 215 THR B HG22 2  
ATOM   3132  H HG23 . THR B 2 76  ? -9.500  8.753   2.740   1.00 0.00  ? 215 THR B HG23 2  
ATOM   3133  N N    . SER B 2 77  ? -11.226 8.281   6.121   1.00 18.97 ? 216 SER B N    2  
ATOM   3134  C CA   . SER B 2 77  ? -12.644 8.453   6.545   1.00 18.71 ? 216 SER B CA   2  
ATOM   3135  C C    . SER B 2 77  ? -13.308 9.535   5.692   1.00 18.69 ? 216 SER B C    2  
ATOM   3136  O O    . SER B 2 77  ? -13.433 10.672  6.101   1.00 20.53 ? 216 SER B O    2  
ATOM   3137  C CB   . SER B 2 77  ? -12.691 8.865   8.017   1.00 20.19 ? 216 SER B CB   2  
ATOM   3138  O OG   . SER B 2 77  ? -14.025 8.748   8.495   1.00 22.41 ? 216 SER B OG   2  
ATOM   3139  H H    . SER B 2 77  ? -10.674 9.064   5.927   1.00 0.00  ? 216 SER B H    2  
ATOM   3140  H HA   . SER B 2 77  ? -13.173 7.519   6.417   1.00 0.00  ? 216 SER B HA   2  
ATOM   3141  H HB2  . SER B 2 77  ? -12.050 8.220   8.594   1.00 0.00  ? 216 SER B HB2  2  
ATOM   3142  H HB3  . SER B 2 77  ? -12.351 9.887   8.113   1.00 0.00  ? 216 SER B HB3  2  
ATOM   3143  H HG   . SER B 2 77  ? -14.041 9.050   9.406   1.00 0.00  ? 216 SER B HG   2  
ATOM   3144  N N    . ARG B 2 78  ? -13.738 9.190   4.508   1.00 0.00  ? 217 ARG B N    2  
ATOM   3145  C CA   . ARG B 2 78  ? -14.397 10.198  3.629   1.00 0.00  ? 217 ARG B CA   2  
ATOM   3146  C C    . ARG B 2 78  ? -14.536 9.633   2.214   1.00 0.00  ? 217 ARG B C    2  
ATOM   3147  O O    . ARG B 2 78  ? -15.423 10.004  1.471   1.00 0.00  ? 217 ARG B O    2  
ATOM   3148  C CB   . ARG B 2 78  ? -13.552 11.473  3.584   1.00 0.00  ? 217 ARG B CB   2  
ATOM   3149  C CG   . ARG B 2 78  ? -12.073 11.103  3.444   1.00 0.00  ? 217 ARG B CG   2  
ATOM   3150  C CD   . ARG B 2 78  ? -11.266 12.351  3.082   1.00 0.00  ? 217 ARG B CD   2  
ATOM   3151  N NE   . ARG B 2 78  ? -12.024 13.164  2.089   1.00 0.00  ? 217 ARG B NE   2  
ATOM   3152  C CZ   . ARG B 2 78  ? -12.198 14.442  2.287   1.00 0.00  ? 217 ARG B CZ   2  
ATOM   3153  N NH1  . ARG B 2 78  ? -13.236 14.862  2.957   1.00 0.00  ? 217 ARG B NH1  2  
ATOM   3154  N NH2  . ARG B 2 78  ? -11.334 15.299  1.816   1.00 0.00  ? 217 ARG B NH2  2  
ATOM   3155  H H    . ARG B 2 78  ? -13.630 8.266   4.199   1.00 0.00  ? 217 ARG B H    2  
ATOM   3156  H HA   . ARG B 2 78  ? -15.377 10.430  4.020   1.00 0.00  ? 217 ARG B HA   2  
ATOM   3157  H HB2  . ARG B 2 78  ? -13.856 12.074  2.739   1.00 0.00  ? 217 ARG B HB2  2  
ATOM   3158  H HB3  . ARG B 2 78  ? -13.696 12.034  4.494   1.00 0.00  ? 217 ARG B HB3  2  
ATOM   3159  H HG2  . ARG B 2 78  ? -11.714 10.700  4.380   1.00 0.00  ? 217 ARG B HG2  2  
ATOM   3160  H HG3  . ARG B 2 78  ? -11.959 10.364  2.665   1.00 0.00  ? 217 ARG B HG3  2  
ATOM   3161  H HD2  . ARG B 2 78  ? -11.094 12.939  3.972   1.00 0.00  ? 217 ARG B HD2  2  
ATOM   3162  H HD3  . ARG B 2 78  ? -10.318 12.056  2.657   1.00 0.00  ? 217 ARG B HD3  2  
ATOM   3163  H HE   . ARG B 2 78  ? -12.391 12.739  1.285   1.00 0.00  ? 217 ARG B HE   2  
ATOM   3164  H HH11 . ARG B 2 78  ? -13.898 14.206  3.319   1.00 0.00  ? 217 ARG B HH11 2  
ATOM   3165  H HH12 . ARG B 2 78  ? -13.369 15.842  3.110   1.00 0.00  ? 217 ARG B HH12 2  
ATOM   3166  H HH21 . ARG B 2 78  ? -10.539 14.976  1.302   1.00 0.00  ? 217 ARG B HH21 2  
ATOM   3167  H HH22 . ARG B 2 78  ? -11.468 16.278  1.968   1.00 0.00  ? 217 ARG B HH22 2  
ATOM   3168  N N    . THR B 2 79  ? -13.664 8.739   1.831   1.00 23.45 ? 218 THR B N    2  
ATOM   3169  C CA   . THR B 2 79  ? -13.749 8.157   0.462   1.00 23.59 ? 218 THR B CA   2  
ATOM   3170  C C    . THR B 2 79  ? -13.789 6.631   0.552   1.00 19.84 ? 218 THR B C    2  
ATOM   3171  O O    . THR B 2 79  ? -12.898 6.006   1.094   1.00 20.24 ? 218 THR B O    2  
ATOM   3172  C CB   . THR B 2 79  ? -12.524 8.587   -0.349  1.00 26.45 ? 218 THR B CB   2  
ATOM   3173  O OG1  . THR B 2 79  ? -12.150 9.906   0.024   1.00 30.31 ? 218 THR B OG1  2  
ATOM   3174  C CG2  . THR B 2 79  ? -12.860 8.552   -1.841  1.00 27.38 ? 218 THR B CG2  2  
ATOM   3175  H H    . THR B 2 79  ? -12.954 8.454   2.442   1.00 0.00  ? 218 THR B H    2  
ATOM   3176  H HA   . THR B 2 79  ? -14.645 8.512   -0.025  1.00 0.00  ? 218 THR B HA   2  
ATOM   3177  H HB   . THR B 2 79  ? -11.706 7.911   -0.153  1.00 0.00  ? 218 THR B HB   2  
ATOM   3178  H HG1  . THR B 2 79  ? -11.502 9.841   0.730   1.00 0.00  ? 218 THR B HG1  2  
ATOM   3179  H HG21 . THR B 2 79  ? -13.926 8.656   -1.973  1.00 0.00  ? 218 THR B HG21 2  
ATOM   3180  H HG22 . THR B 2 79  ? -12.354 9.364   -2.343  1.00 0.00  ? 218 THR B HG22 2  
ATOM   3181  H HG23 . THR B 2 79  ? -12.535 7.612   -2.261  1.00 0.00  ? 218 THR B HG23 2  
ATOM   3182  N N    . GLN B 2 80  ? -14.815 6.023   0.021   1.00 18.30 ? 219 GLN B N    2  
ATOM   3183  C CA   . GLN B 2 80  ? -14.913 4.537   0.070   1.00 20.11 ? 219 GLN B CA   2  
ATOM   3184  C C    . GLN B 2 80  ? -14.842 3.980   -1.351  1.00 19.45 ? 219 GLN B C    2  
ATOM   3185  O O    . GLN B 2 80  ? -15.602 4.361   -2.218  1.00 20.30 ? 219 GLN B O    2  
ATOM   3186  C CB   . GLN B 2 80  ? -16.241 4.129   0.711   1.00 20.56 ? 219 GLN B CB   2  
ATOM   3187  C CG   . GLN B 2 80  ? -16.583 5.100   1.843   1.00 23.60 ? 219 GLN B CG   2  
ATOM   3188  C CD   . GLN B 2 80  ? -15.556 4.954   2.969   1.00 19.08 ? 219 GLN B CD   2  
ATOM   3189  O OE1  . GLN B 2 80  ? -14.378 5.164   2.762   1.00 17.99 ? 219 GLN B OE1  2  
ATOM   3190  N NE2  . GLN B 2 80  ? -15.958 4.598   4.159   1.00 17.08 ? 219 GLN B NE2  2  
ATOM   3191  H H    . GLN B 2 80  ? -15.521 6.547   -0.414  1.00 0.00  ? 219 GLN B H    2  
ATOM   3192  H HA   . GLN B 2 80  ? -14.095 4.140   0.654   1.00 0.00  ? 219 GLN B HA   2  
ATOM   3193  H HB2  . GLN B 2 80  ? -17.021 4.156   -0.036  1.00 0.00  ? 219 GLN B HB2  2  
ATOM   3194  H HB3  . GLN B 2 80  ? -16.156 3.130   1.109   1.00 0.00  ? 219 GLN B HB3  2  
ATOM   3195  H HG2  . GLN B 2 80  ? -16.564 6.113   1.467   1.00 0.00  ? 219 GLN B HG2  2  
ATOM   3196  H HG3  . GLN B 2 80  ? -17.567 4.875   2.225   1.00 0.00  ? 219 GLN B HG3  2  
ATOM   3197  H HE21 . GLN B 2 80  ? -16.913 4.428   4.324   1.00 0.00  ? 219 GLN B HE21 2  
ATOM   3198  H HE22 . GLN B 2 80  ? -15.304 4.502   4.888   1.00 0.00  ? 219 GLN B HE22 2  
ATOM   3199  N N    . PHE B 2 81  ? -13.931 3.081   -1.597  1.00 18.96 ? 220 PHE B N    2  
ATOM   3200  C CA   . PHE B 2 81  ? -13.804 2.498   -2.960  1.00 17.73 ? 220 PHE B CA   2  
ATOM   3201  C C    . PHE B 2 81  ? -14.560 1.170   -3.023  1.00 17.76 ? 220 PHE B C    2  
ATOM   3202  O O    . PHE B 2 81  ? -14.735 0.497   -2.026  1.00 19.11 ? 220 PHE B O    2  
ATOM   3203  C CB   . PHE B 2 81  ? -12.326 2.259   -3.275  1.00 14.17 ? 220 PHE B CB   2  
ATOM   3204  C CG   . PHE B 2 81  ? -11.520 3.466   -2.858  1.00 14.07 ? 220 PHE B CG   2  
ATOM   3205  C CD1  . PHE B 2 81  ? -11.087 3.597   -1.528  1.00 12.87 ? 220 PHE B CD1  2  
ATOM   3206  C CD2  . PHE B 2 81  ? -11.202 4.458   -3.801  1.00 14.01 ? 220 PHE B CD2  2  
ATOM   3207  C CE1  . PHE B 2 81  ? -10.337 4.720   -1.141  1.00 13.31 ? 220 PHE B CE1  2  
ATOM   3208  C CE2  . PHE B 2 81  ? -10.452 5.580   -3.415  1.00 11.11 ? 220 PHE B CE2  2  
ATOM   3209  C CZ   . PHE B 2 81  ? -10.019 5.712   -2.085  1.00 13.09 ? 220 PHE B CZ   2  
ATOM   3210  H H    . PHE B 2 81  ? -13.328 2.791   -0.882  1.00 0.00  ? 220 PHE B H    2  
ATOM   3211  H HA   . PHE B 2 81  ? -14.219 3.183   -3.685  1.00 0.00  ? 220 PHE B HA   2  
ATOM   3212  H HB2  . PHE B 2 81  ? -11.980 1.390   -2.734  1.00 0.00  ? 220 PHE B HB2  2  
ATOM   3213  H HB3  . PHE B 2 81  ? -12.207 2.095   -4.334  1.00 0.00  ? 220 PHE B HB3  2  
ATOM   3214  H HD1  . PHE B 2 81  ? -11.331 2.835   -0.803  1.00 0.00  ? 220 PHE B HD1  2  
ATOM   3215  H HD2  . PHE B 2 81  ? -11.535 4.357   -4.824  1.00 0.00  ? 220 PHE B HD2  2  
ATOM   3216  H HE1  . PHE B 2 81  ? -10.004 4.821   -0.119  1.00 0.00  ? 220 PHE B HE1  2  
ATOM   3217  H HE2  . PHE B 2 81  ? -10.208 6.343   -4.139  1.00 0.00  ? 220 PHE B HE2  2  
ATOM   3218  H HZ   . PHE B 2 81  ? -9.442  6.574   -1.787  1.00 0.00  ? 220 PHE B HZ   2  
ATOM   3219  N N    . ASN B 2 82  ? -15.010 0.787   -4.186  1.00 20.00 ? 221 ASN B N    2  
ATOM   3220  C CA   . ASN B 2 82  ? -15.753 -0.497  -4.312  1.00 21.48 ? 221 ASN B CA   2  
ATOM   3221  C C    . ASN B 2 82  ? -14.840 -1.557  -4.932  1.00 22.18 ? 221 ASN B C    2  
ATOM   3222  O O    . ASN B 2 82  ? -15.293 -2.583  -5.399  1.00 24.56 ? 221 ASN B O    2  
ATOM   3223  C CB   . ASN B 2 82  ? -16.978 -0.293  -5.206  1.00 26.12 ? 221 ASN B CB   2  
ATOM   3224  C CG   . ASN B 2 82  ? -18.227 -0.806  -4.488  1.00 28.62 ? 221 ASN B CG   2  
ATOM   3225  O OD1  . ASN B 2 82  ? -18.622 -1.941  -4.667  1.00 32.09 ? 221 ASN B OD1  2  
ATOM   3226  N ND2  . ASN B 2 82  ? -18.872 -0.012  -3.678  1.00 31.44 ? 221 ASN B ND2  2  
ATOM   3227  H H    . ASN B 2 82  ? -14.858 1.345   -4.978  1.00 0.00  ? 221 ASN B H    2  
ATOM   3228  H HA   . ASN B 2 82  ? -16.073 -0.826  -3.333  1.00 0.00  ? 221 ASN B HA   2  
ATOM   3229  H HB2  . ASN B 2 82  ? -17.093 0.760   -5.423  1.00 0.00  ? 221 ASN B HB2  2  
ATOM   3230  H HB3  . ASN B 2 82  ? -16.846 -0.837  -6.128  1.00 0.00  ? 221 ASN B HB3  2  
ATOM   3231  H HD21 . ASN B 2 82  ? -18.552 0.908   -3.535  1.00 0.00  ? 221 ASN B HD21 2  
ATOM   3232  H HD22 . ASN B 2 82  ? -19.676 -0.333  -3.211  1.00 0.00  ? 221 ASN B HD22 2  
ATOM   3233  N N    . SER B 2 83  ? -13.557 -1.317  -4.940  1.00 20.04 ? 222 SER B N    2  
ATOM   3234  C CA   . SER B 2 83  ? -12.618 -2.310  -5.530  1.00 17.84 ? 222 SER B CA   2  
ATOM   3235  C C    . SER B 2 83  ? -11.189 -1.986  -5.088  1.00 17.08 ? 222 SER B C    2  
ATOM   3236  O O    . SER B 2 83  ? -10.714 -0.881  -5.251  1.00 17.94 ? 222 SER B O    2  
ATOM   3237  C CB   . SER B 2 83  ? -12.704 -2.250  -7.056  1.00 15.42 ? 222 SER B CB   2  
ATOM   3238  O OG   . SER B 2 83  ? -13.046 -0.929  -7.454  1.00 19.15 ? 222 SER B OG   2  
ATOM   3239  H H    . SER B 2 83  ? -13.212 -0.483  -4.558  1.00 0.00  ? 222 SER B H    2  
ATOM   3240  H HA   . SER B 2 83  ? -12.883 -3.302  -5.193  1.00 0.00  ? 222 SER B HA   2  
ATOM   3241  H HB2  . SER B 2 83  ? -11.752 -2.514  -7.483  1.00 0.00  ? 222 SER B HB2  2  
ATOM   3242  H HB3  . SER B 2 83  ? -13.457 -2.947  -7.399  1.00 0.00  ? 222 SER B HB3  2  
ATOM   3243  H HG   . SER B 2 83  ? -13.996 -0.828  -7.362  1.00 0.00  ? 222 SER B HG   2  
ATOM   3244  N N    . LEU B 2 84  ? -10.500 -2.943  -4.528  1.00 17.11 ? 223 LEU B N    2  
ATOM   3245  C CA   . LEU B 2 84  ? -9.104  -2.690  -4.077  1.00 16.96 ? 223 LEU B CA   2  
ATOM   3246  C C    . LEU B 2 84  ? -8.335  -1.959  -5.180  1.00 17.05 ? 223 LEU B C    2  
ATOM   3247  O O    . LEU B 2 84  ? -7.484  -1.133  -4.914  1.00 18.74 ? 223 LEU B O    2  
ATOM   3248  C CB   . LEU B 2 84  ? -8.421  -4.024  -3.776  1.00 15.68 ? 223 LEU B CB   2  
ATOM   3249  C CG   . LEU B 2 84  ? -9.072  -4.668  -2.552  1.00 18.50 ? 223 LEU B CG   2  
ATOM   3250  C CD1  . LEU B 2 84  ? -8.969  -6.190  -2.659  1.00 17.89 ? 223 LEU B CD1  2  
ATOM   3251  C CD2  . LEU B 2 84  ? -8.354  -4.198  -1.285  1.00 17.50 ? 223 LEU B CD2  2  
ATOM   3252  H H    . LEU B 2 84  ? -10.901 -3.828  -4.405  1.00 0.00  ? 223 LEU B H    2  
ATOM   3253  H HA   . LEU B 2 84  ? -9.119  -2.083  -3.184  1.00 0.00  ? 223 LEU B HA   2  
ATOM   3254  H HB2  . LEU B 2 84  ? -8.524  -4.682  -4.628  1.00 0.00  ? 223 LEU B HB2  2  
ATOM   3255  H HB3  . LEU B 2 84  ? -7.374  -3.856  -3.577  1.00 0.00  ? 223 LEU B HB3  2  
ATOM   3256  H HG   . LEU B 2 84  ? -10.113 -4.380  -2.506  1.00 0.00  ? 223 LEU B HG   2  
ATOM   3257  H HD11 . LEU B 2 84  ? -8.076  -6.453  -3.206  1.00 0.00  ? 223 LEU B HD11 2  
ATOM   3258  H HD12 . LEU B 2 84  ? -8.924  -6.618  -1.669  1.00 0.00  ? 223 LEU B HD12 2  
ATOM   3259  H HD13 . LEU B 2 84  ? -9.835  -6.573  -3.177  1.00 0.00  ? 223 LEU B HD13 2  
ATOM   3260  H HD21 . LEU B 2 84  ? -8.016  -3.180  -1.421  1.00 0.00  ? 223 LEU B HD21 2  
ATOM   3261  H HD22 . LEU B 2 84  ? -9.033  -4.242  -0.447  1.00 0.00  ? 223 LEU B HD22 2  
ATOM   3262  H HD23 . LEU B 2 84  ? -7.504  -4.836  -1.096  1.00 0.00  ? 223 LEU B HD23 2  
ATOM   3263  N N    . GLN B 2 85  ? -8.628  -2.256  -6.417  1.00 17.04 ? 224 GLN B N    2  
ATOM   3264  C CA   . GLN B 2 85  ? -7.914  -1.579  -7.535  1.00 17.80 ? 224 GLN B CA   2  
ATOM   3265  C C    . GLN B 2 85  ? -8.275  -0.093  -7.546  1.00 17.42 ? 224 GLN B C    2  
ATOM   3266  O O    . GLN B 2 85  ? -7.420  0.762   -7.660  1.00 17.16 ? 224 GLN B O    2  
ATOM   3267  C CB   . GLN B 2 85  ? -8.333  -2.213  -8.865  1.00 21.63 ? 224 GLN B CB   2  
ATOM   3268  C CG   . GLN B 2 85  ? -7.127  -2.903  -9.504  1.00 27.99 ? 224 GLN B CG   2  
ATOM   3269  C CD   . GLN B 2 85  ? -7.480  -3.330  -10.930 1.00 31.34 ? 224 GLN B CD   2  
ATOM   3270  O OE1  . GLN B 2 85  ? -8.273  -4.228  -11.129 1.00 31.30 ? 224 GLN B OE1  2  
ATOM   3271  N NE2  . GLN B 2 85  ? -6.921  -2.717  -11.938 1.00 33.99 ? 224 GLN B NE2  2  
ATOM   3272  H H    . GLN B 2 85  ? -9.319  -2.925  -6.609  1.00 0.00  ? 224 GLN B H    2  
ATOM   3273  H HA   . GLN B 2 85  ? -6.849  -1.689  -7.402  1.00 0.00  ? 224 GLN B HA   2  
ATOM   3274  H HB2  . GLN B 2 85  ? -9.113  -2.939  -8.686  1.00 0.00  ? 224 GLN B HB2  2  
ATOM   3275  H HB3  . GLN B 2 85  ? -8.699  -1.445  -9.530  1.00 0.00  ? 224 GLN B HB3  2  
ATOM   3276  H HG2  . GLN B 2 85  ? -6.291  -2.219  -9.528  1.00 0.00  ? 224 GLN B HG2  2  
ATOM   3277  H HG3  . GLN B 2 85  ? -6.863  -3.775  -8.925  1.00 0.00  ? 224 GLN B HG3  2  
ATOM   3278  H HE21 . GLN B 2 85  ? -6.279  -1.989  -11.775 1.00 0.00  ? 224 GLN B HE21 2  
ATOM   3279  H HE22 . GLN B 2 85  ? -7.143  -2.985  -12.858 1.00 0.00  ? 224 GLN B HE22 2  
ATOM   3280  N N    . GLN B 2 86  ? -9.536  0.221   -7.429  1.00 17.93 ? 225 GLN B N    2  
ATOM   3281  C CA   . GLN B 2 86  ? -9.949  1.653   -7.433  1.00 17.77 ? 225 GLN B CA   2  
ATOM   3282  C C    . GLN B 2 86  ? -9.156  2.414   -6.368  1.00 14.93 ? 225 GLN B C    2  
ATOM   3283  O O    . GLN B 2 86  ? -8.618  3.473   -6.621  1.00 15.44 ? 225 GLN B O    2  
ATOM   3284  C CB   . GLN B 2 86  ? -11.444 1.749   -7.126  1.00 23.54 ? 225 GLN B CB   2  
ATOM   3285  C CG   . GLN B 2 86  ? -11.980 3.095   -7.616  1.00 32.83 ? 225 GLN B CG   2  
ATOM   3286  C CD   . GLN B 2 86  ? -13.491 3.156   -7.386  1.00 37.70 ? 225 GLN B CD   2  
ATOM   3287  O OE1  . GLN B 2 86  ? -13.963 2.893   -6.298  1.00 41.31 ? 225 GLN B OE1  2  
ATOM   3288  N NE2  . GLN B 2 86  ? -14.275 3.497   -8.372  1.00 38.92 ? 225 GLN B NE2  2  
ATOM   3289  H H    . GLN B 2 86  ? -10.210 -0.483  -7.339  1.00 0.00  ? 225 GLN B H    2  
ATOM   3290  H HA   . GLN B 2 86  ? -9.752  2.081   -8.405  1.00 0.00  ? 225 GLN B HA   2  
ATOM   3291  H HB2  . GLN B 2 86  ? -11.967 0.948   -7.628  1.00 0.00  ? 225 GLN B HB2  2  
ATOM   3292  H HB3  . GLN B 2 86  ? -11.599 1.668   -6.062  1.00 0.00  ? 225 GLN B HB3  2  
ATOM   3293  H HG2  . GLN B 2 86  ? -11.498 3.894   -7.071  1.00 0.00  ? 225 GLN B HG2  2  
ATOM   3294  H HG3  . GLN B 2 86  ? -11.774 3.203   -8.671  1.00 0.00  ? 225 GLN B HG3  2  
ATOM   3295  H HE21 . GLN B 2 86  ? -13.894 3.709   -9.249  1.00 0.00  ? 225 GLN B HE21 2  
ATOM   3296  H HE22 . GLN B 2 86  ? -15.244 3.540   -8.235  1.00 0.00  ? 225 GLN B HE22 2  
ATOM   3297  N N    . LEU B 2 87  ? -9.079  1.881   -5.179  1.00 13.83 ? 226 LEU B N    2  
ATOM   3298  C CA   . LEU B 2 87  ? -8.318  2.573   -4.100  1.00 13.09 ? 226 LEU B CA   2  
ATOM   3299  C C    . LEU B 2 87  ? -6.858  2.732   -4.529  1.00 11.87 ? 226 LEU B C    2  
ATOM   3300  O O    . LEU B 2 87  ? -6.237  3.749   -4.289  1.00 12.13 ? 226 LEU B O    2  
ATOM   3301  C CB   . LEU B 2 87  ? -8.390  1.742   -2.816  1.00 12.56 ? 226 LEU B CB   2  
ATOM   3302  C CG   . LEU B 2 87  ? -7.662  2.471   -1.683  1.00 13.63 ? 226 LEU B CG   2  
ATOM   3303  C CD1  . LEU B 2 87  ? -8.140  1.924   -0.336  1.00 13.34 ? 226 LEU B CD1  2  
ATOM   3304  C CD2  . LEU B 2 87  ? -6.154  2.243   -1.816  1.00 14.36 ? 226 LEU B CD2  2  
ATOM   3305  H H    . LEU B 2 87  ? -9.520  1.026   -4.996  1.00 0.00  ? 226 LEU B H    2  
ATOM   3306  H HA   . LEU B 2 87  ? -8.749  3.549   -3.923  1.00 0.00  ? 226 LEU B HA   2  
ATOM   3307  H HB2  . LEU B 2 87  ? -9.425  1.595   -2.541  1.00 0.00  ? 226 LEU B HB2  2  
ATOM   3308  H HB3  . LEU B 2 87  ? -7.923  0.784   -2.982  1.00 0.00  ? 226 LEU B HB3  2  
ATOM   3309  H HG   . LEU B 2 87  ? -7.875  3.529   -1.736  1.00 0.00  ? 226 LEU B HG   2  
ATOM   3310  H HD11 . LEU B 2 87  ? -8.986  1.271   -0.494  1.00 0.00  ? 226 LEU B HD11 2  
ATOM   3311  H HD12 . LEU B 2 87  ? -7.340  1.370   0.132   1.00 0.00  ? 226 LEU B HD12 2  
ATOM   3312  H HD13 . LEU B 2 87  ? -8.432  2.743   0.302   1.00 0.00  ? 226 LEU B HD13 2  
ATOM   3313  H HD21 . LEU B 2 87  ? -5.972  1.452   -2.527  1.00 0.00  ? 226 LEU B HD21 2  
ATOM   3314  H HD22 . LEU B 2 87  ? -5.683  3.151   -2.158  1.00 0.00  ? 226 LEU B HD22 2  
ATOM   3315  H HD23 . LEU B 2 87  ? -5.746  1.964   -0.855  1.00 0.00  ? 226 LEU B HD23 2  
ATOM   3316  N N    . VAL B 2 88  ? -6.303  1.734   -5.163  1.00 11.28 ? 227 VAL B N    2  
ATOM   3317  C CA   . VAL B 2 88  ? -4.884  1.831   -5.605  1.00 13.23 ? 227 VAL B CA   2  
ATOM   3318  C C    . VAL B 2 88  ? -4.772  2.846   -6.745  1.00 13.64 ? 227 VAL B C    2  
ATOM   3319  O O    . VAL B 2 88  ? -3.711  3.366   -7.022  1.00 15.96 ? 227 VAL B O    2  
ATOM   3320  C CB   . VAL B 2 88  ? -4.405  0.463   -6.093  1.00 9.89  ? 227 VAL B CB   2  
ATOM   3321  C CG1  . VAL B 2 88  ? -2.897  0.509   -6.343  1.00 9.85  ? 227 VAL B CG1  2  
ATOM   3322  C CG2  . VAL B 2 88  ? -4.713  -0.593  -5.029  1.00 9.58  ? 227 VAL B CG2  2  
ATOM   3323  H H    . VAL B 2 88  ? -6.820  0.921   -5.349  1.00 0.00  ? 227 VAL B H    2  
ATOM   3324  H HA   . VAL B 2 88  ? -4.270  2.152   -4.777  1.00 0.00  ? 227 VAL B HA   2  
ATOM   3325  H HB   . VAL B 2 88  ? -4.915  0.209   -7.012  1.00 0.00  ? 227 VAL B HB   2  
ATOM   3326  H HG11 . VAL B 2 88  ? -2.614  1.504   -6.650  1.00 0.00  ? 227 VAL B HG11 2  
ATOM   3327  H HG12 . VAL B 2 88  ? -2.374  0.248   -5.435  1.00 0.00  ? 227 VAL B HG12 2  
ATOM   3328  H HG13 . VAL B 2 88  ? -2.639  -0.194  -7.122  1.00 0.00  ? 227 VAL B HG13 2  
ATOM   3329  H HG21 . VAL B 2 88  ? -5.289  -0.145  -4.233  1.00 0.00  ? 227 VAL B HG21 2  
ATOM   3330  H HG22 . VAL B 2 88  ? -5.277  -1.399  -5.474  1.00 0.00  ? 227 VAL B HG22 2  
ATOM   3331  H HG23 . VAL B 2 88  ? -3.787  -0.980  -4.628  1.00 0.00  ? 227 VAL B HG23 2  
ATOM   3332  N N    . ALA B 2 89  ? -5.860  3.132   -7.406  1.00 16.21 ? 228 ALA B N    2  
ATOM   3333  C CA   . ALA B 2 89  ? -5.812  4.115   -8.525  1.00 16.05 ? 228 ALA B CA   2  
ATOM   3334  C C    . ALA B 2 89  ? -6.044  5.523   -7.975  1.00 16.38 ? 228 ALA B C    2  
ATOM   3335  O O    . ALA B 2 89  ? -5.675  6.507   -8.583  1.00 17.42 ? 228 ALA B O    2  
ATOM   3336  C CB   . ALA B 2 89  ? -6.903  3.780   -9.545  1.00 17.50 ? 228 ALA B CB   2  
ATOM   3337  H H    . ALA B 2 89  ? -6.707  2.703   -7.167  1.00 0.00  ? 228 ALA B H    2  
ATOM   3338  H HA   . ALA B 2 89  ? -4.846  4.069   -9.004  1.00 0.00  ? 228 ALA B HA   2  
ATOM   3339  H HB1  . ALA B 2 89  ? -7.244  2.767   -9.388  1.00 0.00  ? 228 ALA B HB1  2  
ATOM   3340  H HB2  . ALA B 2 89  ? -7.731  4.462   -9.423  1.00 0.00  ? 228 ALA B HB2  2  
ATOM   3341  H HB3  . ALA B 2 89  ? -6.502  3.874   -10.544 1.00 0.00  ? 228 ALA B HB3  2  
ATOM   3342  N N    . TYR B 2 90  ? -6.652  5.625   -6.824  1.00 17.24 ? 229 TYR B N    2  
ATOM   3343  C CA   . TYR B 2 90  ? -6.907  6.969   -6.234  1.00 15.90 ? 229 TYR B CA   2  
ATOM   3344  C C    . TYR B 2 90  ? -5.613  7.504   -5.615  1.00 15.53 ? 229 TYR B C    2  
ATOM   3345  O O    . TYR B 2 90  ? -5.142  8.569   -5.963  1.00 15.40 ? 229 TYR B O    2  
ATOM   3346  C CB   . TYR B 2 90  ? -7.981  6.855   -5.151  1.00 17.41 ? 229 TYR B CB   2  
ATOM   3347  C CG   . TYR B 2 90  ? -8.715  8.169   -5.029  1.00 19.62 ? 229 TYR B CG   2  
ATOM   3348  C CD1  . TYR B 2 90  ? -9.725  8.497   -5.949  1.00 19.06 ? 229 TYR B CD1  2  
ATOM   3349  C CD2  . TYR B 2 90  ? -8.386  9.064   -3.997  1.00 20.00 ? 229 TYR B CD2  2  
ATOM   3350  C CE1  . TYR B 2 90  ? -10.407 9.720   -5.836  1.00 20.67 ? 229 TYR B CE1  2  
ATOM   3351  C CE2  . TYR B 2 90  ? -9.068  10.287  -3.885  1.00 22.03 ? 229 TYR B CE2  2  
ATOM   3352  C CZ   . TYR B 2 90  ? -10.078 10.616  -4.804  1.00 22.97 ? 229 TYR B CZ   2  
ATOM   3353  O OH   . TYR B 2 90  ? -10.749 11.817  -4.693  1.00 24.81 ? 229 TYR B OH   2  
ATOM   3354  H H    . TYR B 2 90  ? -6.941  4.818   -6.349  1.00 0.00  ? 229 TYR B H    2  
ATOM   3355  H HA   . TYR B 2 90  ? -7.243  7.645   -7.006  1.00 0.00  ? 229 TYR B HA   2  
ATOM   3356  H HB2  . TYR B 2 90  ? -8.679  6.076   -5.418  1.00 0.00  ? 229 TYR B HB2  2  
ATOM   3357  H HB3  . TYR B 2 90  ? -7.517  6.613   -4.206  1.00 0.00  ? 229 TYR B HB3  2  
ATOM   3358  H HD1  . TYR B 2 90  ? -9.977  7.809   -6.742  1.00 0.00  ? 229 TYR B HD1  2  
ATOM   3359  H HD2  . TYR B 2 90  ? -7.608  8.812   -3.291  1.00 0.00  ? 229 TYR B HD2  2  
ATOM   3360  H HE1  . TYR B 2 90  ? -11.184 9.973   -6.543  1.00 0.00  ? 229 TYR B HE1  2  
ATOM   3361  H HE2  . TYR B 2 90  ? -8.815  10.976  -3.091  1.00 0.00  ? 229 TYR B HE2  2  
ATOM   3362  H HH   . TYR B 2 90  ? -10.221 12.492  -5.126  1.00 0.00  ? 229 TYR B HH   2  
ATOM   3363  N N    . TYR B 2 91  ? -5.033  6.771   -4.704  1.00 15.18 ? 230 TYR B N    2  
ATOM   3364  C CA   . TYR B 2 91  ? -3.767  7.240   -4.069  1.00 16.33 ? 230 TYR B CA   2  
ATOM   3365  C C    . TYR B 2 91  ? -2.612  7.116   -5.068  1.00 16.83 ? 230 TYR B C    2  
ATOM   3366  O O    . TYR B 2 91  ? -1.492  7.498   -4.785  1.00 16.71 ? 230 TYR B O    2  
ATOM   3367  C CB   . TYR B 2 91  ? -3.472  6.387   -2.834  1.00 14.52 ? 230 TYR B CB   2  
ATOM   3368  C CG   . TYR B 2 91  ? -4.653  6.440   -1.896  1.00 16.10 ? 230 TYR B CG   2  
ATOM   3369  C CD1  . TYR B 2 91  ? -5.364  7.640   -1.730  1.00 15.88 ? 230 TYR B CD1  2  
ATOM   3370  C CD2  . TYR B 2 91  ? -5.042  5.290   -1.188  1.00 17.17 ? 230 TYR B CD2  2  
ATOM   3371  C CE1  . TYR B 2 91  ? -6.464  7.691   -0.857  1.00 17.12 ? 230 TYR B CE1  2  
ATOM   3372  C CE2  . TYR B 2 91  ? -6.142  5.340   -0.315  1.00 17.84 ? 230 TYR B CE2  2  
ATOM   3373  C CZ   . TYR B 2 91  ? -6.853  6.541   -0.150  1.00 17.32 ? 230 TYR B CZ   2  
ATOM   3374  O OH   . TYR B 2 91  ? -7.933  6.591   0.708   1.00 19.89 ? 230 TYR B OH   2  
ATOM   3375  H H    . TYR B 2 91  ? -5.427  5.913   -4.440  1.00 0.00  ? 230 TYR B H    2  
ATOM   3376  H HA   . TYR B 2 91  ? -3.876  8.273   -3.774  1.00 0.00  ? 230 TYR B HA   2  
ATOM   3377  H HB2  . TYR B 2 91  ? -3.295  5.365   -3.135  1.00 0.00  ? 230 TYR B HB2  2  
ATOM   3378  H HB3  . TYR B 2 91  ? -2.596  6.772   -2.331  1.00 0.00  ? 230 TYR B HB3  2  
ATOM   3379  H HD1  . TYR B 2 91  ? -5.065  8.525   -2.274  1.00 0.00  ? 230 TYR B HD1  2  
ATOM   3380  H HD2  . TYR B 2 91  ? -4.495  4.367   -1.315  1.00 0.00  ? 230 TYR B HD2  2  
ATOM   3381  H HE1  . TYR B 2 91  ? -7.010  8.614   -0.730  1.00 0.00  ? 230 TYR B HE1  2  
ATOM   3382  H HE2  . TYR B 2 91  ? -6.441  4.456   0.228   1.00 0.00  ? 230 TYR B HE2  2  
ATOM   3383  H HH   . TYR B 2 91  ? -7.680  7.111   1.473   1.00 0.00  ? 230 TYR B HH   2  
ATOM   3384  N N    . SER B 2 92  ? -2.869  6.587   -6.235  1.00 17.92 ? 231 SER B N    2  
ATOM   3385  C CA   . SER B 2 92  ? -1.783  6.445   -7.241  1.00 22.15 ? 231 SER B CA   2  
ATOM   3386  C C    . SER B 2 92  ? -1.652  7.742   -8.040  1.00 22.66 ? 231 SER B C    2  
ATOM   3387  O O    . SER B 2 92  ? -0.631  8.009   -8.643  1.00 24.35 ? 231 SER B O    2  
ATOM   3388  C CB   . SER B 2 92  ? -2.114  5.295   -8.193  1.00 21.66 ? 231 SER B CB   2  
ATOM   3389  O OG   . SER B 2 92  ? -1.566  4.088   -7.682  1.00 28.41 ? 231 SER B OG   2  
ATOM   3390  H H    . SER B 2 92  ? -3.774  6.283   -6.449  1.00 0.00  ? 231 SER B H    2  
ATOM   3391  H HA   . SER B 2 92  ? -0.853  6.239   -6.736  1.00 0.00  ? 231 SER B HA   2  
ATOM   3392  H HB2  . SER B 2 92  ? -3.183  5.192   -8.277  1.00 0.00  ? 231 SER B HB2  2  
ATOM   3393  H HB3  . SER B 2 92  ? -1.699  5.508   -9.169  1.00 0.00  ? 231 SER B HB3  2  
ATOM   3394  H HG   . SER B 2 92  ? -0.634  4.066   -7.911  1.00 0.00  ? 231 SER B HG   2  
ATOM   3395  N N    . LYS B 2 93  ? -2.675  8.551   -8.055  1.00 24.70 ? 232 LYS B N    2  
ATOM   3396  C CA   . LYS B 2 93  ? -2.600  9.825   -8.821  1.00 27.78 ? 232 LYS B CA   2  
ATOM   3397  C C    . LYS B 2 93  ? -2.859  11.010  -7.888  1.00 29.48 ? 232 LYS B C    2  
ATOM   3398  O O    . LYS B 2 93  ? -2.661  12.152  -8.253  1.00 31.78 ? 232 LYS B O    2  
ATOM   3399  C CB   . LYS B 2 93  ? -3.649  9.814   -9.930  1.00 28.95 ? 232 LYS B CB   2  
ATOM   3400  C CG   . LYS B 2 93  ? -3.106  9.052   -11.140 1.00 35.04 ? 232 LYS B CG   2  
ATOM   3401  C CD   . LYS B 2 93  ? -3.269  9.906   -12.400 1.00 42.20 ? 232 LYS B CD   2  
ATOM   3402  C CE   . LYS B 2 93  ? -2.275  11.068  -12.362 1.00 46.43 ? 232 LYS B CE   2  
ATOM   3403  N NZ   . LYS B 2 93  ? -3.011  12.356  -12.501 1.00 50.42 ? 232 LYS B NZ   2  
ATOM   3404  H H    . LYS B 2 93  ? -3.492  8.319   -7.564  1.00 0.00  ? 232 LYS B H    2  
ATOM   3405  H HA   . LYS B 2 93  ? -1.622  9.920   -9.260  1.00 0.00  ? 232 LYS B HA   2  
ATOM   3406  H HB2  . LYS B 2 93  ? -4.541  9.332   -9.570  1.00 0.00  ? 232 LYS B HB2  2  
ATOM   3407  H HB3  . LYS B 2 93  ? -3.876  10.829  -10.218 1.00 0.00  ? 232 LYS B HB3  2  
ATOM   3408  H HG2  . LYS B 2 93  ? -2.059  8.832   -10.987 1.00 0.00  ? 232 LYS B HG2  2  
ATOM   3409  H HG3  . LYS B 2 93  ? -3.653  8.130   -11.260 1.00 0.00  ? 232 LYS B HG3  2  
ATOM   3410  H HD2  . LYS B 2 93  ? -3.081  9.298   -13.273 1.00 0.00  ? 232 LYS B HD2  2  
ATOM   3411  H HD3  . LYS B 2 93  ? -4.274  10.296  -12.442 1.00 0.00  ? 232 LYS B HD3  2  
ATOM   3412  H HE2  . LYS B 2 93  ? -1.743  11.057  -11.422 1.00 0.00  ? 232 LYS B HE2  2  
ATOM   3413  H HE3  . LYS B 2 93  ? -1.571  10.966  -13.175 1.00 0.00  ? 232 LYS B HE3  2  
ATOM   3414  H HZ1  . LYS B 2 93  ? -3.797  12.381  -11.823 1.00 0.00  ? 232 LYS B HZ1  2  
ATOM   3415  H HZ2  . LYS B 2 93  ? -2.365  13.147  -12.309 1.00 0.00  ? 232 LYS B HZ2  2  
ATOM   3416  H HZ3  . LYS B 2 93  ? -3.384  12.439  -13.469 1.00 0.00  ? 232 LYS B HZ3  2  
ATOM   3417  N N    . HIS B 2 94  ? -3.300  10.753  -6.687  1.00 31.24 ? 233 HIS B N    2  
ATOM   3418  C CA   . HIS B 2 94  ? -3.567  11.871  -5.739  1.00 31.51 ? 233 HIS B CA   2  
ATOM   3419  C C    . HIS B 2 94  ? -3.170  11.449  -4.324  1.00 28.20 ? 233 HIS B C    2  
ATOM   3420  O O    . HIS B 2 94  ? -3.924  10.802  -3.624  1.00 29.72 ? 233 HIS B O    2  
ATOM   3421  C CB   . HIS B 2 94  ? -5.056  12.220  -5.768  1.00 33.74 ? 233 HIS B CB   2  
ATOM   3422  C CG   . HIS B 2 94  ? -5.267  13.453  -6.603  1.00 39.30 ? 233 HIS B CG   2  
ATOM   3423  N ND1  . HIS B 2 94  ? -4.903  14.715  -6.163  1.00 40.06 ? 233 HIS B ND1  2  
ATOM   3424  C CD2  . HIS B 2 94  ? -5.805  13.633  -7.854  1.00 39.81 ? 233 HIS B CD2  2  
ATOM   3425  C CE1  . HIS B 2 94  ? -5.221  15.591  -7.134  1.00 41.81 ? 233 HIS B CE1  2  
ATOM   3426  N NE2  . HIS B 2 94  ? -5.775  14.983  -8.187  1.00 42.50 ? 233 HIS B NE2  2  
ATOM   3427  H H    . HIS B 2 94  ? -3.455  9.827   -6.408  1.00 0.00  ? 233 HIS B H    2  
ATOM   3428  H HA   . HIS B 2 94  ? -2.991  12.736  -6.033  1.00 0.00  ? 233 HIS B HA   2  
ATOM   3429  H HB2  . HIS B 2 94  ? -5.611  11.397  -6.193  1.00 0.00  ? 233 HIS B HB2  2  
ATOM   3430  H HB3  . HIS B 2 94  ? -5.401  12.405  -4.762  1.00 0.00  ? 233 HIS B HB3  2  
ATOM   3431  H HD1  . HIS B 2 94  ? -4.487  14.931  -5.302  1.00 0.00  ? 233 HIS B HD1  2  
ATOM   3432  H HD2  . HIS B 2 94  ? -6.192  12.846  -8.484  1.00 0.00  ? 233 HIS B HD2  2  
ATOM   3433  H HE1  . HIS B 2 94  ? -5.051  16.656  -7.069  1.00 0.00  ? 233 HIS B HE1  2  
ATOM   3434  N N    . ALA B 2 95  ? -1.993  11.814  -3.898  1.00 24.22 ? 234 ALA B N    2  
ATOM   3435  C CA   . ALA B 2 95  ? -1.547  11.436  -2.527  1.00 22.83 ? 234 ALA B CA   2  
ATOM   3436  C C    . ALA B 2 95  ? -2.627  11.826  -1.516  1.00 24.43 ? 234 ALA B C    2  
ATOM   3437  O O    . ALA B 2 95  ? -2.916  11.098  -0.589  1.00 23.70 ? 234 ALA B O    2  
ATOM   3438  C CB   . ALA B 2 95  ? -0.246  12.172  -2.194  1.00 19.43 ? 234 ALA B CB   2  
ATOM   3439  H H    . ALA B 2 95  ? -1.403  12.337  -4.478  1.00 0.00  ? 234 ALA B H    2  
ATOM   3440  H HA   . ALA B 2 95  ? -1.379  10.370  -2.483  1.00 0.00  ? 234 ALA B HA   2  
ATOM   3441  H HB1  . ALA B 2 95  ? -0.112  12.993  -2.881  1.00 0.00  ? 234 ALA B HB1  2  
ATOM   3442  H HB2  . ALA B 2 95  ? -0.296  12.552  -1.185  1.00 0.00  ? 234 ALA B HB2  2  
ATOM   3443  H HB3  . ALA B 2 95  ? 0.585   11.489  -2.281  1.00 0.00  ? 234 ALA B HB3  2  
ATOM   3444  N N    . ASP B 2 96  ? -3.226  12.972  -1.689  1.00 27.21 ? 235 ASP B N    2  
ATOM   3445  C CA   . ASP B 2 96  ? -4.287  13.410  -0.740  1.00 29.29 ? 235 ASP B CA   2  
ATOM   3446  C C    . ASP B 2 96  ? -3.725  13.426  0.683   1.00 28.86 ? 235 ASP B C    2  
ATOM   3447  O O    . ASP B 2 96  ? -4.368  12.996  1.620   1.00 29.80 ? 235 ASP B O    2  
ATOM   3448  C CB   . ASP B 2 96  ? -5.466  12.437  -0.811  1.00 35.17 ? 235 ASP B CB   2  
ATOM   3449  C CG   . ASP B 2 96  ? -6.751  13.215  -1.102  1.00 40.61 ? 235 ASP B CG   2  
ATOM   3450  O OD1  . ASP B 2 96  ? -6.928  14.269  -0.514  1.00 46.14 ? 235 ASP B OD1  2  
ATOM   3451  O OD2  . ASP B 2 96  ? -7.536  12.743  -1.908  1.00 45.11 ? 235 ASP B OD2  2  
ATOM   3452  H H    . ASP B 2 96  ? -2.979  13.546  -2.445  1.00 0.00  ? 235 ASP B H    2  
ATOM   3453  H HA   . ASP B 2 96  ? -4.622  14.401  -1.006  1.00 0.00  ? 235 ASP B HA   2  
ATOM   3454  H HB2  . ASP B 2 96  ? -5.293  11.719  -1.599  1.00 0.00  ? 235 ASP B HB2  2  
ATOM   3455  H HB3  . ASP B 2 96  ? -5.566  11.921  0.132   1.00 0.00  ? 235 ASP B HB3  2  
ATOM   3456  N N    . GLY B 2 97  ? -2.530  13.922  0.854   1.00 27.14 ? 236 GLY B N    2  
ATOM   3457  C CA   . GLY B 2 97  ? -1.929  13.967  2.216   1.00 25.64 ? 236 GLY B CA   2  
ATOM   3458  C C    . GLY B 2 97  ? -1.298  12.613  2.547   1.00 24.14 ? 236 GLY B C    2  
ATOM   3459  O O    . GLY B 2 97  ? -0.946  12.342  3.678   1.00 24.47 ? 236 GLY B O    2  
ATOM   3460  H H    . GLY B 2 97  ? -2.028  14.265  0.085   1.00 0.00  ? 236 GLY B H    2  
ATOM   3461  H HA2  . GLY B 2 97  ? -1.172  14.737  2.250   1.00 0.00  ? 236 GLY B HA2  2  
ATOM   3462  H HA3  . GLY B 2 97  ? -2.698  14.188  2.941   1.00 0.00  ? 236 GLY B HA3  2  
ATOM   3463  N N    . LEU B 2 98  ? -1.150  11.759  1.571   1.00 20.92 ? 237 LEU B N    2  
ATOM   3464  C CA   . LEU B 2 98  ? -0.540  10.426  1.836   1.00 19.13 ? 237 LEU B CA   2  
ATOM   3465  C C    . LEU B 2 98  ? 0.980   10.570  1.914   1.00 18.42 ? 237 LEU B C    2  
ATOM   3466  O O    . LEU B 2 98  ? 1.519   11.649  1.774   1.00 19.85 ? 237 LEU B O    2  
ATOM   3467  C CB   . LEU B 2 98  ? -0.902  9.462   0.704   1.00 19.72 ? 237 LEU B CB   2  
ATOM   3468  C CG   . LEU B 2 98  ? -2.133  8.646   1.103   1.00 21.67 ? 237 LEU B CG   2  
ATOM   3469  C CD1  . LEU B 2 98  ? -2.987  8.373   -0.135  1.00 17.09 ? 237 LEU B CD1  2  
ATOM   3470  C CD2  . LEU B 2 98  ? -1.686  7.318   1.717   1.00 22.76 ? 237 LEU B CD2  2  
ATOM   3471  H H    . LEU B 2 98  ? -1.440  11.994  0.665   1.00 0.00  ? 237 LEU B H    2  
ATOM   3472  H HA   . LEU B 2 98  ? -0.913  10.039  2.771   1.00 0.00  ? 237 LEU B HA   2  
ATOM   3473  H HB2  . LEU B 2 98  ? -1.114  10.024  -0.193  1.00 0.00  ? 237 LEU B HB2  2  
ATOM   3474  H HB3  . LEU B 2 98  ? -0.073  8.793   0.523   1.00 0.00  ? 237 LEU B HB3  2  
ATOM   3475  H HG   . LEU B 2 98  ? -2.714  9.202   1.825   1.00 0.00  ? 237 LEU B HG   2  
ATOM   3476  H HD11 . LEU B 2 98  ? -2.538  8.846   -0.996  1.00 0.00  ? 237 LEU B HD11 2  
ATOM   3477  H HD12 . LEU B 2 98  ? -3.049  7.307   -0.302  1.00 0.00  ? 237 LEU B HD12 2  
ATOM   3478  H HD13 . LEU B 2 98  ? -3.980  8.771   0.017   1.00 0.00  ? 237 LEU B HD13 2  
ATOM   3479  H HD21 . LEU B 2 98  ? -0.879  6.904   1.132   1.00 0.00  ? 237 LEU B HD21 2  
ATOM   3480  H HD22 . LEU B 2 98  ? -1.348  7.485   2.729   1.00 0.00  ? 237 LEU B HD22 2  
ATOM   3481  H HD23 . LEU B 2 98  ? -2.517  6.627   1.724   1.00 0.00  ? 237 LEU B HD23 2  
ATOM   3482  N N    . CYS B 2 99  ? 1.676   9.489   2.136   1.00 18.29 ? 238 CYS B N    2  
ATOM   3483  C CA   . CYS B 2 99  ? 3.159   9.564   2.223   1.00 17.21 ? 238 CYS B CA   2  
ATOM   3484  C C    . CYS B 2 99  ? 3.720   10.091  0.901   1.00 18.80 ? 238 CYS B C    2  
ATOM   3485  O O    . CYS B 2 99  ? 4.667   10.850  0.877   1.00 19.09 ? 238 CYS B O    2  
ATOM   3486  C CB   . CYS B 2 99  ? 3.724   8.169   2.498   1.00 17.49 ? 238 CYS B CB   2  
ATOM   3487  S SG   . CYS B 2 99  ? 3.347   7.079   1.103   1.00 18.25 ? 238 CYS B SG   2  
ATOM   3488  H H    . CYS B 2 99  ? 1.222   8.627   2.246   1.00 0.00  ? 238 CYS B H    2  
ATOM   3489  H HA   . CYS B 2 99  ? 3.440   10.232  3.025   1.00 0.00  ? 238 CYS B HA   2  
ATOM   3490  H HB2  . CYS B 2 99  ? 4.794   8.233   2.627   1.00 0.00  ? 238 CYS B HB2  2  
ATOM   3491  H HB3  . CYS B 2 99  ? 3.277   7.772   3.397   1.00 0.00  ? 238 CYS B HB3  2  
ATOM   3492  H HG   . CYS B 2 99  ? 4.112   7.066   0.522   1.00 0.00  ? 238 CYS B HG   2  
ATOM   3493  N N    . HIS B 2 100 ? 3.140   9.695   -0.201  1.00 17.96 ? 239 HIS B N    2  
ATOM   3494  C CA   . HIS B 2 100 ? 3.641   10.176  -1.521  1.00 18.41 ? 239 HIS B CA   2  
ATOM   3495  C C    . HIS B 2 100 ? 2.837   9.521   -2.646  1.00 18.79 ? 239 HIS B C    2  
ATOM   3496  O O    . HIS B 2 100 ? 2.524   8.348   -2.598  1.00 19.28 ? 239 HIS B O    2  
ATOM   3497  C CB   . HIS B 2 100 ? 5.118   9.803   -1.672  1.00 18.77 ? 239 HIS B CB   2  
ATOM   3498  C CG   . HIS B 2 100 ? 5.808   10.826  -2.532  1.00 18.40 ? 239 HIS B CG   2  
ATOM   3499  N ND1  . HIS B 2 100 ? 5.488   11.005  -3.869  1.00 18.53 ? 239 HIS B ND1  2  
ATOM   3500  C CD2  . HIS B 2 100 ? 6.801   11.732  -2.260  1.00 19.51 ? 239 HIS B CD2  2  
ATOM   3501  C CE1  . HIS B 2 100 ? 6.276   11.986  -4.347  1.00 19.04 ? 239 HIS B CE1  2  
ATOM   3502  N NE2  . HIS B 2 100 ? 7.095   12.464  -3.408  1.00 20.02 ? 239 HIS B NE2  2  
ATOM   3503  H H    . HIS B 2 100 ? 2.374   9.084   -0.160  1.00 0.00  ? 239 HIS B H    2  
ATOM   3504  H HA   . HIS B 2 100 ? 3.534   11.249  -1.578  1.00 0.00  ? 239 HIS B HA   2  
ATOM   3505  H HB2  . HIS B 2 100 ? 5.586   9.775   -0.701  1.00 0.00  ? 239 HIS B HB2  2  
ATOM   3506  H HB3  . HIS B 2 100 ? 5.197   8.832   -2.138  1.00 0.00  ? 239 HIS B HB3  2  
ATOM   3507  H HD1  . HIS B 2 100 ? 4.810   10.508  -4.374  1.00 0.00  ? 239 HIS B HD1  2  
ATOM   3508  H HD2  . HIS B 2 100 ? 7.282   11.859  -1.301  1.00 0.00  ? 239 HIS B HD2  2  
ATOM   3509  H HE1  . HIS B 2 100 ? 6.249   12.342  -5.366  1.00 0.00  ? 239 HIS B HE1  2  
ATOM   3510  N N    . ARG B 2 101 ? 2.505   10.268  -3.664  1.00 19.17 ? 240 ARG B N    2  
ATOM   3511  C CA   . ARG B 2 101 ? 1.728   9.688   -4.795  1.00 20.76 ? 240 ARG B CA   2  
ATOM   3512  C C    . ARG B 2 101 ? 2.444   8.439   -5.310  1.00 18.50 ? 240 ARG B C    2  
ATOM   3513  O O    . ARG B 2 101 ? 3.639   8.443   -5.523  1.00 17.06 ? 240 ARG B O    2  
ATOM   3514  C CB   . ARG B 2 101 ? 1.630   10.716  -5.923  1.00 25.30 ? 240 ARG B CB   2  
ATOM   3515  C CG   . ARG B 2 101 ? 0.548   10.288  -6.916  1.00 30.23 ? 240 ARG B CG   2  
ATOM   3516  C CD   . ARG B 2 101 ? -0.084  11.532  -7.539  1.00 37.22 ? 240 ARG B CD   2  
ATOM   3517  N NE   . ARG B 2 101 ? 0.973   12.549  -7.800  1.00 43.41 ? 240 ARG B NE   2  
ATOM   3518  C CZ   . ARG B 2 101 ? 1.663   12.507  -8.906  1.00 45.15 ? 240 ARG B CZ   2  
ATOM   3519  N NH1  . ARG B 2 101 ? 2.355   11.440  -9.203  1.00 46.15 ? 240 ARG B NH1  2  
ATOM   3520  N NH2  . ARG B 2 101 ? 1.663   13.530  -9.716  1.00 46.50 ? 240 ARG B NH2  2  
ATOM   3521  H H    . ARG B 2 101 ? 2.771   11.212  -3.685  1.00 0.00  ? 240 ARG B H    2  
ATOM   3522  H HA   . ARG B 2 101 ? 0.736   9.426   -4.458  1.00 0.00  ? 240 ARG B HA   2  
ATOM   3523  H HB2  . ARG B 2 101 ? 1.378   11.681  -5.508  1.00 0.00  ? 240 ARG B HB2  2  
ATOM   3524  H HB3  . ARG B 2 101 ? 2.580   10.781  -6.434  1.00 0.00  ? 240 ARG B HB3  2  
ATOM   3525  H HG2  . ARG B 2 101 ? 0.990   9.679   -7.692  1.00 0.00  ? 240 ARG B HG2  2  
ATOM   3526  H HG3  . ARG B 2 101 ? -0.212  9.719   -6.401  1.00 0.00  ? 240 ARG B HG3  2  
ATOM   3527  H HD2  . ARG B 2 101 ? -0.563  11.264  -8.469  1.00 0.00  ? 240 ARG B HD2  2  
ATOM   3528  H HD3  . ARG B 2 101 ? -0.818  11.940  -6.861  1.00 0.00  ? 240 ARG B HD3  2  
ATOM   3529  H HE   . ARG B 2 101 ? 1.150   13.251  -7.139  1.00 0.00  ? 240 ARG B HE   2  
ATOM   3530  H HH11 . ARG B 2 101 ? 2.354   10.655  -8.584  1.00 0.00  ? 240 ARG B HH11 2  
ATOM   3531  H HH12 . ARG B 2 101 ? 2.884   11.407  -10.052 1.00 0.00  ? 240 ARG B HH12 2  
ATOM   3532  H HH21 . ARG B 2 101 ? 1.134   14.347  -9.488  1.00 0.00  ? 240 ARG B HH21 2  
ATOM   3533  H HH22 . ARG B 2 101 ? 2.192   13.496  -10.564 1.00 0.00  ? 240 ARG B HH22 2  
ATOM   3534  N N    . LEU B 2 102 ? 1.726   7.368   -5.513  1.00 16.42 ? 241 LEU B N    2  
ATOM   3535  C CA   . LEU B 2 102 ? 2.379   6.127   -6.017  1.00 16.95 ? 241 LEU B CA   2  
ATOM   3536  C C    . LEU B 2 102 ? 3.157   6.448   -7.293  1.00 18.53 ? 241 LEU B C    2  
ATOM   3537  O O    . LEU B 2 102 ? 2.798   7.333   -8.044  1.00 19.32 ? 241 LEU B O    2  
ATOM   3538  C CB   . LEU B 2 102 ? 1.316   5.072   -6.323  1.00 12.02 ? 241 LEU B CB   2  
ATOM   3539  C CG   . LEU B 2 102 ? 0.388   4.908   -5.115  1.00 10.93 ? 241 LEU B CG   2  
ATOM   3540  C CD1  . LEU B 2 102 ? -0.526  3.701   -5.333  1.00 7.07  ? 241 LEU B CD1  2  
ATOM   3541  C CD2  . LEU B 2 102 ? 1.227   4.687   -3.853  1.00 9.30  ? 241 LEU B CD2  2  
ATOM   3542  H H    . LEU B 2 102 ? 0.761   7.382   -5.337  1.00 0.00  ? 241 LEU B H    2  
ATOM   3543  H HA   . LEU B 2 102 ? 3.058   5.748   -5.267  1.00 0.00  ? 241 LEU B HA   2  
ATOM   3544  H HB2  . LEU B 2 102 ? 0.740   5.383   -7.181  1.00 0.00  ? 241 LEU B HB2  2  
ATOM   3545  H HB3  . LEU B 2 102 ? 1.795   4.128   -6.535  1.00 0.00  ? 241 LEU B HB3  2  
ATOM   3546  H HG   . LEU B 2 102 ? -0.213  5.798   -4.999  1.00 0.00  ? 241 LEU B HG   2  
ATOM   3547  H HD11 . LEU B 2 102 ? -0.211  3.166   -6.217  1.00 0.00  ? 241 LEU B HD11 2  
ATOM   3548  H HD12 . LEU B 2 102 ? -0.467  3.046   -4.476  1.00 0.00  ? 241 LEU B HD12 2  
ATOM   3549  H HD13 . LEU B 2 102 ? -1.543  4.038   -5.460  1.00 0.00  ? 241 LEU B HD13 2  
ATOM   3550  H HD21 . LEU B 2 102 ? 2.133   4.159   -4.110  1.00 0.00  ? 241 LEU B HD21 2  
ATOM   3551  H HD22 . LEU B 2 102 ? 1.479   5.642   -3.417  1.00 0.00  ? 241 LEU B HD22 2  
ATOM   3552  H HD23 . LEU B 2 102 ? 0.660   4.105   -3.142  1.00 0.00  ? 241 LEU B HD23 2  
ATOM   3553  N N    . THR B 2 103 ? 4.219   5.736   -7.548  1.00 20.81 ? 242 THR B N    2  
ATOM   3554  C CA   . THR B 2 103 ? 5.017   6.007   -8.777  1.00 20.89 ? 242 THR B CA   2  
ATOM   3555  C C    . THR B 2 103 ? 5.385   4.683   -9.453  1.00 21.74 ? 242 THR B C    2  
ATOM   3556  O O    . THR B 2 103 ? 5.398   4.578   -10.663 1.00 24.76 ? 242 THR B O    2  
ATOM   3557  C CB   . THR B 2 103 ? 6.293   6.761   -8.398  1.00 20.18 ? 242 THR B CB   2  
ATOM   3558  O OG1  . THR B 2 103 ? 7.203   5.865   -7.774  1.00 22.88 ? 242 THR B OG1  2  
ATOM   3559  C CG2  . THR B 2 103 ? 5.948   7.898   -7.435  1.00 19.22 ? 242 THR B CG2  2  
ATOM   3560  H H    . THR B 2 103 ? 4.494   5.027   -6.930  1.00 0.00  ? 242 THR B H    2  
ATOM   3561  H HA   . THR B 2 103 ? 4.433   6.608   -9.458  1.00 0.00  ? 242 THR B HA   2  
ATOM   3562  H HB   . THR B 2 103 ? 6.746   7.172   -9.287  1.00 0.00  ? 242 THR B HB   2  
ATOM   3563  H HG1  . THR B 2 103 ? 7.870   5.622   -8.419  1.00 0.00  ? 242 THR B HG1  2  
ATOM   3564  H HG21 . THR B 2 103 ? 5.455   7.493   -6.563  1.00 0.00  ? 242 THR B HG21 2  
ATOM   3565  H HG22 . THR B 2 103 ? 6.854   8.402   -7.135  1.00 0.00  ? 242 THR B HG22 2  
ATOM   3566  H HG23 . THR B 2 103 ? 5.291   8.599   -7.928  1.00 0.00  ? 242 THR B HG23 2  
ATOM   3567  N N    . THR B 2 104 ? 5.688   3.674   -8.684  1.00 20.71 ? 243 THR B N    2  
ATOM   3568  C CA   . THR B 2 104 ? 6.056   2.363   -9.290  1.00 18.86 ? 243 THR B CA   2  
ATOM   3569  C C    . THR B 2 104 ? 5.642   1.229   -8.350  1.00 18.56 ? 243 THR B C    2  
ATOM   3570  O O    . THR B 2 104 ? 5.156   1.458   -7.259  1.00 18.28 ? 243 THR B O    2  
ATOM   3571  C CB   . THR B 2 104 ? 7.569   2.314   -9.512  1.00 20.42 ? 243 THR B CB   2  
ATOM   3572  O OG1  . THR B 2 104 ? 8.024   3.590   -9.941  1.00 20.70 ? 243 THR B OG1  2  
ATOM   3573  C CG2  . THR B 2 104 ? 7.898   1.267   -10.577 1.00 16.38 ? 243 THR B CG2  2  
ATOM   3574  H H    . THR B 2 104 ? 5.675   3.777   -7.710  1.00 0.00  ? 243 THR B H    2  
ATOM   3575  H HA   . THR B 2 104 ? 5.549   2.250   -10.236 1.00 0.00  ? 243 THR B HA   2  
ATOM   3576  H HB   . THR B 2 104 ? 8.060   2.048   -8.588  1.00 0.00  ? 243 THR B HB   2  
ATOM   3577  H HG1  . THR B 2 104 ? 7.424   3.905   -10.621 1.00 0.00  ? 243 THR B HG1  2  
ATOM   3578  H HG21 . THR B 2 104 ? 7.019   1.071   -11.172 1.00 0.00  ? 243 THR B HG21 2  
ATOM   3579  H HG22 . THR B 2 104 ? 8.688   1.638   -11.213 1.00 0.00  ? 243 THR B HG22 2  
ATOM   3580  H HG23 . THR B 2 104 ? 8.220   0.354   -10.098 1.00 0.00  ? 243 THR B HG23 2  
ATOM   3581  N N    . VAL B 2 105 ? 5.830   0.006   -8.764  1.00 16.29 ? 244 VAL B N    2  
ATOM   3582  C CA   . VAL B 2 105 ? 5.449   -1.144  -7.897  1.00 16.81 ? 244 VAL B CA   2  
ATOM   3583  C C    . VAL B 2 105 ? 6.688   -1.989  -7.601  1.00 16.74 ? 244 VAL B C    2  
ATOM   3584  O O    . VAL B 2 105 ? 7.720   -1.838  -8.226  1.00 17.40 ? 244 VAL B O    2  
ATOM   3585  C CB   . VAL B 2 105 ? 4.411   -2.003  -8.619  1.00 17.29 ? 244 VAL B CB   2  
ATOM   3586  C CG1  . VAL B 2 105 ? 3.687   -2.893  -7.608  1.00 17.99 ? 244 VAL B CG1  2  
ATOM   3587  C CG2  . VAL B 2 105 ? 3.395   -1.096  -9.317  1.00 17.19 ? 244 VAL B CG2  2  
ATOM   3588  H H    . VAL B 2 105 ? 6.224   -0.155  -9.647  1.00 0.00  ? 244 VAL B H    2  
ATOM   3589  H HA   . VAL B 2 105 ? 5.032   -0.777  -6.971  1.00 0.00  ? 244 VAL B HA   2  
ATOM   3590  H HB   . VAL B 2 105 ? 4.905   -2.624  -9.352  1.00 0.00  ? 244 VAL B HB   2  
ATOM   3591  H HG11 . VAL B 2 105 ? 3.358   -2.293  -6.772  1.00 0.00  ? 244 VAL B HG11 2  
ATOM   3592  H HG12 . VAL B 2 105 ? 2.832   -3.352  -8.079  1.00 0.00  ? 244 VAL B HG12 2  
ATOM   3593  H HG13 . VAL B 2 105 ? 4.360   -3.660  -7.257  1.00 0.00  ? 244 VAL B HG13 2  
ATOM   3594  H HG21 . VAL B 2 105 ? 3.272   -0.187  -8.746  1.00 0.00  ? 244 VAL B HG21 2  
ATOM   3595  H HG22 . VAL B 2 105 ? 3.749   -0.853  -10.308 1.00 0.00  ? 244 VAL B HG22 2  
ATOM   3596  H HG23 . VAL B 2 105 ? 2.446   -1.606  -9.389  1.00 0.00  ? 244 VAL B HG23 2  
ATOM   3597  N N    . CYS B 2 106 ? 6.595   -2.881  -6.654  1.00 15.40 ? 245 CYS B N    2  
ATOM   3598  C CA   . CYS B 2 106 ? 7.768   -3.739  -6.320  1.00 16.70 ? 245 CYS B CA   2  
ATOM   3599  C C    . CYS B 2 106 ? 7.319   -5.201  -6.226  1.00 16.64 ? 245 CYS B C    2  
ATOM   3600  O O    . CYS B 2 106 ? 7.347   -5.786  -5.163  1.00 17.47 ? 245 CYS B O    2  
ATOM   3601  C CB   . CYS B 2 106 ? 8.364   -3.300  -4.979  1.00 15.93 ? 245 CYS B CB   2  
ATOM   3602  S SG   . CYS B 2 106 ? 7.030   -2.923  -3.815  1.00 18.24 ? 245 CYS B SG   2  
ATOM   3603  H H    . CYS B 2 106 ? 5.754   -2.988  -6.163  1.00 0.00  ? 245 CYS B H    2  
ATOM   3604  H HA   . CYS B 2 106 ? 8.516   -3.642  -7.095  1.00 0.00  ? 245 CYS B HA   2  
ATOM   3605  H HB2  . CYS B 2 106 ? 8.975   -4.097  -4.580  1.00 0.00  ? 245 CYS B HB2  2  
ATOM   3606  H HB3  . CYS B 2 106 ? 8.973   -2.421  -5.126  1.00 0.00  ? 245 CYS B HB3  2  
ATOM   3607  H HG   . CYS B 2 106 ? 7.425   -2.569  -3.015  1.00 0.00  ? 245 CYS B HG   2  
ATOM   3608  N N    . PRO B 2 107 ? 6.917   -5.749  -7.348  1.00 18.63 ? 246 PRO B N    2  
ATOM   3609  C CA   . PRO B 2 107 ? 6.453   -7.145  -7.425  1.00 19.52 ? 246 PRO B CA   2  
ATOM   3610  C C    . PRO B 2 107 ? 7.648   -8.104  -7.427  1.00 19.33 ? 246 PRO B C    2  
ATOM   3611  O O    . PRO B 2 107 ? 7.836   -8.781  -8.425  1.00 19.97 ? 246 PRO B O    2  
ATOM   3612  C CB   . PRO B 2 107 ? 5.703   -7.203  -8.759  1.00 18.97 ? 246 PRO B CB   2  
ATOM   3613  C CG   . PRO B 2 107 ? 6.251   -6.038  -9.618  1.00 18.88 ? 246 PRO B CG   2  
ATOM   3614  C CD   . PRO B 2 107 ? 6.885   -5.030  -8.641  1.00 17.74 ? 246 PRO B CD   2  
ATOM   3615  O OXT  . PRO B 2 107 ? 8.352   -8.144  -6.433  1.00 0.00  ? 246 PRO B OXT  2  
ATOM   3616  H HA   . PRO B 2 107 ? 5.782   -7.371  -6.612  1.00 0.00  ? 246 PRO B HA   2  
ATOM   3617  H HB2  . PRO B 2 107 ? 5.889   -8.150  -9.247  1.00 0.00  ? 246 PRO B HB2  2  
ATOM   3618  H HB3  . PRO B 2 107 ? 4.645   -7.069  -8.596  1.00 0.00  ? 246 PRO B HB3  2  
ATOM   3619  H HG2  . PRO B 2 107 ? 6.995   -6.408  -10.309 1.00 0.00  ? 246 PRO B HG2  2  
ATOM   3620  H HG3  . PRO B 2 107 ? 5.445   -5.564  -10.157 1.00 0.00  ? 246 PRO B HG3  2  
ATOM   3621  H HD2  . PRO B 2 107 ? 7.886   -4.775  -8.960  1.00 0.00  ? 246 PRO B HD2  2  
ATOM   3622  H HD3  . PRO B 2 107 ? 6.274   -4.145  -8.559  1.00 0.00  ? 246 PRO B HD3  2  
HETATM 3623  C C    . ACE A 1 1   ? 1.108   1.843   12.070  1.00 14.10 ? 100 ACE A C    3  
HETATM 3624  O O    . ACE A 1 1   ? 2.106   2.045   11.406  1.00 14.64 ? 100 ACE A O    3  
HETATM 3625  C CH3  . ACE A 1 1   ? 1.201   1.497   13.557  1.00 14.17 ? 100 ACE A CH3  3  
HETATM 3626  H H1   . ACE A 1 1   ? 0.211   1.312   13.947  1.00 0.00  ? 100 ACE A H1   3  
HETATM 3627  H H2   . ACE A 1 1   ? 1.809   0.612   13.683  1.00 0.00  ? 100 ACE A H2   3  
HETATM 3628  H H3   . ACE A 1 1   ? 1.651   2.321   14.091  1.00 0.00  ? 100 ACE A H3   3  
HETATM 3629  N N    . PTR A 1 2   ? -0.083  1.915   11.541  1.00 14.28 ? 101 PTR A N    3  
HETATM 3630  C CA   . PTR A 1 2   ? -0.238  2.250   10.098  1.00 13.54 ? 101 PTR A CA   3  
HETATM 3631  C C    . PTR A 1 2   ? -0.472  3.754   9.945   1.00 14.12 ? 101 PTR A C    3  
HETATM 3632  O O    . PTR A 1 2   ? -0.954  4.412   10.846  1.00 13.97 ? 101 PTR A O    3  
HETATM 3633  C CB   . PTR A 1 2   ? -1.434  1.488   9.524   1.00 13.83 ? 101 PTR A CB   3  
HETATM 3634  C CG   . PTR A 1 2   ? -1.080  0.026   9.380   1.00 12.91 ? 101 PTR A CG   3  
HETATM 3635  C CD1  . PTR A 1 2   ? -0.443  -0.432  8.214   1.00 12.17 ? 101 PTR A CD1  3  
HETATM 3636  C CD2  . PTR A 1 2   ? -1.388  -0.874  10.413  1.00 12.70 ? 101 PTR A CD2  3  
HETATM 3637  C CE1  . PTR A 1 2   ? -0.115  -1.792  8.082   1.00 12.08 ? 101 PTR A CE1  3  
HETATM 3638  C CE2  . PTR A 1 2   ? -1.060  -2.235  10.281  1.00 11.44 ? 101 PTR A CE2  3  
HETATM 3639  C CZ   . PTR A 1 2   ? -0.423  -2.693  9.115   1.00 13.78 ? 101 PTR A CZ   3  
HETATM 3640  O OH   . PTR A 1 2   ? -0.091  -4.078  8.978   1.00 14.51 ? 101 PTR A OH   3  
HETATM 3641  P P    . PTR A 1 2   ? 1.221   -4.685  9.686   1.00 17.94 ? 101 PTR A P    3  
HETATM 3642  O O1P  . PTR A 1 2   ? 1.483   -5.915  8.905   1.00 18.17 ? 101 PTR A O1P  3  
HETATM 3643  O O2P  . PTR A 1 2   ? 0.776   -4.912  11.080  1.00 15.88 ? 101 PTR A O2P  3  
HETATM 3644  O O3P  . PTR A 1 2   ? 2.225   -3.611  9.517   1.00 18.41 ? 101 PTR A O3P  3  
HETATM 3645  H H    . PTR A 1 2   ? -0.874  1.749   12.093  1.00 0.00  ? 101 PTR A H    3  
HETATM 3646  H HA   . PTR A 1 2   ? 0.658   1.969   9.565   1.00 0.00  ? 101 PTR A HA   3  
HETATM 3647  H HB2  . PTR A 1 2   ? -2.279  1.590   10.189  1.00 0.00  ? 101 PTR A HB2  3  
HETATM 3648  H HB3  . PTR A 1 2   ? -1.688  1.892   8.555   1.00 0.00  ? 101 PTR A HB3  3  
HETATM 3649  H HD1  . PTR A 1 2   ? -0.206  0.260   7.420   1.00 0.00  ? 101 PTR A HD1  3  
HETATM 3650  H HD2  . PTR A 1 2   ? -1.877  -0.522  11.310  1.00 0.00  ? 101 PTR A HD2  3  
HETATM 3651  H HE1  . PTR A 1 2   ? 0.374   -2.145  7.186   1.00 0.00  ? 101 PTR A HE1  3  
HETATM 3652  H HE2  . PTR A 1 2   ? -1.297  -2.928  11.074  1.00 0.00  ? 101 PTR A HE2  3  
ATOM   3653  N N    . GLU A 1 3   ? -0.134  4.304   8.811   1.00 15.01 ? 102 GLU A N    3  
ATOM   3654  C CA   . GLU A 1 3   ? -0.338  5.766   8.602   1.00 18.67 ? 102 GLU A CA   3  
ATOM   3655  C C    . GLU A 1 3   ? -1.709  6.003   7.964   1.00 23.30 ? 102 GLU A C    3  
ATOM   3656  O O    . GLU A 1 3   ? -2.077  5.354   7.004   1.00 23.42 ? 102 GLU A O    3  
ATOM   3657  C CB   . GLU A 1 3   ? 0.756   6.307   7.679   1.00 18.41 ? 102 GLU A CB   3  
ATOM   3658  C CG   . GLU A 1 3   ? 2.128   5.892   8.213   1.00 20.30 ? 102 GLU A CG   3  
ATOM   3659  C CD   . GLU A 1 3   ? 2.246   6.289   9.685   1.00 19.75 ? 102 GLU A CD   3  
ATOM   3660  O OE1  . GLU A 1 3   ? 1.611   5.645   10.505  1.00 19.69 ? 102 GLU A OE1  3  
ATOM   3661  O OE2  . GLU A 1 3   ? 2.968   7.231   9.968   1.00 21.81 ? 102 GLU A OE2  3  
ATOM   3662  H H    . GLU A 1 3   ? 0.252   3.757   8.096   1.00 0.00  ? 102 GLU A H    3  
ATOM   3663  H HA   . GLU A 1 3   ? -0.292  6.276   9.553   1.00 0.00  ? 102 GLU A HA   3  
ATOM   3664  H HB2  . GLU A 1 3   ? 0.618   5.905   6.685   1.00 0.00  ? 102 GLU A HB2  3  
ATOM   3665  H HB3  . GLU A 1 3   ? 0.697   7.384   7.643   1.00 0.00  ? 102 GLU A HB3  3  
ATOM   3666  H HG2  . GLU A 1 3   ? 2.243   4.821   8.117   1.00 0.00  ? 102 GLU A HG2  3  
ATOM   3667  H HG3  . GLU A 1 3   ? 2.901   6.388   7.645   1.00 0.00  ? 102 GLU A HG3  3  
ATOM   3668  N N    . GLU A 1 4   ? -2.469  6.926   8.488   1.00 29.30 ? 103 GLU A N    3  
ATOM   3669  C CA   . GLU A 1 4   ? -3.814  7.201   7.909   1.00 35.63 ? 103 GLU A CA   3  
ATOM   3670  C C    . GLU A 1 4   ? -3.687  8.225   6.780   1.00 37.94 ? 103 GLU A C    3  
ATOM   3671  O O    . GLU A 1 4   ? -2.603  8.641   6.424   1.00 40.44 ? 103 GLU A O    3  
ATOM   3672  C CB   . GLU A 1 4   ? -4.736  7.754   8.999   1.00 38.84 ? 103 GLU A CB   3  
ATOM   3673  C CG   . GLU A 1 4   ? -4.713  6.819   10.210  1.00 44.99 ? 103 GLU A CG   3  
ATOM   3674  C CD   . GLU A 1 4   ? -5.482  5.538   9.880   1.00 50.48 ? 103 GLU A CD   3  
ATOM   3675  O OE1  . GLU A 1 4   ? -6.698  5.601   9.811   1.00 53.04 ? 103 GLU A OE1  3  
ATOM   3676  O OE2  . GLU A 1 4   ? -4.841  4.515   9.703   1.00 53.57 ? 103 GLU A OE2  3  
ATOM   3677  H H    . GLU A 1 4   ? -2.154  7.437   9.262   1.00 0.00  ? 103 GLU A H    3  
ATOM   3678  H HA   . GLU A 1 4   ? -4.231  6.284   7.518   1.00 0.00  ? 103 GLU A HA   3  
ATOM   3679  H HB2  . GLU A 1 4   ? -4.393  8.735   9.295   1.00 0.00  ? 103 GLU A HB2  3  
ATOM   3680  H HB3  . GLU A 1 4   ? -5.743  7.823   8.619   1.00 0.00  ? 103 GLU A HB3  3  
ATOM   3681  H HG2  . GLU A 1 4   ? -3.691  6.573   10.457  1.00 0.00  ? 103 GLU A HG2  3  
ATOM   3682  H HG3  . GLU A 1 4   ? -5.179  7.308   11.052  1.00 0.00  ? 103 GLU A HG3  3  
ATOM   3683  N N    . ILE A 1 5   ? -4.789  8.635   6.213   1.00 39.26 ? 104 ILE A N    3  
ATOM   3684  C CA   . ILE A 1 5   ? -4.733  9.632   5.106   1.00 40.91 ? 104 ILE A CA   3  
ATOM   3685  C C    . ILE A 1 5   ? -5.483  10.899  5.521   1.00 42.72 ? 104 ILE A C    3  
ATOM   3686  O O    . ILE A 1 5   ? -6.524  10.839  6.146   1.00 43.33 ? 104 ILE A O    3  
ATOM   3687  C CB   . ILE A 1 5   ? -5.384  9.040   3.855   1.00 40.30 ? 104 ILE A CB   3  
ATOM   3688  C CG1  . ILE A 1 5   ? -4.719  7.701   3.522   1.00 39.28 ? 104 ILE A CG1  3  
ATOM   3689  C CG2  . ILE A 1 5   ? -5.209  10.002  2.679   1.00 41.44 ? 104 ILE A CG2  3  
ATOM   3690  C CD1  . ILE A 1 5   ? -5.468  7.032   2.367   1.00 37.66 ? 104 ILE A CD1  3  
ATOM   3691  H H    . ILE A 1 5   ? -5.654  8.288   6.514   1.00 0.00  ? 104 ILE A H    3  
ATOM   3692  H HA   . ILE A 1 5   ? -3.703  9.876   4.893   1.00 0.00  ? 104 ILE A HA   3  
ATOM   3693  H HB   . ILE A 1 5   ? -6.438  8.883   4.038   1.00 0.00  ? 104 ILE A HB   3  
ATOM   3694  H HG12 . ILE A 1 5   ? -3.692  7.873   3.235   1.00 0.00  ? 104 ILE A HG12 3  
ATOM   3695  H HG13 . ILE A 1 5   ? -4.749  7.059   4.388   1.00 0.00  ? 104 ILE A HG13 3  
ATOM   3696  H HG21 . ILE A 1 5   ? -4.501  10.772  2.947   1.00 0.00  ? 104 ILE A HG21 3  
ATOM   3697  H HG22 . ILE A 1 5   ? -4.844  9.459   1.821   1.00 0.00  ? 104 ILE A HG22 3  
ATOM   3698  H HG23 . ILE A 1 5   ? -6.160  10.456  2.441   1.00 0.00  ? 104 ILE A HG23 3  
ATOM   3699  H HD11 . ILE A 1 5   ? -5.767  7.782   1.650   1.00 0.00  ? 104 ILE A HD11 3  
ATOM   3700  H HD12 . ILE A 1 5   ? -4.821  6.313   1.887   1.00 0.00  ? 104 ILE A HD12 3  
ATOM   3701  H HD13 . ILE A 1 5   ? -6.343  6.529   2.750   1.00 0.00  ? 104 ILE A HD13 3  
ATOM   3702  N N    . GLU A 1 6   ? -4.965  12.047  5.178   1.00 0.00  ? 105 GLU A N    3  
ATOM   3703  C CA   . GLU A 1 6   ? -5.650  13.315  5.555   1.00 0.00  ? 105 GLU A CA   3  
ATOM   3704  C C    . GLU A 1 6   ? -5.622  14.281  4.368   1.00 0.00  ? 105 GLU A C    3  
ATOM   3705  O O    . GLU A 1 6   ? -6.469  14.147  3.500   1.00 0.00  ? 105 GLU A O    3  
ATOM   3706  C CB   . GLU A 1 6   ? -4.929  13.950  6.746   1.00 0.00  ? 105 GLU A CB   3  
ATOM   3707  C CG   . GLU A 1 6   ? -5.209  13.130  8.007   1.00 0.00  ? 105 GLU A CG   3  
ATOM   3708  C CD   . GLU A 1 6   ? -5.277  14.064  9.217   1.00 0.00  ? 105 GLU A CD   3  
ATOM   3709  O OE1  . GLU A 1 6   ? -5.319  15.266  9.012   1.00 0.00  ? 105 GLU A OE1  3  
ATOM   3710  O OE2  . GLU A 1 6   ? -5.285  13.561  10.329  1.00 0.00  ? 105 GLU A OE2  3  
ATOM   3711  O OXT  . GLU A 1 6   ? -4.756  15.139  4.348   1.00 0.00  ? 105 GLU A OXT  3  
ATOM   3712  H H    . GLU A 1 6   ? -4.125  12.074  4.674   1.00 0.00  ? 105 GLU A H    3  
ATOM   3713  H HA   . GLU A 1 6   ? -6.674  13.104  5.824   1.00 0.00  ? 105 GLU A HA   3  
ATOM   3714  H HB2  . GLU A 1 6   ? -3.866  13.967  6.554   1.00 0.00  ? 105 GLU A HB2  3  
ATOM   3715  H HB3  . GLU A 1 6   ? -5.287  14.959  6.887   1.00 0.00  ? 105 GLU A HB3  3  
ATOM   3716  H HG2  . GLU A 1 6   ? -6.151  12.612  7.898   1.00 0.00  ? 105 GLU A HG2  3  
ATOM   3717  H HG3  . GLU A 1 6   ? -4.417  12.411  8.153   1.00 0.00  ? 105 GLU A HG3  3  
ATOM   3718  N N    . MET B 2 1   ? -7.649  -8.817  -19.197 1.00 0.00  ? 140 MET B N    3  
ATOM   3719  C CA   . MET B 2 1   ? -7.138  -8.726  -17.799 1.00 0.00  ? 140 MET B CA   3  
ATOM   3720  C C    . MET B 2 1   ? -8.311  -8.824  -16.822 1.00 0.00  ? 140 MET B C    3  
ATOM   3721  O O    . MET B 2 1   ? -9.302  -8.136  -16.957 1.00 0.00  ? 140 MET B O    3  
ATOM   3722  C CB   . MET B 2 1   ? -6.421  -7.390  -17.604 1.00 0.00  ? 140 MET B CB   3  
ATOM   3723  C CG   . MET B 2 1   ? -5.082  -7.415  -18.343 1.00 0.00  ? 140 MET B CG   3  
ATOM   3724  S SD   . MET B 2 1   ? -4.782  -5.801  -19.105 1.00 0.00  ? 140 MET B SD   3  
ATOM   3725  C CE   . MET B 2 1   ? -3.226  -6.223  -19.928 1.00 0.00  ? 140 MET B CE   3  
ATOM   3726  H H1   . MET B 2 1   ? -8.535  -8.281  -19.278 1.00 0.00  ? 140 MET B H1   3  
ATOM   3727  H H2   . MET B 2 1   ? -6.945  -8.419  -19.850 1.00 0.00  ? 140 MET B H2   3  
ATOM   3728  H H3   . MET B 2 1   ? -7.822  -9.814  -19.438 1.00 0.00  ? 140 MET B H3   3  
ATOM   3729  H HA   . MET B 2 1   ? -6.448  -9.537  -17.615 1.00 0.00  ? 140 MET B HA   3  
ATOM   3730  H HB2  . MET B 2 1   ? -7.035  -6.591  -17.996 1.00 0.00  ? 140 MET B HB2  3  
ATOM   3731  H HB3  . MET B 2 1   ? -6.246  -7.225  -16.551 1.00 0.00  ? 140 MET B HB3  3  
ATOM   3732  H HG2  . MET B 2 1   ? -4.288  -7.637  -17.644 1.00 0.00  ? 140 MET B HG2  3  
ATOM   3733  H HG3  . MET B 2 1   ? -5.108  -8.176  -19.110 1.00 0.00  ? 140 MET B HG3  3  
ATOM   3734  H HE1  . MET B 2 1   ? -3.289  -7.227  -20.323 1.00 0.00  ? 140 MET B HE1  3  
ATOM   3735  H HE2  . MET B 2 1   ? -3.046  -5.532  -20.736 1.00 0.00  ? 140 MET B HE2  3  
ATOM   3736  H HE3  . MET B 2 1   ? -2.415  -6.159  -19.216 1.00 0.00  ? 140 MET B HE3  3  
ATOM   3737  N N    . ASP B 2 2   ? -8.207  -9.676  -15.838 1.00 0.00  ? 141 ASP B N    3  
ATOM   3738  C CA   . ASP B 2 2   ? -9.316  -9.817  -14.854 1.00 0.00  ? 141 ASP B CA   3  
ATOM   3739  C C    . ASP B 2 2   ? -8.916  -10.824 -13.773 1.00 0.00  ? 141 ASP B C    3  
ATOM   3740  O O    . ASP B 2 2   ? -9.665  -11.721 -13.440 1.00 0.00  ? 141 ASP B O    3  
ATOM   3741  C CB   . ASP B 2 2   ? -10.574 -10.311 -15.571 1.00 0.00  ? 141 ASP B CB   3  
ATOM   3742  C CG   . ASP B 2 2   ? -11.745 -10.341 -14.586 1.00 0.00  ? 141 ASP B CG   3  
ATOM   3743  O OD1  . ASP B 2 2   ? -11.677 -9.633  -13.595 1.00 0.00  ? 141 ASP B OD1  3  
ATOM   3744  O OD2  . ASP B 2 2   ? -12.687 -11.072 -14.839 1.00 0.00  ? 141 ASP B OD2  3  
ATOM   3745  H H    . ASP B 2 2   ? -7.399  -10.223 -15.747 1.00 0.00  ? 141 ASP B H    3  
ATOM   3746  H HA   . ASP B 2 2   ? -9.515  -8.859  -14.396 1.00 0.00  ? 141 ASP B HA   3  
ATOM   3747  H HB2  . ASP B 2 2   ? -10.808 -9.644  -16.388 1.00 0.00  ? 141 ASP B HB2  3  
ATOM   3748  H HB3  . ASP B 2 2   ? -10.403 -11.306 -15.954 1.00 0.00  ? 141 ASP B HB3  3  
ATOM   3749  N N    . SER B 2 3   ? -7.741  -10.683 -13.225 1.00 0.00  ? 142 SER B N    3  
ATOM   3750  C CA   . SER B 2 3   ? -7.293  -11.632 -12.166 1.00 0.00  ? 142 SER B CA   3  
ATOM   3751  C C    . SER B 2 3   ? -6.545  -10.864 -11.075 1.00 0.00  ? 142 SER B C    3  
ATOM   3752  O O    . SER B 2 3   ? -5.399  -10.493 -11.239 1.00 0.00  ? 142 SER B O    3  
ATOM   3753  C CB   . SER B 2 3   ? -6.365  -12.680 -12.780 1.00 0.00  ? 142 SER B CB   3  
ATOM   3754  O OG   . SER B 2 3   ? -6.256  -12.449 -14.179 1.00 0.00  ? 142 SER B OG   3  
ATOM   3755  H H    . SER B 2 3   ? -7.152  -9.952  -13.508 1.00 0.00  ? 142 SER B H    3  
ATOM   3756  H HA   . SER B 2 3   ? -8.154  -12.123 -11.736 1.00 0.00  ? 142 SER B HA   3  
ATOM   3757  H HB2  . SER B 2 3   ? -5.388  -12.607 -12.332 1.00 0.00  ? 142 SER B HB2  3  
ATOM   3758  H HB3  . SER B 2 3   ? -6.768  -13.668 -12.599 1.00 0.00  ? 142 SER B HB3  3  
ATOM   3759  H HG   . SER B 2 3   ? -6.924  -12.979 -14.620 1.00 0.00  ? 142 SER B HG   3  
ATOM   3760  N N    . ILE B 2 4   ? -7.183  -10.622 -9.964  1.00 0.00  ? 143 ILE B N    3  
ATOM   3761  C CA   . ILE B 2 4   ? -6.507  -9.878  -8.864  1.00 0.00  ? 143 ILE B CA   3  
ATOM   3762  C C    . ILE B 2 4   ? -5.442  -10.770 -8.224  1.00 0.00  ? 143 ILE B C    3  
ATOM   3763  O O    . ILE B 2 4   ? -4.480  -10.295 -7.654  1.00 0.00  ? 143 ILE B O    3  
ATOM   3764  C CB   . ILE B 2 4   ? -7.539  -9.478  -7.808  1.00 0.00  ? 143 ILE B CB   3  
ATOM   3765  C CG1  . ILE B 2 4   ? -6.859  -8.630  -6.730  1.00 0.00  ? 143 ILE B CG1  3  
ATOM   3766  C CG2  . ILE B 2 4   ? -8.131  -10.736 -7.169  1.00 0.00  ? 143 ILE B CG2  3  
ATOM   3767  C CD1  . ILE B 2 4   ? -7.912  -7.802  -5.992  1.00 0.00  ? 143 ILE B CD1  3  
ATOM   3768  H H    . ILE B 2 4   ? -8.107  -10.929 -9.852  1.00 0.00  ? 143 ILE B H    3  
ATOM   3769  H HA   . ILE B 2 4   ? -6.039  -8.990  -9.265  1.00 0.00  ? 143 ILE B HA   3  
ATOM   3770  H HB   . ILE B 2 4   ? -8.328  -8.906  -8.275  1.00 0.00  ? 143 ILE B HB   3  
ATOM   3771  H HG12 . ILE B 2 4   ? -6.353  -9.279  -6.029  1.00 0.00  ? 143 ILE B HG12 3  
ATOM   3772  H HG13 . ILE B 2 4   ? -6.142  -7.969  -7.190  1.00 0.00  ? 143 ILE B HG13 3  
ATOM   3773  H HG21 . ILE B 2 4   ? -8.029  -11.568 -7.851  1.00 0.00  ? 143 ILE B HG21 3  
ATOM   3774  H HG22 . ILE B 2 4   ? -7.605  -10.956 -6.252  1.00 0.00  ? 143 ILE B HG22 3  
ATOM   3775  H HG23 . ILE B 2 4   ? -9.176  -10.573 -6.955  1.00 0.00  ? 143 ILE B HG23 3  
ATOM   3776  H HD11 . ILE B 2 4   ? -8.804  -7.733  -6.597  1.00 0.00  ? 143 ILE B HD11 3  
ATOM   3777  H HD12 . ILE B 2 4   ? -8.152  -8.279  -5.052  1.00 0.00  ? 143 ILE B HD12 3  
ATOM   3778  H HD13 . ILE B 2 4   ? -7.525  -6.812  -5.804  1.00 0.00  ? 143 ILE B HD13 3  
ATOM   3779  N N    . GLN B 2 5   ? -5.603  -12.062 -8.316  1.00 0.00  ? 144 GLN B N    3  
ATOM   3780  C CA   . GLN B 2 5   ? -4.599  -12.983 -7.714  1.00 0.00  ? 144 GLN B CA   3  
ATOM   3781  C C    . GLN B 2 5   ? -3.238  -12.757 -8.376  1.00 0.00  ? 144 GLN B C    3  
ATOM   3782  O O    . GLN B 2 5   ? -2.214  -13.169 -7.868  1.00 0.00  ? 144 GLN B O    3  
ATOM   3783  C CB   . GLN B 2 5   ? -5.040  -14.433 -7.934  1.00 0.00  ? 144 GLN B CB   3  
ATOM   3784  C CG   . GLN B 2 5   ? -5.228  -14.689 -9.431  1.00 0.00  ? 144 GLN B CG   3  
ATOM   3785  C CD   . GLN B 2 5   ? -6.635  -15.235 -9.683  1.00 0.00  ? 144 GLN B CD   3  
ATOM   3786  O OE1  . GLN B 2 5   ? -7.481  -15.192 -8.812  1.00 0.00  ? 144 GLN B OE1  3  
ATOM   3787  N NE2  . GLN B 2 5   ? -6.922  -15.751 -10.846 1.00 0.00  ? 144 GLN B NE2  3  
ATOM   3788  H H    . GLN B 2 5   ? -6.386  -12.426 -8.782  1.00 0.00  ? 144 GLN B H    3  
ATOM   3789  H HA   . GLN B 2 5   ? -4.521  -12.788 -6.655  1.00 0.00  ? 144 GLN B HA   3  
ATOM   3790  H HB2  . GLN B 2 5   ? -4.285  -15.100 -7.545  1.00 0.00  ? 144 GLN B HB2  3  
ATOM   3791  H HB3  . GLN B 2 5   ? -5.973  -14.607 -7.421  1.00 0.00  ? 144 GLN B HB3  3  
ATOM   3792  H HG2  . GLN B 2 5   ? -5.097  -13.764 -9.974  1.00 0.00  ? 144 GLN B HG2  3  
ATOM   3793  H HG3  . GLN B 2 5   ? -4.499  -15.410 -9.767  1.00 0.00  ? 144 GLN B HG3  3  
ATOM   3794  H HE21 . GLN B 2 5   ? -6.240  -15.785 -11.549 1.00 0.00  ? 144 GLN B HE21 3  
ATOM   3795  H HE22 . GLN B 2 5   ? -7.821  -16.103 -11.017 1.00 0.00  ? 144 GLN B HE22 3  
ATOM   3796  N N    . ALA B 2 6   ? -3.218  -12.106 -9.506  1.00 42.36 ? 145 ALA B N    3  
ATOM   3797  C CA   . ALA B 2 6   ? -1.924  -11.852 -10.200 1.00 39.52 ? 145 ALA B CA   3  
ATOM   3798  C C    . ALA B 2 6   ? -1.879  -10.401 -10.679 1.00 36.36 ? 145 ALA B C    3  
ATOM   3799  O O    . ALA B 2 6   ? -1.438  -10.112 -11.775 1.00 36.34 ? 145 ALA B O    3  
ATOM   3800  C CB   . ALA B 2 6   ? -1.799  -12.790 -11.402 1.00 40.62 ? 145 ALA B CB   3  
ATOM   3801  H H    . ALA B 2 6   ? -4.056  -11.781 -9.899  1.00 0.00  ? 145 ALA B H    3  
ATOM   3802  H HA   . ALA B 2 6   ? -1.107  -12.033 -9.516  1.00 0.00  ? 145 ALA B HA   3  
ATOM   3803  H HB1  . ALA B 2 6   ? -2.750  -12.853 -11.912 1.00 0.00  ? 145 ALA B HB1  3  
ATOM   3804  H HB2  . ALA B 2 6   ? -1.051  -12.407 -12.081 1.00 0.00  ? 145 ALA B HB2  3  
ATOM   3805  H HB3  . ALA B 2 6   ? -1.507  -13.773 -11.064 1.00 0.00  ? 145 ALA B HB3  3  
ATOM   3806  N N    . GLU B 2 7   ? -2.332  -9.484  -9.869  1.00 32.22 ? 146 GLU B N    3  
ATOM   3807  C CA   . GLU B 2 7   ? -2.316  -8.051  -10.280 1.00 28.03 ? 146 GLU B CA   3  
ATOM   3808  C C    . GLU B 2 7   ? -0.870  -7.552  -10.337 1.00 24.38 ? 146 GLU B C    3  
ATOM   3809  O O    . GLU B 2 7   ? 0.027   -8.151  -9.776  1.00 22.48 ? 146 GLU B O    3  
ATOM   3810  C CB   . GLU B 2 7   ? -3.105  -7.221  -9.265  1.00 27.81 ? 146 GLU B CB   3  
ATOM   3811  C CG   . GLU B 2 7   ? -4.450  -6.818  -9.872  1.00 30.44 ? 146 GLU B CG   3  
ATOM   3812  C CD   . GLU B 2 7   ? -4.296  -5.495  -10.623 1.00 31.15 ? 146 GLU B CD   3  
ATOM   3813  O OE1  . GLU B 2 7   ? -3.178  -5.018  -10.719 1.00 34.56 ? 146 GLU B OE1  3  
ATOM   3814  O OE2  . GLU B 2 7   ? -5.300  -4.981  -11.089 1.00 30.91 ? 146 GLU B OE2  3  
ATOM   3815  H H    . GLU B 2 7   ? -2.684  -9.738  -8.991  1.00 0.00  ? 146 GLU B H    3  
ATOM   3816  H HA   . GLU B 2 7   ? -2.768  -7.952  -11.255 1.00 0.00  ? 146 GLU B HA   3  
ATOM   3817  H HB2  . GLU B 2 7   ? -3.272  -7.808  -8.374  1.00 0.00  ? 146 GLU B HB2  3  
ATOM   3818  H HB3  . GLU B 2 7   ? -2.546  -6.333  -9.013  1.00 0.00  ? 146 GLU B HB3  3  
ATOM   3819  H HG2  . GLU B 2 7   ? -4.780  -7.587  -10.557 1.00 0.00  ? 146 GLU B HG2  3  
ATOM   3820  H HG3  . GLU B 2 7   ? -5.180  -6.701  -9.085  1.00 0.00  ? 146 GLU B HG3  3  
ATOM   3821  N N    . GLU B 2 8   ? -0.636  -6.461  -11.013 1.00 21.92 ? 147 GLU B N    3  
ATOM   3822  C CA   . GLU B 2 8   ? 0.751   -5.924  -11.111 1.00 21.70 ? 147 GLU B CA   3  
ATOM   3823  C C    . GLU B 2 8   ? 1.219   -5.442  -9.735  1.00 19.46 ? 147 GLU B C    3  
ATOM   3824  O O    . GLU B 2 8   ? 2.379   -5.142  -9.536  1.00 19.28 ? 147 GLU B O    3  
ATOM   3825  C CB   . GLU B 2 8   ? 0.776   -4.754  -12.097 1.00 26.72 ? 147 GLU B CB   3  
ATOM   3826  C CG   . GLU B 2 8   ? -0.418  -3.835  -11.829 1.00 37.15 ? 147 GLU B CG   3  
ATOM   3827  C CD   . GLU B 2 8   ? -1.484  -4.055  -12.904 1.00 41.71 ? 147 GLU B CD   3  
ATOM   3828  O OE1  . GLU B 2 8   ? -1.414  -5.067  -13.581 1.00 45.02 ? 147 GLU B OE1  3  
ATOM   3829  O OE2  . GLU B 2 8   ? -2.352  -3.207  -13.033 1.00 46.00 ? 147 GLU B OE2  3  
ATOM   3830  H H    . GLU B 2 8   ? -1.374  -5.995  -11.461 1.00 0.00  ? 147 GLU B H    3  
ATOM   3831  H HA   . GLU B 2 8   ? 1.412   -6.703  -11.462 1.00 0.00  ? 147 GLU B HA   3  
ATOM   3832  H HB2  . GLU B 2 8   ? 1.695   -4.199  -11.974 1.00 0.00  ? 147 GLU B HB2  3  
ATOM   3833  H HB3  . GLU B 2 8   ? 0.716   -5.132  -13.107 1.00 0.00  ? 147 GLU B HB3  3  
ATOM   3834  H HG2  . GLU B 2 8   ? -0.834  -4.059  -10.857 1.00 0.00  ? 147 GLU B HG2  3  
ATOM   3835  H HG3  . GLU B 2 8   ? -0.092  -2.805  -11.853 1.00 0.00  ? 147 GLU B HG3  3  
ATOM   3836  N N    . TRP B 2 9   ? 0.329   -5.364  -8.783  1.00 17.10 ? 148 TRP B N    3  
ATOM   3837  C CA   . TRP B 2 9   ? 0.733   -4.901  -7.424  1.00 12.75 ? 148 TRP B CA   3  
ATOM   3838  C C    . TRP B 2 9   ? 0.204   -5.878  -6.371  1.00 12.19 ? 148 TRP B C    3  
ATOM   3839  O O    . TRP B 2 9   ? -0.104  -5.499  -5.260  1.00 11.66 ? 148 TRP B O    3  
ATOM   3840  C CB   . TRP B 2 9   ? 0.160   -3.504  -7.157  1.00 14.42 ? 148 TRP B CB   3  
ATOM   3841  C CG   . TRP B 2 9   ? -1.170  -3.360  -7.829  1.00 13.12 ? 148 TRP B CG   3  
ATOM   3842  C CD1  . TRP B 2 9   ? -1.391  -2.662  -8.968  1.00 13.11 ? 148 TRP B CD1  3  
ATOM   3843  C CD2  . TRP B 2 9   ? -2.458  -3.910  -7.429  1.00 12.81 ? 148 TRP B CD2  3  
ATOM   3844  N NE1  . TRP B 2 9   ? -2.733  -2.748  -9.293  1.00 12.63 ? 148 TRP B NE1  3  
ATOM   3845  C CE2  . TRP B 2 9   ? -3.434  -3.506  -8.376  1.00 13.14 ? 148 TRP B CE2  3  
ATOM   3846  C CE3  . TRP B 2 9   ? -2.873  -4.713  -6.345  1.00 10.52 ? 148 TRP B CE3  3  
ATOM   3847  C CZ2  . TRP B 2 9   ? -4.774  -3.886  -8.252  1.00 13.39 ? 148 TRP B CZ2  3  
ATOM   3848  C CZ3  . TRP B 2 9   ? -4.221  -5.098  -6.216  1.00 12.83 ? 148 TRP B CZ3  3  
ATOM   3849  C CH2  . TRP B 2 9   ? -5.169  -4.685  -7.169  1.00 12.53 ? 148 TRP B CH2  3  
ATOM   3850  H H    . TRP B 2 9   ? -0.602  -5.610  -8.961  1.00 0.00  ? 148 TRP B H    3  
ATOM   3851  H HA   . TRP B 2 9   ? 1.811   -4.863  -7.366  1.00 0.00  ? 148 TRP B HA   3  
ATOM   3852  H HB2  . TRP B 2 9   ? 0.041   -3.363  -6.093  1.00 0.00  ? 148 TRP B HB2  3  
ATOM   3853  H HB3  . TRP B 2 9   ? 0.840   -2.758  -7.543  1.00 0.00  ? 148 TRP B HB3  3  
ATOM   3854  H HD1  . TRP B 2 9   ? -0.643  -2.125  -9.530  1.00 0.00  ? 148 TRP B HD1  3  
ATOM   3855  H HE1  . TRP B 2 9   ? -3.154  -2.331  -10.073 1.00 0.00  ? 148 TRP B HE1  3  
ATOM   3856  H HE3  . TRP B 2 9   ? -2.151  -5.035  -5.608  1.00 0.00  ? 148 TRP B HE3  3  
ATOM   3857  H HZ2  . TRP B 2 9   ? -5.500  -3.567  -8.986  1.00 0.00  ? 148 TRP B HZ2  3  
ATOM   3858  H HZ3  . TRP B 2 9   ? -4.528  -5.713  -5.384  1.00 0.00  ? 148 TRP B HZ3  3  
ATOM   3859  H HH2  . TRP B 2 9   ? -6.202  -4.983  -7.067  1.00 0.00  ? 148 TRP B HH2  3  
ATOM   3860  N N    . TYR B 2 10  ? 0.099   -7.133  -6.712  1.00 11.66 ? 149 TYR B N    3  
ATOM   3861  C CA   . TYR B 2 10  ? -0.408  -8.132  -5.727  1.00 13.63 ? 149 TYR B CA   3  
ATOM   3862  C C    . TYR B 2 10  ? 0.657   -9.205  -5.496  1.00 14.73 ? 149 TYR B C    3  
ATOM   3863  O O    . TYR B 2 10  ? 1.004   -9.952  -6.389  1.00 16.34 ? 149 TYR B O    3  
ATOM   3864  C CB   . TYR B 2 10  ? -1.680  -8.783  -6.271  1.00 12.52 ? 149 TYR B CB   3  
ATOM   3865  C CG   . TYR B 2 10  ? -2.473  -9.373  -5.130  1.00 15.49 ? 149 TYR B CG   3  
ATOM   3866  C CD1  . TYR B 2 10  ? -3.155  -8.529  -4.238  1.00 19.03 ? 149 TYR B CD1  3  
ATOM   3867  C CD2  . TYR B 2 10  ? -2.529  -10.766 -4.959  1.00 14.45 ? 149 TYR B CD2  3  
ATOM   3868  C CE1  . TYR B 2 10  ? -3.893  -9.077  -3.175  1.00 20.41 ? 149 TYR B CE1  3  
ATOM   3869  C CE2  . TYR B 2 10  ? -3.266  -11.315 -3.897  1.00 15.99 ? 149 TYR B CE2  3  
ATOM   3870  C CZ   . TYR B 2 10  ? -3.948  -10.471 -3.005  1.00 21.15 ? 149 TYR B CZ   3  
ATOM   3871  O OH   . TYR B 2 10  ? -4.673  -11.011 -1.961  1.00 23.67 ? 149 TYR B OH   3  
ATOM   3872  H H    . TYR B 2 10  ? 0.354   -7.421  -7.613  1.00 0.00  ? 149 TYR B H    3  
ATOM   3873  H HA   . TYR B 2 10  ? -0.627  -7.636  -4.793  1.00 0.00  ? 149 TYR B HA   3  
ATOM   3874  H HB2  . TYR B 2 10  ? -2.276  -8.039  -6.777  1.00 0.00  ? 149 TYR B HB2  3  
ATOM   3875  H HB3  . TYR B 2 10  ? -1.415  -9.566  -6.966  1.00 0.00  ? 149 TYR B HB3  3  
ATOM   3876  H HD1  . TYR B 2 10  ? -3.113  -7.457  -4.369  1.00 0.00  ? 149 TYR B HD1  3  
ATOM   3877  H HD2  . TYR B 2 10  ? -2.004  -11.415 -5.645  1.00 0.00  ? 149 TYR B HD2  3  
ATOM   3878  H HE1  . TYR B 2 10  ? -4.417  -8.429  -2.490  1.00 0.00  ? 149 TYR B HE1  3  
ATOM   3879  H HE2  . TYR B 2 10  ? -3.309  -12.387 -3.766  1.00 0.00  ? 149 TYR B HE2  3  
ATOM   3880  H HH   . TYR B 2 10  ? -4.388  -11.919 -1.842  1.00 0.00  ? 149 TYR B HH   3  
ATOM   3881  N N    . PHE B 2 11  ? 1.180   -9.288  -4.302  1.00 14.41 ? 150 PHE B N    3  
ATOM   3882  C CA   . PHE B 2 11  ? 2.222   -10.313 -4.015  1.00 13.20 ? 150 PHE B CA   3  
ATOM   3883  C C    . PHE B 2 11  ? 1.595   -11.479 -3.250  1.00 12.95 ? 150 PHE B C    3  
ATOM   3884  O O    . PHE B 2 11  ? 1.953   -12.625 -3.443  1.00 12.44 ? 150 PHE B O    3  
ATOM   3885  C CB   . PHE B 2 11  ? 3.335   -9.688  -3.171  1.00 13.34 ? 150 PHE B CB   3  
ATOM   3886  C CG   . PHE B 2 11  ? 4.159   -8.761  -4.031  1.00 10.91 ? 150 PHE B CG   3  
ATOM   3887  C CD1  . PHE B 2 11  ? 3.732   -7.441  -4.249  1.00 10.43 ? 150 PHE B CD1  3  
ATOM   3888  C CD2  . PHE B 2 11  ? 5.352   -9.219  -4.615  1.00 10.09 ? 150 PHE B CD2  3  
ATOM   3889  C CE1  . PHE B 2 11  ? 4.498   -6.577  -5.050  1.00 9.38  ? 150 PHE B CE1  3  
ATOM   3890  C CE2  . PHE B 2 11  ? 6.119   -8.356  -5.416  1.00 7.94  ? 150 PHE B CE2  3  
ATOM   3891  C CZ   . PHE B 2 11  ? 5.692   -7.035  -5.634  1.00 8.81  ? 150 PHE B CZ   3  
ATOM   3892  H H    . PHE B 2 11  ? 0.887   -8.676  -3.595  1.00 0.00  ? 150 PHE B H    3  
ATOM   3893  H HA   . PHE B 2 11  ? 2.636   -10.674 -4.945  1.00 0.00  ? 150 PHE B HA   3  
ATOM   3894  H HB2  . PHE B 2 11  ? 2.897   -9.131  -2.355  1.00 0.00  ? 150 PHE B HB2  3  
ATOM   3895  H HB3  . PHE B 2 11  ? 3.969   -10.468 -2.775  1.00 0.00  ? 150 PHE B HB3  3  
ATOM   3896  H HD1  . PHE B 2 11  ? 2.815   -7.088  -3.801  1.00 0.00  ? 150 PHE B HD1  3  
ATOM   3897  H HD2  . PHE B 2 11  ? 5.681   -10.234 -4.448  1.00 0.00  ? 150 PHE B HD2  3  
ATOM   3898  H HE1  . PHE B 2 11  ? 4.170   -5.562  -5.217  1.00 0.00  ? 150 PHE B HE1  3  
ATOM   3899  H HE2  . PHE B 2 11  ? 7.036   -8.708  -5.865  1.00 0.00  ? 150 PHE B HE2  3  
ATOM   3900  H HZ   . PHE B 2 11  ? 6.280   -6.372  -6.250  1.00 0.00  ? 150 PHE B HZ   3  
ATOM   3901  N N    . GLY B 2 12  ? 0.662   -11.199 -2.382  1.00 14.57 ? 151 GLY B N    3  
ATOM   3902  C CA   . GLY B 2 12  ? 0.014   -12.292 -1.604  1.00 13.68 ? 151 GLY B CA   3  
ATOM   3903  C C    . GLY B 2 12  ? 0.401   -12.168 -0.131  1.00 15.95 ? 151 GLY B C    3  
ATOM   3904  O O    . GLY B 2 12  ? 0.974   -11.183 0.291   1.00 16.08 ? 151 GLY B O    3  
ATOM   3905  H H    . GLY B 2 12  ? 0.388   -10.270 -2.240  1.00 0.00  ? 151 GLY B H    3  
ATOM   3906  H HA2  . GLY B 2 12  ? -1.060  -12.217 -1.705  1.00 0.00  ? 151 GLY B HA2  3  
ATOM   3907  H HA3  . GLY B 2 12  ? 0.346   -13.247 -1.981  1.00 0.00  ? 151 GLY B HA3  3  
ATOM   3908  N N    . LYS B 2 13  ? 0.092   -13.160 0.657   1.00 14.92 ? 152 LYS B N    3  
ATOM   3909  C CA   . LYS B 2 13  ? 0.437   -13.106 2.098   1.00 16.57 ? 152 LYS B CA   3  
ATOM   3910  C C    . LYS B 2 13  ? 1.955   -13.212 2.263   1.00 15.79 ? 152 LYS B C    3  
ATOM   3911  O O    . LYS B 2 13  ? 2.541   -14.257 2.052   1.00 15.62 ? 152 LYS B O    3  
ATOM   3912  C CB   . LYS B 2 13  ? -0.239  -14.274 2.814   1.00 19.39 ? 152 LYS B CB   3  
ATOM   3913  C CG   . LYS B 2 13  ? -0.061  -15.553 1.994   1.00 26.20 ? 152 LYS B CG   3  
ATOM   3914  C CD   . LYS B 2 13  ? -0.063  -16.763 2.929   1.00 32.70 ? 152 LYS B CD   3  
ATOM   3915  C CE   . LYS B 2 13  ? 1.097   -17.692 2.565   1.00 38.73 ? 152 LYS B CE   3  
ATOM   3916  N NZ   . LYS B 2 13  ? 1.036   -18.017 1.113   1.00 43.61 ? 152 LYS B NZ   3  
ATOM   3917  H H    . LYS B 2 13  ? -0.369  -13.944 0.301   1.00 0.00  ? 152 LYS B H    3  
ATOM   3918  H HA   . LYS B 2 13  ? 0.091   -12.174 2.521   1.00 0.00  ? 152 LYS B HA   3  
ATOM   3919  H HB2  . LYS B 2 13  ? 0.212   -14.404 3.780   1.00 0.00  ? 152 LYS B HB2  3  
ATOM   3920  H HB3  . LYS B 2 13  ? -1.291  -14.066 2.931   1.00 0.00  ? 152 LYS B HB3  3  
ATOM   3921  H HG2  . LYS B 2 13  ? -0.874  -15.642 1.287   1.00 0.00  ? 152 LYS B HG2  3  
ATOM   3922  H HG3  . LYS B 2 13  ? 0.876   -15.513 1.462   1.00 0.00  ? 152 LYS B HG3  3  
ATOM   3923  H HD2  . LYS B 2 13  ? 0.049   -16.429 3.950   1.00 0.00  ? 152 LYS B HD2  3  
ATOM   3924  H HD3  . LYS B 2 13  ? -0.995  -17.298 2.825   1.00 0.00  ? 152 LYS B HD3  3  
ATOM   3925  H HE2  . LYS B 2 13  ? 2.034   -17.201 2.785   1.00 0.00  ? 152 LYS B HE2  3  
ATOM   3926  H HE3  . LYS B 2 13  ? 1.025   -18.602 3.141   1.00 0.00  ? 152 LYS B HE3  3  
ATOM   3927  H HZ1  . LYS B 2 13  ? 0.046   -18.161 0.830   1.00 0.00  ? 152 LYS B HZ1  3  
ATOM   3928  H HZ2  . LYS B 2 13  ? 1.439   -17.232 0.563   1.00 0.00  ? 152 LYS B HZ2  3  
ATOM   3929  H HZ3  . LYS B 2 13  ? 1.579   -18.886 0.928   1.00 0.00  ? 152 LYS B HZ3  3  
ATOM   3930  N N    . ILE B 2 14  ? 2.597   -12.140 2.636   1.00 16.90 ? 153 ILE B N    3  
ATOM   3931  C CA   . ILE B 2 14  ? 4.076   -12.178 2.811   1.00 16.60 ? 153 ILE B CA   3  
ATOM   3932  C C    . ILE B 2 14  ? 4.432   -11.792 4.249   1.00 17.59 ? 153 ILE B C    3  
ATOM   3933  O O    . ILE B 2 14  ? 3.763   -10.990 4.869   1.00 21.20 ? 153 ILE B O    3  
ATOM   3934  C CB   . ILE B 2 14  ? 4.728   -11.191 1.843   1.00 15.36 ? 153 ILE B CB   3  
ATOM   3935  C CG1  . ILE B 2 14  ? 4.035   -9.831  1.963   1.00 14.56 ? 153 ILE B CG1  3  
ATOM   3936  C CG2  . ILE B 2 14  ? 4.587   -11.709 0.411   1.00 15.80 ? 153 ILE B CG2  3  
ATOM   3937  C CD1  . ILE B 2 14  ? 4.833   -8.780  1.188   1.00 13.00 ? 153 ILE B CD1  3  
ATOM   3938  H H    . ILE B 2 14  ? 2.106   -11.307 2.800   1.00 0.00  ? 153 ILE B H    3  
ATOM   3939  H HA   . ILE B 2 14  ? 4.437   -13.176 2.606   1.00 0.00  ? 153 ILE B HA   3  
ATOM   3940  H HB   . ILE B 2 14  ? 5.776   -11.085 2.087   1.00 0.00  ? 153 ILE B HB   3  
ATOM   3941  H HG12 . ILE B 2 14  ? 3.037   -9.899  1.554   1.00 0.00  ? 153 ILE B HG12 3  
ATOM   3942  H HG13 . ILE B 2 14  ? 3.980   -9.544  3.002   1.00 0.00  ? 153 ILE B HG13 3  
ATOM   3943  H HG21 . ILE B 2 14  ? 4.636   -12.787 0.413   1.00 0.00  ? 153 ILE B HG21 3  
ATOM   3944  H HG22 . ILE B 2 14  ? 3.638   -11.391 0.005   1.00 0.00  ? 153 ILE B HG22 3  
ATOM   3945  H HG23 . ILE B 2 14  ? 5.389   -11.313 -0.196  1.00 0.00  ? 153 ILE B HG23 3  
ATOM   3946  H HD11 . ILE B 2 14  ? 5.860   -8.789  1.524   1.00 0.00  ? 153 ILE B HD11 3  
ATOM   3947  H HD12 . ILE B 2 14  ? 4.797   -9.005  0.133   1.00 0.00  ? 153 ILE B HD12 3  
ATOM   3948  H HD13 . ILE B 2 14  ? 4.405   -7.803  1.363   1.00 0.00  ? 153 ILE B HD13 3  
ATOM   3949  N N    . THR B 2 15  ? 5.482   -12.356 4.781   1.00 16.79 ? 154 THR B N    3  
ATOM   3950  C CA   . THR B 2 15  ? 5.879   -12.016 6.176   1.00 16.02 ? 154 THR B CA   3  
ATOM   3951  C C    . THR B 2 15  ? 6.210   -10.526 6.260   1.00 15.06 ? 154 THR B C    3  
ATOM   3952  O O    . THR B 2 15  ? 6.382   -9.861  5.257   1.00 14.17 ? 154 THR B O    3  
ATOM   3953  C CB   . THR B 2 15  ? 7.111   -12.837 6.569   1.00 18.43 ? 154 THR B CB   3  
ATOM   3954  O OG1  . THR B 2 15  ? 8.265   -12.277 5.955   1.00 22.52 ? 154 THR B OG1  3  
ATOM   3955  C CG2  . THR B 2 15  ? 6.934   -14.283 6.104   1.00 19.67 ? 154 THR B CG2  3  
ATOM   3956  H H    . THR B 2 15  ? 6.008   -12.999 4.264   1.00 0.00  ? 154 THR B H    3  
ATOM   3957  H HA   . THR B 2 15  ? 5.065   -12.244 6.848   1.00 0.00  ? 154 THR B HA   3  
ATOM   3958  H HB   . THR B 2 15  ? 7.229   -12.819 7.641   1.00 0.00  ? 154 THR B HB   3  
ATOM   3959  H HG1  . THR B 2 15  ? 8.130   -12.289 5.005   1.00 0.00  ? 154 THR B HG1  3  
ATOM   3960  H HG21 . THR B 2 15  ? 5.907   -14.443 5.808   1.00 0.00  ? 154 THR B HG21 3  
ATOM   3961  H HG22 . THR B 2 15  ? 7.586   -14.474 5.265   1.00 0.00  ? 154 THR B HG22 3  
ATOM   3962  H HG23 . THR B 2 15  ? 7.183   -14.953 6.914   1.00 0.00  ? 154 THR B HG23 3  
ATOM   3963  N N    . ARG B 2 16  ? 6.298   -9.992  7.447   1.00 15.92 ? 155 ARG B N    3  
ATOM   3964  C CA   . ARG B 2 16  ? 6.615   -8.543  7.590   1.00 14.63 ? 155 ARG B CA   3  
ATOM   3965  C C    . ARG B 2 16  ? 8.105   -8.317  7.323   1.00 15.69 ? 155 ARG B C    3  
ATOM   3966  O O    . ARG B 2 16  ? 8.509   -7.274  6.851   1.00 13.45 ? 155 ARG B O    3  
ATOM   3967  C CB   . ARG B 2 16  ? 6.276   -8.083  9.009   1.00 13.07 ? 155 ARG B CB   3  
ATOM   3968  C CG   . ARG B 2 16  ? 6.062   -6.568  9.018   1.00 14.81 ? 155 ARG B CG   3  
ATOM   3969  C CD   . ARG B 2 16  ? 5.819   -6.094  10.452  1.00 13.27 ? 155 ARG B CD   3  
ATOM   3970  N NE   . ARG B 2 16  ? 6.937   -6.554  11.322  1.00 16.05 ? 155 ARG B NE   3  
ATOM   3971  C CZ   . ARG B 2 16  ? 8.140   -6.078  11.145  1.00 8.86  ? 155 ARG B CZ   3  
ATOM   3972  N NH1  . ARG B 2 16  ? 8.419   -4.858  11.512  1.00 12.78 ? 155 ARG B NH1  3  
ATOM   3973  N NH2  . ARG B 2 16  ? 9.063   -6.824  10.602  1.00 8.73  ? 155 ARG B NH2  3  
ATOM   3974  H H    . ARG B 2 16  ? 6.153   -10.543 8.245   1.00 0.00  ? 155 ARG B H    3  
ATOM   3975  H HA   . ARG B 2 16  ? 6.032   -7.976  6.879   1.00 0.00  ? 155 ARG B HA   3  
ATOM   3976  H HB2  . ARG B 2 16  ? 5.375   -8.578  9.342   1.00 0.00  ? 155 ARG B HB2  3  
ATOM   3977  H HB3  . ARG B 2 16  ? 7.090   -8.333  9.673   1.00 0.00  ? 155 ARG B HB3  3  
ATOM   3978  H HG2  . ARG B 2 16  ? 6.938   -6.079  8.618   1.00 0.00  ? 155 ARG B HG2  3  
ATOM   3979  H HG3  . ARG B 2 16  ? 5.204   -6.323  8.411   1.00 0.00  ? 155 ARG B HG3  3  
ATOM   3980  H HD2  . ARG B 2 16  ? 5.769   -5.015  10.471  1.00 0.00  ? 155 ARG B HD2  3  
ATOM   3981  H HD3  . ARG B 2 16  ? 4.889   -6.505  10.815  1.00 0.00  ? 155 ARG B HD3  3  
ATOM   3982  H HE   . ARG B 2 16  ? 6.771   -7.214  12.028  1.00 0.00  ? 155 ARG B HE   3  
ATOM   3983  H HH11 . ARG B 2 16  ? 7.711   -4.286  11.927  1.00 0.00  ? 155 ARG B HH11 3  
ATOM   3984  H HH12 . ARG B 2 16  ? 9.339   -4.493  11.376  1.00 0.00  ? 155 ARG B HH12 3  
ATOM   3985  H HH21 . ARG B 2 16  ? 8.849   -7.759  10.321  1.00 0.00  ? 155 ARG B HH21 3  
ATOM   3986  H HH22 . ARG B 2 16  ? 9.984   -6.459  10.467  1.00 0.00  ? 155 ARG B HH22 3  
ATOM   3987  N N    . ARG B 2 17  ? 8.924   -9.287  7.621   1.00 16.92 ? 156 ARG B N    3  
ATOM   3988  C CA   . ARG B 2 17  ? 10.386  -9.127  7.384   1.00 18.61 ? 156 ARG B CA   3  
ATOM   3989  C C    . ARG B 2 17  ? 10.637  -8.892  5.893   1.00 17.01 ? 156 ARG B C    3  
ATOM   3990  O O    . ARG B 2 17  ? 11.246  -7.916  5.502   1.00 17.04 ? 156 ARG B O    3  
ATOM   3991  C CB   . ARG B 2 17  ? 11.118  -10.393 7.832   1.00 24.11 ? 156 ARG B CB   3  
ATOM   3992  C CG   . ARG B 2 17  ? 12.367  -10.007 8.629   1.00 33.87 ? 156 ARG B CG   3  
ATOM   3993  C CD   . ARG B 2 17  ? 13.611  -10.234 7.769   1.00 41.26 ? 156 ARG B CD   3  
ATOM   3994  N NE   . ARG B 2 17  ? 14.428  -8.989  7.738   1.00 49.98 ? 156 ARG B NE   3  
ATOM   3995  C CZ   . ARG B 2 17  ? 14.800  -8.425  8.855   1.00 51.87 ? 156 ARG B CZ   3  
ATOM   3996  N NH1  . ARG B 2 17  ? 15.717  -8.986  9.594   1.00 52.15 ? 156 ARG B NH1  3  
ATOM   3997  N NH2  . ARG B 2 17  ? 14.256  -7.302  9.231   1.00 53.57 ? 156 ARG B NH2  3  
ATOM   3998  H H    . ARG B 2 17  ? 8.578   -10.123 8.001   1.00 0.00  ? 156 ARG B H    3  
ATOM   3999  H HA   . ARG B 2 17  ? 10.751  -8.281  7.947   1.00 0.00  ? 156 ARG B HA   3  
ATOM   4000  H HB2  . ARG B 2 17  ? 10.463  -10.987 8.453   1.00 0.00  ? 156 ARG B HB2  3  
ATOM   4001  H HB3  . ARG B 2 17  ? 11.411  -10.966 6.966   1.00 0.00  ? 156 ARG B HB3  3  
ATOM   4002  H HG2  . ARG B 2 17  ? 12.306  -8.965  8.908   1.00 0.00  ? 156 ARG B HG2  3  
ATOM   4003  H HG3  . ARG B 2 17  ? 12.429  -10.616 9.518   1.00 0.00  ? 156 ARG B HG3  3  
ATOM   4004  H HD2  . ARG B 2 17  ? 14.197  -11.038 8.189   1.00 0.00  ? 156 ARG B HD2  3  
ATOM   4005  H HD3  . ARG B 2 17  ? 13.312  -10.494 6.764   1.00 0.00  ? 156 ARG B HD3  3  
ATOM   4006  H HE   . ARG B 2 17  ? 14.685  -8.593  6.880   1.00 0.00  ? 156 ARG B HE   3  
ATOM   4007  H HH11 . ARG B 2 17  ? 16.135  -9.848  9.306   1.00 0.00  ? 156 ARG B HH11 3  
ATOM   4008  H HH12 . ARG B 2 17  ? 16.003  -8.554  10.450  1.00 0.00  ? 156 ARG B HH12 3  
ATOM   4009  H HH21 . ARG B 2 17  ? 13.553  -6.871  8.665   1.00 0.00  ? 156 ARG B HH21 3  
ATOM   4010  H HH22 . ARG B 2 17  ? 14.541  -6.870  10.088  1.00 0.00  ? 156 ARG B HH22 3  
ATOM   4011  N N    . GLU B 2 18  ? 10.172  -9.781  5.057   1.00 15.73 ? 157 GLU B N    3  
ATOM   4012  C CA   . GLU B 2 18  ? 10.385  -9.607  3.593   1.00 15.26 ? 157 GLU B CA   3  
ATOM   4013  C C    . GLU B 2 18  ? 9.648   -8.354  3.115   1.00 14.10 ? 157 GLU B C    3  
ATOM   4014  O O    . GLU B 2 18  ? 10.029  -7.731  2.144   1.00 15.48 ? 157 GLU B O    3  
ATOM   4015  C CB   . GLU B 2 18  ? 9.841   -10.830 2.851   1.00 19.30 ? 157 GLU B CB   3  
ATOM   4016  C CG   . GLU B 2 18  ? 9.888   -10.577 1.343   1.00 28.11 ? 157 GLU B CG   3  
ATOM   4017  C CD   . GLU B 2 18  ? 9.545   -11.868 0.598   1.00 29.65 ? 157 GLU B CD   3  
ATOM   4018  O OE1  . GLU B 2 18  ? 9.570   -12.914 1.223   1.00 28.63 ? 157 GLU B OE1  3  
ATOM   4019  O OE2  . GLU B 2 18  ? 9.265   -11.787 -0.587  1.00 31.13 ? 157 GLU B OE2  3  
ATOM   4020  H H    . GLU B 2 18  ? 9.684   -10.560 5.392   1.00 0.00  ? 157 GLU B H    3  
ATOM   4021  H HA   . GLU B 2 18  ? 11.440  -9.504  3.391   1.00 0.00  ? 157 GLU B HA   3  
ATOM   4022  H HB2  . GLU B 2 18  ? 10.444  -11.694 3.092   1.00 0.00  ? 157 GLU B HB2  3  
ATOM   4023  H HB3  . GLU B 2 18  ? 8.819   -11.009 3.152   1.00 0.00  ? 157 GLU B HB3  3  
ATOM   4024  H HG2  . GLU B 2 18  ? 9.172   -9.810  1.085   1.00 0.00  ? 157 GLU B HG2  3  
ATOM   4025  H HG3  . GLU B 2 18  ? 10.879  -10.253 1.063   1.00 0.00  ? 157 GLU B HG3  3  
ATOM   4026  N N    . SER B 2 19  ? 8.597   -7.979  3.791   1.00 11.43 ? 158 SER B N    3  
ATOM   4027  C CA   . SER B 2 19  ? 7.837   -6.766  3.375   1.00 9.58  ? 158 SER B CA   3  
ATOM   4028  C C    . SER B 2 19  ? 8.772   -5.555  3.370   1.00 10.15 ? 158 SER B C    3  
ATOM   4029  O O    . SER B 2 19  ? 9.060   -4.986  2.335   1.00 12.31 ? 158 SER B O    3  
ATOM   4030  C CB   . SER B 2 19  ? 6.691   -6.521  4.358   1.00 8.90  ? 158 SER B CB   3  
ATOM   4031  O OG   . SER B 2 19  ? 5.475   -6.978  3.782   1.00 11.55 ? 158 SER B OG   3  
ATOM   4032  H H    . SER B 2 19  ? 8.306   -8.496  4.571   1.00 0.00  ? 158 SER B H    3  
ATOM   4033  H HA   . SER B 2 19  ? 7.436   -6.916  2.384   1.00 0.00  ? 158 SER B HA   3  
ATOM   4034  H HB2  . SER B 2 19  ? 6.876   -7.061  5.271   1.00 0.00  ? 158 SER B HB2  3  
ATOM   4035  H HB3  . SER B 2 19  ? 6.624   -5.463  4.574   1.00 0.00  ? 158 SER B HB3  3  
ATOM   4036  H HG   . SER B 2 19  ? 5.433   -6.657  2.879   1.00 0.00  ? 158 SER B HG   3  
ATOM   4037  N N    . GLU B 2 20  ? 9.247   -5.155  4.517   1.00 11.35 ? 159 GLU B N    3  
ATOM   4038  C CA   . GLU B 2 20  ? 10.159  -3.984  4.579   1.00 12.85 ? 159 GLU B CA   3  
ATOM   4039  C C    . GLU B 2 20  ? 11.448  -4.298  3.816   1.00 15.16 ? 159 GLU B C    3  
ATOM   4040  O O    . GLU B 2 20  ? 12.140  -3.412  3.358   1.00 13.16 ? 159 GLU B O    3  
ATOM   4041  C CB   . GLU B 2 20  ? 10.492  -3.685  6.041   1.00 13.71 ? 159 GLU B CB   3  
ATOM   4042  C CG   . GLU B 2 20  ? 9.205   -3.680  6.869   1.00 16.00 ? 159 GLU B CG   3  
ATOM   4043  C CD   . GLU B 2 20  ? 9.491   -3.089  8.251   1.00 19.40 ? 159 GLU B CD   3  
ATOM   4044  O OE1  . GLU B 2 20  ? 10.653  -2.861  8.546   1.00 26.69 ? 159 GLU B OE1  3  
ATOM   4045  O OE2  . GLU B 2 20  ? 8.544   -2.875  8.989   1.00 21.73 ? 159 GLU B OE2  3  
ATOM   4046  H H    . GLU B 2 20  ? 9.004   -5.625  5.340   1.00 0.00  ? 159 GLU B H    3  
ATOM   4047  H HA   . GLU B 2 20  ? 9.677   -3.126  4.136   1.00 0.00  ? 159 GLU B HA   3  
ATOM   4048  H HB2  . GLU B 2 20  ? 11.163  -4.443  6.419   1.00 0.00  ? 159 GLU B HB2  3  
ATOM   4049  H HB3  . GLU B 2 20  ? 10.963  -2.721  6.109   1.00 0.00  ? 159 GLU B HB3  3  
ATOM   4050  H HG2  . GLU B 2 20  ? 8.457   -3.084  6.369   1.00 0.00  ? 159 GLU B HG2  3  
ATOM   4051  H HG3  . GLU B 2 20  ? 8.845   -4.692  6.981   1.00 0.00  ? 159 GLU B HG3  3  
ATOM   4052  N N    . ARG B 2 21  ? 11.775  -5.554  3.677   1.00 15.73 ? 160 ARG B N    3  
ATOM   4053  C CA   . ARG B 2 21  ? 13.019  -5.924  2.944   1.00 17.77 ? 160 ARG B CA   3  
ATOM   4054  C C    . ARG B 2 21  ? 12.841  -5.634  1.453   1.00 17.96 ? 160 ARG B C    3  
ATOM   4055  O O    . ARG B 2 21  ? 13.795  -5.415  0.734   1.00 17.67 ? 160 ARG B O    3  
ATOM   4056  C CB   . ARG B 2 21  ? 13.300  -7.414  3.141   1.00 21.81 ? 160 ARG B CB   3  
ATOM   4057  C CG   . ARG B 2 21  ? 14.797  -7.626  3.384   1.00 30.59 ? 160 ARG B CG   3  
ATOM   4058  C CD   . ARG B 2 21  ? 15.105  -9.124  3.412   1.00 37.74 ? 160 ARG B CD   3  
ATOM   4059  N NE   . ARG B 2 21  ? 14.269  -9.824  2.395   1.00 43.93 ? 160 ARG B NE   3  
ATOM   4060  C CZ   . ARG B 2 21  ? 14.616  -9.800  1.136   1.00 48.64 ? 160 ARG B CZ   3  
ATOM   4061  N NH1  . ARG B 2 21  ? 14.703  -8.661  0.505   1.00 51.68 ? 160 ARG B NH1  3  
ATOM   4062  N NH2  . ARG B 2 21  ? 14.875  -10.915 0.509   1.00 50.79 ? 160 ARG B NH2  3  
ATOM   4063  H H    . ARG B 2 21  ? 11.202  -6.254  4.055   1.00 0.00  ? 160 ARG B H    3  
ATOM   4064  H HA   . ARG B 2 21  ? 13.847  -5.349  3.326   1.00 0.00  ? 160 ARG B HA   3  
ATOM   4065  H HB2  . ARG B 2 21  ? 12.742  -7.778  3.991   1.00 0.00  ? 160 ARG B HB2  3  
ATOM   4066  H HB3  . ARG B 2 21  ? 13.003  -7.954  2.257   1.00 0.00  ? 160 ARG B HB3  3  
ATOM   4067  H HG2  . ARG B 2 21  ? 15.359  -7.156  2.589   1.00 0.00  ? 160 ARG B HG2  3  
ATOM   4068  H HG3  . ARG B 2 21  ? 15.074  -7.185  4.330   1.00 0.00  ? 160 ARG B HG3  3  
ATOM   4069  H HD2  . ARG B 2 21  ? 16.150  -9.280  3.188   1.00 0.00  ? 160 ARG B HD2  3  
ATOM   4070  H HD3  . ARG B 2 21  ? 14.883  -9.519  4.392   1.00 0.00  ? 160 ARG B HD3  3  
ATOM   4071  H HE   . ARG B 2 21  ? 13.460  -10.303 2.671   1.00 0.00  ? 160 ARG B HE   3  
ATOM   4072  H HH11 . ARG B 2 21  ? 14.505  -7.807  0.986   1.00 0.00  ? 160 ARG B HH11 3  
ATOM   4073  H HH12 . ARG B 2 21  ? 14.970  -8.644  -0.458  1.00 0.00  ? 160 ARG B HH12 3  
ATOM   4074  H HH21 . ARG B 2 21  ? 14.808  -11.788 0.992   1.00 0.00  ? 160 ARG B HH21 3  
ATOM   4075  H HH22 . ARG B 2 21  ? 15.139  -10.896 -0.455  1.00 0.00  ? 160 ARG B HH22 3  
ATOM   4076  N N    . LEU B 2 22  ? 11.624  -5.634  0.982   1.00 16.19 ? 161 LEU B N    3  
ATOM   4077  C CA   . LEU B 2 22  ? 11.384  -5.362  -0.463  1.00 12.63 ? 161 LEU B CA   3  
ATOM   4078  C C    . LEU B 2 22  ? 11.243  -3.856  -0.690  1.00 13.41 ? 161 LEU B C    3  
ATOM   4079  O O    . LEU B 2 22  ? 11.618  -3.336  -1.721  1.00 14.12 ? 161 LEU B O    3  
ATOM   4080  C CB   . LEU B 2 22  ? 10.097  -6.064  -0.902  1.00 10.23 ? 161 LEU B CB   3  
ATOM   4081  C CG   . LEU B 2 22  ? 10.418  -7.493  -1.340  1.00 11.74 ? 161 LEU B CG   3  
ATOM   4082  C CD1  . LEU B 2 22  ? 9.138   -8.181  -1.819  1.00 10.85 ? 161 LEU B CD1  3  
ATOM   4083  C CD2  . LEU B 2 22  ? 11.437  -7.460  -2.482  1.00 15.84 ? 161 LEU B CD2  3  
ATOM   4084  H H    . LEU B 2 22  ? 10.869  -5.815  1.577   1.00 0.00  ? 161 LEU B H    3  
ATOM   4085  H HA   . LEU B 2 22  ? 12.214  -5.738  -1.043  1.00 0.00  ? 161 LEU B HA   3  
ATOM   4086  H HB2  . LEU B 2 22  ? 9.402   -6.087  -0.076  1.00 0.00  ? 161 LEU B HB2  3  
ATOM   4087  H HB3  . LEU B 2 22  ? 9.657   -5.525  -1.728  1.00 0.00  ? 161 LEU B HB3  3  
ATOM   4088  H HG   . LEU B 2 22  ? 10.829  -8.041  -0.505  1.00 0.00  ? 161 LEU B HG   3  
ATOM   4089  H HD11 . LEU B 2 22  ? 8.352   -7.448  -1.923  1.00 0.00  ? 161 LEU B HD11 3  
ATOM   4090  H HD12 . LEU B 2 22  ? 9.320   -8.652  -2.775  1.00 0.00  ? 161 LEU B HD12 3  
ATOM   4091  H HD13 . LEU B 2 22  ? 8.841   -8.930  -1.100  1.00 0.00  ? 161 LEU B HD13 3  
ATOM   4092  H HD21 . LEU B 2 22  ? 11.464  -6.469  -2.910  1.00 0.00  ? 161 LEU B HD21 3  
ATOM   4093  H HD22 . LEU B 2 22  ? 12.414  -7.714  -2.100  1.00 0.00  ? 161 LEU B HD22 3  
ATOM   4094  H HD23 . LEU B 2 22  ? 11.150  -8.172  -3.241  1.00 0.00  ? 161 LEU B HD23 3  
ATOM   4095  N N    . LEU B 2 23  ? 10.698  -3.151  0.264   1.00 12.10 ? 162 LEU B N    3  
ATOM   4096  C CA   . LEU B 2 23  ? 10.527  -1.680  0.097   1.00 13.70 ? 162 LEU B CA   3  
ATOM   4097  C C    . LEU B 2 23  ? 11.768  -0.949  0.617   1.00 15.43 ? 162 LEU B C    3  
ATOM   4098  O O    . LEU B 2 23  ? 11.924  0.241   0.422   1.00 15.50 ? 162 LEU B O    3  
ATOM   4099  C CB   . LEU B 2 23  ? 9.298   -1.223  0.882   1.00 13.91 ? 162 LEU B CB   3  
ATOM   4100  C CG   . LEU B 2 23  ? 8.045   -1.852  0.272   1.00 12.97 ? 162 LEU B CG   3  
ATOM   4101  C CD1  . LEU B 2 23  ? 6.993   -2.058  1.364   1.00 9.03  ? 162 LEU B CD1  3  
ATOM   4102  C CD2  . LEU B 2 23  ? 7.483   -0.923  -0.807  1.00 11.59 ? 162 LEU B CD2  3  
ATOM   4103  H H    . LEU B 2 23  ? 10.398  -3.589  1.087   1.00 0.00  ? 162 LEU B H    3  
ATOM   4104  H HA   . LEU B 2 23  ? 10.390  -1.451  -0.949  1.00 0.00  ? 162 LEU B HA   3  
ATOM   4105  H HB2  . LEU B 2 23  ? 9.393   -1.532  1.913   1.00 0.00  ? 162 LEU B HB2  3  
ATOM   4106  H HB3  . LEU B 2 23  ? 9.218   -0.147  0.833   1.00 0.00  ? 162 LEU B HB3  3  
ATOM   4107  H HG   . LEU B 2 23  ? 8.300   -2.807  -0.168  1.00 0.00  ? 162 LEU B HG   3  
ATOM   4108  H HD11 . LEU B 2 23  ? 7.318   -1.574  2.273   1.00 0.00  ? 162 LEU B HD11 3  
ATOM   4109  H HD12 . LEU B 2 23  ? 6.054   -1.631  1.045   1.00 0.00  ? 162 LEU B HD12 3  
ATOM   4110  H HD13 . LEU B 2 23  ? 6.865   -3.114  1.545   1.00 0.00  ? 162 LEU B HD13 3  
ATOM   4111  H HD21 . LEU B 2 23  ? 8.144   -0.079  -0.934  1.00 0.00  ? 162 LEU B HD21 3  
ATOM   4112  H HD22 . LEU B 2 23  ? 7.404   -1.462  -1.739  1.00 0.00  ? 162 LEU B HD22 3  
ATOM   4113  H HD23 . LEU B 2 23  ? 6.506   -0.574  -0.508  1.00 0.00  ? 162 LEU B HD23 3  
ATOM   4114  N N    . LEU B 2 24  ? 12.654  -1.645  1.275   1.00 17.97 ? 163 LEU B N    3  
ATOM   4115  C CA   . LEU B 2 24  ? 13.878  -0.985  1.800   1.00 23.68 ? 163 LEU B CA   3  
ATOM   4116  C C    . LEU B 2 24  ? 15.067  -1.329  0.901   1.00 29.76 ? 163 LEU B C    3  
ATOM   4117  O O    . LEU B 2 24  ? 16.049  -1.892  1.341   1.00 34.43 ? 163 LEU B O    3  
ATOM   4118  C CB   . LEU B 2 24  ? 14.150  -1.477  3.221   1.00 20.30 ? 163 LEU B CB   3  
ATOM   4119  C CG   . LEU B 2 24  ? 13.115  -0.882  4.178   1.00 19.42 ? 163 LEU B CG   3  
ATOM   4120  C CD1  . LEU B 2 24  ? 13.487  -1.239  5.618   1.00 19.86 ? 163 LEU B CD1  3  
ATOM   4121  C CD2  . LEU B 2 24  ? 13.092  0.641   4.022   1.00 19.28 ? 163 LEU B CD2  3  
ATOM   4122  H H    . LEU B 2 24  ? 12.514  -2.603  1.423   1.00 0.00  ? 163 LEU B H    3  
ATOM   4123  H HA   . LEU B 2 24  ? 13.733  0.086   1.811   1.00 0.00  ? 163 LEU B HA   3  
ATOM   4124  H HB2  . LEU B 2 24  ? 14.086  -2.556  3.246   1.00 0.00  ? 163 LEU B HB2  3  
ATOM   4125  H HB3  . LEU B 2 24  ? 15.137  -1.170  3.524   1.00 0.00  ? 163 LEU B HB3  3  
ATOM   4126  H HG   . LEU B 2 24  ? 12.140  -1.285  3.949   1.00 0.00  ? 163 LEU B HG   3  
ATOM   4127  H HD11 . LEU B 2 24  ? 14.506  -1.592  5.651   1.00 0.00  ? 163 LEU B HD11 3  
ATOM   4128  H HD12 . LEU B 2 24  ? 13.390  -0.362  6.243   1.00 0.00  ? 163 LEU B HD12 3  
ATOM   4129  H HD13 . LEU B 2 24  ? 12.826  -2.012  5.980   1.00 0.00  ? 163 LEU B HD13 3  
ATOM   4130  H HD21 . LEU B 2 24  ? 14.103  1.013   3.961   1.00 0.00  ? 163 LEU B HD21 3  
ATOM   4131  H HD22 . LEU B 2 24  ? 12.557  0.902   3.120   1.00 0.00  ? 163 LEU B HD22 3  
ATOM   4132  H HD23 . LEU B 2 24  ? 12.597  1.083   4.874   1.00 0.00  ? 163 LEU B HD23 3  
ATOM   4133  N N    . ASN B 2 25  ? 14.985  -0.994  -0.357  1.00 33.44 ? 164 ASN B N    3  
ATOM   4134  C CA   . ASN B 2 25  ? 16.108  -1.298  -1.287  1.00 37.75 ? 164 ASN B CA   3  
ATOM   4135  C C    . ASN B 2 25  ? 16.389  -0.074  -2.158  1.00 40.49 ? 164 ASN B C    3  
ATOM   4136  O O    . ASN B 2 25  ? 15.489  0.647   -2.541  1.00 41.14 ? 164 ASN B O    3  
ATOM   4137  C CB   . ASN B 2 25  ? 15.730  -2.484  -2.177  1.00 39.08 ? 164 ASN B CB   3  
ATOM   4138  C CG   . ASN B 2 25  ? 16.710  -3.634  -1.941  1.00 42.87 ? 164 ASN B CG   3  
ATOM   4139  O OD1  . ASN B 2 25  ? 17.506  -3.956  -2.801  1.00 47.61 ? 164 ASN B OD1  3  
ATOM   4140  N ND2  . ASN B 2 25  ? 16.685  -4.273  -0.803  1.00 46.52 ? 164 ASN B ND2  3  
ATOM   4141  H H    . ASN B 2 25  ? 14.183  -0.540  -0.692  1.00 0.00  ? 164 ASN B H    3  
ATOM   4142  H HA   . ASN B 2 25  ? 16.991  -1.545  -0.715  1.00 0.00  ? 164 ASN B HA   3  
ATOM   4143  H HB2  . ASN B 2 25  ? 14.728  -2.808  -1.939  1.00 0.00  ? 164 ASN B HB2  3  
ATOM   4144  H HB3  . ASN B 2 25  ? 15.775  -2.182  -3.213  1.00 0.00  ? 164 ASN B HB3  3  
ATOM   4145  H HD21 . ASN B 2 25  ? 16.040  -4.012  -0.108  1.00 0.00  ? 164 ASN B HD21 3  
ATOM   4146  H HD22 . ASN B 2 25  ? 17.311  -5.015  -0.644  1.00 0.00  ? 164 ASN B HD22 3  
ATOM   4147  N N    . ALA B 2 26  ? 17.630  0.168   -2.474  1.00 41.13 ? 165 ALA B N    3  
ATOM   4148  C CA   . ALA B 2 26  ? 17.966  1.348   -3.319  1.00 40.91 ? 165 ALA B CA   3  
ATOM   4149  C C    . ALA B 2 26  ? 17.387  1.155   -4.722  1.00 39.78 ? 165 ALA B C    3  
ATOM   4150  O O    . ALA B 2 26  ? 17.263  2.089   -5.488  1.00 42.37 ? 165 ALA B O    3  
ATOM   4151  C CB   . ALA B 2 26  ? 19.487  1.493   -3.410  1.00 43.50 ? 165 ALA B CB   3  
ATOM   4152  H H    . ALA B 2 26  ? 18.342  -0.424  -2.154  1.00 0.00  ? 165 ALA B H    3  
ATOM   4153  H HA   . ALA B 2 26  ? 17.547  2.239   -2.876  1.00 0.00  ? 165 ALA B HA   3  
ATOM   4154  H HB1  . ALA B 2 26  ? 19.940  1.104   -2.510  1.00 0.00  ? 165 ALA B HB1  3  
ATOM   4155  H HB2  . ALA B 2 26  ? 19.851  0.940   -4.264  1.00 0.00  ? 165 ALA B HB2  3  
ATOM   4156  H HB3  . ALA B 2 26  ? 19.743  2.537   -3.521  1.00 0.00  ? 165 ALA B HB3  3  
ATOM   4157  N N    . GLU B 2 27  ? 17.029  -0.053  -5.065  1.00 36.31 ? 166 GLU B N    3  
ATOM   4158  C CA   . GLU B 2 27  ? 16.458  -0.305  -6.417  1.00 32.86 ? 166 GLU B CA   3  
ATOM   4159  C C    . GLU B 2 27  ? 15.053  0.294   -6.498  1.00 28.56 ? 166 GLU B C    3  
ATOM   4160  O O    . GLU B 2 27  ? 14.552  0.588   -7.565  1.00 27.16 ? 166 GLU B O    3  
ATOM   4161  C CB   . GLU B 2 27  ? 16.385  -1.812  -6.664  1.00 35.96 ? 166 GLU B CB   3  
ATOM   4162  C CG   . GLU B 2 27  ? 17.730  -2.453  -6.315  1.00 44.79 ? 166 GLU B CG   3  
ATOM   4163  C CD   . GLU B 2 27  ? 17.734  -3.912  -6.773  1.00 50.54 ? 166 GLU B CD   3  
ATOM   4164  O OE1  . GLU B 2 27  ? 16.855  -4.647  -6.353  1.00 52.17 ? 166 GLU B OE1  3  
ATOM   4165  O OE2  . GLU B 2 27  ? 18.616  -4.271  -7.534  1.00 54.06 ? 166 GLU B OE2  3  
ATOM   4166  H H    . GLU B 2 27  ? 17.137  -0.794  -4.434  1.00 0.00  ? 166 GLU B H    3  
ATOM   4167  H HA   . GLU B 2 27  ? 17.088  0.153   -7.166  1.00 0.00  ? 166 GLU B HA   3  
ATOM   4168  H HB2  . GLU B 2 27  ? 15.609  -2.241  -6.046  1.00 0.00  ? 166 GLU B HB2  3  
ATOM   4169  H HB3  . GLU B 2 27  ? 16.160  -1.996  -7.703  1.00 0.00  ? 166 GLU B HB3  3  
ATOM   4170  H HG2  . GLU B 2 27  ? 18.523  -1.916  -6.813  1.00 0.00  ? 166 GLU B HG2  3  
ATOM   4171  H HG3  . GLU B 2 27  ? 17.880  -2.412  -5.247  1.00 0.00  ? 166 GLU B HG3  3  
ATOM   4172  N N    . ASN B 2 28  ? 14.411  0.477   -5.377  1.00 24.51 ? 167 ASN B N    3  
ATOM   4173  C CA   . ASN B 2 28  ? 13.038  1.055   -5.391  1.00 21.82 ? 167 ASN B CA   3  
ATOM   4174  C C    . ASN B 2 28  ? 13.123  2.574   -5.170  1.00 19.62 ? 167 ASN B C    3  
ATOM   4175  O O    . ASN B 2 28  ? 13.639  3.015   -4.162  1.00 20.78 ? 167 ASN B O    3  
ATOM   4176  C CB   . ASN B 2 28  ? 12.211  0.425   -4.268  1.00 20.91 ? 167 ASN B CB   3  
ATOM   4177  C CG   . ASN B 2 28  ? 12.175  -1.094  -4.451  1.00 21.84 ? 167 ASN B CG   3  
ATOM   4178  O OD1  . ASN B 2 28  ? 12.833  -1.627  -5.322  1.00 20.75 ? 167 ASN B OD1  3  
ATOM   4179  N ND2  . ASN B 2 28  ? 11.430  -1.817  -3.661  1.00 24.01 ? 167 ASN B ND2  3  
ATOM   4180  H H    . ASN B 2 28  ? 14.830  0.232   -4.526  1.00 0.00  ? 167 ASN B H    3  
ATOM   4181  H HA   . ASN B 2 28  ? 12.573  0.844   -6.340  1.00 0.00  ? 167 ASN B HA   3  
ATOM   4182  H HB2  . ASN B 2 28  ? 12.658  0.664   -3.314  1.00 0.00  ? 167 ASN B HB2  3  
ATOM   4183  H HB3  . ASN B 2 28  ? 11.204  0.813   -4.301  1.00 0.00  ? 167 ASN B HB3  3  
ATOM   4184  H HD21 . ASN B 2 28  ? 10.898  -1.383  -2.956  1.00 0.00  ? 167 ASN B HD21 3  
ATOM   4185  H HD22 . ASN B 2 28  ? 11.401  -2.794  -3.772  1.00 0.00  ? 167 ASN B HD22 3  
ATOM   4186  N N    . PRO B 2 29  ? 12.615  3.336   -6.114  1.00 18.42 ? 168 PRO B N    3  
ATOM   4187  C CA   . PRO B 2 29  ? 12.630  4.807   -6.030  1.00 16.88 ? 168 PRO B CA   3  
ATOM   4188  C C    . PRO B 2 29  ? 11.526  5.300   -5.089  1.00 16.36 ? 168 PRO B C    3  
ATOM   4189  O O    . PRO B 2 29  ? 10.485  4.686   -4.963  1.00 15.23 ? 168 PRO B O    3  
ATOM   4190  C CB   . PRO B 2 29  ? 12.359  5.254   -7.468  1.00 18.00 ? 168 PRO B CB   3  
ATOM   4191  C CG   . PRO B 2 29  ? 11.652  4.069   -8.168  1.00 17.15 ? 168 PRO B CG   3  
ATOM   4192  C CD   . PRO B 2 29  ? 11.985  2.810   -7.344  1.00 16.33 ? 168 PRO B CD   3  
ATOM   4193  H HA   . PRO B 2 29  ? 13.595  5.163   -5.708  1.00 0.00  ? 168 PRO B HA   3  
ATOM   4194  H HB2  . PRO B 2 29  ? 11.719  6.126   -7.471  1.00 0.00  ? 168 PRO B HB2  3  
ATOM   4195  H HB3  . PRO B 2 29  ? 13.288  5.472   -7.971  1.00 0.00  ? 168 PRO B HB3  3  
ATOM   4196  H HG2  . PRO B 2 29  ? 10.583  4.234   -8.183  1.00 0.00  ? 168 PRO B HG2  3  
ATOM   4197  H HG3  . PRO B 2 29  ? 12.025  3.956   -9.174  1.00 0.00  ? 168 PRO B HG3  3  
ATOM   4198  H HD2  . PRO B 2 29  ? 11.082  2.265   -7.108  1.00 0.00  ? 168 PRO B HD2  3  
ATOM   4199  H HD3  . PRO B 2 29  ? 12.680  2.182   -7.879  1.00 0.00  ? 168 PRO B HD3  3  
ATOM   4200  N N    . ARG B 2 30  ? 11.745  6.405   -4.429  1.00 16.48 ? 169 ARG B N    3  
ATOM   4201  C CA   . ARG B 2 30  ? 10.709  6.935   -3.499  1.00 15.86 ? 169 ARG B CA   3  
ATOM   4202  C C    . ARG B 2 30  ? 9.349   6.940   -4.202  1.00 13.88 ? 169 ARG B C    3  
ATOM   4203  O O    . ARG B 2 30  ? 9.141   7.652   -5.164  1.00 15.48 ? 169 ARG B O    3  
ATOM   4204  C CB   . ARG B 2 30  ? 11.075  8.363   -3.087  1.00 15.75 ? 169 ARG B CB   3  
ATOM   4205  C CG   . ARG B 2 30  ? 9.952   8.950   -2.230  1.00 19.73 ? 169 ARG B CG   3  
ATOM   4206  C CD   . ARG B 2 30  ? 10.523  10.031  -1.310  1.00 22.87 ? 169 ARG B CD   3  
ATOM   4207  N NE   . ARG B 2 30  ? 10.487  11.347  -2.009  1.00 21.47 ? 169 ARG B NE   3  
ATOM   4208  C CZ   . ARG B 2 30  ? 11.568  12.074  -2.087  1.00 20.61 ? 169 ARG B CZ   3  
ATOM   4209  N NH1  . ARG B 2 30  ? 12.557  11.693  -2.847  1.00 23.69 ? 169 ARG B NH1  3  
ATOM   4210  N NH2  . ARG B 2 30  ? 11.659  13.182  -1.403  1.00 22.31 ? 169 ARG B NH2  3  
ATOM   4211  H H    . ARG B 2 30  ? 12.591  6.885   -4.546  1.00 0.00  ? 169 ARG B H    3  
ATOM   4212  H HA   . ARG B 2 30  ? 10.658  6.308   -2.622  1.00 0.00  ? 169 ARG B HA   3  
ATOM   4213  H HB2  . ARG B 2 30  ? 11.994  8.348   -2.519  1.00 0.00  ? 169 ARG B HB2  3  
ATOM   4214  H HB3  . ARG B 2 30  ? 11.206  8.970   -3.970  1.00 0.00  ? 169 ARG B HB3  3  
ATOM   4215  H HG2  . ARG B 2 30  ? 9.198   9.383   -2.871  1.00 0.00  ? 169 ARG B HG2  3  
ATOM   4216  H HG3  . ARG B 2 30  ? 9.511   8.167   -1.630  1.00 0.00  ? 169 ARG B HG3  3  
ATOM   4217  H HD2  . ARG B 2 30  ? 9.930   10.086  -0.409  1.00 0.00  ? 169 ARG B HD2  3  
ATOM   4218  H HD3  . ARG B 2 30  ? 11.543  9.786   -1.056  1.00 0.00  ? 169 ARG B HD3  3  
ATOM   4219  H HE   . ARG B 2 30  ? 9.652   11.666  -2.410  1.00 0.00  ? 169 ARG B HE   3  
ATOM   4220  H HH11 . ARG B 2 30  ? 12.486  10.844  -3.371  1.00 0.00  ? 169 ARG B HH11 3  
ATOM   4221  H HH12 . ARG B 2 30  ? 13.385  12.250  -2.907  1.00 0.00  ? 169 ARG B HH12 3  
ATOM   4222  H HH21 . ARG B 2 30  ? 10.902  13.473  -0.819  1.00 0.00  ? 169 ARG B HH21 3  
ATOM   4223  H HH22 . ARG B 2 30  ? 12.488  13.739  -1.462  1.00 0.00  ? 169 ARG B HH22 3  
ATOM   4224  N N    . GLY B 2 31  ? 8.423   6.152   -3.728  1.00 11.61 ? 170 GLY B N    3  
ATOM   4225  C CA   . GLY B 2 31  ? 7.079   6.114   -4.370  1.00 10.78 ? 170 GLY B CA   3  
ATOM   4226  C C    . GLY B 2 31  ? 6.713   4.668   -4.721  1.00 11.90 ? 170 GLY B C    3  
ATOM   4227  O O    . GLY B 2 31  ? 5.663   4.402   -5.269  1.00 11.93 ? 170 GLY B O    3  
ATOM   4228  H H    . GLY B 2 31  ? 8.613   5.586   -2.951  1.00 0.00  ? 170 GLY B H    3  
ATOM   4229  H HA2  . GLY B 2 31  ? 6.345   6.516   -3.687  1.00 0.00  ? 170 GLY B HA2  3  
ATOM   4230  H HA3  . GLY B 2 31  ? 7.094   6.705   -5.272  1.00 0.00  ? 170 GLY B HA3  3  
ATOM   4231  N N    . THR B 2 32  ? 7.568   3.730   -4.409  1.00 11.18 ? 171 THR B N    3  
ATOM   4232  C CA   . THR B 2 32  ? 7.258   2.307   -4.727  1.00 10.98 ? 171 THR B CA   3  
ATOM   4233  C C    . THR B 2 32  ? 6.282   1.756   -3.685  1.00 10.39 ? 171 THR B C    3  
ATOM   4234  O O    . THR B 2 32  ? 6.457   1.944   -2.498  1.00 11.11 ? 171 THR B O    3  
ATOM   4235  C CB   . THR B 2 32  ? 8.549   1.486   -4.701  1.00 12.81 ? 171 THR B CB   3  
ATOM   4236  O OG1  . THR B 2 32  ? 9.430   1.959   -5.710  1.00 15.73 ? 171 THR B OG1  3  
ATOM   4237  C CG2  . THR B 2 32  ? 8.225   0.012   -4.951  1.00 10.54 ? 171 THR B CG2  3  
ATOM   4238  H H    . THR B 2 32  ? 8.411   3.959   -3.966  1.00 0.00  ? 171 THR B H    3  
ATOM   4239  H HA   . THR B 2 32  ? 6.812   2.246   -5.709  1.00 0.00  ? 171 THR B HA   3  
ATOM   4240  H HB   . THR B 2 32  ? 9.022   1.586   -3.735  1.00 0.00  ? 171 THR B HB   3  
ATOM   4241  H HG1  . THR B 2 32  ? 9.402   2.918   -5.704  1.00 0.00  ? 171 THR B HG1  3  
ATOM   4242  H HG21 . THR B 2 32  ? 7.177   -0.090  -5.190  1.00 0.00  ? 171 THR B HG21 3  
ATOM   4243  H HG22 . THR B 2 32  ? 8.818   -0.352  -5.777  1.00 0.00  ? 171 THR B HG22 3  
ATOM   4244  H HG23 . THR B 2 32  ? 8.450   -0.562  -4.065  1.00 0.00  ? 171 THR B HG23 3  
ATOM   4245  N N    . PHE B 2 33  ? 5.255   1.080   -4.119  1.00 9.86  ? 172 PHE B N    3  
ATOM   4246  C CA   . PHE B 2 33  ? 4.270   0.521   -3.150  1.00 10.31 ? 172 PHE B CA   3  
ATOM   4247  C C    . PHE B 2 33  ? 4.033   -0.958  -3.462  1.00 9.74  ? 172 PHE B C    3  
ATOM   4248  O O    . PHE B 2 33  ? 4.612   -1.511  -4.375  1.00 10.89 ? 172 PHE B O    3  
ATOM   4249  C CB   . PHE B 2 33  ? 2.949   1.285   -3.268  1.00 8.42  ? 172 PHE B CB   3  
ATOM   4250  C CG   . PHE B 2 33  ? 2.425   1.168   -4.679  1.00 10.33 ? 172 PHE B CG   3  
ATOM   4251  C CD1  . PHE B 2 33  ? 2.931   2.006   -5.687  1.00 10.22 ? 172 PHE B CD1  3  
ATOM   4252  C CD2  . PHE B 2 33  ? 1.434   0.221   -4.984  1.00 9.32  ? 172 PHE B CD2  3  
ATOM   4253  C CE1  . PHE B 2 33  ? 2.444   1.897   -7.000  1.00 9.66  ? 172 PHE B CE1  3  
ATOM   4254  C CE2  . PHE B 2 33  ? 0.947   0.112   -6.297  1.00 10.82 ? 172 PHE B CE2  3  
ATOM   4255  C CZ   . PHE B 2 33  ? 1.453   0.950   -7.306  1.00 11.64 ? 172 PHE B CZ   3  
ATOM   4256  H H    . PHE B 2 33  ? 5.130   0.939   -5.080  1.00 0.00  ? 172 PHE B H    3  
ATOM   4257  H HA   . PHE B 2 33  ? 4.656   0.620   -2.146  1.00 0.00  ? 172 PHE B HA   3  
ATOM   4258  H HB2  . PHE B 2 33  ? 2.229   0.868   -2.580  1.00 0.00  ? 172 PHE B HB2  3  
ATOM   4259  H HB3  . PHE B 2 33  ? 3.113   2.326   -3.031  1.00 0.00  ? 172 PHE B HB3  3  
ATOM   4260  H HD1  . PHE B 2 33  ? 3.693   2.735   -5.453  1.00 0.00  ? 172 PHE B HD1  3  
ATOM   4261  H HD2  . PHE B 2 33  ? 1.045   -0.423  -4.209  1.00 0.00  ? 172 PHE B HD2  3  
ATOM   4262  H HE1  . PHE B 2 33  ? 2.832   2.542   -7.776  1.00 0.00  ? 172 PHE B HE1  3  
ATOM   4263  H HE2  . PHE B 2 33  ? 0.185   -0.616  -6.533  1.00 0.00  ? 172 PHE B HE2  3  
ATOM   4264  H HZ   . PHE B 2 33  ? 1.078   0.866   -8.316  1.00 0.00  ? 172 PHE B HZ   3  
ATOM   4265  N N    . LEU B 2 34  ? 3.185   -1.602  -2.708  1.00 8.06  ? 173 LEU B N    3  
ATOM   4266  C CA   . LEU B 2 34  ? 2.910   -3.044  -2.959  1.00 6.70  ? 173 LEU B CA   3  
ATOM   4267  C C    . LEU B 2 34  ? 1.679   -3.472  -2.159  1.00 8.22  ? 173 LEU B C    3  
ATOM   4268  O O    . LEU B 2 34  ? 1.564   -3.192  -0.982  1.00 8.04  ? 173 LEU B O    3  
ATOM   4269  C CB   . LEU B 2 34  ? 4.118   -3.878  -2.525  1.00 7.47  ? 173 LEU B CB   3  
ATOM   4270  C CG   . LEU B 2 34  ? 4.258   -3.828  -1.002  1.00 8.31  ? 173 LEU B CG   3  
ATOM   4271  C CD1  . LEU B 2 34  ? 3.407   -4.933  -0.375  1.00 7.11  ? 173 LEU B CD1  3  
ATOM   4272  C CD2  . LEU B 2 34  ? 5.725   -4.037  -0.619  1.00 7.67  ? 173 LEU B CD2  3  
ATOM   4273  H H    . LEU B 2 34  ? 2.729   -1.137  -1.977  1.00 0.00  ? 173 LEU B H    3  
ATOM   4274  H HA   . LEU B 2 34  ? 2.726   -3.197  -4.013  1.00 0.00  ? 173 LEU B HA   3  
ATOM   4275  H HB2  . LEU B 2 34  ? 3.980   -4.903  -2.841  1.00 0.00  ? 173 LEU B HB2  3  
ATOM   4276  H HB3  . LEU B 2 34  ? 5.013   -3.479  -2.980  1.00 0.00  ? 173 LEU B HB3  3  
ATOM   4277  H HG   . LEU B 2 34  ? 3.922   -2.866  -0.642  1.00 0.00  ? 173 LEU B HG   3  
ATOM   4278  H HD11 . LEU B 2 34  ? 2.817   -5.414  -1.141  1.00 0.00  ? 173 LEU B HD11 3  
ATOM   4279  H HD12 . LEU B 2 34  ? 4.052   -5.663  0.093   1.00 0.00  ? 173 LEU B HD12 3  
ATOM   4280  H HD13 . LEU B 2 34  ? 2.752   -4.505  0.369   1.00 0.00  ? 173 LEU B HD13 3  
ATOM   4281  H HD21 . LEU B 2 34  ? 6.148   -4.821  -1.228  1.00 0.00  ? 173 LEU B HD21 3  
ATOM   4282  H HD22 . LEU B 2 34  ? 6.273   -3.120  -0.780  1.00 0.00  ? 173 LEU B HD22 3  
ATOM   4283  H HD23 . LEU B 2 34  ? 5.788   -4.316  0.422   1.00 0.00  ? 173 LEU B HD23 3  
ATOM   4284  N N    . VAL B 2 35  ? 0.755   -4.146  -2.787  1.00 9.95  ? 174 VAL B N    3  
ATOM   4285  C CA   . VAL B 2 35  ? -0.467  -4.588  -2.058  1.00 10.61 ? 174 VAL B CA   3  
ATOM   4286  C C    . VAL B 2 35  ? -0.338  -6.071  -1.704  1.00 10.97 ? 174 VAL B C    3  
ATOM   4287  O O    . VAL B 2 35  ? -0.350  -6.927  -2.566  1.00 13.68 ? 174 VAL B O    3  
ATOM   4288  C CB   . VAL B 2 35  ? -1.696  -4.384  -2.946  1.00 8.85  ? 174 VAL B CB   3  
ATOM   4289  C CG1  . VAL B 2 35  ? -2.963  -4.546  -2.105  1.00 7.48  ? 174 VAL B CG1  3  
ATOM   4290  C CG2  . VAL B 2 35  ? -1.663  -2.977  -3.549  1.00 7.46  ? 174 VAL B CG2  3  
ATOM   4291  H H    . VAL B 2 35  ? 0.865   -4.362  -3.736  1.00 0.00  ? 174 VAL B H    3  
ATOM   4292  H HA   . VAL B 2 35  ? -0.575  -4.010  -1.153  1.00 0.00  ? 174 VAL B HA   3  
ATOM   4293  H HB   . VAL B 2 35  ? -1.693  -5.118  -3.739  1.00 0.00  ? 174 VAL B HB   3  
ATOM   4294  H HG11 . VAL B 2 35  ? -2.698  -4.587  -1.059  1.00 0.00  ? 174 VAL B HG11 3  
ATOM   4295  H HG12 . VAL B 2 35  ? -3.620  -3.707  -2.277  1.00 0.00  ? 174 VAL B HG12 3  
ATOM   4296  H HG13 . VAL B 2 35  ? -3.465  -5.460  -2.385  1.00 0.00  ? 174 VAL B HG13 3  
ATOM   4297  H HG21 . VAL B 2 35  ? -0.670  -2.565  -3.447  1.00 0.00  ? 174 VAL B HG21 3  
ATOM   4298  H HG22 . VAL B 2 35  ? -1.926  -3.028  -4.595  1.00 0.00  ? 174 VAL B HG22 3  
ATOM   4299  H HG23 . VAL B 2 35  ? -2.370  -2.346  -3.030  1.00 0.00  ? 174 VAL B HG23 3  
ATOM   4300  N N    . ARG B 2 36  ? -0.219  -6.381  -0.443  1.00 12.04 ? 175 ARG B N    3  
ATOM   4301  C CA   . ARG B 2 36  ? -0.093  -7.810  -0.040  1.00 13.07 ? 175 ARG B CA   3  
ATOM   4302  C C    . ARG B 2 36  ? -1.236  -8.176  0.905   1.00 15.49 ? 175 ARG B C    3  
ATOM   4303  O O    . ARG B 2 36  ? -1.970  -7.326  1.370   1.00 11.34 ? 175 ARG B O    3  
ATOM   4304  C CB   . ARG B 2 36  ? 1.243   -8.032  0.671   1.00 10.24 ? 175 ARG B CB   3  
ATOM   4305  C CG   . ARG B 2 36  ? 1.358   -7.076  1.860   1.00 10.97 ? 175 ARG B CG   3  
ATOM   4306  C CD   . ARG B 2 36  ? 1.267   -7.869  3.165   1.00 8.81  ? 175 ARG B CD   3  
ATOM   4307  N NE   . ARG B 2 36  ? 2.411   -7.505  4.047   1.00 7.82  ? 175 ARG B NE   3  
ATOM   4308  C CZ   . ARG B 2 36  ? 2.187   -7.056  5.253   1.00 8.03  ? 175 ARG B CZ   3  
ATOM   4309  N NH1  . ARG B 2 36  ? 1.571   -7.807  6.124   1.00 11.06 ? 175 ARG B NH1  3  
ATOM   4310  N NH2  . ARG B 2 36  ? 2.579   -5.857  5.586   1.00 7.60  ? 175 ARG B NH2  3  
ATOM   4311  H H    . ARG B 2 36  ? -0.215  -5.676  0.238   1.00 0.00  ? 175 ARG B H    3  
ATOM   4312  H HA   . ARG B 2 36  ? -0.140  -8.436  -0.919  1.00 0.00  ? 175 ARG B HA   3  
ATOM   4313  H HB2  . ARG B 2 36  ? 1.299   -9.052  1.021   1.00 0.00  ? 175 ARG B HB2  3  
ATOM   4314  H HB3  . ARG B 2 36  ? 2.052   -7.844  -0.020  1.00 0.00  ? 175 ARG B HB3  3  
ATOM   4315  H HG2  . ARG B 2 36  ? 2.307   -6.560  1.816   1.00 0.00  ? 175 ARG B HG2  3  
ATOM   4316  H HG3  . ARG B 2 36  ? 0.556   -6.356  1.823   1.00 0.00  ? 175 ARG B HG3  3  
ATOM   4317  H HD2  . ARG B 2 36  ? 0.338   -7.637  3.663   1.00 0.00  ? 175 ARG B HD2  3  
ATOM   4318  H HD3  . ARG B 2 36  ? 1.304   -8.926  2.946   1.00 0.00  ? 175 ARG B HD3  3  
ATOM   4319  H HE   . ARG B 2 36  ? 3.330   -7.601  3.724   1.00 0.00  ? 175 ARG B HE   3  
ATOM   4320  H HH11 . ARG B 2 36  ? 1.271   -8.726  5.868   1.00 0.00  ? 175 ARG B HH11 3  
ATOM   4321  H HH12 . ARG B 2 36  ? 1.401   -7.464  7.048   1.00 0.00  ? 175 ARG B HH12 3  
ATOM   4322  H HH21 . ARG B 2 36  ? 3.052   -5.282  4.918   1.00 0.00  ? 175 ARG B HH21 3  
ATOM   4323  H HH22 . ARG B 2 36  ? 2.408   -5.513  6.510   1.00 0.00  ? 175 ARG B HH22 3  
ATOM   4324  N N    . GLU B 2 37  ? -1.392  -9.437  1.194   1.00 20.91 ? 176 GLU B N    3  
ATOM   4325  C CA   . GLU B 2 37  ? -2.487  -9.861  2.110   1.00 26.31 ? 176 GLU B CA   3  
ATOM   4326  C C    . GLU B 2 37  ? -2.130  -9.464  3.543   1.00 29.76 ? 176 GLU B C    3  
ATOM   4327  O O    . GLU B 2 37  ? -1.031  -9.695  4.006   1.00 30.61 ? 176 GLU B O    3  
ATOM   4328  C CB   . GLU B 2 37  ? -2.661  -11.379 2.029   1.00 25.39 ? 176 GLU B CB   3  
ATOM   4329  C CG   . GLU B 2 37  ? -4.131  -11.737 2.261   1.00 29.84 ? 176 GLU B CG   3  
ATOM   4330  C CD   . GLU B 2 37  ? -4.223  -13.095 2.959   1.00 32.50 ? 176 GLU B CD   3  
ATOM   4331  O OE1  . GLU B 2 37  ? -4.288  -14.093 2.261   1.00 36.79 ? 176 GLU B OE1  3  
ATOM   4332  O OE2  . GLU B 2 37  ? -4.229  -13.112 4.179   1.00 34.32 ? 176 GLU B OE2  3  
ATOM   4333  H H    . GLU B 2 37  ? -0.788  -10.106 0.809   1.00 0.00  ? 176 GLU B H    3  
ATOM   4334  H HA   . GLU B 2 37  ? -3.407  -9.377  1.820   1.00 0.00  ? 176 GLU B HA   3  
ATOM   4335  H HB2  . GLU B 2 37  ? -2.355  -11.723 1.052   1.00 0.00  ? 176 GLU B HB2  3  
ATOM   4336  H HB3  . GLU B 2 37  ? -2.054  -11.852 2.785   1.00 0.00  ? 176 GLU B HB3  3  
ATOM   4337  H HG2  . GLU B 2 37  ? -4.592  -10.980 2.880   1.00 0.00  ? 176 GLU B HG2  3  
ATOM   4338  H HG3  . GLU B 2 37  ? -4.643  -11.786 1.312   1.00 0.00  ? 176 GLU B HG3  3  
ATOM   4339  N N    . SER B 2 38  ? -3.050  -8.867  4.250   1.00 36.14 ? 177 SER B N    3  
ATOM   4340  C CA   . SER B 2 38  ? -2.760  -8.459  5.652   1.00 41.98 ? 177 SER B CA   3  
ATOM   4341  C C    . SER B 2 38  ? -2.634  -9.706  6.527   1.00 43.00 ? 177 SER B C    3  
ATOM   4342  O O    . SER B 2 38  ? -3.478  -10.579 6.506   1.00 43.66 ? 177 SER B O    3  
ATOM   4343  C CB   . SER B 2 38  ? -3.898  -7.583  6.173   1.00 45.78 ? 177 SER B CB   3  
ATOM   4344  O OG   . SER B 2 38  ? -5.092  -8.352  6.236   1.00 51.84 ? 177 SER B OG   3  
ATOM   4345  H H    . SER B 2 38  ? -3.930  -8.688  3.859   1.00 0.00  ? 177 SER B H    3  
ATOM   4346  H HA   . SER B 2 38  ? -1.835  -7.902  5.681   1.00 0.00  ? 177 SER B HA   3  
ATOM   4347  H HB2  . SER B 2 38  ? -3.655  -7.223  7.158   1.00 0.00  ? 177 SER B HB2  3  
ATOM   4348  H HB3  . SER B 2 38  ? -4.035  -6.739  5.508   1.00 0.00  ? 177 SER B HB3  3  
ATOM   4349  H HG   . SER B 2 38  ? -5.833  -7.744  6.294   1.00 0.00  ? 177 SER B HG   3  
ATOM   4350  N N    . GLU B 2 39  ? -1.582  -9.801  7.294   1.00 23.97 ? 178 GLU B N    3  
ATOM   4351  C CA   . GLU B 2 39  ? -1.401  -10.995 8.166   1.00 25.52 ? 178 GLU B CA   3  
ATOM   4352  C C    . GLU B 2 39  ? -1.840  -10.664 9.593   1.00 30.02 ? 178 GLU B C    3  
ATOM   4353  O O    . GLU B 2 39  ? -2.368  -11.499 10.301  1.00 31.55 ? 178 GLU B O    3  
ATOM   4354  C CB   . GLU B 2 39  ? 0.075   -11.397 8.176   1.00 23.29 ? 178 GLU B CB   3  
ATOM   4355  C CG   . GLU B 2 39  ? 0.385   -12.244 6.940   1.00 29.79 ? 178 GLU B CG   3  
ATOM   4356  C CD   . GLU B 2 39  ? -0.082  -11.506 5.686   1.00 33.17 ? 178 GLU B CD   3  
ATOM   4357  O OE1  . GLU B 2 39  ? -1.249  -11.627 5.352   1.00 39.84 ? 178 GLU B OE1  3  
ATOM   4358  O OE2  . GLU B 2 39  ? 0.735   -10.833 5.080   1.00 21.15 ? 178 GLU B OE2  3  
ATOM   4359  H H    . GLU B 2 39  ? -0.910  -9.088  7.294   1.00 0.00  ? 178 GLU B H    3  
ATOM   4360  H HA   . GLU B 2 39  ? -1.994  -11.814 7.787   1.00 0.00  ? 178 GLU B HA   3  
ATOM   4361  H HB2  . GLU B 2 39  ? 0.690   -10.508 8.167   1.00 0.00  ? 178 GLU B HB2  3  
ATOM   4362  H HB3  . GLU B 2 39  ? 0.286   -11.972 9.065   1.00 0.00  ? 178 GLU B HB3  3  
ATOM   4363  H HG2  . GLU B 2 39  ? 1.451   -12.415 6.881   1.00 0.00  ? 178 GLU B HG2  3  
ATOM   4364  H HG3  . GLU B 2 39  ? -0.130  -13.189 7.013   1.00 0.00  ? 178 GLU B HG3  3  
ATOM   4365  N N    . THR B 2 40  ? -1.616  -9.454  10.026  1.00 26.98 ? 179 THR B N    3  
ATOM   4366  C CA   . THR B 2 40  ? -2.007  -9.071  11.410  1.00 31.67 ? 179 THR B CA   3  
ATOM   4367  C C    . THR B 2 40  ? -3.432  -8.510  11.415  1.00 34.54 ? 179 THR B C    3  
ATOM   4368  O O    . THR B 2 40  ? -4.016  -8.291  12.458  1.00 34.85 ? 179 THR B O    3  
ATOM   4369  C CB   . THR B 2 40  ? -1.037  -8.007  11.928  1.00 26.17 ? 179 THR B CB   3  
ATOM   4370  O OG1  . THR B 2 40  ? -1.443  -6.729  11.458  1.00 28.58 ? 179 THR B OG1  3  
ATOM   4371  C CG2  . THR B 2 40  ? 0.376   -8.313  11.428  1.00 35.55 ? 179 THR B CG2  3  
ATOM   4372  H H    . THR B 2 40  ? -1.180  -8.798  9.444   1.00 0.00  ? 179 THR B H    3  
ATOM   4373  H HA   . THR B 2 40  ? -1.961  -9.939  12.049  1.00 0.00  ? 179 THR B HA   3  
ATOM   4374  H HB   . THR B 2 40  ? -1.042  -8.013  13.005  1.00 0.00  ? 179 THR B HB   3  
ATOM   4375  H HG1  . THR B 2 40  ? -1.785  -6.233  12.206  1.00 0.00  ? 179 THR B HG1  3  
ATOM   4376  H HG21 . THR B 2 40  ? 0.470   -9.373  11.242  1.00 0.00  ? 179 THR B HG21 3  
ATOM   4377  H HG22 . THR B 2 40  ? 0.560   -7.769  10.514  1.00 0.00  ? 179 THR B HG22 3  
ATOM   4378  H HG23 . THR B 2 40  ? 1.096   -8.014  12.176  1.00 0.00  ? 179 THR B HG23 3  
ATOM   4379  N N    . THR B 2 41  ? -3.999  -8.275  10.265  1.00 27.03 ? 180 THR B N    3  
ATOM   4380  C CA   . THR B 2 41  ? -5.385  -7.729  10.218  1.00 25.08 ? 180 THR B CA   3  
ATOM   4381  C C    . THR B 2 41  ? -6.383  -8.880  10.056  1.00 30.09 ? 180 THR B C    3  
ATOM   4382  O O    . THR B 2 41  ? -6.017  -10.037 10.082  1.00 30.04 ? 180 THR B O    3  
ATOM   4383  C CB   . THR B 2 41  ? -5.516  -6.762  9.038   1.00 29.37 ? 180 THR B CB   3  
ATOM   4384  O OG1  . THR B 2 41  ? -4.279  -6.092  8.841   1.00 38.10 ? 180 THR B OG1  3  
ATOM   4385  C CG2  . THR B 2 41  ? -6.611  -5.737  9.334   1.00 40.88 ? 180 THR B CG2  3  
ATOM   4386  H H    . THR B 2 41  ? -3.515  -8.457  9.432   1.00 0.00  ? 180 THR B H    3  
ATOM   4387  H HA   . THR B 2 41  ? -5.593  -7.202  11.139  1.00 0.00  ? 180 THR B HA   3  
ATOM   4388  H HB   . THR B 2 41  ? -5.775  -7.313  8.147   1.00 0.00  ? 180 THR B HB   3  
ATOM   4389  H HG1  . THR B 2 41  ? -4.454  -5.289  8.344   1.00 0.00  ? 180 THR B HG1  3  
ATOM   4390  H HG21 . THR B 2 41  ? -6.891  -5.799  10.376  1.00 0.00  ? 180 THR B HG21 3  
ATOM   4391  H HG22 . THR B 2 41  ? -6.242  -4.744  9.120   1.00 0.00  ? 180 THR B HG22 3  
ATOM   4392  H HG23 . THR B 2 41  ? -7.473  -5.942  8.716   1.00 0.00  ? 180 THR B HG23 3  
ATOM   4393  N N    . LYS B 2 42  ? -7.640  -8.571  9.892   1.00 32.42 ? 181 LYS B N    3  
ATOM   4394  C CA   . LYS B 2 42  ? -8.659  -9.647  9.734   1.00 38.97 ? 181 LYS B CA   3  
ATOM   4395  C C    . LYS B 2 42  ? -8.725  -10.089 8.270   1.00 35.28 ? 181 LYS B C    3  
ATOM   4396  O O    . LYS B 2 42  ? -9.607  -9.696  7.533   1.00 34.92 ? 181 LYS B O    3  
ATOM   4397  C CB   . LYS B 2 42  ? -10.029 -9.118  10.167  1.00 51.02 ? 181 LYS B CB   3  
ATOM   4398  C CG   . LYS B 2 42  ? -10.074 -9.002  11.693  1.00 72.35 ? 181 LYS B CG   3  
ATOM   4399  C CD   . LYS B 2 42  ? -9.612  -7.605  12.112  1.00 84.05 ? 181 LYS B CD   3  
ATOM   4400  C CE   . LYS B 2 42  ? -10.796 -6.825  12.686  1.00 88.20 ? 181 LYS B CE   3  
ATOM   4401  N NZ   . LYS B 2 42  ? -10.553 -5.363  12.525  1.00 87.98 ? 181 LYS B NZ   3  
ATOM   4402  H H    . LYS B 2 42  ? -7.916  -7.631  9.878   1.00 0.00  ? 181 LYS B H    3  
ATOM   4403  H HA   . LYS B 2 42  ? -8.390  -10.491 10.352  1.00 0.00  ? 181 LYS B HA   3  
ATOM   4404  H HB2  . LYS B 2 42  ? -10.195 -8.146  9.726   1.00 0.00  ? 181 LYS B HB2  3  
ATOM   4405  H HB3  . LYS B 2 42  ? -10.799 -9.800  9.838   1.00 0.00  ? 181 LYS B HB3  3  
ATOM   4406  H HG2  . LYS B 2 42  ? -11.085 -9.166  12.036  1.00 0.00  ? 181 LYS B HG2  3  
ATOM   4407  H HG3  . LYS B 2 42  ? -9.419  -9.741  12.130  1.00 0.00  ? 181 LYS B HG3  3  
ATOM   4408  H HD2  . LYS B 2 42  ? -8.838  -7.692  12.861  1.00 0.00  ? 181 LYS B HD2  3  
ATOM   4409  H HD3  . LYS B 2 42  ? -9.222  -7.082  11.252  1.00 0.00  ? 181 LYS B HD3  3  
ATOM   4410  H HE2  . LYS B 2 42  ? -11.698 -7.100  12.160  1.00 0.00  ? 181 LYS B HE2  3  
ATOM   4411  H HE3  . LYS B 2 42  ? -10.905 -7.058  13.734  1.00 0.00  ? 181 LYS B HE3  3  
ATOM   4412  H HZ1  . LYS B 2 42  ? -9.777  -5.213  11.849  1.00 0.00  ? 181 LYS B HZ1  3  
ATOM   4413  H HZ2  . LYS B 2 42  ? -11.416 -4.905  12.170  1.00 0.00  ? 181 LYS B HZ2  3  
ATOM   4414  H HZ3  . LYS B 2 42  ? -10.298 -4.950  13.445  1.00 0.00  ? 181 LYS B HZ3  3  
ATOM   4415  N N    . GLY B 2 43  ? -7.801  -10.908 7.846   1.00 38.03 ? 182 GLY B N    3  
ATOM   4416  C CA   . GLY B 2 43  ? -7.811  -11.383 6.431   1.00 30.70 ? 182 GLY B CA   3  
ATOM   4417  C C    . GLY B 2 43  ? -8.077  -10.205 5.491   1.00 29.58 ? 182 GLY B C    3  
ATOM   4418  O O    . GLY B 2 43  ? -8.630  -10.366 4.421   1.00 31.67 ? 182 GLY B O    3  
ATOM   4419  H H    . GLY B 2 43  ? -7.102  -11.216 8.460   1.00 0.00  ? 182 GLY B H    3  
ATOM   4420  H HA2  . GLY B 2 43  ? -6.852  -11.823 6.195   1.00 0.00  ? 182 GLY B HA2  3  
ATOM   4421  H HA3  . GLY B 2 43  ? -8.588  -12.121 6.306   1.00 0.00  ? 182 GLY B HA3  3  
ATOM   4422  N N    . ALA B 2 44  ? -7.689  -9.023  5.880   1.00 35.86 ? 183 ALA B N    3  
ATOM   4423  C CA   . ALA B 2 44  ? -7.921  -7.839  5.005   1.00 32.70 ? 183 ALA B CA   3  
ATOM   4424  C C    . ALA B 2 44  ? -6.720  -7.651  4.076   1.00 28.65 ? 183 ALA B C    3  
ATOM   4425  O O    . ALA B 2 44  ? -6.049  -8.599  3.716   1.00 29.39 ? 183 ALA B O    3  
ATOM   4426  C CB   . ALA B 2 44  ? -8.097  -6.590  5.871   1.00 31.44 ? 183 ALA B CB   3  
ATOM   4427  H H    . ALA B 2 44  ? -7.245  -8.912  6.746   1.00 0.00  ? 183 ALA B H    3  
ATOM   4428  H HA   . ALA B 2 44  ? -8.812  -7.996  4.414   1.00 0.00  ? 183 ALA B HA   3  
ATOM   4429  H HB1  . ALA B 2 44  ? -8.725  -6.826  6.718   1.00 0.00  ? 183 ALA B HB1  3  
ATOM   4430  H HB2  . ALA B 2 44  ? -7.131  -6.256  6.221   1.00 0.00  ? 183 ALA B HB2  3  
ATOM   4431  H HB3  . ALA B 2 44  ? -8.559  -5.808  5.287   1.00 0.00  ? 183 ALA B HB3  3  
ATOM   4432  N N    . TYR B 2 45  ? -6.441  -6.438  3.683   1.00 24.43 ? 184 TYR B N    3  
ATOM   4433  C CA   . TYR B 2 45  ? -5.282  -6.197  2.778   1.00 19.69 ? 184 TYR B CA   3  
ATOM   4434  C C    . TYR B 2 45  ? -4.388  -5.110  3.379   1.00 15.67 ? 184 TYR B C    3  
ATOM   4435  O O    . TYR B 2 45  ? -4.722  -4.502  4.376   1.00 11.54 ? 184 TYR B O    3  
ATOM   4436  C CB   . TYR B 2 45  ? -5.789  -5.743  1.408   1.00 20.89 ? 184 TYR B CB   3  
ATOM   4437  C CG   . TYR B 2 45  ? -6.686  -6.808  0.828   1.00 21.46 ? 184 TYR B CG   3  
ATOM   4438  C CD1  . TYR B 2 45  ? -8.066  -6.791  1.099   1.00 21.81 ? 184 TYR B CD1  3  
ATOM   4439  C CD2  . TYR B 2 45  ? -6.144  -7.820  0.016   1.00 23.38 ? 184 TYR B CD2  3  
ATOM   4440  C CE1  . TYR B 2 45  ? -8.901  -7.782  0.559   1.00 21.77 ? 184 TYR B CE1  3  
ATOM   4441  C CE2  . TYR B 2 45  ? -6.980  -8.811  -0.524  1.00 24.77 ? 184 TYR B CE2  3  
ATOM   4442  C CZ   . TYR B 2 45  ? -8.358  -8.793  -0.252  1.00 25.72 ? 184 TYR B CZ   3  
ATOM   4443  O OH   . TYR B 2 45  ? -9.179  -9.768  -0.783  1.00 27.17 ? 184 TYR B OH   3  
ATOM   4444  H H    . TYR B 2 45  ? -6.993  -5.687  3.982   1.00 0.00  ? 184 TYR B H    3  
ATOM   4445  H HA   . TYR B 2 45  ? -4.714  -7.110  2.668   1.00 0.00  ? 184 TYR B HA   3  
ATOM   4446  H HB2  . TYR B 2 45  ? -6.344  -4.823  1.517   1.00 0.00  ? 184 TYR B HB2  3  
ATOM   4447  H HB3  . TYR B 2 45  ? -4.949  -5.582  0.749   1.00 0.00  ? 184 TYR B HB3  3  
ATOM   4448  H HD1  . TYR B 2 45  ? -8.483  -6.014  1.723   1.00 0.00  ? 184 TYR B HD1  3  
ATOM   4449  H HD2  . TYR B 2 45  ? -5.085  -7.834  -0.193  1.00 0.00  ? 184 TYR B HD2  3  
ATOM   4450  H HE1  . TYR B 2 45  ? -9.961  -7.769  0.768   1.00 0.00  ? 184 TYR B HE1  3  
ATOM   4451  H HE2  . TYR B 2 45  ? -6.563  -9.589  -1.148  1.00 0.00  ? 184 TYR B HE2  3  
ATOM   4452  H HH   . TYR B 2 45  ? -9.537  -9.437  -1.609  1.00 0.00  ? 184 TYR B HH   3  
ATOM   4453  N N    . CYS B 2 46  ? -3.254  -4.860  2.783   1.00 12.49 ? 185 CYS B N    3  
ATOM   4454  C CA   . CYS B 2 46  ? -2.345  -3.813  3.329   1.00 13.07 ? 185 CYS B CA   3  
ATOM   4455  C C    . CYS B 2 46  ? -1.517  -3.205  2.195   1.00 11.90 ? 185 CYS B C    3  
ATOM   4456  O O    . CYS B 2 46  ? -0.700  -3.866  1.585   1.00 11.52 ? 185 CYS B O    3  
ATOM   4457  C CB   . CYS B 2 46  ? -1.409  -4.440  4.363   1.00 13.05 ? 185 CYS B CB   3  
ATOM   4458  S SG   . CYS B 2 46  ? -2.336  -4.800  5.875   1.00 27.90 ? 185 CYS B SG   3  
ATOM   4459  H H    . CYS B 2 46  ? -3.000  -5.361  1.981   1.00 0.00  ? 185 CYS B H    3  
ATOM   4460  H HA   . CYS B 2 46  ? -2.932  -3.039  3.799   1.00 0.00  ? 185 CYS B HA   3  
ATOM   4461  H HB2  . CYS B 2 46  ? -0.997  -5.356  3.967   1.00 0.00  ? 185 CYS B HB2  3  
ATOM   4462  H HB3  . CYS B 2 46  ? -0.607  -3.752  4.587   1.00 0.00  ? 185 CYS B HB3  3  
ATOM   4463  H HG   . CYS B 2 46  ? -2.192  -4.078  6.491   1.00 0.00  ? 185 CYS B HG   3  
ATOM   4464  N N    . LEU B 2 47  ? -1.720  -1.947  1.910   1.00 10.41 ? 186 LEU B N    3  
ATOM   4465  C CA   . LEU B 2 47  ? -0.943  -1.291  0.821   1.00 10.82 ? 186 LEU B CA   3  
ATOM   4466  C C    . LEU B 2 47  ? 0.261   -0.564  1.426   1.00 10.91 ? 186 LEU B C    3  
ATOM   4467  O O    . LEU B 2 47  ? 0.126   0.478   2.035   1.00 11.30 ? 186 LEU B O    3  
ATOM   4468  C CB   . LEU B 2 47  ? -1.839  -0.283  0.094   1.00 8.57  ? 186 LEU B CB   3  
ATOM   4469  C CG   . LEU B 2 47  ? -0.993  0.569   -0.856  1.00 8.23  ? 186 LEU B CG   3  
ATOM   4470  C CD1  . LEU B 2 47  ? -0.431  -0.313  -1.972  1.00 10.17 ? 186 LEU B CD1  3  
ATOM   4471  C CD2  . LEU B 2 47  ? -1.866  1.667   -1.467  1.00 8.76  ? 186 LEU B CD2  3  
ATOM   4472  H H    . LEU B 2 47  ? -2.383  -1.432  2.417   1.00 0.00  ? 186 LEU B H    3  
ATOM   4473  H HA   . LEU B 2 47  ? -0.599  -2.039  0.121   1.00 0.00  ? 186 LEU B HA   3  
ATOM   4474  H HB2  . LEU B 2 47  ? -2.591  -0.815  -0.472  1.00 0.00  ? 186 LEU B HB2  3  
ATOM   4475  H HB3  . LEU B 2 47  ? -2.320  0.358   0.817   1.00 0.00  ? 186 LEU B HB3  3  
ATOM   4476  H HG   . LEU B 2 47  ? -0.178  1.017   -0.306  1.00 0.00  ? 186 LEU B HG   3  
ATOM   4477  H HD11 . LEU B 2 47  ? -1.128  -1.110  -2.187  1.00 0.00  ? 186 LEU B HD11 3  
ATOM   4478  H HD12 . LEU B 2 47  ? -0.280  0.283   -2.859  1.00 0.00  ? 186 LEU B HD12 3  
ATOM   4479  H HD13 . LEU B 2 47  ? 0.512   -0.735  -1.656  1.00 0.00  ? 186 LEU B HD13 3  
ATOM   4480  H HD21 . LEU B 2 47  ? -2.810  1.244   -1.779  1.00 0.00  ? 186 LEU B HD21 3  
ATOM   4481  H HD22 . LEU B 2 47  ? -2.043  2.437   -0.730  1.00 0.00  ? 186 LEU B HD22 3  
ATOM   4482  H HD23 . LEU B 2 47  ? -1.362  2.094   -2.321  1.00 0.00  ? 186 LEU B HD23 3  
ATOM   4483  N N    . SER B 2 48  ? 1.437   -1.108  1.266   1.00 10.50 ? 187 SER B N    3  
ATOM   4484  C CA   . SER B 2 48  ? 2.647   -0.447  1.837   1.00 9.18  ? 187 SER B CA   3  
ATOM   4485  C C    . SER B 2 48  ? 3.248   0.508   0.802   1.00 8.50  ? 187 SER B C    3  
ATOM   4486  O O    . SER B 2 48  ? 2.896   0.482   -0.360  1.00 9.53  ? 187 SER B O    3  
ATOM   4487  C CB   . SER B 2 48  ? 3.680   -1.511  2.207   1.00 7.49  ? 187 SER B CB   3  
ATOM   4488  O OG   . SER B 2 48  ? 3.114   -2.404  3.157   1.00 5.18  ? 187 SER B OG   3  
ATOM   4489  H H    . SER B 2 48  ? 1.525   -1.949  0.773   1.00 0.00  ? 187 SER B H    3  
ATOM   4490  H HA   . SER B 2 48  ? 2.369   0.108   2.720   1.00 0.00  ? 187 SER B HA   3  
ATOM   4491  H HB2  . SER B 2 48  ? 3.965   -2.063  1.327   1.00 0.00  ? 187 SER B HB2  3  
ATOM   4492  H HB3  . SER B 2 48  ? 4.555   -1.030  2.627   1.00 0.00  ? 187 SER B HB3  3  
ATOM   4493  H HG   . SER B 2 48  ? 2.412   -2.894  2.723   1.00 0.00  ? 187 SER B HG   3  
ATOM   4494  N N    . VAL B 2 49  ? 4.155   1.351   1.218   1.00 11.78 ? 188 VAL B N    3  
ATOM   4495  C CA   . VAL B 2 49  ? 4.781   2.307   0.262   1.00 12.79 ? 188 VAL B CA   3  
ATOM   4496  C C    . VAL B 2 49  ? 6.209   2.618   0.715   1.00 14.65 ? 188 VAL B C    3  
ATOM   4497  O O    . VAL B 2 49  ? 6.600   2.309   1.823   1.00 14.43 ? 188 VAL B O    3  
ATOM   4498  C CB   . VAL B 2 49  ? 3.966   3.601   0.224   1.00 12.22 ? 188 VAL B CB   3  
ATOM   4499  C CG1  . VAL B 2 49  ? 4.407   4.446   -0.972  1.00 11.34 ? 188 VAL B CG1  3  
ATOM   4500  C CG2  . VAL B 2 49  ? 2.479   3.262   0.089   1.00 12.23 ? 188 VAL B CG2  3  
ATOM   4501  H H    . VAL B 2 49  ? 4.425   1.353   2.160   1.00 0.00  ? 188 VAL B H    3  
ATOM   4502  H HA   . VAL B 2 49  ? 4.804   1.867   -0.724  1.00 0.00  ? 188 VAL B HA   3  
ATOM   4503  H HB   . VAL B 2 49  ? 4.129   4.156   1.137   1.00 0.00  ? 188 VAL B HB   3  
ATOM   4504  H HG11 . VAL B 2 49  ? 4.625   3.800   -1.809  1.00 0.00  ? 188 VAL B HG11 3  
ATOM   4505  H HG12 . VAL B 2 49  ? 3.614   5.129   -1.242  1.00 0.00  ? 188 VAL B HG12 3  
ATOM   4506  H HG13 . VAL B 2 49  ? 5.291   5.007   -0.710  1.00 0.00  ? 188 VAL B HG13 3  
ATOM   4507  H HG21 . VAL B 2 49  ? 2.347   2.534   -0.698  1.00 0.00  ? 188 VAL B HG21 3  
ATOM   4508  H HG22 . VAL B 2 49  ? 2.117   2.854   1.021   1.00 0.00  ? 188 VAL B HG22 3  
ATOM   4509  H HG23 . VAL B 2 49  ? 1.927   4.157   -0.152  1.00 0.00  ? 188 VAL B HG23 3  
ATOM   4510  N N    . SER B 2 50  ? 6.992   3.226   -0.132  1.00 14.39 ? 189 SER B N    3  
ATOM   4511  C CA   . SER B 2 50  ? 8.395   3.553   0.253   1.00 13.97 ? 189 SER B CA   3  
ATOM   4512  C C    . SER B 2 50  ? 8.590   5.071   0.243   1.00 14.32 ? 189 SER B C    3  
ATOM   4513  O O    . SER B 2 50  ? 7.955   5.785   -0.507  1.00 13.16 ? 189 SER B O    3  
ATOM   4514  C CB   . SER B 2 50  ? 9.360   2.910   -0.743  1.00 12.52 ? 189 SER B CB   3  
ATOM   4515  O OG   . SER B 2 50  ? 8.823   3.020   -2.055  1.00 13.11 ? 189 SER B OG   3  
ATOM   4516  H H    . SER B 2 50  ? 6.660   3.467   -1.023  1.00 0.00  ? 189 SER B H    3  
ATOM   4517  H HA   . SER B 2 50  ? 8.593   3.172   1.244   1.00 0.00  ? 189 SER B HA   3  
ATOM   4518  H HB2  . SER B 2 50  ? 10.310  3.415   -0.706  1.00 0.00  ? 189 SER B HB2  3  
ATOM   4519  H HB3  . SER B 2 50  ? 9.498   1.868   -0.486  1.00 0.00  ? 189 SER B HB3  3  
ATOM   4520  H HG   . SER B 2 50  ? 9.556   3.112   -2.668  1.00 0.00  ? 189 SER B HG   3  
ATOM   4521  N N    . ASP B 2 51  ? 9.468   5.570   1.072   1.00 17.22 ? 190 ASP B N    3  
ATOM   4522  C CA   . ASP B 2 51  ? 9.707   7.041   1.112   1.00 20.71 ? 190 ASP B CA   3  
ATOM   4523  C C    . ASP B 2 51  ? 11.195  7.307   1.352   1.00 19.82 ? 190 ASP B C    3  
ATOM   4524  O O    . ASP B 2 51  ? 11.950  6.413   1.680   1.00 20.14 ? 190 ASP B O    3  
ATOM   4525  C CB   . ASP B 2 51  ? 8.889   7.659   2.248   1.00 25.05 ? 190 ASP B CB   3  
ATOM   4526  C CG   . ASP B 2 51  ? 8.661   9.145   1.964   1.00 26.93 ? 190 ASP B CG   3  
ATOM   4527  O OD1  . ASP B 2 51  ? 7.877   9.445   1.079   1.00 31.13 ? 190 ASP B OD1  3  
ATOM   4528  O OD2  . ASP B 2 51  ? 9.275   9.957   2.637   1.00 30.74 ? 190 ASP B OD2  3  
ATOM   4529  H H    . ASP B 2 51  ? 9.970   4.975   1.668   1.00 0.00  ? 190 ASP B H    3  
ATOM   4530  H HA   . ASP B 2 51  ? 9.409   7.480   0.172   1.00 0.00  ? 190 ASP B HA   3  
ATOM   4531  H HB2  . ASP B 2 51  ? 7.936   7.155   2.321   1.00 0.00  ? 190 ASP B HB2  3  
ATOM   4532  H HB3  . ASP B 2 51  ? 9.426   7.551   3.180   1.00 0.00  ? 190 ASP B HB3  3  
ATOM   4533  N N    . PHE B 2 52  ? 11.624  8.529   1.192   1.00 21.67 ? 191 PHE B N    3  
ATOM   4534  C CA   . PHE B 2 52  ? 13.064  8.849   1.412   1.00 24.27 ? 191 PHE B CA   3  
ATOM   4535  C C    . PHE B 2 52  ? 13.229  10.358  1.603   1.00 28.02 ? 191 PHE B C    3  
ATOM   4536  O O    . PHE B 2 52  ? 12.494  11.150  1.046   1.00 25.66 ? 191 PHE B O    3  
ATOM   4537  C CB   . PHE B 2 52  ? 13.877  8.393   0.197   1.00 23.13 ? 191 PHE B CB   3  
ATOM   4538  C CG   . PHE B 2 52  ? 15.303  8.870   0.336   1.00 21.13 ? 191 PHE B CG   3  
ATOM   4539  C CD1  . PHE B 2 52  ? 16.202  8.169   1.158   1.00 18.20 ? 191 PHE B CD1  3  
ATOM   4540  C CD2  . PHE B 2 52  ? 15.732  10.015  -0.357  1.00 20.50 ? 191 PHE B CD2  3  
ATOM   4541  C CE1  . PHE B 2 52  ? 17.529  8.613   1.286   1.00 16.51 ? 191 PHE B CE1  3  
ATOM   4542  C CE2  . PHE B 2 52  ? 17.059  10.458  -0.230  1.00 19.46 ? 191 PHE B CE2  3  
ATOM   4543  C CZ   . PHE B 2 52  ? 17.958  9.757   0.592   1.00 17.79 ? 191 PHE B CZ   3  
ATOM   4544  H H    . PHE B 2 52  ? 10.999  9.237   0.927   1.00 0.00  ? 191 PHE B H    3  
ATOM   4545  H HA   . PHE B 2 52  ? 13.414  8.335   2.293   1.00 0.00  ? 191 PHE B HA   3  
ATOM   4546  H HB2  . PHE B 2 52  ? 13.863  7.314   0.140   1.00 0.00  ? 191 PHE B HB2  3  
ATOM   4547  H HB3  . PHE B 2 52  ? 13.445  8.807   -0.701  1.00 0.00  ? 191 PHE B HB3  3  
ATOM   4548  H HD1  . PHE B 2 52  ? 15.873  7.290   1.691   1.00 0.00  ? 191 PHE B HD1  3  
ATOM   4549  H HD2  . PHE B 2 52  ? 15.041  10.554  -0.990  1.00 0.00  ? 191 PHE B HD2  3  
ATOM   4550  H HE1  . PHE B 2 52  ? 18.220  8.073   1.917   1.00 0.00  ? 191 PHE B HE1  3  
ATOM   4551  H HE2  . PHE B 2 52  ? 17.388  11.337  -0.764  1.00 0.00  ? 191 PHE B HE2  3  
ATOM   4552  H HZ   . PHE B 2 52  ? 18.977  10.096  0.690   1.00 0.00  ? 191 PHE B HZ   3  
ATOM   4553  N N    . ASP B 2 53  ? 14.190  10.764  2.390   1.00 32.66 ? 192 ASP B N    3  
ATOM   4554  C CA   . ASP B 2 53  ? 14.400  12.222  2.619   1.00 38.82 ? 192 ASP B CA   3  
ATOM   4555  C C    . ASP B 2 53  ? 15.899  12.514  2.708   1.00 41.14 ? 192 ASP B C    3  
ATOM   4556  O O    . ASP B 2 53  ? 16.700  11.632  2.951   1.00 38.49 ? 192 ASP B O    3  
ATOM   4557  C CB   . ASP B 2 53  ? 13.724  12.636  3.928   1.00 42.78 ? 192 ASP B CB   3  
ATOM   4558  C CG   . ASP B 2 53  ? 13.111  14.029  3.770   1.00 45.03 ? 192 ASP B CG   3  
ATOM   4559  O OD1  . ASP B 2 53  ? 12.243  14.182  2.927   1.00 46.40 ? 192 ASP B OD1  3  
ATOM   4560  O OD2  . ASP B 2 53  ? 13.522  14.920  4.496   1.00 49.15 ? 192 ASP B OD2  3  
ATOM   4561  H H    . ASP B 2 53  ? 14.771  10.109  2.832   1.00 0.00  ? 192 ASP B H    3  
ATOM   4562  H HA   . ASP B 2 53  ? 13.973  12.781  1.800   1.00 0.00  ? 192 ASP B HA   3  
ATOM   4563  H HB2  . ASP B 2 53  ? 12.947  11.926  4.171   1.00 0.00  ? 192 ASP B HB2  3  
ATOM   4564  H HB3  . ASP B 2 53  ? 14.456  12.654  4.721   1.00 0.00  ? 192 ASP B HB3  3  
ATOM   4565  N N    . ASN B 2 54  ? 16.286  13.745  2.514   1.00 45.91 ? 193 ASN B N    3  
ATOM   4566  C CA   . ASN B 2 54  ? 17.732  14.093  2.588   1.00 50.53 ? 193 ASN B CA   3  
ATOM   4567  C C    . ASN B 2 54  ? 18.110  14.400  4.039   1.00 51.37 ? 193 ASN B C    3  
ATOM   4568  O O    . ASN B 2 54  ? 18.718  15.410  4.332   1.00 52.38 ? 193 ASN B O    3  
ATOM   4569  C CB   . ASN B 2 54  ? 18.007  15.322  1.719   1.00 54.84 ? 193 ASN B CB   3  
ATOM   4570  C CG   . ASN B 2 54  ? 19.369  15.171  1.040   1.00 60.46 ? 193 ASN B CG   3  
ATOM   4571  O OD1  . ASN B 2 54  ? 20.257  14.533  1.570   1.00 63.78 ? 193 ASN B OD1  3  
ATOM   4572  N ND2  . ASN B 2 54  ? 19.574  15.734  -0.120  1.00 62.09 ? 193 ASN B ND2  3  
ATOM   4573  H H    . ASN B 2 54  ? 15.627  14.440  2.320   1.00 0.00  ? 193 ASN B H    3  
ATOM   4574  H HA   . ASN B 2 54  ? 18.318  13.262  2.231   1.00 0.00  ? 193 ASN B HA   3  
ATOM   4575  H HB2  . ASN B 2 54  ? 17.236  15.410  0.967   1.00 0.00  ? 193 ASN B HB2  3  
ATOM   4576  H HB3  . ASN B 2 54  ? 18.012  16.207  2.338   1.00 0.00  ? 193 ASN B HB3  3  
ATOM   4577  H HD21 . ASN B 2 54  ? 18.854  16.249  -0.548  1.00 0.00  ? 193 ASN B HD21 3  
ATOM   4578  H HD22 . ASN B 2 54  ? 20.447  15.640  -0.562  1.00 0.00  ? 193 ASN B HD22 3  
ATOM   4579  N N    . ALA B 2 55  ? 17.752  13.536  4.950   1.00 51.03 ? 194 ALA B N    3  
ATOM   4580  C CA   . ALA B 2 55  ? 18.091  13.779  6.381   1.00 49.87 ? 194 ALA B CA   3  
ATOM   4581  C C    . ALA B 2 55  ? 18.679  12.506  6.991   1.00 48.78 ? 194 ALA B C    3  
ATOM   4582  O O    . ALA B 2 55  ? 19.713  12.531  7.628   1.00 50.16 ? 194 ALA B O    3  
ATOM   4583  C CB   . ALA B 2 55  ? 16.825  14.173  7.145   1.00 50.70 ? 194 ALA B CB   3  
ATOM   4584  H H    . ALA B 2 55  ? 17.261  12.728  4.694   1.00 0.00  ? 194 ALA B H    3  
ATOM   4585  H HA   . ALA B 2 55  ? 18.814  14.578  6.449   1.00 0.00  ? 194 ALA B HA   3  
ATOM   4586  H HB1  . ALA B 2 55  ? 15.996  13.570  6.803   1.00 0.00  ? 194 ALA B HB1  3  
ATOM   4587  H HB2  . ALA B 2 55  ? 16.977  14.009  8.202   1.00 0.00  ? 194 ALA B HB2  3  
ATOM   4588  H HB3  . ALA B 2 55  ? 16.608  15.216  6.970   1.00 0.00  ? 194 ALA B HB3  3  
ATOM   4589  N N    . LYS B 2 56  ? 18.028  11.391  6.802   1.00 45.35 ? 195 LYS B N    3  
ATOM   4590  C CA   . LYS B 2 56  ? 18.551  10.117  7.373   1.00 41.76 ? 195 LYS B CA   3  
ATOM   4591  C C    . LYS B 2 56  ? 18.676  9.073   6.262   1.00 38.59 ? 195 LYS B C    3  
ATOM   4592  O O    . LYS B 2 56  ? 19.763  8.667   5.897   1.00 39.85 ? 195 LYS B O    3  
ATOM   4593  C CB   . LYS B 2 56  ? 17.588  9.607   8.446   1.00 42.95 ? 195 LYS B CB   3  
ATOM   4594  C CG   . LYS B 2 56  ? 17.366  10.698  9.495   1.00 45.27 ? 195 LYS B CG   3  
ATOM   4595  C CD   . LYS B 2 56  ? 16.023  11.386  9.241   1.00 47.56 ? 195 LYS B CD   3  
ATOM   4596  C CE   . LYS B 2 56  ? 15.654  12.252  10.447  1.00 50.16 ? 195 LYS B CE   3  
ATOM   4597  N NZ   . LYS B 2 56  ? 16.721  13.267  10.674  1.00 50.69 ? 195 LYS B NZ   3  
ATOM   4598  H H    . LYS B 2 56  ? 17.194  11.390  6.286   1.00 0.00  ? 195 LYS B H    3  
ATOM   4599  H HA   . LYS B 2 56  ? 19.520  10.291  7.813   1.00 0.00  ? 195 LYS B HA   3  
ATOM   4600  H HB2  . LYS B 2 56  ? 16.646  9.349   7.988   1.00 0.00  ? 195 LYS B HB2  3  
ATOM   4601  H HB3  . LYS B 2 56  ? 18.009  8.734   8.921   1.00 0.00  ? 195 LYS B HB3  3  
ATOM   4602  H HG2  . LYS B 2 56  ? 17.364  10.256  10.480  1.00 0.00  ? 195 LYS B HG2  3  
ATOM   4603  H HG3  . LYS B 2 56  ? 18.160  11.428  9.429   1.00 0.00  ? 195 LYS B HG3  3  
ATOM   4604  H HD2  . LYS B 2 56  ? 16.098  12.006  8.359   1.00 0.00  ? 195 LYS B HD2  3  
ATOM   4605  H HD3  . LYS B 2 56  ? 15.259  10.637  9.090   1.00 0.00  ? 195 LYS B HD3  3  
ATOM   4606  H HE2  . LYS B 2 56  ? 14.716  12.752  10.257  1.00 0.00  ? 195 LYS B HE2  3  
ATOM   4607  H HE3  . LYS B 2 56  ? 15.558  11.628  11.322  1.00 0.00  ? 195 LYS B HE3  3  
ATOM   4608  H HZ1  . LYS B 2 56  ? 17.460  13.163  9.950   1.00 0.00  ? 195 LYS B HZ1  3  
ATOM   4609  H HZ2  . LYS B 2 56  ? 16.312  14.220  10.613  1.00 0.00  ? 195 LYS B HZ2  3  
ATOM   4610  H HZ3  . LYS B 2 56  ? 17.136  13.127  11.618  1.00 0.00  ? 195 LYS B HZ3  3  
ATOM   4611  N N    . GLY B 2 57  ? 17.574  8.632   5.719   1.00 34.40 ? 196 GLY B N    3  
ATOM   4612  C CA   . GLY B 2 57  ? 17.633  7.614   4.633   1.00 29.38 ? 196 GLY B CA   3  
ATOM   4613  C C    . GLY B 2 57  ? 16.222  7.345   4.106   1.00 25.82 ? 196 GLY B C    3  
ATOM   4614  O O    . GLY B 2 57  ? 15.407  8.241   4.005   1.00 25.14 ? 196 GLY B O    3  
ATOM   4615  H H    . GLY B 2 57  ? 16.707  8.971   6.027   1.00 0.00  ? 196 GLY B H    3  
ATOM   4616  H HA2  . GLY B 2 57  ? 18.254  7.980   3.829   1.00 0.00  ? 196 GLY B HA2  3  
ATOM   4617  H HA3  . GLY B 2 57  ? 18.048  6.696   5.021   1.00 0.00  ? 196 GLY B HA3  3  
ATOM   4618  N N    . LEU B 2 58  ? 15.925  6.120   3.769   1.00 25.09 ? 197 LEU B N    3  
ATOM   4619  C CA   . LEU B 2 58  ? 14.566  5.799   3.250   1.00 24.92 ? 197 LEU B CA   3  
ATOM   4620  C C    . LEU B 2 58  ? 13.789  5.009   4.303   1.00 23.75 ? 197 LEU B C    3  
ATOM   4621  O O    . LEU B 2 58  ? 14.352  4.243   5.060   1.00 23.93 ? 197 LEU B O    3  
ATOM   4622  C CB   . LEU B 2 58  ? 14.689  4.964   1.973   1.00 25.84 ? 197 LEU B CB   3  
ATOM   4623  C CG   . LEU B 2 58  ? 15.483  3.690   2.269   1.00 30.07 ? 197 LEU B CG   3  
ATOM   4624  C CD1  . LEU B 2 58  ? 14.990  2.559   1.366   1.00 29.71 ? 197 LEU B CD1  3  
ATOM   4625  C CD2  . LEU B 2 58  ? 16.967  3.945   2.002   1.00 30.59 ? 197 LEU B CD2  3  
ATOM   4626  H H    . LEU B 2 58  ? 16.597  5.411   3.858   1.00 0.00  ? 197 LEU B H    3  
ATOM   4627  H HA   . LEU B 2 58  ? 14.041  6.716   3.029   1.00 0.00  ? 197 LEU B HA   3  
ATOM   4628  H HB2  . LEU B 2 58  ? 13.703  4.699   1.621   1.00 0.00  ? 197 LEU B HB2  3  
ATOM   4629  H HB3  . LEU B 2 58  ? 15.201  5.536   1.216   1.00 0.00  ? 197 LEU B HB3  3  
ATOM   4630  H HG   . LEU B 2 58  ? 15.344  3.411   3.304   1.00 0.00  ? 197 LEU B HG   3  
ATOM   4631  H HD11 . LEU B 2 58  ? 14.636  2.972   0.433   1.00 0.00  ? 197 LEU B HD11 3  
ATOM   4632  H HD12 . LEU B 2 58  ? 15.803  1.874   1.171   1.00 0.00  ? 197 LEU B HD12 3  
ATOM   4633  H HD13 . LEU B 2 58  ? 14.185  2.032   1.855   1.00 0.00  ? 197 LEU B HD13 3  
ATOM   4634  H HD21 . LEU B 2 58  ? 17.144  5.008   1.934   1.00 0.00  ? 197 LEU B HD21 3  
ATOM   4635  H HD22 . LEU B 2 58  ? 17.554  3.533   2.810   1.00 0.00  ? 197 LEU B HD22 3  
ATOM   4636  H HD23 . LEU B 2 58  ? 17.252  3.471   1.073   1.00 0.00  ? 197 LEU B HD23 3  
ATOM   4637  N N    . ASN B 2 59  ? 12.498  5.187   4.354   1.00 21.78 ? 198 ASN B N    3  
ATOM   4638  C CA   . ASN B 2 59  ? 11.682  4.446   5.357   1.00 19.17 ? 198 ASN B CA   3  
ATOM   4639  C C    . ASN B 2 59  ? 10.571  3.678   4.639   1.00 16.90 ? 198 ASN B C    3  
ATOM   4640  O O    . ASN B 2 59  ? 10.513  3.642   3.426   1.00 15.60 ? 198 ASN B O    3  
ATOM   4641  C CB   . ASN B 2 59  ? 11.062  5.437   6.344   1.00 18.45 ? 198 ASN B CB   3  
ATOM   4642  C CG   . ASN B 2 59  ? 12.067  6.548   6.656   1.00 20.04 ? 198 ASN B CG   3  
ATOM   4643  O OD1  . ASN B 2 59  ? 12.828  6.446   7.597   1.00 23.65 ? 198 ASN B OD1  3  
ATOM   4644  N ND2  . ASN B 2 59  ? 12.101  7.611   5.901   1.00 21.55 ? 198 ASN B ND2  3  
ATOM   4645  H H    . ASN B 2 59  ? 12.064  5.808   3.733   1.00 0.00  ? 198 ASN B H    3  
ATOM   4646  H HA   . ASN B 2 59  ? 12.313  3.752   5.892   1.00 0.00  ? 198 ASN B HA   3  
ATOM   4647  H HB2  . ASN B 2 59  ? 10.171  5.868   5.906   1.00 0.00  ? 198 ASN B HB2  3  
ATOM   4648  H HB3  . ASN B 2 59  ? 10.802  4.923   7.256   1.00 0.00  ? 198 ASN B HB3  3  
ATOM   4649  H HD21 . ASN B 2 59  ? 11.483  7.693   5.139   1.00 0.00  ? 198 ASN B HD21 3  
ATOM   4650  H HD22 . ASN B 2 59  ? 12.743  8.331   6.096   1.00 0.00  ? 198 ASN B HD22 3  
ATOM   4651  N N    . VAL B 2 60  ? 9.688   3.065   5.377   1.00 14.62 ? 199 VAL B N    3  
ATOM   4652  C CA   . VAL B 2 60  ? 8.582   2.303   4.734   1.00 11.82 ? 199 VAL B CA   3  
ATOM   4653  C C    . VAL B 2 60  ? 7.254   2.673   5.398   1.00 10.68 ? 199 VAL B C    3  
ATOM   4654  O O    . VAL B 2 60  ? 7.019   2.368   6.551   1.00 13.24 ? 199 VAL B O    3  
ATOM   4655  C CB   . VAL B 2 60  ? 8.831   0.804   4.897   1.00 9.61  ? 199 VAL B CB   3  
ATOM   4656  C CG1  . VAL B 2 60  ? 7.979   0.032   3.888   1.00 11.94 ? 199 VAL B CG1  3  
ATOM   4657  C CG2  . VAL B 2 60  ? 10.310  0.503   4.648   1.00 10.00 ? 199 VAL B CG2  3  
ATOM   4658  H H    . VAL B 2 60  ? 9.752   3.106   6.354   1.00 0.00  ? 199 VAL B H    3  
ATOM   4659  H HA   . VAL B 2 60  ? 8.540   2.548   3.683   1.00 0.00  ? 199 VAL B HA   3  
ATOM   4660  H HB   . VAL B 2 60  ? 8.563   0.502   5.899   1.00 0.00  ? 199 VAL B HB   3  
ATOM   4661  H HG11 . VAL B 2 60  ? 6.969   0.416   3.901   1.00 0.00  ? 199 VAL B HG11 3  
ATOM   4662  H HG12 . VAL B 2 60  ? 8.396   0.151   2.899   1.00 0.00  ? 199 VAL B HG12 3  
ATOM   4663  H HG13 . VAL B 2 60  ? 7.969   -1.015  4.151   1.00 0.00  ? 199 VAL B HG13 3  
ATOM   4664  H HG21 . VAL B 2 60  ? 10.764  1.335   4.131   1.00 0.00  ? 199 VAL B HG21 3  
ATOM   4665  H HG22 . VAL B 2 60  ? 10.810  0.350   5.593   1.00 0.00  ? 199 VAL B HG22 3  
ATOM   4666  H HG23 . VAL B 2 60  ? 10.401  -0.388  4.045   1.00 0.00  ? 199 VAL B HG23 3  
ATOM   4667  N N    . LYS B 2 61  ? 6.385   3.328   4.680   1.00 11.30 ? 200 LYS B N    3  
ATOM   4668  C CA   . LYS B 2 61  ? 5.075   3.718   5.266   1.00 11.14 ? 200 LYS B CA   3  
ATOM   4669  C C    . LYS B 2 61  ? 4.041   2.630   4.971   1.00 8.78  ? 200 LYS B C    3  
ATOM   4670  O O    . LYS B 2 61  ? 3.653   2.420   3.839   1.00 9.63  ? 200 LYS B O    3  
ATOM   4671  C CB   . LYS B 2 61  ? 4.618   5.038   4.644   1.00 11.27 ? 200 LYS B CB   3  
ATOM   4672  C CG   . LYS B 2 61  ? 5.658   6.125   4.925   1.00 16.97 ? 200 LYS B CG   3  
ATOM   4673  C CD   . LYS B 2 61  ? 5.395   6.744   6.300   1.00 21.04 ? 200 LYS B CD   3  
ATOM   4674  C CE   . LYS B 2 61  ? 4.974   8.205   6.128   1.00 28.12 ? 200 LYS B CE   3  
ATOM   4675  N NZ   . LYS B 2 61  ? 6.156   9.089   6.337   1.00 32.40 ? 200 LYS B NZ   3  
ATOM   4676  H H    . LYS B 2 61  ? 6.594   3.564   3.753   1.00 0.00  ? 200 LYS B H    3  
ATOM   4677  H HA   . LYS B 2 61  ? 5.178   3.839   6.334   1.00 0.00  ? 200 LYS B HA   3  
ATOM   4678  H HB2  . LYS B 2 61  ? 4.506   4.912   3.577   1.00 0.00  ? 200 LYS B HB2  3  
ATOM   4679  H HB3  . LYS B 2 61  ? 3.674   5.328   5.074   1.00 0.00  ? 200 LYS B HB3  3  
ATOM   4680  H HG2  . LYS B 2 61  ? 6.647   5.688   4.910   1.00 0.00  ? 200 LYS B HG2  3  
ATOM   4681  H HG3  . LYS B 2 61  ? 5.591   6.891   4.168   1.00 0.00  ? 200 LYS B HG3  3  
ATOM   4682  H HD2  . LYS B 2 61  ? 4.605   6.197   6.795   1.00 0.00  ? 200 LYS B HD2  3  
ATOM   4683  H HD3  . LYS B 2 61  ? 6.294   6.697   6.894   1.00 0.00  ? 200 LYS B HD3  3  
ATOM   4684  H HE2  . LYS B 2 61  ? 4.584   8.353   5.133   1.00 0.00  ? 200 LYS B HE2  3  
ATOM   4685  H HE3  . LYS B 2 61  ? 4.212   8.447   6.854   1.00 0.00  ? 200 LYS B HE3  3  
ATOM   4686  H HZ1  . LYS B 2 61  ? 6.860   8.597   6.923   1.00 0.00  ? 200 LYS B HZ1  3  
ATOM   4687  H HZ2  . LYS B 2 61  ? 6.577   9.327   5.415   1.00 0.00  ? 200 LYS B HZ2  3  
ATOM   4688  H HZ3  . LYS B 2 61  ? 5.857   9.961   6.817   1.00 0.00  ? 200 LYS B HZ3  3  
ATOM   4689  N N    . HIS B 2 62  ? 3.594   1.935   5.980   1.00 7.82  ? 201 HIS B N    3  
ATOM   4690  C CA   . HIS B 2 62  ? 2.587   0.860   5.755   1.00 7.41  ? 201 HIS B CA   3  
ATOM   4691  C C    . HIS B 2 62  ? 1.178   1.445   5.871   1.00 9.79  ? 201 HIS B C    3  
ATOM   4692  O O    . HIS B 2 62  ? 0.822   2.043   6.866   1.00 10.36 ? 201 HIS B O    3  
ATOM   4693  C CB   . HIS B 2 62  ? 2.771   -0.238  6.803   1.00 6.15  ? 201 HIS B CB   3  
ATOM   4694  C CG   . HIS B 2 62  ? 3.836   -1.197  6.345   1.00 5.80  ? 201 HIS B CG   3  
ATOM   4695  N ND1  . HIS B 2 62  ? 3.540   -2.483  5.925   1.00 7.97  ? 201 HIS B ND1  3  
ATOM   4696  C CD2  . HIS B 2 62  ? 5.198   -1.070  6.235   1.00 7.69  ? 201 HIS B CD2  3  
ATOM   4697  C CE1  . HIS B 2 62  ? 4.700   -3.075  5.585   1.00 7.75  ? 201 HIS B CE1  3  
ATOM   4698  N NE2  . HIS B 2 62  ? 5.742   -2.257  5.755   1.00 6.51  ? 201 HIS B NE2  3  
ATOM   4699  H H    . HIS B 2 62  ? 3.920   2.118   6.886   1.00 0.00  ? 201 HIS B H    3  
ATOM   4700  H HA   . HIS B 2 62  ? 2.722   0.442   4.768   1.00 0.00  ? 201 HIS B HA   3  
ATOM   4701  H HB2  . HIS B 2 62  ? 3.066   0.206   7.743   1.00 0.00  ? 201 HIS B HB2  3  
ATOM   4702  H HB3  . HIS B 2 62  ? 1.840   -0.771  6.934   1.00 0.00  ? 201 HIS B HB3  3  
ATOM   4703  H HD1  . HIS B 2 62  ? 2.649   -2.889  5.883   1.00 0.00  ? 201 HIS B HD1  3  
ATOM   4704  H HD2  . HIS B 2 62  ? 5.763   -0.183  6.485   1.00 0.00  ? 201 HIS B HD2  3  
ATOM   4705  H HE1  . HIS B 2 62  ? 4.779   -4.088  5.218   1.00 0.00  ? 201 HIS B HE1  3  
ATOM   4706  N N    . TYR B 2 63  ? 0.371   1.273   4.860   1.00 10.61 ? 202 TYR B N    3  
ATOM   4707  C CA   . TYR B 2 63  ? -1.016  1.814   4.907   1.00 10.61 ? 202 TYR B CA   3  
ATOM   4708  C C    . TYR B 2 63  ? -2.009  0.650   4.915   1.00 10.67 ? 202 TYR B C    3  
ATOM   4709  O O    . TYR B 2 63  ? -2.389  0.139   3.879   1.00 11.97 ? 202 TYR B O    3  
ATOM   4710  C CB   . TYR B 2 63  ? -1.262  2.686   3.675   1.00 10.02 ? 202 TYR B CB   3  
ATOM   4711  C CG   . TYR B 2 63  ? -0.699  4.066   3.913   1.00 10.20 ? 202 TYR B CG   3  
ATOM   4712  C CD1  . TYR B 2 63  ? 0.669   4.312   3.705   1.00 10.92 ? 202 TYR B CD1  3  
ATOM   4713  C CD2  . TYR B 2 63  ? -1.541  5.106   4.342   1.00 9.08  ? 202 TYR B CD2  3  
ATOM   4714  C CE1  . TYR B 2 63  ? 1.194   5.596   3.925   1.00 11.72 ? 202 TYR B CE1  3  
ATOM   4715  C CE2  . TYR B 2 63  ? -1.016  6.390   4.563   1.00 11.32 ? 202 TYR B CE2  3  
ATOM   4716  C CZ   . TYR B 2 63  ? 0.351   6.635   4.354   1.00 12.88 ? 202 TYR B CZ   3  
ATOM   4717  O OH   . TYR B 2 63  ? 0.868   7.896   4.571   1.00 13.22 ? 202 TYR B OH   3  
ATOM   4718  H H    . TYR B 2 63  ? 0.677   0.786   4.067   1.00 0.00  ? 202 TYR B H    3  
ATOM   4719  H HA   . TYR B 2 63  ? -1.144  2.405   5.801   1.00 0.00  ? 202 TYR B HA   3  
ATOM   4720  H HB2  . TYR B 2 63  ? -0.779  2.242   2.818   1.00 0.00  ? 202 TYR B HB2  3  
ATOM   4721  H HB3  . TYR B 2 63  ? -2.322  2.757   3.492   1.00 0.00  ? 202 TYR B HB3  3  
ATOM   4722  H HD1  . TYR B 2 63  ? 1.316   3.513   3.376   1.00 0.00  ? 202 TYR B HD1  3  
ATOM   4723  H HD2  . TYR B 2 63  ? -2.593  4.917   4.502   1.00 0.00  ? 202 TYR B HD2  3  
ATOM   4724  H HE1  . TYR B 2 63  ? 2.245   5.784   3.765   1.00 0.00  ? 202 TYR B HE1  3  
ATOM   4725  H HE2  . TYR B 2 63  ? -1.664  7.189   4.892   1.00 0.00  ? 202 TYR B HE2  3  
ATOM   4726  H HH   . TYR B 2 63  ? 1.230   7.919   5.460   1.00 0.00  ? 202 TYR B HH   3  
ATOM   4727  N N    . LYS B 2 64  ? -2.427  0.223   6.073   1.00 11.16 ? 203 LYS B N    3  
ATOM   4728  C CA   . LYS B 2 64  ? -3.390  -0.913  6.145   1.00 13.85 ? 203 LYS B CA   3  
ATOM   4729  C C    . LYS B 2 64  ? -4.664  -0.561  5.372   1.00 13.44 ? 203 LYS B C    3  
ATOM   4730  O O    . LYS B 2 64  ? -5.265  0.474   5.582   1.00 12.80 ? 203 LYS B O    3  
ATOM   4731  C CB   . LYS B 2 64  ? -3.743  -1.189  7.608   1.00 19.04 ? 203 LYS B CB   3  
ATOM   4732  C CG   . LYS B 2 64  ? -4.211  0.106   8.276   1.00 23.92 ? 203 LYS B CG   3  
ATOM   4733  C CD   . LYS B 2 64  ? -5.669  -0.042  8.713   1.00 29.39 ? 203 LYS B CD   3  
ATOM   4734  C CE   . LYS B 2 64  ? -5.728  -0.740  10.073  1.00 31.37 ? 203 LYS B CE   3  
ATOM   4735  N NZ   . LYS B 2 64  ? -6.919  -1.635  10.120  1.00 36.57 ? 203 LYS B NZ   3  
ATOM   4736  H H    . LYS B 2 64  ? -2.106  0.645   6.896   1.00 0.00  ? 203 LYS B H    3  
ATOM   4737  H HA   . LYS B 2 64  ? -2.940  -1.793  5.713   1.00 0.00  ? 203 LYS B HA   3  
ATOM   4738  H HB2  . LYS B 2 64  ? -4.534  -1.924  7.655   1.00 0.00  ? 203 LYS B HB2  3  
ATOM   4739  H HB3  . LYS B 2 64  ? -2.872  -1.563  8.125   1.00 0.00  ? 203 LYS B HB3  3  
ATOM   4740  H HG2  . LYS B 2 64  ? -3.594  0.308   9.140   1.00 0.00  ? 203 LYS B HG2  3  
ATOM   4741  H HG3  . LYS B 2 64  ? -4.128  0.923   7.576   1.00 0.00  ? 203 LYS B HG3  3  
ATOM   4742  H HD2  . LYS B 2 64  ? -6.123  0.936   8.789   1.00 0.00  ? 203 LYS B HD2  3  
ATOM   4743  H HD3  . LYS B 2 64  ? -6.206  -0.632  7.985   1.00 0.00  ? 203 LYS B HD3  3  
ATOM   4744  H HE2  . LYS B 2 64  ? -4.832  -1.325  10.216  1.00 0.00  ? 203 LYS B HE2  3  
ATOM   4745  H HE3  . LYS B 2 64  ? -5.803  0.000   10.856  1.00 0.00  ? 203 LYS B HE3  3  
ATOM   4746  H HZ1  . LYS B 2 64  ? -7.148  -1.959  9.160   1.00 0.00  ? 203 LYS B HZ1  3  
ATOM   4747  H HZ2  . LYS B 2 64  ? -6.711  -2.458  10.721  1.00 0.00  ? 203 LYS B HZ2  3  
ATOM   4748  H HZ3  . LYS B 2 64  ? -7.728  -1.114  10.514  1.00 0.00  ? 203 LYS B HZ3  3  
ATOM   4749  N N    . ILE B 2 65  ? -5.082  -1.420  4.483   1.00 14.05 ? 204 ILE B N    3  
ATOM   4750  C CA   . ILE B 2 65  ? -6.321  -1.144  3.700   1.00 13.51 ? 204 ILE B CA   3  
ATOM   4751  C C    . ILE B 2 65  ? -7.523  -1.713  4.456   1.00 14.04 ? 204 ILE B C    3  
ATOM   4752  O O    . ILE B 2 65  ? -7.577  -2.888  4.761   1.00 15.82 ? 204 ILE B O    3  
ATOM   4753  C CB   . ILE B 2 65  ? -6.215  -1.809  2.325   1.00 12.30 ? 204 ILE B CB   3  
ATOM   4754  C CG1  . ILE B 2 65  ? -5.164  -1.075  1.486   1.00 11.29 ? 204 ILE B CG1  3  
ATOM   4755  C CG2  . ILE B 2 65  ? -7.569  -1.740  1.616   1.00 14.21 ? 204 ILE B CG2  3  
ATOM   4756  C CD1  . ILE B 2 65  ? -4.825  -1.909  0.250   1.00 13.89 ? 204 ILE B CD1  3  
ATOM   4757  H H    . ILE B 2 65  ? -4.585  -2.252  4.333   1.00 0.00  ? 204 ILE B H    3  
ATOM   4758  H HA   . ILE B 2 65  ? -6.443  -0.077  3.580   1.00 0.00  ? 204 ILE B HA   3  
ATOM   4759  H HB   . ILE B 2 65  ? -5.923  -2.842  2.447   1.00 0.00  ? 204 ILE B HB   3  
ATOM   4760  H HG12 . ILE B 2 65  ? -5.556  -0.116  1.179   1.00 0.00  ? 204 ILE B HG12 3  
ATOM   4761  H HG13 . ILE B 2 65  ? -4.272  -0.929  2.075   1.00 0.00  ? 204 ILE B HG13 3  
ATOM   4762  H HG21 . ILE B 2 65  ? -8.040  -0.792  1.829   1.00 0.00  ? 204 ILE B HG21 3  
ATOM   4763  H HG22 . ILE B 2 65  ? -7.423  -1.838  0.550   1.00 0.00  ? 204 ILE B HG22 3  
ATOM   4764  H HG23 . ILE B 2 65  ? -8.200  -2.542  1.968   1.00 0.00  ? 204 ILE B HG23 3  
ATOM   4765  H HD11 . ILE B 2 65  ? -5.571  -2.678  0.118   1.00 0.00  ? 204 ILE B HD11 3  
ATOM   4766  H HD12 . ILE B 2 65  ? -4.809  -1.271  -0.621  1.00 0.00  ? 204 ILE B HD12 3  
ATOM   4767  H HD13 . ILE B 2 65  ? -3.855  -2.367  0.379   1.00 0.00  ? 204 ILE B HD13 3  
ATOM   4768  N N    . ARG B 2 66  ? -8.485  -0.889  4.769   1.00 15.56 ? 205 ARG B N    3  
ATOM   4769  C CA   . ARG B 2 66  ? -9.674  -1.385  5.515   1.00 13.76 ? 205 ARG B CA   3  
ATOM   4770  C C    . ARG B 2 66  ? -10.669 -2.021  4.548   1.00 13.72 ? 205 ARG B C    3  
ATOM   4771  O O    . ARG B 2 66  ? -10.566 -1.881  3.345   1.00 13.25 ? 205 ARG B O    3  
ATOM   4772  C CB   . ARG B 2 66  ? -10.345 -0.220  6.239   1.00 15.23 ? 205 ARG B CB   3  
ATOM   4773  C CG   . ARG B 2 66  ? -9.269  0.645   6.886   1.00 20.69 ? 205 ARG B CG   3  
ATOM   4774  C CD   . ARG B 2 66  ? -9.924  1.769   7.690   1.00 28.70 ? 205 ARG B CD   3  
ATOM   4775  N NE   . ARG B 2 66  ? -8.946  2.309   8.675   1.00 38.45 ? 205 ARG B NE   3  
ATOM   4776  C CZ   . ARG B 2 66  ? -9.317  3.222   9.530   1.00 41.91 ? 205 ARG B CZ   3  
ATOM   4777  N NH1  . ARG B 2 66  ? -9.924  4.298   9.111   1.00 41.78 ? 205 ARG B NH1  3  
ATOM   4778  N NH2  . ARG B 2 66  ? -9.081  3.059   10.802  1.00 44.96 ? 205 ARG B NH2  3  
ATOM   4779  H H    . ARG B 2 66  ? -8.420  0.058   4.520   1.00 0.00  ? 205 ARG B H    3  
ATOM   4780  H HA   . ARG B 2 66  ? -9.360  -2.121  6.239   1.00 0.00  ? 205 ARG B HA   3  
ATOM   4781  H HB2  . ARG B 2 66  ? -10.910 0.368   5.530   1.00 0.00  ? 205 ARG B HB2  3  
ATOM   4782  H HB3  . ARG B 2 66  ? -11.006 -0.601  7.002   1.00 0.00  ? 205 ARG B HB3  3  
ATOM   4783  H HG2  . ARG B 2 66  ? -8.669  0.034   7.543   1.00 0.00  ? 205 ARG B HG2  3  
ATOM   4784  H HG3  . ARG B 2 66  ? -8.644  1.072   6.117   1.00 0.00  ? 205 ARG B HG3  3  
ATOM   4785  H HD2  . ARG B 2 66  ? -10.232 2.559   7.020   1.00 0.00  ? 205 ARG B HD2  3  
ATOM   4786  H HD3  . ARG B 2 66  ? -10.788 1.383   8.211   1.00 0.00  ? 205 ARG B HD3  3  
ATOM   4787  H HE   . ARG B 2 66  ? -8.024  1.977   8.683   1.00 0.00  ? 205 ARG B HE   3  
ATOM   4788  H HH11 . ARG B 2 66  ? -10.105 4.422   8.134   1.00 0.00  ? 205 ARG B HH11 3  
ATOM   4789  H HH12 . ARG B 2 66  ? -10.209 4.999   9.765   1.00 0.00  ? 205 ARG B HH12 3  
ATOM   4790  H HH21 . ARG B 2 66  ? -8.617  2.234   11.123  1.00 0.00  ? 205 ARG B HH21 3  
ATOM   4791  H HH22 . ARG B 2 66  ? -9.366  3.759   11.457  1.00 0.00  ? 205 ARG B HH22 3  
ATOM   4792  N N    . LYS B 2 67  ? -11.630 -2.723  5.075   1.00 14.89 ? 206 LYS B N    3  
ATOM   4793  C CA   . LYS B 2 67  ? -12.642 -3.382  4.204   1.00 18.13 ? 206 LYS B CA   3  
ATOM   4794  C C    . LYS B 2 67  ? -14.013 -3.332  4.883   1.00 17.74 ? 206 LYS B C    3  
ATOM   4795  O O    . LYS B 2 67  ? -14.136 -3.545  6.073   1.00 18.39 ? 206 LYS B O    3  
ATOM   4796  C CB   . LYS B 2 67  ? -12.239 -4.843  3.980   1.00 21.97 ? 206 LYS B CB   3  
ATOM   4797  C CG   . LYS B 2 67  ? -13.393 -5.608  3.322   1.00 27.97 ? 206 LYS B CG   3  
ATOM   4798  C CD   . LYS B 2 67  ? -12.933 -6.173  1.979   1.00 32.27 ? 206 LYS B CD   3  
ATOM   4799  C CE   . LYS B 2 67  ? -13.971 -7.172  1.463   1.00 33.99 ? 206 LYS B CE   3  
ATOM   4800  N NZ   . LYS B 2 67  ? -13.344 -8.055  0.439   1.00 35.74 ? 206 LYS B NZ   3  
ATOM   4801  H H    . LYS B 2 67  ? -11.684 -2.816  6.048   1.00 0.00  ? 206 LYS B H    3  
ATOM   4802  H HA   . LYS B 2 67  ? -12.691 -2.872  3.254   1.00 0.00  ? 206 LYS B HA   3  
ATOM   4803  H HB2  . LYS B 2 67  ? -11.370 -4.880  3.339   1.00 0.00  ? 206 LYS B HB2  3  
ATOM   4804  H HB3  . LYS B 2 67  ? -12.003 -5.299  4.929   1.00 0.00  ? 206 LYS B HB3  3  
ATOM   4805  H HG2  . LYS B 2 67  ? -13.703 -6.418  3.969   1.00 0.00  ? 206 LYS B HG2  3  
ATOM   4806  H HG3  . LYS B 2 67  ? -14.226 -4.939  3.163   1.00 0.00  ? 206 LYS B HG3  3  
ATOM   4807  H HD2  . LYS B 2 67  ? -12.825 -5.368  1.268   1.00 0.00  ? 206 LYS B HD2  3  
ATOM   4808  H HD3  . LYS B 2 67  ? -11.985 -6.674  2.104   1.00 0.00  ? 206 LYS B HD3  3  
ATOM   4809  H HE2  . LYS B 2 67  ? -14.331 -7.773  2.284   1.00 0.00  ? 206 LYS B HE2  3  
ATOM   4810  H HE3  . LYS B 2 67  ? -14.797 -6.637  1.020   1.00 0.00  ? 206 LYS B HE3  3  
ATOM   4811  H HZ1  . LYS B 2 67  ? -12.452 -7.632  0.115   1.00 0.00  ? 206 LYS B HZ1  3  
ATOM   4812  H HZ2  . LYS B 2 67  ? -13.155 -8.989  0.856   1.00 0.00  ? 206 LYS B HZ2  3  
ATOM   4813  H HZ3  . LYS B 2 67  ? -13.988 -8.160  -0.369  1.00 0.00  ? 206 LYS B HZ3  3  
ATOM   4814  N N    . LEU B 2 68  ? -15.044 -3.068  4.131   1.00 17.31 ? 207 LEU B N    3  
ATOM   4815  C CA   . LEU B 2 68  ? -16.406 -3.021  4.726   1.00 19.33 ? 207 LEU B CA   3  
ATOM   4816  C C    . LEU B 2 68  ? -17.025 -4.416  4.642   1.00 21.64 ? 207 LEU B C    3  
ATOM   4817  O O    . LEU B 2 68  ? -16.790 -5.152  3.705   1.00 21.80 ? 207 LEU B O    3  
ATOM   4818  C CB   . LEU B 2 68  ? -17.268 -2.028  3.948   1.00 19.68 ? 207 LEU B CB   3  
ATOM   4819  C CG   . LEU B 2 68  ? -16.786 -0.603  4.224   1.00 19.58 ? 207 LEU B CG   3  
ATOM   4820  C CD1  . LEU B 2 68  ? -17.764 0.397   3.606   1.00 16.81 ? 207 LEU B CD1  3  
ATOM   4821  C CD2  . LEU B 2 68  ? -16.711 -0.374  5.735   1.00 16.39 ? 207 LEU B CD2  3  
ATOM   4822  H H    . LEU B 2 68  ? -14.925 -2.909  3.172   1.00 0.00  ? 207 LEU B H    3  
ATOM   4823  H HA   . LEU B 2 68  ? -16.340 -2.715  5.759   1.00 0.00  ? 207 LEU B HA   3  
ATOM   4824  H HB2  . LEU B 2 68  ? -17.191 -2.236  2.890   1.00 0.00  ? 207 LEU B HB2  3  
ATOM   4825  H HB3  . LEU B 2 68  ? -18.297 -2.124  4.258   1.00 0.00  ? 207 LEU B HB3  3  
ATOM   4826  H HG   . LEU B 2 68  ? -15.806 -0.465  3.788   1.00 0.00  ? 207 LEU B HG   3  
ATOM   4827  H HD11 . LEU B 2 68  ? -18.578 -0.137  3.139   1.00 0.00  ? 207 LEU B HD11 3  
ATOM   4828  H HD12 . LEU B 2 68  ? -18.154 1.044   4.377   1.00 0.00  ? 207 LEU B HD12 3  
ATOM   4829  H HD13 . LEU B 2 68  ? -17.250 0.991   2.864   1.00 0.00  ? 207 LEU B HD13 3  
ATOM   4830  H HD21 . LEU B 2 68  ? -17.548 -0.858  6.214   1.00 0.00  ? 207 LEU B HD21 3  
ATOM   4831  H HD22 . LEU B 2 68  ? -15.789 -0.787  6.117   1.00 0.00  ? 207 LEU B HD22 3  
ATOM   4832  H HD23 . LEU B 2 68  ? -16.743 0.686   5.941   1.00 0.00  ? 207 LEU B HD23 3  
ATOM   4833  N N    . ASP B 2 69  ? -17.809 -4.792  5.613   1.00 24.31 ? 208 ASP B N    3  
ATOM   4834  C CA   . ASP B 2 69  ? -18.430 -6.144  5.578   1.00 27.33 ? 208 ASP B CA   3  
ATOM   4835  C C    . ASP B 2 69  ? -19.369 -6.246  4.373   1.00 28.23 ? 208 ASP B C    3  
ATOM   4836  O O    . ASP B 2 69  ? -19.717 -7.326  3.938   1.00 28.17 ? 208 ASP B O    3  
ATOM   4837  C CB   . ASP B 2 69  ? -19.222 -6.377  6.866   1.00 32.44 ? 208 ASP B CB   3  
ATOM   4838  C CG   . ASP B 2 69  ? -19.276 -7.876  7.167   1.00 36.84 ? 208 ASP B CG   3  
ATOM   4839  O OD1  . ASP B 2 69  ? -19.398 -8.645  6.228   1.00 40.11 ? 208 ASP B OD1  3  
ATOM   4840  O OD2  . ASP B 2 69  ? -19.196 -8.229  8.332   1.00 41.58 ? 208 ASP B OD2  3  
ATOM   4841  H H    . ASP B 2 69  ? -17.985 -4.188  6.365   1.00 0.00  ? 208 ASP B H    3  
ATOM   4842  H HA   . ASP B 2 69  ? -17.653 -6.891  5.493   1.00 0.00  ? 208 ASP B HA   3  
ATOM   4843  H HB2  . ASP B 2 69  ? -18.738 -5.862  7.684   1.00 0.00  ? 208 ASP B HB2  3  
ATOM   4844  H HB3  . ASP B 2 69  ? -20.225 -5.999  6.746   1.00 0.00  ? 208 ASP B HB3  3  
ATOM   4845  N N    . SER B 2 70  ? -19.780 -5.133  3.831   1.00 30.57 ? 209 SER B N    3  
ATOM   4846  C CA   . SER B 2 70  ? -20.691 -5.166  2.662   1.00 30.81 ? 209 SER B CA   3  
ATOM   4847  C C    . SER B 2 70  ? -19.896 -5.507  1.400   1.00 31.86 ? 209 SER B C    3  
ATOM   4848  O O    . SER B 2 70  ? -20.426 -6.035  0.444   1.00 34.96 ? 209 SER B O    3  
ATOM   4849  C CB   . SER B 2 70  ? -21.331 -3.793  2.506   1.00 29.35 ? 209 SER B CB   3  
ATOM   4850  O OG   . SER B 2 70  ? -20.438 -2.797  2.990   1.00 27.77 ? 209 SER B OG   3  
ATOM   4851  H H    . SER B 2 70  ? -19.493 -4.272  4.192   1.00 0.00  ? 209 SER B H    3  
ATOM   4852  H HA   . SER B 2 70  ? -21.460 -5.904  2.817   1.00 0.00  ? 209 SER B HA   3  
ATOM   4853  H HB2  . SER B 2 70  ? -21.530 -3.612  1.472   1.00 0.00  ? 209 SER B HB2  3  
ATOM   4854  H HB3  . SER B 2 70  ? -22.257 -3.762  3.063   1.00 0.00  ? 209 SER B HB3  3  
ATOM   4855  H HG   . SER B 2 70  ? -20.936 -1.987  3.112   1.00 0.00  ? 209 SER B HG   3  
ATOM   4856  N N    . GLY B 2 71  ? -18.625 -5.207  1.389   1.00 31.91 ? 210 GLY B N    3  
ATOM   4857  C CA   . GLY B 2 71  ? -17.796 -5.513  0.188   1.00 30.37 ? 210 GLY B CA   3  
ATOM   4858  C C    . GLY B 2 71  ? -17.183 -4.219  -0.349  1.00 29.39 ? 210 GLY B C    3  
ATOM   4859  O O    . GLY B 2 71  ? -17.515 -3.765  -1.425  1.00 32.51 ? 210 GLY B O    3  
ATOM   4860  H H    . GLY B 2 71  ? -18.217 -4.779  2.170   1.00 0.00  ? 210 GLY B H    3  
ATOM   4861  H HA2  . GLY B 2 71  ? -17.009 -6.201  0.461   1.00 0.00  ? 210 GLY B HA2  3  
ATOM   4862  H HA3  . GLY B 2 71  ? -18.417 -5.957  -0.575  1.00 0.00  ? 210 GLY B HA3  3  
ATOM   4863  N N    . GLY B 2 72  ? -16.291 -3.620  0.393   1.00 27.09 ? 211 GLY B N    3  
ATOM   4864  C CA   . GLY B 2 72  ? -15.661 -2.355  -0.077  1.00 22.75 ? 211 GLY B CA   3  
ATOM   4865  C C    . GLY B 2 72  ? -14.298 -2.181  0.595   1.00 20.54 ? 211 GLY B C    3  
ATOM   4866  O O    . GLY B 2 72  ? -13.794 -3.077  1.243   1.00 21.66 ? 211 GLY B O    3  
ATOM   4867  H H    . GLY B 2 72  ? -16.039 -4.003  1.259   1.00 0.00  ? 211 GLY B H    3  
ATOM   4868  H HA2  . GLY B 2 72  ? -15.533 -2.395  -1.150  1.00 0.00  ? 211 GLY B HA2  3  
ATOM   4869  H HA3  . GLY B 2 72  ? -16.295 -1.520  0.181   1.00 0.00  ? 211 GLY B HA3  3  
ATOM   4870  N N    . PHE B 2 73  ? -13.697 -1.033  0.446   1.00 18.17 ? 212 PHE B N    3  
ATOM   4871  C CA   . PHE B 2 73  ? -12.367 -0.798  1.075   1.00 17.54 ? 212 PHE B CA   3  
ATOM   4872  C C    . PHE B 2 73  ? -12.223 0.688   1.403   1.00 15.84 ? 212 PHE B C    3  
ATOM   4873  O O    . PHE B 2 73  ? -12.922 1.520   0.862   1.00 18.26 ? 212 PHE B O    3  
ATOM   4874  C CB   . PHE B 2 73  ? -11.262 -1.211  0.101   1.00 16.88 ? 212 PHE B CB   3  
ATOM   4875  C CG   . PHE B 2 73  ? -11.425 -2.666  -0.266  1.00 18.16 ? 212 PHE B CG   3  
ATOM   4876  C CD1  . PHE B 2 73  ? -12.327 -3.040  -1.277  1.00 18.64 ? 212 PHE B CD1  3  
ATOM   4877  C CD2  . PHE B 2 73  ? -10.674 -3.647  0.403   1.00 18.25 ? 212 PHE B CD2  3  
ATOM   4878  C CE1  . PHE B 2 73  ? -12.477 -4.395  -1.619  1.00 19.59 ? 212 PHE B CE1  3  
ATOM   4879  C CE2  . PHE B 2 73  ? -10.824 -5.002  0.061   1.00 18.17 ? 212 PHE B CE2  3  
ATOM   4880  C CZ   . PHE B 2 73  ? -11.725 -5.376  -0.950  1.00 18.19 ? 212 PHE B CZ   3  
ATOM   4881  H H    . PHE B 2 73  ? -14.121 -0.321  -0.079  1.00 0.00  ? 212 PHE B H    3  
ATOM   4882  H HA   . PHE B 2 73  ? -12.287 -1.379  1.982   1.00 0.00  ? 212 PHE B HA   3  
ATOM   4883  H HB2  . PHE B 2 73  ? -11.326 -0.607  -0.792  1.00 0.00  ? 212 PHE B HB2  3  
ATOM   4884  H HB3  . PHE B 2 73  ? -10.299 -1.064  0.566   1.00 0.00  ? 212 PHE B HB3  3  
ATOM   4885  H HD1  . PHE B 2 73  ? -12.904 -2.286  -1.791  1.00 0.00  ? 212 PHE B HD1  3  
ATOM   4886  H HD2  . PHE B 2 73  ? -9.981  -3.361  1.180   1.00 0.00  ? 212 PHE B HD2  3  
ATOM   4887  H HE1  . PHE B 2 73  ? -13.170 -4.681  -2.396  1.00 0.00  ? 212 PHE B HE1  3  
ATOM   4888  H HE2  . PHE B 2 73  ? -10.246 -5.757  0.576   1.00 0.00  ? 212 PHE B HE2  3  
ATOM   4889  H HZ   . PHE B 2 73  ? -11.841 -6.417  -1.213  1.00 0.00  ? 212 PHE B HZ   3  
ATOM   4890  N N    . TYR B 2 74  ? -11.320 1.031   2.279   1.00 14.56 ? 213 TYR B N    3  
ATOM   4891  C CA   . TYR B 2 74  ? -11.139 2.469   2.623   1.00 12.35 ? 213 TYR B CA   3  
ATOM   4892  C C    . TYR B 2 74  ? -9.997  2.620   3.631   1.00 12.92 ? 213 TYR B C    3  
ATOM   4893  O O    . TYR B 2 74  ? -10.076 2.161   4.753   1.00 12.14 ? 213 TYR B O    3  
ATOM   4894  C CB   . TYR B 2 74  ? -12.447 3.030   3.206   1.00 12.55 ? 213 TYR B CB   3  
ATOM   4895  C CG   . TYR B 2 74  ? -12.625 2.573   4.637   1.00 14.01 ? 213 TYR B CG   3  
ATOM   4896  C CD1  . TYR B 2 74  ? -13.032 1.256   4.911   1.00 13.49 ? 213 TYR B CD1  3  
ATOM   4897  C CD2  . TYR B 2 74  ? -12.383 3.468   5.693   1.00 13.18 ? 213 TYR B CD2  3  
ATOM   4898  C CE1  . TYR B 2 74  ? -13.195 0.836   6.242   1.00 13.06 ? 213 TYR B CE1  3  
ATOM   4899  C CE2  . TYR B 2 74  ? -12.548 3.048   7.024   1.00 14.46 ? 213 TYR B CE2  3  
ATOM   4900  C CZ   . TYR B 2 74  ? -12.953 1.730   7.298   1.00 15.80 ? 213 TYR B CZ   3  
ATOM   4901  O OH   . TYR B 2 74  ? -13.115 1.317   8.605   1.00 18.90 ? 213 TYR B OH   3  
ATOM   4902  H H    . TYR B 2 74  ? -10.758 0.348   2.705   1.00 0.00  ? 213 TYR B H    3  
ATOM   4903  H HA   . TYR B 2 74  ? -10.890 3.017   1.725   1.00 0.00  ? 213 TYR B HA   3  
ATOM   4904  H HB2  . TYR B 2 74  ? -12.415 4.108   3.178   1.00 0.00  ? 213 TYR B HB2  3  
ATOM   4905  H HB3  . TYR B 2 74  ? -13.280 2.682   2.613   1.00 0.00  ? 213 TYR B HB3  3  
ATOM   4906  H HD1  . TYR B 2 74  ? -13.218 0.568   4.101   1.00 0.00  ? 213 TYR B HD1  3  
ATOM   4907  H HD2  . TYR B 2 74  ? -12.071 4.480   5.482   1.00 0.00  ? 213 TYR B HD2  3  
ATOM   4908  H HE1  . TYR B 2 74  ? -13.507 -0.177  6.454   1.00 0.00  ? 213 TYR B HE1  3  
ATOM   4909  H HE2  . TYR B 2 74  ? -12.360 3.735   7.834   1.00 0.00  ? 213 TYR B HE2  3  
ATOM   4910  H HH   . TYR B 2 74  ? -13.998 1.565   8.888   1.00 0.00  ? 213 TYR B HH   3  
ATOM   4911  N N    . ILE B 2 75  ? -8.936  3.264   3.239   1.00 13.74 ? 214 ILE B N    3  
ATOM   4912  C CA   . ILE B 2 75  ? -7.794  3.450   4.174   1.00 13.80 ? 214 ILE B CA   3  
ATOM   4913  C C    . ILE B 2 75  ? -8.051  4.688   5.043   1.00 14.16 ? 214 ILE B C    3  
ATOM   4914  O O    . ILE B 2 75  ? -7.328  4.959   5.981   1.00 12.50 ? 214 ILE B O    3  
ATOM   4915  C CB   . ILE B 2 75  ? -6.504  3.623   3.363   1.00 10.15 ? 214 ILE B CB   3  
ATOM   4916  C CG1  . ILE B 2 75  ? -6.067  2.259   2.825   1.00 9.57  ? 214 ILE B CG1  3  
ATOM   4917  C CG2  . ILE B 2 75  ? -5.395  4.192   4.254   1.00 8.37  ? 214 ILE B CG2  3  
ATOM   4918  C CD1  . ILE B 2 75  ? -5.066  2.457   1.685   1.00 7.18  ? 214 ILE B CD1  3  
ATOM   4919  H H    . ILE B 2 75  ? -8.891  3.630   2.331   1.00 0.00  ? 214 ILE B H    3  
ATOM   4920  H HA   . ILE B 2 75  ? -7.707  2.579   4.808   1.00 0.00  ? 214 ILE B HA   3  
ATOM   4921  H HB   . ILE B 2 75  ? -6.685  4.296   2.536   1.00 0.00  ? 214 ILE B HB   3  
ATOM   4922  H HG12 . ILE B 2 75  ? -5.602  1.691   3.619   1.00 0.00  ? 214 ILE B HG12 3  
ATOM   4923  H HG13 . ILE B 2 75  ? -6.929  1.724   2.457   1.00 0.00  ? 214 ILE B HG13 3  
ATOM   4924  H HG21 . ILE B 2 75  ? -5.547  3.866   5.272   1.00 0.00  ? 214 ILE B HG21 3  
ATOM   4925  H HG22 . ILE B 2 75  ? -4.436  3.841   3.904   1.00 0.00  ? 214 ILE B HG22 3  
ATOM   4926  H HG23 . ILE B 2 75  ? -5.420  5.272   4.214   1.00 0.00  ? 214 ILE B HG23 3  
ATOM   4927  H HD11 . ILE B 2 75  ? -4.537  3.387   1.827   1.00 0.00  ? 214 ILE B HD11 3  
ATOM   4928  H HD12 . ILE B 2 75  ? -4.362  1.639   1.679   1.00 0.00  ? 214 ILE B HD12 3  
ATOM   4929  H HD13 . ILE B 2 75  ? -5.595  2.483   0.744   1.00 0.00  ? 214 ILE B HD13 3  
ATOM   4930  N N    . THR B 2 76  ? -9.079  5.436   4.741   1.00 15.77 ? 215 THR B N    3  
ATOM   4931  C CA   . THR B 2 76  ? -9.384  6.648   5.552   1.00 18.20 ? 215 THR B CA   3  
ATOM   4932  C C    . THR B 2 76  ? -10.893 6.904   5.529   1.00 17.81 ? 215 THR B C    3  
ATOM   4933  O O    . THR B 2 76  ? -11.604 6.401   4.681   1.00 15.56 ? 215 THR B O    3  
ATOM   4934  C CB   . THR B 2 76  ? -8.651  7.855   4.963   1.00 20.21 ? 215 THR B CB   3  
ATOM   4935  O OG1  . THR B 2 76  ? -9.042  9.029   5.663   1.00 26.81 ? 215 THR B OG1  3  
ATOM   4936  C CG2  . THR B 2 76  ? -9.006  7.999   3.483   1.00 22.31 ? 215 THR B CG2  3  
ATOM   4937  H H    . THR B 2 76  ? -9.654  5.200   3.984   1.00 0.00  ? 215 THR B H    3  
ATOM   4938  H HA   . THR B 2 76  ? -9.062  6.489   6.570   1.00 0.00  ? 215 THR B HA   3  
ATOM   4939  H HB   . THR B 2 76  ? -7.586  7.714   5.062   1.00 0.00  ? 215 THR B HB   3  
ATOM   4940  H HG1  . THR B 2 76  ? -8.377  9.703   5.505   1.00 0.00  ? 215 THR B HG1  3  
ATOM   4941  H HG21 . THR B 2 76  ? -8.981  7.028   3.010   1.00 0.00  ? 215 THR B HG21 3  
ATOM   4942  H HG22 . THR B 2 76  ? -9.997  8.419   3.388   1.00 0.00  ? 215 THR B HG22 3  
ATOM   4943  H HG23 . THR B 2 76  ? -8.292  8.652   3.002   1.00 0.00  ? 215 THR B HG23 3  
ATOM   4944  N N    . SER B 2 77  ? -11.388 7.683   6.452   1.00 18.97 ? 216 SER B N    3  
ATOM   4945  C CA   . SER B 2 77  ? -12.851 7.968   6.478   1.00 18.71 ? 216 SER B CA   3  
ATOM   4946  C C    . SER B 2 77  ? -13.154 9.153   5.560   1.00 18.69 ? 216 SER B C    3  
ATOM   4947  O O    . SER B 2 77  ? -13.590 10.198  6.000   1.00 20.53 ? 216 SER B O    3  
ATOM   4948  C CB   . SER B 2 77  ? -13.281 8.307   7.906   1.00 20.19 ? 216 SER B CB   3  
ATOM   4949  O OG   . SER B 2 77  ? -14.236 7.351   8.348   1.00 22.41 ? 216 SER B OG   3  
ATOM   4950  H H    . SER B 2 77  ? -10.799 8.079   7.127   1.00 0.00  ? 216 SER B H    3  
ATOM   4951  H HA   . SER B 2 77  ? -13.392 7.099   6.134   1.00 0.00  ? 216 SER B HA   3  
ATOM   4952  H HB2  . SER B 2 77  ? -12.424 8.278   8.558   1.00 0.00  ? 216 SER B HB2  3  
ATOM   4953  H HB3  . SER B 2 77  ? -13.713 9.298   7.925   1.00 0.00  ? 216 SER B HB3  3  
ATOM   4954  H HG   . SER B 2 77  ? -14.803 7.776   8.996   1.00 0.00  ? 216 SER B HG   3  
ATOM   4955  N N    . ARG B 2 78  ? -12.925 9.001   4.284   1.00 0.00  ? 217 ARG B N    3  
ATOM   4956  C CA   . ARG B 2 78  ? -13.198 10.119  3.341   1.00 0.00  ? 217 ARG B CA   3  
ATOM   4957  C C    . ARG B 2 78  ? -13.645 9.554   1.989   1.00 0.00  ? 217 ARG B C    3  
ATOM   4958  O O    . ARG B 2 78  ? -14.529 10.084  1.348   1.00 0.00  ? 217 ARG B O    3  
ATOM   4959  C CB   . ARG B 2 78  ? -11.925 10.945  3.152   1.00 0.00  ? 217 ARG B CB   3  
ATOM   4960  C CG   . ARG B 2 78  ? -12.258 12.223  2.383   1.00 0.00  ? 217 ARG B CG   3  
ATOM   4961  C CD   . ARG B 2 78  ? -12.179 13.423  3.326   1.00 0.00  ? 217 ARG B CD   3  
ATOM   4962  N NE   . ARG B 2 78  ? -13.207 14.429  2.939   1.00 0.00  ? 217 ARG B NE   3  
ATOM   4963  C CZ   . ARG B 2 78  ? -13.414 15.474  3.694   1.00 0.00  ? 217 ARG B CZ   3  
ATOM   4964  N NH1  . ARG B 2 78  ? -12.406 16.204  4.087   1.00 0.00  ? 217 ARG B NH1  3  
ATOM   4965  N NH2  . ARG B 2 78  ? -14.627 15.789  4.054   1.00 0.00  ? 217 ARG B NH2  3  
ATOM   4966  H H    . ARG B 2 78  ? -12.571 8.153   3.947   1.00 0.00  ? 217 ARG B H    3  
ATOM   4967  H HA   . ARG B 2 78  ? -13.978 10.747  3.744   1.00 0.00  ? 217 ARG B HA   3  
ATOM   4968  H HB2  . ARG B 2 78  ? -11.516 11.202  4.118   1.00 0.00  ? 217 ARG B HB2  3  
ATOM   4969  H HB3  . ARG B 2 78  ? -11.202 10.370  2.594   1.00 0.00  ? 217 ARG B HB3  3  
ATOM   4970  H HG2  . ARG B 2 78  ? -11.552 12.348  1.575   1.00 0.00  ? 217 ARG B HG2  3  
ATOM   4971  H HG3  . ARG B 2 78  ? -13.257 12.149  1.979   1.00 0.00  ? 217 ARG B HG3  3  
ATOM   4972  H HD2  . ARG B 2 78  ? -12.357 13.097  4.340   1.00 0.00  ? 217 ARG B HD2  3  
ATOM   4973  H HD3  . ARG B 2 78  ? -11.197 13.868  3.260   1.00 0.00  ? 217 ARG B HD3  3  
ATOM   4974  H HE   . ARG B 2 78  ? -13.728 14.306  2.119   1.00 0.00  ? 217 ARG B HE   3  
ATOM   4975  H HH11 . ARG B 2 78  ? -11.475 15.963  3.811   1.00 0.00  ? 217 ARG B HH11 3  
ATOM   4976  H HH12 . ARG B 2 78  ? -12.564 17.005  4.665   1.00 0.00  ? 217 ARG B HH12 3  
ATOM   4977  H HH21 . ARG B 2 78  ? -15.400 15.230  3.752   1.00 0.00  ? 217 ARG B HH21 3  
ATOM   4978  H HH22 . ARG B 2 78  ? -14.786 16.590  4.631   1.00 0.00  ? 217 ARG B HH22 3  
ATOM   4979  N N    . THR B 2 79  ? -13.038 8.485   1.550   1.00 23.45 ? 218 THR B N    3  
ATOM   4980  C CA   . THR B 2 79  ? -13.429 7.893   0.240   1.00 23.59 ? 218 THR B CA   3  
ATOM   4981  C C    . THR B 2 79  ? -13.517 6.370   0.369   1.00 19.84 ? 218 THR B C    3  
ATOM   4982  O O    . THR B 2 79  ? -12.727 5.747   1.050   1.00 20.24 ? 218 THR B O    3  
ATOM   4983  C CB   . THR B 2 79  ? -12.379 8.257   -0.812  1.00 26.45 ? 218 THR B CB   3  
ATOM   4984  O OG1  . THR B 2 79  ? -11.920 9.582   -0.581  1.00 30.31 ? 218 THR B OG1  3  
ATOM   4985  C CG2  . THR B 2 79  ? -12.999 8.165   -2.208  1.00 27.38 ? 218 THR B CG2  3  
ATOM   4986  H H    . THR B 2 79  ? -12.324 8.072   2.081   1.00 0.00  ? 218 THR B H    3  
ATOM   4987  H HA   . THR B 2 79  ? -14.389 8.284   -0.060  1.00 0.00  ? 218 THR B HA   3  
ATOM   4988  H HB   . THR B 2 79  ? -11.548 7.572   -0.746  1.00 0.00  ? 218 THR B HB   3  
ATOM   4989  H HG1  . THR B 2 79  ? -10.994 9.536   -0.331  1.00 0.00  ? 218 THR B HG1  3  
ATOM   4990  H HG21 . THR B 2 79  ? -13.350 7.159   -2.380  1.00 0.00  ? 218 THR B HG21 3  
ATOM   4991  H HG22 . THR B 2 79  ? -13.828 8.854   -2.279  1.00 0.00  ? 218 THR B HG22 3  
ATOM   4992  H HG23 . THR B 2 79  ? -12.256 8.419   -2.950  1.00 0.00  ? 218 THR B HG23 3  
ATOM   4993  N N    . GLN B 2 80  ? -14.475 5.765   -0.280  1.00 18.30 ? 219 GLN B N    3  
ATOM   4994  C CA   . GLN B 2 80  ? -14.619 4.284   -0.197  1.00 20.11 ? 219 GLN B CA   3  
ATOM   4995  C C    . GLN B 2 80  ? -14.545 3.684   -1.603  1.00 19.45 ? 219 GLN B C    3  
ATOM   4996  O O    . GLN B 2 80  ? -15.255 4.092   -2.501  1.00 20.30 ? 219 GLN B O    3  
ATOM   4997  C CB   . GLN B 2 80  ? -15.969 3.940   0.432   1.00 20.56 ? 219 GLN B CB   3  
ATOM   4998  C CG   . GLN B 2 80  ? -16.280 4.933   1.554   1.00 23.60 ? 219 GLN B CG   3  
ATOM   4999  C CD   . GLN B 2 80  ? -17.104 4.238   2.639   1.00 19.08 ? 219 GLN B CD   3  
ATOM   5000  O OE1  . GLN B 2 80  ? -16.574 3.835   3.656   1.00 17.99 ? 219 GLN B OE1  3  
ATOM   5001  N NE2  . GLN B 2 80  ? -18.388 4.080   2.467   1.00 17.08 ? 219 GLN B NE2  3  
ATOM   5002  H H    . GLN B 2 80  ? -15.103 6.286   -0.822  1.00 0.00  ? 219 GLN B H    3  
ATOM   5003  H HA   . GLN B 2 80  ? -13.824 3.875   0.410   1.00 0.00  ? 219 GLN B HA   3  
ATOM   5004  H HB2  . GLN B 2 80  ? -16.742 3.993   -0.322  1.00 0.00  ? 219 GLN B HB2  3  
ATOM   5005  H HB3  . GLN B 2 80  ? -15.932 2.941   0.838   1.00 0.00  ? 219 GLN B HB3  3  
ATOM   5006  H HG2  . GLN B 2 80  ? -15.355 5.295   1.979   1.00 0.00  ? 219 GLN B HG2  3  
ATOM   5007  H HG3  . GLN B 2 80  ? -16.843 5.763   1.155   1.00 0.00  ? 219 GLN B HG3  3  
ATOM   5008  H HE21 . GLN B 2 80  ? -18.816 4.406   1.644   1.00 0.00  ? 219 GLN B HE21 3  
ATOM   5009  H HE22 . GLN B 2 80  ? -18.925 3.634   3.160   1.00 0.00  ? 219 GLN B HE22 3  
ATOM   5010  N N    . PHE B 2 81  ? -13.693 2.718   -1.799  1.00 18.96 ? 220 PHE B N    3  
ATOM   5011  C CA   . PHE B 2 81  ? -13.573 2.089   -3.145  1.00 17.73 ? 220 PHE B CA   3  
ATOM   5012  C C    . PHE B 2 81  ? -14.322 0.754   -3.148  1.00 17.76 ? 220 PHE B C    3  
ATOM   5013  O O    . PHE B 2 81  ? -14.474 0.115   -2.127  1.00 19.11 ? 220 PHE B O    3  
ATOM   5014  C CB   . PHE B 2 81  ? -12.096 1.843   -3.465  1.00 14.17 ? 220 PHE B CB   3  
ATOM   5015  C CG   . PHE B 2 81  ? -11.266 2.994   -2.947  1.00 14.07 ? 220 PHE B CG   3  
ATOM   5016  C CD1  . PHE B 2 81  ? -11.039 4.119   -3.759  1.00 12.87 ? 220 PHE B CD1  3  
ATOM   5017  C CD2  . PHE B 2 81  ? -10.721 2.941   -1.653  1.00 14.01 ? 220 PHE B CD2  3  
ATOM   5018  C CE1  . PHE B 2 81  ? -10.265 5.188   -3.276  1.00 13.31 ? 220 PHE B CE1  3  
ATOM   5019  C CE2  . PHE B 2 81  ? -9.948  4.011   -1.171  1.00 11.11 ? 220 PHE B CE2  3  
ATOM   5020  C CZ   . PHE B 2 81  ? -9.721  5.134   -1.982  1.00 13.09 ? 220 PHE B CZ   3  
ATOM   5021  H H    . PHE B 2 81  ? -13.132 2.403   -1.060  1.00 0.00  ? 220 PHE B H    3  
ATOM   5022  H HA   . PHE B 2 81  ? -14.000 2.744   -3.889  1.00 0.00  ? 220 PHE B HA   3  
ATOM   5023  H HB2  . PHE B 2 81  ? -11.773 0.926   -2.994  1.00 0.00  ? 220 PHE B HB2  3  
ATOM   5024  H HB3  . PHE B 2 81  ? -11.968 1.762   -4.534  1.00 0.00  ? 220 PHE B HB3  3  
ATOM   5025  H HD1  . PHE B 2 81  ? -11.456 4.160   -4.753  1.00 0.00  ? 220 PHE B HD1  3  
ATOM   5026  H HD2  . PHE B 2 81  ? -10.896 2.076   -1.028  1.00 0.00  ? 220 PHE B HD2  3  
ATOM   5027  H HE1  . PHE B 2 81  ? -10.090 6.052   -3.900  1.00 0.00  ? 220 PHE B HE1  3  
ATOM   5028  H HE2  . PHE B 2 81  ? -9.529  3.968   -0.176  1.00 0.00  ? 220 PHE B HE2  3  
ATOM   5029  H HZ   . PHE B 2 81  ? -9.126  5.956   -1.611  1.00 0.00  ? 220 PHE B HZ   3  
ATOM   5030  N N    . ASN B 2 82  ? -14.793 0.326   -4.288  1.00 20.00 ? 221 ASN B N    3  
ATOM   5031  C CA   . ASN B 2 82  ? -15.531 -0.968  -4.347  1.00 21.48 ? 221 ASN B CA   3  
ATOM   5032  C C    . ASN B 2 82  ? -14.581 -2.073  -4.812  1.00 22.18 ? 221 ASN B C    3  
ATOM   5033  O O    . ASN B 2 82  ? -15.004 -3.122  -5.256  1.00 24.56 ? 221 ASN B O    3  
ATOM   5034  C CB   . ASN B 2 82  ? -16.696 -0.849  -5.331  1.00 26.12 ? 221 ASN B CB   3  
ATOM   5035  C CG   . ASN B 2 82  ? -18.019 -0.985  -4.574  1.00 28.62 ? 221 ASN B CG   3  
ATOM   5036  O OD1  . ASN B 2 82  ? -18.072 -1.596  -3.525  1.00 32.09 ? 221 ASN B OD1  3  
ATOM   5037  N ND2  . ASN B 2 82  ? -19.097 -0.437  -5.064  1.00 31.44 ? 221 ASN B ND2  3  
ATOM   5038  H H    . ASN B 2 82  ? -14.662 0.855   -5.103  1.00 0.00  ? 221 ASN B H    3  
ATOM   5039  H HA   . ASN B 2 82  ? -15.911 -1.210  -3.366  1.00 0.00  ? 221 ASN B HA   3  
ATOM   5040  H HB2  . ASN B 2 82  ? -16.658 0.113   -5.822  1.00 0.00  ? 221 ASN B HB2  3  
ATOM   5041  H HB3  . ASN B 2 82  ? -16.625 -1.633  -6.070  1.00 0.00  ? 221 ASN B HB3  3  
ATOM   5042  H HD21 . ASN B 2 82  ? -19.053 0.058   -5.914  1.00 0.00  ? 221 ASN B HD21 3  
ATOM   5043  H HD22 . ASN B 2 82  ? -19.951 -0.519  -4.583  1.00 0.00  ? 221 ASN B HD22 3  
ATOM   5044  N N    . SER B 2 83  ? -13.299 -1.847  -4.714  1.00 20.04 ? 222 SER B N    3  
ATOM   5045  C CA   . SER B 2 83  ? -12.325 -2.886  -5.151  1.00 17.84 ? 222 SER B CA   3  
ATOM   5046  C C    . SER B 2 83  ? -10.900 -2.400  -4.872  1.00 17.08 ? 222 SER B C    3  
ATOM   5047  O O    . SER B 2 83  ? -10.585 -1.238  -5.038  1.00 17.94 ? 222 SER B O    3  
ATOM   5048  C CB   . SER B 2 83  ? -12.491 -3.144  -6.648  1.00 15.42 ? 222 SER B CB   3  
ATOM   5049  O OG   . SER B 2 83  ? -12.512 -1.902  -7.340  1.00 19.15 ? 222 SER B OG   3  
ATOM   5050  H H    . SER B 2 83  ? -12.978 -0.995  -4.354  1.00 0.00  ? 222 SER B H    3  
ATOM   5051  H HA   . SER B 2 83  ? -12.506 -3.800  -4.605  1.00 0.00  ? 222 SER B HA   3  
ATOM   5052  H HB2  . SER B 2 83  ? -11.667 -3.736  -7.008  1.00 0.00  ? 222 SER B HB2  3  
ATOM   5053  H HB3  . SER B 2 83  ? -13.417 -3.678  -6.819  1.00 0.00  ? 222 SER B HB3  3  
ATOM   5054  H HG   . SER B 2 83  ? -13.413 -1.570  -7.327  1.00 0.00  ? 222 SER B HG   3  
ATOM   5055  N N    . LEU B 2 84  ? -10.036 -3.283  -4.450  1.00 17.11 ? 223 LEU B N    3  
ATOM   5056  C CA   . LEU B 2 84  ? -8.632  -2.876  -4.161  1.00 16.96 ? 223 LEU B CA   3  
ATOM   5057  C C    . LEU B 2 84  ? -8.078  -2.086  -5.346  1.00 17.05 ? 223 LEU B C    3  
ATOM   5058  O O    . LEU B 2 84  ? -7.334  -1.140  -5.181  1.00 18.74 ? 223 LEU B O    3  
ATOM   5059  C CB   . LEU B 2 84  ? -7.776  -4.123  -3.937  1.00 15.68 ? 223 LEU B CB   3  
ATOM   5060  C CG   . LEU B 2 84  ? -7.950  -4.612  -2.500  1.00 18.50 ? 223 LEU B CG   3  
ATOM   5061  C CD1  . LEU B 2 84  ? -7.757  -6.129  -2.450  1.00 17.89 ? 223 LEU B CD1  3  
ATOM   5062  C CD2  . LEU B 2 84  ? -6.911  -3.937  -1.603  1.00 17.50 ? 223 LEU B CD2  3  
ATOM   5063  H H    . LEU B 2 84  ? -10.312 -4.216  -4.323  1.00 0.00  ? 223 LEU B H    3  
ATOM   5064  H HA   . LEU B 2 84  ? -8.611  -2.259  -3.274  1.00 0.00  ? 223 LEU B HA   3  
ATOM   5065  H HB2  . LEU B 2 84  ? -8.085  -4.899  -4.623  1.00 0.00  ? 223 LEU B HB2  3  
ATOM   5066  H HB3  . LEU B 2 84  ? -6.738  -3.882  -4.110  1.00 0.00  ? 223 LEU B HB3  3  
ATOM   5067  H HG   . LEU B 2 84  ? -8.943  -4.365  -2.153  1.00 0.00  ? 223 LEU B HG   3  
ATOM   5068  H HD11 . LEU B 2 84  ? -6.925  -6.406  -3.082  1.00 0.00  ? 223 LEU B HD11 3  
ATOM   5069  H HD12 . LEU B 2 84  ? -7.553  -6.433  -1.433  1.00 0.00  ? 223 LEU B HD12 3  
ATOM   5070  H HD13 . LEU B 2 84  ? -8.654  -6.617  -2.799  1.00 0.00  ? 223 LEU B HD13 3  
ATOM   5071  H HD21 . LEU B 2 84  ? -6.750  -2.922  -1.938  1.00 0.00  ? 223 LEU B HD21 3  
ATOM   5072  H HD22 . LEU B 2 84  ? -7.266  -3.928  -0.583  1.00 0.00  ? 223 LEU B HD22 3  
ATOM   5073  H HD23 . LEU B 2 84  ? -5.980  -4.483  -1.655  1.00 0.00  ? 223 LEU B HD23 3  
ATOM   5074  N N    . GLN B 2 85  ? -8.432  -2.467  -6.542  1.00 17.04 ? 224 GLN B N    3  
ATOM   5075  C CA   . GLN B 2 85  ? -7.923  -1.738  -7.736  1.00 17.80 ? 224 GLN B CA   3  
ATOM   5076  C C    . GLN B 2 85  ? -8.392  -0.285  -7.687  1.00 17.42 ? 224 GLN B C    3  
ATOM   5077  O O    . GLN B 2 85  ? -7.616  0.630   -7.866  1.00 17.16 ? 224 GLN B O    3  
ATOM   5078  C CB   . GLN B 2 85  ? -8.452  -2.407  -9.007  1.00 21.63 ? 224 GLN B CB   3  
ATOM   5079  C CG   . GLN B 2 85  ? -7.443  -2.222  -10.142 1.00 27.99 ? 224 GLN B CG   3  
ATOM   5080  C CD   . GLN B 2 85  ? -8.024  -1.273  -11.192 1.00 31.34 ? 224 GLN B CD   3  
ATOM   5081  O OE1  . GLN B 2 85  ? -8.384  -0.154  -10.884 1.00 31.30 ? 224 GLN B OE1  3  
ATOM   5082  N NE2  . GLN B 2 85  ? -8.132  -1.675  -12.429 1.00 33.99 ? 224 GLN B NE2  3  
ATOM   5083  H H    . GLN B 2 85  ? -9.033  -3.234  -6.655  1.00 0.00  ? 224 GLN B H    3  
ATOM   5084  H HA   . GLN B 2 85  ? -6.842  -1.765  -7.739  1.00 0.00  ? 224 GLN B HA   3  
ATOM   5085  H HB2  . GLN B 2 85  ? -8.601  -3.461  -8.823  1.00 0.00  ? 224 GLN B HB2  3  
ATOM   5086  H HB3  . GLN B 2 85  ? -9.392  -1.955  -9.287  1.00 0.00  ? 224 GLN B HB3  3  
ATOM   5087  H HG2  . GLN B 2 85  ? -6.528  -1.805  -9.746  1.00 0.00  ? 224 GLN B HG2  3  
ATOM   5088  H HG3  . GLN B 2 85  ? -7.236  -3.177  -10.599 1.00 0.00  ? 224 GLN B HG3  3  
ATOM   5089  H HE21 . GLN B 2 85  ? -7.839  -2.581  -12.677 1.00 0.00  ? 224 GLN B HE21 3  
ATOM   5090  H HE22 . GLN B 2 85  ? -8.505  -1.071  -13.111 1.00 0.00  ? 224 GLN B HE22 3  
ATOM   5091  N N    . GLN B 2 86  ? -9.654  -0.063  -7.447  1.00 17.93 ? 225 GLN B N    3  
ATOM   5092  C CA   . GLN B 2 86  ? -10.163 1.337   -7.388  1.00 17.77 ? 225 GLN B CA   3  
ATOM   5093  C C    . GLN B 2 86  ? -9.302  2.153   -6.420  1.00 14.93 ? 225 GLN B C    3  
ATOM   5094  O O    . GLN B 2 86  ? -8.805  3.210   -6.757  1.00 15.44 ? 225 GLN B O    3  
ATOM   5095  C CB   . GLN B 2 86  ? -11.613 1.333   -6.901  1.00 23.54 ? 225 GLN B CB   3  
ATOM   5096  C CG   . GLN B 2 86  ? -12.555 1.225   -8.101  1.00 32.83 ? 225 GLN B CG   3  
ATOM   5097  C CD   . GLN B 2 86  ? -14.002 1.372   -7.630  1.00 37.70 ? 225 GLN B CD   3  
ATOM   5098  O OE1  . GLN B 2 86  ? -14.611 0.415   -7.192  1.00 41.31 ? 225 GLN B OE1  3  
ATOM   5099  N NE2  . GLN B 2 86  ? -14.583 2.538   -7.699  1.00 38.92 ? 225 GLN B NE2  3  
ATOM   5100  H H    . GLN B 2 86  ? -10.267 -0.814  -7.305  1.00 0.00  ? 225 GLN B H    3  
ATOM   5101  H HA   . GLN B 2 86  ? -10.115 1.778   -8.372  1.00 0.00  ? 225 GLN B HA   3  
ATOM   5102  H HB2  . GLN B 2 86  ? -11.769 0.490   -6.243  1.00 0.00  ? 225 GLN B HB2  3  
ATOM   5103  H HB3  . GLN B 2 86  ? -11.816 2.248   -6.367  1.00 0.00  ? 225 GLN B HB3  3  
ATOM   5104  H HG2  . GLN B 2 86  ? -12.325 2.007   -8.811  1.00 0.00  ? 225 GLN B HG2  3  
ATOM   5105  H HG3  . GLN B 2 86  ? -12.429 0.262   -8.574  1.00 0.00  ? 225 GLN B HG3  3  
ATOM   5106  H HE21 . GLN B 2 86  ? -14.092 3.310   -8.051  1.00 0.00  ? 225 GLN B HE21 3  
ATOM   5107  H HE22 . GLN B 2 86  ? -15.510 2.642   -7.400  1.00 0.00  ? 225 GLN B HE22 3  
ATOM   5108  N N    . LEU B 2 87  ? -9.119  1.672   -5.222  1.00 13.83 ? 226 LEU B N    3  
ATOM   5109  C CA   . LEU B 2 87  ? -8.288  2.419   -4.233  1.00 13.09 ? 226 LEU B CA   3  
ATOM   5110  C C    . LEU B 2 87  ? -6.908  2.697   -4.836  1.00 11.87 ? 226 LEU B C    3  
ATOM   5111  O O    . LEU B 2 87  ? -6.294  3.712   -4.566  1.00 12.13 ? 226 LEU B O    3  
ATOM   5112  C CB   . LEU B 2 87  ? -8.135  1.579   -2.961  1.00 12.56 ? 226 LEU B CB   3  
ATOM   5113  C CG   . LEU B 2 87  ? -7.342  2.361   -1.910  1.00 13.63 ? 226 LEU B CG   3  
ATOM   5114  C CD1  . LEU B 2 87  ? -7.597  1.759   -0.527  1.00 13.34 ? 226 LEU B CD1  3  
ATOM   5115  C CD2  . LEU B 2 87  ? -5.848  2.275   -2.231  1.00 14.36 ? 226 LEU B CD2  3  
ATOM   5116  H H    . LEU B 2 87  ? -9.527  0.816   -4.970  1.00 0.00  ? 226 LEU B H    3  
ATOM   5117  H HA   . LEU B 2 87  ? -8.770  3.356   -3.992  1.00 0.00  ? 226 LEU B HA   3  
ATOM   5118  H HB2  . LEU B 2 87  ? -9.113  1.342   -2.569  1.00 0.00  ? 226 LEU B HB2  3  
ATOM   5119  H HB3  . LEU B 2 87  ? -7.612  0.664   -3.196  1.00 0.00  ? 226 LEU B HB3  3  
ATOM   5120  H HG   . LEU B 2 87  ? -7.655  3.395   -1.914  1.00 0.00  ? 226 LEU B HG   3  
ATOM   5121  H HD11 . LEU B 2 87  ? -8.423  1.066   -0.583  1.00 0.00  ? 226 LEU B HD11 3  
ATOM   5122  H HD12 . LEU B 2 87  ? -6.712  1.236   -0.194  1.00 0.00  ? 226 LEU B HD12 3  
ATOM   5123  H HD13 . LEU B 2 87  ? -7.834  2.548   0.171   1.00 0.00  ? 226 LEU B HD13 3  
ATOM   5124  H HD21 . LEU B 2 87  ? -5.679  1.484   -2.948  1.00 0.00  ? 226 LEU B HD21 3  
ATOM   5125  H HD22 . LEU B 2 87  ? -5.514  3.213   -2.646  1.00 0.00  ? 226 LEU B HD22 3  
ATOM   5126  H HD23 . LEU B 2 87  ? -5.297  2.065   -1.328  1.00 0.00  ? 226 LEU B HD23 3  
ATOM   5127  N N    . VAL B 2 88  ? -6.415  1.802   -5.650  1.00 11.28 ? 227 VAL B N    3  
ATOM   5128  C CA   . VAL B 2 88  ? -5.074  2.015   -6.266  1.00 13.23 ? 227 VAL B CA   3  
ATOM   5129  C C    . VAL B 2 88  ? -5.128  3.207   -7.225  1.00 13.64 ? 227 VAL B C    3  
ATOM   5130  O O    . VAL B 2 88  ? -4.288  4.082   -7.185  1.00 15.96 ? 227 VAL B O    3  
ATOM   5131  C CB   . VAL B 2 88  ? -4.665  0.759   -7.037  1.00 9.89  ? 227 VAL B CB   3  
ATOM   5132  C CG1  . VAL B 2 88  ? -3.362  1.024   -7.791  1.00 9.85  ? 227 VAL B CG1  3  
ATOM   5133  C CG2  . VAL B 2 88  ? -4.460  -0.396  -6.054  1.00 9.58  ? 227 VAL B CG2  3  
ATOM   5134  H H    . VAL B 2 88  ? -6.925  0.989   -5.855  1.00 0.00  ? 227 VAL B H    3  
ATOM   5135  H HA   . VAL B 2 88  ? -4.350  2.210   -5.489  1.00 0.00  ? 227 VAL B HA   3  
ATOM   5136  H HB   . VAL B 2 88  ? -5.443  0.501   -7.741  1.00 0.00  ? 227 VAL B HB   3  
ATOM   5137  H HG11 . VAL B 2 88  ? -3.066  2.052   -7.647  1.00 0.00  ? 227 VAL B HG11 3  
ATOM   5138  H HG12 . VAL B 2 88  ? -2.588  0.371   -7.413  1.00 0.00  ? 227 VAL B HG12 3  
ATOM   5139  H HG13 . VAL B 2 88  ? -3.510  0.836   -8.844  1.00 0.00  ? 227 VAL B HG13 3  
ATOM   5140  H HG21 . VAL B 2 88  ? -4.327  -0.001  -5.057  1.00 0.00  ? 227 VAL B HG21 3  
ATOM   5141  H HG22 . VAL B 2 88  ? -5.323  -1.043  -6.073  1.00 0.00  ? 227 VAL B HG22 3  
ATOM   5142  H HG23 . VAL B 2 88  ? -3.582  -0.958  -6.337  1.00 0.00  ? 227 VAL B HG23 3  
ATOM   5143  N N    . ALA B 2 89  ? -6.106  3.246   -8.087  1.00 16.21 ? 228 ALA B N    3  
ATOM   5144  C CA   . ALA B 2 89  ? -6.209  4.379   -9.051  1.00 16.05 ? 228 ALA B CA   3  
ATOM   5145  C C    . ALA B 2 89  ? -6.294  5.702   -8.288  1.00 16.38 ? 228 ALA B C    3  
ATOM   5146  O O    . ALA B 2 89  ? -5.631  6.665   -8.619  1.00 17.42 ? 228 ALA B O    3  
ATOM   5147  C CB   . ALA B 2 89  ? -7.466  4.203   -9.907  1.00 17.50 ? 228 ALA B CB   3  
ATOM   5148  H H    . ALA B 2 89  ? -6.770  2.530   -8.104  1.00 0.00  ? 228 ALA B H    3  
ATOM   5149  H HA   . ALA B 2 89  ? -5.339  4.387   -9.691  1.00 0.00  ? 228 ALA B HA   3  
ATOM   5150  H HB1  . ALA B 2 89  ? -7.899  3.233   -9.715  1.00 0.00  ? 228 ALA B HB1  3  
ATOM   5151  H HB2  . ALA B 2 89  ? -8.182  4.972   -9.656  1.00 0.00  ? 228 ALA B HB2  3  
ATOM   5152  H HB3  . ALA B 2 89  ? -7.205  4.281   -10.952 1.00 0.00  ? 228 ALA B HB3  3  
ATOM   5153  N N    . TYR B 2 90  ? -7.110  5.760   -7.272  1.00 17.24 ? 229 TYR B N    3  
ATOM   5154  C CA   . TYR B 2 90  ? -7.241  7.022   -6.492  1.00 15.90 ? 229 TYR B CA   3  
ATOM   5155  C C    . TYR B 2 90  ? -5.860  7.490   -6.024  1.00 15.53 ? 229 TYR B C    3  
ATOM   5156  O O    . TYR B 2 90  ? -5.354  8.505   -6.465  1.00 15.40 ? 229 TYR B O    3  
ATOM   5157  C CB   . TYR B 2 90  ? -8.132  6.776   -5.272  1.00 17.41 ? 229 TYR B CB   3  
ATOM   5158  C CG   . TYR B 2 90  ? -8.852  8.051   -4.908  1.00 19.62 ? 229 TYR B CG   3  
ATOM   5159  C CD1  . TYR B 2 90  ? -8.133  9.136   -4.379  1.00 20.00 ? 229 TYR B CD1  3  
ATOM   5160  C CD2  . TYR B 2 90  ? -10.240 8.153   -5.097  1.00 19.06 ? 229 TYR B CD2  3  
ATOM   5161  C CE1  . TYR B 2 90  ? -8.803  10.323  -4.039  1.00 22.03 ? 229 TYR B CE1  3  
ATOM   5162  C CE2  . TYR B 2 90  ? -10.911 9.341   -4.757  1.00 20.67 ? 229 TYR B CE2  3  
ATOM   5163  C CZ   . TYR B 2 90  ? -10.191 10.426  -4.229  1.00 22.97 ? 229 TYR B CZ   3  
ATOM   5164  O OH   . TYR B 2 90  ? -10.849 11.592  -3.896  1.00 24.81 ? 229 TYR B OH   3  
ATOM   5165  H H    . TYR B 2 90  ? -7.638  4.974   -7.024  1.00 0.00  ? 229 TYR B H    3  
ATOM   5166  H HA   . TYR B 2 90  ? -7.687  7.785   -7.113  1.00 0.00  ? 229 TYR B HA   3  
ATOM   5167  H HB2  . TYR B 2 90  ? -8.854  6.007   -5.504  1.00 0.00  ? 229 TYR B HB2  3  
ATOM   5168  H HB3  . TYR B 2 90  ? -7.522  6.457   -4.439  1.00 0.00  ? 229 TYR B HB3  3  
ATOM   5169  H HD1  . TYR B 2 90  ? -7.066  9.058   -4.233  1.00 0.00  ? 229 TYR B HD1  3  
ATOM   5170  H HD2  . TYR B 2 90  ? -10.793 7.319   -5.504  1.00 0.00  ? 229 TYR B HD2  3  
ATOM   5171  H HE1  . TYR B 2 90  ? -8.251  11.158  -3.633  1.00 0.00  ? 229 TYR B HE1  3  
ATOM   5172  H HE2  . TYR B 2 90  ? -11.977 9.419   -4.904  1.00 0.00  ? 229 TYR B HE2  3  
ATOM   5173  H HH   . TYR B 2 90  ? -10.197 12.218  -3.570  1.00 0.00  ? 229 TYR B HH   3  
ATOM   5174  N N    . TYR B 2 91  ? -5.247  6.760   -5.133  1.00 15.18 ? 230 TYR B N    3  
ATOM   5175  C CA   . TYR B 2 91  ? -3.902  7.167   -4.632  1.00 16.33 ? 230 TYR B CA   3  
ATOM   5176  C C    . TYR B 2 91  ? -2.852  6.995   -5.737  1.00 16.83 ? 230 TYR B C    3  
ATOM   5177  O O    . TYR B 2 91  ? -1.701  7.350   -5.570  1.00 16.71 ? 230 TYR B O    3  
ATOM   5178  C CB   . TYR B 2 91  ? -3.524  6.300   -3.429  1.00 14.52 ? 230 TYR B CB   3  
ATOM   5179  C CG   . TYR B 2 91  ? -4.626  6.356   -2.395  1.00 16.10 ? 230 TYR B CG   3  
ATOM   5180  C CD1  . TYR B 2 91  ? -5.389  7.527   -2.242  1.00 17.17 ? 230 TYR B CD1  3  
ATOM   5181  C CD2  . TYR B 2 91  ? -4.885  5.239   -1.585  1.00 15.88 ? 230 TYR B CD2  3  
ATOM   5182  C CE1  . TYR B 2 91  ? -6.412  7.577   -1.279  1.00 17.84 ? 230 TYR B CE1  3  
ATOM   5183  C CE2  . TYR B 2 91  ? -5.908  5.290   -0.621  1.00 17.12 ? 230 TYR B CE2  3  
ATOM   5184  C CZ   . TYR B 2 91  ? -6.671  6.459   -0.469  1.00 17.32 ? 230 TYR B CZ   3  
ATOM   5185  O OH   . TYR B 2 91  ? -7.675  6.509   0.477   1.00 19.89 ? 230 TYR B OH   3  
ATOM   5186  H H    . TYR B 2 91  ? -5.673  5.946   -4.788  1.00 0.00  ? 230 TYR B H    3  
ATOM   5187  H HA   . TYR B 2 91  ? -3.933  8.204   -4.329  1.00 0.00  ? 230 TYR B HA   3  
ATOM   5188  H HB2  . TYR B 2 91  ? -3.386  5.279   -3.752  1.00 0.00  ? 230 TYR B HB2  3  
ATOM   5189  H HB3  . TYR B 2 91  ? -2.606  6.667   -2.995  1.00 0.00  ? 230 TYR B HB3  3  
ATOM   5190  H HD1  . TYR B 2 91  ? -5.191  8.387   -2.864  1.00 0.00  ? 230 TYR B HD1  3  
ATOM   5191  H HD2  . TYR B 2 91  ? -4.299  4.339   -1.701  1.00 0.00  ? 230 TYR B HD2  3  
ATOM   5192  H HE1  . TYR B 2 91  ? -6.999  8.476   -1.161  1.00 0.00  ? 230 TYR B HE1  3  
ATOM   5193  H HE2  . TYR B 2 91  ? -6.107  4.430   0.001   1.00 0.00  ? 230 TYR B HE2  3  
ATOM   5194  H HH   . TYR B 2 91  ? -8.042  7.396   0.473   1.00 0.00  ? 230 TYR B HH   3  
ATOM   5195  N N    . SER B 2 92  ? -3.235  6.457   -6.863  1.00 17.92 ? 231 SER B N    3  
ATOM   5196  C CA   . SER B 2 92  ? -2.252  6.268   -7.967  1.00 22.15 ? 231 SER B CA   3  
ATOM   5197  C C    . SER B 2 92  ? -1.902  7.620   -8.588  1.00 22.66 ? 231 SER B C    3  
ATOM   5198  O O    . SER B 2 92  ? -0.844  7.793   -9.159  1.00 24.35 ? 231 SER B O    3  
ATOM   5199  C CB   . SER B 2 92  ? -2.855  5.357   -9.039  1.00 21.66 ? 231 SER B CB   3  
ATOM   5200  O OG   . SER B 2 92  ? -2.529  3.999   -8.756  1.00 28.41 ? 231 SER B OG   3  
ATOM   5201  H H    . SER B 2 92  ? -4.163  6.178   -6.984  1.00 0.00  ? 231 SER B H    3  
ATOM   5202  H HA   . SER B 2 92  ? -1.359  5.812   -7.574  1.00 0.00  ? 231 SER B HA   3  
ATOM   5203  H HB2  . SER B 2 92  ? -3.925  5.468   -9.047  1.00 0.00  ? 231 SER B HB2  3  
ATOM   5204  H HB3  . SER B 2 92  ? -2.461  5.636   -10.008 1.00 0.00  ? 231 SER B HB3  3  
ATOM   5205  H HG   . SER B 2 92  ? -2.271  3.936   -7.833  1.00 0.00  ? 231 SER B HG   3  
ATOM   5206  N N    . LYS B 2 93  ? -2.779  8.581   -8.488  1.00 24.70 ? 232 LYS B N    3  
ATOM   5207  C CA   . LYS B 2 93  ? -2.481  9.914   -9.085  1.00 27.78 ? 232 LYS B CA   3  
ATOM   5208  C C    . LYS B 2 93  ? -2.739  11.021  -8.060  1.00 29.48 ? 232 LYS B C    3  
ATOM   5209  O O    . LYS B 2 93  ? -2.500  12.184  -8.320  1.00 31.78 ? 232 LYS B O    3  
ATOM   5210  C CB   . LYS B 2 93  ? -3.376  10.138  -10.302 1.00 28.95 ? 232 LYS B CB   3  
ATOM   5211  C CG   . LYS B 2 93  ? -2.557  9.949   -11.580 1.00 35.04 ? 232 LYS B CG   3  
ATOM   5212  C CD   . LYS B 2 93  ? -2.074  11.311  -12.084 1.00 42.20 ? 232 LYS B CD   3  
ATOM   5213  C CE   . LYS B 2 93  ? -3.263  12.104  -12.631 1.00 46.43 ? 232 LYS B CE   3  
ATOM   5214  N NZ   . LYS B 2 93  ? -3.372  13.401  -11.906 1.00 50.42 ? 232 LYS B NZ   3  
ATOM   5215  H H    . LYS B 2 93  ? -3.632  8.426   -8.027  1.00 0.00  ? 232 LYS B H    3  
ATOM   5216  H HA   . LYS B 2 93  ? -1.448  9.945   -9.392  1.00 0.00  ? 232 LYS B HA   3  
ATOM   5217  H HB2  . LYS B 2 93  ? -4.188  9.428   -10.285 1.00 0.00  ? 232 LYS B HB2  3  
ATOM   5218  H HB3  . LYS B 2 93  ? -3.771  11.142  -10.275 1.00 0.00  ? 232 LYS B HB3  3  
ATOM   5219  H HG2  . LYS B 2 93  ? -1.705  9.318   -11.373 1.00 0.00  ? 232 LYS B HG2  3  
ATOM   5220  H HG3  . LYS B 2 93  ? -3.173  9.486   -12.337 1.00 0.00  ? 232 LYS B HG3  3  
ATOM   5221  H HD2  . LYS B 2 93  ? -1.622  11.857  -11.268 1.00 0.00  ? 232 LYS B HD2  3  
ATOM   5222  H HD3  . LYS B 2 93  ? -1.347  11.168  -12.868 1.00 0.00  ? 232 LYS B HD3  3  
ATOM   5223  H HE2  . LYS B 2 93  ? -3.115  12.293  -13.684 1.00 0.00  ? 232 LYS B HE2  3  
ATOM   5224  H HE3  . LYS B 2 93  ? -4.170  11.535  -12.492 1.00 0.00  ? 232 LYS B HE3  3  
ATOM   5225  H HZ1  . LYS B 2 93  ? -3.250  13.238  -10.886 1.00 0.00  ? 232 LYS B HZ1  3  
ATOM   5226  H HZ2  . LYS B 2 93  ? -2.633  14.051  -12.245 1.00 0.00  ? 232 LYS B HZ2  3  
ATOM   5227  H HZ3  . LYS B 2 93  ? -4.308  13.817  -12.078 1.00 0.00  ? 232 LYS B HZ3  3  
ATOM   5228  N N    . HIS B 2 94  ? -3.223  10.681  -6.898  1.00 31.24 ? 233 HIS B N    3  
ATOM   5229  C CA   . HIS B 2 94  ? -3.491  11.729  -5.875  1.00 31.51 ? 233 HIS B CA   3  
ATOM   5230  C C    . HIS B 2 94  ? -3.125  11.199  -4.487  1.00 28.20 ? 233 HIS B C    3  
ATOM   5231  O O    . HIS B 2 94  ? -3.776  10.323  -3.955  1.00 29.72 ? 233 HIS B O    3  
ATOM   5232  C CB   . HIS B 2 94  ? -4.973  12.102  -5.905  1.00 33.74 ? 233 HIS B CB   3  
ATOM   5233  C CG   . HIS B 2 94  ? -5.282  12.814  -7.193  1.00 39.30 ? 233 HIS B CG   3  
ATOM   5234  N ND1  . HIS B 2 94  ? -4.817  14.092  -7.462  1.00 40.06 ? 233 HIS B ND1  3  
ATOM   5235  C CD2  . HIS B 2 94  ? -6.007  12.439  -8.297  1.00 39.81 ? 233 HIS B CD2  3  
ATOM   5236  C CE1  . HIS B 2 94  ? -5.263  14.437  -8.683  1.00 41.81 ? 233 HIS B CE1  3  
ATOM   5237  N NE2  . HIS B 2 94  ? -5.993  13.465  -9.237  1.00 42.50 ? 233 HIS B NE2  3  
ATOM   5238  H H    . HIS B 2 94  ? -3.413  9.740   -6.699  1.00 0.00  ? 233 HIS B H    3  
ATOM   5239  H HA   . HIS B 2 94  ? -2.895  12.603  -6.093  1.00 0.00  ? 233 HIS B HA   3  
ATOM   5240  H HB2  . HIS B 2 94  ? -5.572  11.207  -5.835  1.00 0.00  ? 233 HIS B HB2  3  
ATOM   5241  H HB3  . HIS B 2 94  ? -5.198  12.752  -5.071  1.00 0.00  ? 233 HIS B HB3  3  
ATOM   5242  H HD1  . HIS B 2 94  ? -4.264  14.644  -6.869  1.00 0.00  ? 233 HIS B HD1  3  
ATOM   5243  H HD2  . HIS B 2 94  ? -6.511  11.491  -8.418  1.00 0.00  ? 233 HIS B HD2  3  
ATOM   5244  H HE1  . HIS B 2 94  ? -5.056  15.384  -9.159  1.00 0.00  ? 233 HIS B HE1  3  
ATOM   5245  N N    . ALA B 2 95  ? -2.087  11.727  -3.896  1.00 24.22 ? 234 ALA B N    3  
ATOM   5246  C CA   . ALA B 2 95  ? -1.682  11.255  -2.544  1.00 22.83 ? 234 ALA B CA   3  
ATOM   5247  C C    . ALA B 2 95  ? -2.756  11.652  -1.528  1.00 24.43 ? 234 ALA B C    3  
ATOM   5248  O O    . ALA B 2 95  ? -2.985  10.962  -0.555  1.00 23.70 ? 234 ALA B O    3  
ATOM   5249  C CB   . ALA B 2 95  ? -0.351  11.900  -2.155  1.00 19.43 ? 234 ALA B CB   3  
ATOM   5250  H H    . ALA B 2 95  ? -1.576  12.434  -4.342  1.00 0.00  ? 234 ALA B H    3  
ATOM   5251  H HA   . ALA B 2 95  ? -1.574  10.181  -2.553  1.00 0.00  ? 234 ALA B HA   3  
ATOM   5252  H HB1  . ALA B 2 95  ? -0.146  12.729  -2.816  1.00 0.00  ? 234 ALA B HB1  3  
ATOM   5253  H HB2  . ALA B 2 95  ? -0.406  12.255  -1.137  1.00 0.00  ? 234 ALA B HB2  3  
ATOM   5254  H HB3  . ALA B 2 95  ? 0.441   11.170  -2.239  1.00 0.00  ? 234 ALA B HB3  3  
ATOM   5255  N N    . ASP B 2 96  ? -3.413  12.761  -1.756  1.00 27.21 ? 235 ASP B N    3  
ATOM   5256  C CA   . ASP B 2 96  ? -4.481  13.224  -0.818  1.00 29.29 ? 235 ASP B CA   3  
ATOM   5257  C C    . ASP B 2 96  ? -4.046  12.984  0.631   1.00 28.86 ? 235 ASP B C    3  
ATOM   5258  O O    . ASP B 2 96  ? -4.667  12.235  1.359   1.00 29.80 ? 235 ASP B O    3  
ATOM   5259  C CB   . ASP B 2 96  ? -5.782  12.465  -1.097  1.00 35.17 ? 235 ASP B CB   3  
ATOM   5260  C CG   . ASP B 2 96  ? -5.496  10.966  -1.201  1.00 40.61 ? 235 ASP B CG   3  
ATOM   5261  O OD1  . ASP B 2 96  ? -5.305  10.347  -0.168  1.00 46.14 ? 235 ASP B OD1  3  
ATOM   5262  O OD2  . ASP B 2 96  ? -5.473  10.463  -2.312  1.00 45.11 ? 235 ASP B OD2  3  
ATOM   5263  H H    . ASP B 2 96  ? -3.205  13.293  -2.552  1.00 0.00  ? 235 ASP B H    3  
ATOM   5264  H HA   . ASP B 2 96  ? -4.648  14.282  -0.966  1.00 0.00  ? 235 ASP B HA   3  
ATOM   5265  H HB2  . ASP B 2 96  ? -6.482  12.643  -0.293  1.00 0.00  ? 235 ASP B HB2  3  
ATOM   5266  H HB3  . ASP B 2 96  ? -6.207  12.813  -2.027  1.00 0.00  ? 235 ASP B HB3  3  
ATOM   5267  N N    . GLY B 2 97  ? -2.987  13.617  1.054   1.00 27.14 ? 236 GLY B N    3  
ATOM   5268  C CA   . GLY B 2 97  ? -2.514  13.428  2.455   1.00 25.64 ? 236 GLY B CA   3  
ATOM   5269  C C    . GLY B 2 97  ? -1.846  12.058  2.594   1.00 24.14 ? 236 GLY B C    3  
ATOM   5270  O O    . GLY B 2 97  ? -1.795  11.488  3.665   1.00 24.47 ? 236 GLY B O    3  
ATOM   5271  H H    . GLY B 2 97  ? -2.502  14.219  0.451   1.00 0.00  ? 236 GLY B H    3  
ATOM   5272  H HA2  . GLY B 2 97  ? -1.804  14.203  2.702   1.00 0.00  ? 236 GLY B HA2  3  
ATOM   5273  H HA3  . GLY B 2 97  ? -3.356  13.483  3.129   1.00 0.00  ? 236 GLY B HA3  3  
ATOM   5274  N N    . LEU B 2 98  ? -1.331  11.526  1.519   1.00 20.92 ? 237 LEU B N    3  
ATOM   5275  C CA   . LEU B 2 98  ? -0.666  10.195  1.596   1.00 19.13 ? 237 LEU B CA   3  
ATOM   5276  C C    . LEU B 2 98  ? 0.835   10.386  1.827   1.00 18.42 ? 237 LEU B C    3  
ATOM   5277  O O    . LEU B 2 98  ? 1.314   11.494  1.963   1.00 19.85 ? 237 LEU B O    3  
ATOM   5278  C CB   . LEU B 2 98  ? -0.886  9.436   0.285   1.00 19.72 ? 237 LEU B CB   3  
ATOM   5279  C CG   . LEU B 2 98  ? -2.135  8.559   0.407   1.00 21.67 ? 237 LEU B CG   3  
ATOM   5280  C CD1  . LEU B 2 98  ? -2.543  8.053   -0.978  1.00 17.09 ? 237 LEU B CD1  3  
ATOM   5281  C CD2  . LEU B 2 98  ? -1.830  7.366   1.316   1.00 22.76 ? 237 LEU B CD2  3  
ATOM   5282  H H    . LEU B 2 98  ? -1.380  12.001  0.664   1.00 0.00  ? 237 LEU B H    3  
ATOM   5283  H HA   . LEU B 2 98  ? -1.086  9.629   2.414   1.00 0.00  ? 237 LEU B HA   3  
ATOM   5284  H HB2  . LEU B 2 98  ? -1.018  10.141  -0.523  1.00 0.00  ? 237 LEU B HB2  3  
ATOM   5285  H HB3  . LEU B 2 98  ? -0.030  8.811   0.082   1.00 0.00  ? 237 LEU B HB3  3  
ATOM   5286  H HG   . LEU B 2 98  ? -2.942  9.139   0.830   1.00 0.00  ? 237 LEU B HG   3  
ATOM   5287  H HD11 . LEU B 2 98  ? -1.686  8.068   -1.634  1.00 0.00  ? 237 LEU B HD11 3  
ATOM   5288  H HD12 . LEU B 2 98  ? -2.916  7.043   -0.897  1.00 0.00  ? 237 LEU B HD12 3  
ATOM   5289  H HD13 . LEU B 2 98  ? -3.316  8.691   -1.381  1.00 0.00  ? 237 LEU B HD13 3  
ATOM   5290  H HD21 . LEU B 2 98  ? -0.948  6.857   0.958   1.00 0.00  ? 237 LEU B HD21 3  
ATOM   5291  H HD22 . LEU B 2 98  ? -1.660  7.715   2.323   1.00 0.00  ? 237 LEU B HD22 3  
ATOM   5292  H HD23 . LEU B 2 98  ? -2.667  6.684   1.308   1.00 0.00  ? 237 LEU B HD23 3  
ATOM   5293  N N    . CYS B 2 99  ? 1.580   9.316   1.870   1.00 18.29 ? 238 CYS B N    3  
ATOM   5294  C CA   . CYS B 2 99  ? 3.047   9.441   2.092   1.00 17.21 ? 238 CYS B CA   3  
ATOM   5295  C C    . CYS B 2 99  ? 3.724   9.865   0.787   1.00 18.80 ? 238 CYS B C    3  
ATOM   5296  O O    . CYS B 2 99  ? 4.742   10.528  0.792   1.00 19.09 ? 238 CYS B O    3  
ATOM   5297  C CB   . CYS B 2 99  ? 3.609   8.091   2.544   1.00 17.49 ? 238 CYS B CB   3  
ATOM   5298  S SG   . CYS B 2 99  ? 3.187   6.823   1.323   1.00 18.25 ? 238 CYS B SG   3  
ATOM   5299  H H    . CYS B 2 99  ? 1.176   8.432   1.758   1.00 0.00  ? 238 CYS B H    3  
ATOM   5300  H HA   . CYS B 2 99  ? 3.235   10.183  2.854   1.00 0.00  ? 238 CYS B HA   3  
ATOM   5301  H HB2  . CYS B 2 99  ? 4.682   8.162   2.634   1.00 0.00  ? 238 CYS B HB2  3  
ATOM   5302  H HB3  . CYS B 2 99  ? 3.184   7.826   3.500   1.00 0.00  ? 238 CYS B HB3  3  
ATOM   5303  H HG   . CYS B 2 99  ? 3.831   6.115   1.398   1.00 0.00  ? 238 CYS B HG   3  
ATOM   5304  N N    . HIS B 2 100 ? 3.165   9.491   -0.332  1.00 17.96 ? 239 HIS B N    3  
ATOM   5305  C CA   . HIS B 2 100 ? 3.777   9.873   -1.637  1.00 18.41 ? 239 HIS B CA   3  
ATOM   5306  C C    . HIS B 2 100 ? 2.942   9.293   -2.782  1.00 18.79 ? 239 HIS B C    3  
ATOM   5307  O O    . HIS B 2 100 ? 2.671   8.109   -2.827  1.00 19.28 ? 239 HIS B O    3  
ATOM   5308  C CB   . HIS B 2 100 ? 5.201   9.319   -1.715  1.00 18.77 ? 239 HIS B CB   3  
ATOM   5309  C CG   . HIS B 2 100 ? 6.004   10.128  -2.696  1.00 18.40 ? 239 HIS B CG   3  
ATOM   5310  N ND1  . HIS B 2 100 ? 5.686   10.185  -4.044  1.00 18.53 ? 239 HIS B ND1  3  
ATOM   5311  C CD2  . HIS B 2 100 ? 7.117   10.917  -2.540  1.00 19.51 ? 239 HIS B CD2  3  
ATOM   5312  C CE1  . HIS B 2 100 ? 6.591   10.984  -4.641  1.00 19.04 ? 239 HIS B CE1  3  
ATOM   5313  N NE2  . HIS B 2 100 ? 7.486   11.456  -3.769  1.00 20.02 ? 239 HIS B NE2  3  
ATOM   5314  H H    . HIS B 2 100 ? 2.343   8.957   -0.314  1.00 0.00  ? 239 HIS B H    3  
ATOM   5315  H HA   . HIS B 2 100 ? 3.804   10.950  -1.720  1.00 0.00  ? 239 HIS B HA   3  
ATOM   5316  H HB2  . HIS B 2 100 ? 5.663   9.373   -0.741  1.00 0.00  ? 239 HIS B HB2  3  
ATOM   5317  H HB3  . HIS B 2 100 ? 5.169   8.289   -2.041  1.00 0.00  ? 239 HIS B HB3  3  
ATOM   5318  H HD1  . HIS B 2 100 ? 4.938   9.729   -4.483  1.00 0.00  ? 239 HIS B HD1  3  
ATOM   5319  H HD2  . HIS B 2 100 ? 7.630   11.092  -1.605  1.00 0.00  ? 239 HIS B HD2  3  
ATOM   5320  H HE1  . HIS B 2 100 ? 6.592   11.214  -5.696  1.00 0.00  ? 239 HIS B HE1  3  
ATOM   5321  N N    . ARG B 2 101 ? 2.534   10.118  -3.709  1.00 19.17 ? 240 ARG B N    3  
ATOM   5322  C CA   . ARG B 2 101 ? 1.721   9.614   -4.854  1.00 20.76 ? 240 ARG B CA   3  
ATOM   5323  C C    . ARG B 2 101 ? 2.353   8.333   -5.399  1.00 18.50 ? 240 ARG B C    3  
ATOM   5324  O O    . ARG B 2 101 ? 3.539   8.277   -5.656  1.00 17.06 ? 240 ARG B O    3  
ATOM   5325  C CB   . ARG B 2 101 ? 1.691   10.668  -5.959  1.00 25.30 ? 240 ARG B CB   3  
ATOM   5326  C CG   . ARG B 2 101 ? 0.620   10.300  -6.989  1.00 30.23 ? 240 ARG B CG   3  
ATOM   5327  C CD   . ARG B 2 101 ? 0.103   11.573  -7.655  1.00 37.22 ? 240 ARG B CD   3  
ATOM   5328  N NE   . ARG B 2 101 ? 1.253   12.450  -8.011  1.00 43.41 ? 240 ARG B NE   3  
ATOM   5329  C CZ   . ARG B 2 101 ? 1.768   12.398  -9.209  1.00 45.15 ? 240 ARG B CZ   3  
ATOM   5330  N NH1  . ARG B 2 101 ? 1.158   12.976  -10.207 1.00 46.50 ? 240 ARG B NH1  3  
ATOM   5331  N NH2  . ARG B 2 101 ? 2.893   11.768  -9.409  1.00 46.15 ? 240 ARG B NH2  3  
ATOM   5332  H H    . ARG B 2 101 ? 2.766   11.069  -3.656  1.00 0.00  ? 240 ARG B H    3  
ATOM   5333  H HA   . ARG B 2 101 ? 0.713   9.410   -4.523  1.00 0.00  ? 240 ARG B HA   3  
ATOM   5334  H HB2  . ARG B 2 101 ? 1.461   11.633  -5.530  1.00 0.00  ? 240 ARG B HB2  3  
ATOM   5335  H HB3  . ARG B 2 101 ? 2.654   10.710  -6.444  1.00 0.00  ? 240 ARG B HB3  3  
ATOM   5336  H HG2  . ARG B 2 101 ? 1.049   9.648   -7.738  1.00 0.00  ? 240 ARG B HG2  3  
ATOM   5337  H HG3  . ARG B 2 101 ? -0.197  9.795   -6.496  1.00 0.00  ? 240 ARG B HG3  3  
ATOM   5338  H HD2  . ARG B 2 101 ? -0.443  11.314  -8.549  1.00 0.00  ? 240 ARG B HD2  3  
ATOM   5339  H HD3  . ARG B 2 101 ? -0.551  12.094  -6.971  1.00 0.00  ? 240 ARG B HD3  3  
ATOM   5340  H HE   . ARG B 2 101 ? 1.623   13.068  -7.345  1.00 0.00  ? 240 ARG B HE   3  
ATOM   5341  H HH11 . ARG B 2 101 ? 0.295   13.460  -10.054 1.00 0.00  ? 240 ARG B HH11 3  
ATOM   5342  H HH12 . ARG B 2 101 ? 1.551   12.935  -11.125 1.00 0.00  ? 240 ARG B HH12 3  
ATOM   5343  H HH21 . ARG B 2 101 ? 3.361   11.325  -8.644  1.00 0.00  ? 240 ARG B HH21 3  
ATOM   5344  H HH22 . ARG B 2 101 ? 3.287   11.728  -10.327 1.00 0.00  ? 240 ARG B HH22 3  
ATOM   5345  N N    . LEU B 2 102 ? 1.576   7.302   -5.580  1.00 16.42 ? 241 LEU B N    3  
ATOM   5346  C CA   . LEU B 2 102 ? 2.146   6.032   -6.111  1.00 16.95 ? 241 LEU B CA   3  
ATOM   5347  C C    . LEU B 2 102 ? 2.882   6.319   -7.421  1.00 18.53 ? 241 LEU B C    3  
ATOM   5348  O O    . LEU B 2 102 ? 2.464   7.142   -8.211  1.00 19.32 ? 241 LEU B O    3  
ATOM   5349  C CB   . LEU B 2 102 ? 1.018   5.034   -6.372  1.00 12.02 ? 241 LEU B CB   3  
ATOM   5350  C CG   . LEU B 2 102 ? 0.156   4.890   -5.117  1.00 10.93 ? 241 LEU B CG   3  
ATOM   5351  C CD1  . LEU B 2 102 ? -0.838  3.744   -5.309  1.00 7.07  ? 241 LEU B CD1  3  
ATOM   5352  C CD2  . LEU B 2 102 ? 1.052   4.588   -3.912  1.00 9.30  ? 241 LEU B CD2  3  
ATOM   5353  H H    . LEU B 2 102 ? 0.619   7.362   -5.368  1.00 0.00  ? 241 LEU B H    3  
ATOM   5354  H HA   . LEU B 2 102 ? 2.837   5.618   -5.391  1.00 0.00  ? 241 LEU B HA   3  
ATOM   5355  H HB2  . LEU B 2 102 ? 0.411   5.390   -7.189  1.00 0.00  ? 241 LEU B HB2  3  
ATOM   5356  H HB3  . LEU B 2 102 ? 1.440   4.074   -6.628  1.00 0.00  ? 241 LEU B HB3  3  
ATOM   5357  H HG   . LEU B 2 102 ? -0.384  5.809   -4.944  1.00 0.00  ? 241 LEU B HG   3  
ATOM   5358  H HD11 . LEU B 2 102 ? -1.112  3.677   -6.352  1.00 0.00  ? 241 LEU B HD11 3  
ATOM   5359  H HD12 . LEU B 2 102 ? -0.382  2.816   -4.998  1.00 0.00  ? 241 LEU B HD12 3  
ATOM   5360  H HD13 . LEU B 2 102 ? -1.721  3.929   -4.716  1.00 0.00  ? 241 LEU B HD13 3  
ATOM   5361  H HD21 . LEU B 2 102 ? 1.737   3.791   -4.164  1.00 0.00  ? 241 LEU B HD21 3  
ATOM   5362  H HD22 . LEU B 2 102 ? 1.612   5.474   -3.650  1.00 0.00  ? 241 LEU B HD22 3  
ATOM   5363  H HD23 . LEU B 2 102 ? 0.441   4.287   -3.075  1.00 0.00  ? 241 LEU B HD23 3  
ATOM   5364  N N    . THR B 2 103 ? 3.975   5.648   -7.659  1.00 20.81 ? 242 THR B N    3  
ATOM   5365  C CA   . THR B 2 103 ? 4.734   5.886   -8.919  1.00 20.89 ? 242 THR B CA   3  
ATOM   5366  C C    . THR B 2 103 ? 5.205   4.549   -9.495  1.00 21.74 ? 242 THR B C    3  
ATOM   5367  O O    . THR B 2 103 ? 5.192   4.339   -10.692 1.00 24.76 ? 242 THR B O    3  
ATOM   5368  C CB   . THR B 2 103 ? 5.951   6.767   -8.623  1.00 20.18 ? 242 THR B CB   3  
ATOM   5369  O OG1  . THR B 2 103 ? 6.653   6.241   -7.506  1.00 22.88 ? 242 THR B OG1  3  
ATOM   5370  C CG2  . THR B 2 103 ? 5.489   8.191   -8.314  1.00 19.22 ? 242 THR B CG2  3  
ATOM   5371  H H    . THR B 2 103 ? 4.297   4.988   -7.010  1.00 0.00  ? 242 THR B H    3  
ATOM   5372  H HA   . THR B 2 103 ? 4.097   6.383   -9.636  1.00 0.00  ? 242 THR B HA   3  
ATOM   5373  H HB   . THR B 2 103 ? 6.602   6.783   -9.484  1.00 0.00  ? 242 THR B HB   3  
ATOM   5374  H HG1  . THR B 2 103 ? 6.020   6.098   -6.798  1.00 0.00  ? 242 THR B HG1  3  
ATOM   5375  H HG21 . THR B 2 103 ? 4.432   8.188   -8.092  1.00 0.00  ? 242 THR B HG21 3  
ATOM   5376  H HG22 . THR B 2 103 ? 6.035   8.570   -7.462  1.00 0.00  ? 242 THR B HG22 3  
ATOM   5377  H HG23 . THR B 2 103 ? 5.675   8.824   -9.170  1.00 0.00  ? 242 THR B HG23 3  
ATOM   5378  N N    . THR B 2 104 ? 5.625   3.645   -8.653  1.00 20.71 ? 243 THR B N    3  
ATOM   5379  C CA   . THR B 2 104 ? 6.100   2.326   -9.155  1.00 18.86 ? 243 THR B CA   3  
ATOM   5380  C C    . THR B 2 104 ? 5.587   1.215   -8.237  1.00 18.56 ? 243 THR B C    3  
ATOM   5381  O O    . THR B 2 104 ? 5.139   1.465   -7.136  1.00 18.28 ? 243 THR B O    3  
ATOM   5382  C CB   . THR B 2 104 ? 7.629   2.307   -9.166  1.00 20.42 ? 243 THR B CB   3  
ATOM   5383  O OG1  . THR B 2 104 ? 8.110   3.488   -9.794  1.00 20.70 ? 243 THR B OG1  3  
ATOM   5384  C CG2  . THR B 2 104 ? 8.122   1.081   -9.936  1.00 16.38 ? 243 THR B CG2  3  
ATOM   5385  H H    . THR B 2 104 ? 5.631   3.834   -7.692  1.00 0.00  ? 243 THR B H    3  
ATOM   5386  H HA   . THR B 2 104 ? 5.729   2.165   -10.157 1.00 0.00  ? 243 THR B HA   3  
ATOM   5387  H HB   . THR B 2 104 ? 7.997   2.262   -8.152  1.00 0.00  ? 243 THR B HB   3  
ATOM   5388  H HG1  . THR B 2 104 ? 8.077   4.200   -9.150  1.00 0.00  ? 243 THR B HG1  3  
ATOM   5389  H HG21 . THR B 2 104 ? 7.420   0.843   -10.722 1.00 0.00  ? 243 THR B HG21 3  
ATOM   5390  H HG22 . THR B 2 104 ? 9.089   1.292   -10.368 1.00 0.00  ? 243 THR B HG22 3  
ATOM   5391  H HG23 . THR B 2 104 ? 8.205   0.242   -9.262  1.00 0.00  ? 243 THR B HG23 3  
ATOM   5392  N N    . VAL B 2 105 ? 5.654   -0.010  -8.678  1.00 16.29 ? 244 VAL B N    3  
ATOM   5393  C CA   . VAL B 2 105 ? 5.176   -1.135  -7.828  1.00 16.81 ? 244 VAL B CA   3  
ATOM   5394  C C    . VAL B 2 105 ? 6.380   -1.917  -7.301  1.00 16.74 ? 244 VAL B C    3  
ATOM   5395  O O    . VAL B 2 105 ? 7.495   -1.730  -7.745  1.00 17.40 ? 244 VAL B O    3  
ATOM   5396  C CB   . VAL B 2 105 ? 4.288   -2.064  -8.657  1.00 17.29 ? 244 VAL B CB   3  
ATOM   5397  C CG1  . VAL B 2 105 ? 3.469   -2.955  -7.722  1.00 17.99 ? 244 VAL B CG1  3  
ATOM   5398  C CG2  . VAL B 2 105 ? 3.342   -1.229  -9.522  1.00 17.19 ? 244 VAL B CG2  3  
ATOM   5399  H H    . VAL B 2 105 ? 6.022   -0.191  -9.568  1.00 0.00  ? 244 VAL B H    3  
ATOM   5400  H HA   . VAL B 2 105 ? 4.609   -0.743  -6.996  1.00 0.00  ? 244 VAL B HA   3  
ATOM   5401  H HB   . VAL B 2 105 ? 4.907   -2.683  -9.290  1.00 0.00  ? 244 VAL B HB   3  
ATOM   5402  H HG11 . VAL B 2 105 ? 3.107   -2.368  -6.890  1.00 0.00  ? 244 VAL B HG11 3  
ATOM   5403  H HG12 . VAL B 2 105 ? 2.629   -3.368  -8.261  1.00 0.00  ? 244 VAL B HG12 3  
ATOM   5404  H HG13 . VAL B 2 105 ? 4.090   -3.757  -7.353  1.00 0.00  ? 244 VAL B HG13 3  
ATOM   5405  H HG21 . VAL B 2 105 ? 2.733   -0.601  -8.888  1.00 0.00  ? 244 VAL B HG21 3  
ATOM   5406  H HG22 . VAL B 2 105 ? 3.919   -0.610  -10.192 1.00 0.00  ? 244 VAL B HG22 3  
ATOM   5407  H HG23 . VAL B 2 105 ? 2.706   -1.885  -10.097 1.00 0.00  ? 244 VAL B HG23 3  
ATOM   5408  N N    . CYS B 2 106 ? 6.167   -2.792  -6.357  1.00 15.40 ? 245 CYS B N    3  
ATOM   5409  C CA   . CYS B 2 106 ? 7.303   -3.582  -5.806  1.00 16.70 ? 245 CYS B CA   3  
ATOM   5410  C C    . CYS B 2 106 ? 7.819   -4.546  -6.880  1.00 16.64 ? 245 CYS B C    3  
ATOM   5411  O O    . CYS B 2 106 ? 7.063   -4.999  -7.716  1.00 17.47 ? 245 CYS B O    3  
ATOM   5412  C CB   . CYS B 2 106 ? 6.829   -4.377  -4.589  1.00 15.93 ? 245 CYS B CB   3  
ATOM   5413  S SG   . CYS B 2 106 ? 7.551   -3.669  -3.088  1.00 18.24 ? 245 CYS B SG   3  
ATOM   5414  H H    . CYS B 2 106 ? 5.260   -2.929  -6.011  1.00 0.00  ? 245 CYS B H    3  
ATOM   5415  H HA   . CYS B 2 106 ? 8.097   -2.912  -5.512  1.00 0.00  ? 245 CYS B HA   3  
ATOM   5416  H HB2  . CYS B 2 106 ? 5.752   -4.332  -4.526  1.00 0.00  ? 245 CYS B HB2  3  
ATOM   5417  H HB3  . CYS B 2 106 ? 7.142   -5.407  -4.687  1.00 0.00  ? 245 CYS B HB3  3  
ATOM   5418  H HG   . CYS B 2 106 ? 7.775   -2.754  -3.270  1.00 0.00  ? 245 CYS B HG   3  
ATOM   5419  N N    . PRO B 2 107 ? 9.097   -4.835  -6.824  1.00 18.63 ? 246 PRO B N    3  
ATOM   5420  C CA   . PRO B 2 107 ? 9.746   -5.746  -7.783  1.00 19.52 ? 246 PRO B CA   3  
ATOM   5421  C C    . PRO B 2 107 ? 9.441   -7.203  -7.424  1.00 19.33 ? 246 PRO B C    3  
ATOM   5422  O O    . PRO B 2 107 ? 9.498   -7.526  -6.249  1.00 19.97 ? 246 PRO B O    3  
ATOM   5423  C CB   . PRO B 2 107 ? 11.237  -5.441  -7.616  1.00 18.97 ? 246 PRO B CB   3  
ATOM   5424  C CG   . PRO B 2 107 ? 11.401  -4.813  -6.212  1.00 18.88 ? 246 PRO B CG   3  
ATOM   5425  C CD   . PRO B 2 107 ? 10.014  -4.280  -5.804  1.00 17.74 ? 246 PRO B CD   3  
ATOM   5426  O OXT  . PRO B 2 107 ? 9.157   -7.969  -8.329  1.00 0.00  ? 246 PRO B OXT  3  
ATOM   5427  H HA   . PRO B 2 107 ? 9.434   -5.526  -8.790  1.00 0.00  ? 246 PRO B HA   3  
ATOM   5428  H HB2  . PRO B 2 107 ? 11.812  -6.355  -7.687  1.00 0.00  ? 246 PRO B HB2  3  
ATOM   5429  H HB3  . PRO B 2 107 ? 11.560  -4.739  -8.368  1.00 0.00  ? 246 PRO B HB3  3  
ATOM   5430  H HG2  . PRO B 2 107 ? 11.736  -5.562  -5.509  1.00 0.00  ? 246 PRO B HG2  3  
ATOM   5431  H HG3  . PRO B 2 107 ? 12.107  -3.997  -6.250  1.00 0.00  ? 246 PRO B HG3  3  
ATOM   5432  H HD2  . PRO B 2 107 ? 9.749   -4.638  -4.818  1.00 0.00  ? 246 PRO B HD2  3  
ATOM   5433  H HD3  . PRO B 2 107 ? 9.997   -3.202  -5.834  1.00 0.00  ? 246 PRO B HD3  3  
HETATM 5434  C C    . ACE A 1 1   ? 2.283   0.513   11.590  1.00 14.10 ? 100 ACE A C    4  
HETATM 5435  O O    . ACE A 1 1   ? 3.082   0.876   10.750  1.00 14.64 ? 100 ACE A O    4  
HETATM 5436  C CH3  . ACE A 1 1   ? 2.745   -0.152  12.889  1.00 14.17 ? 100 ACE A CH3  4  
HETATM 5437  H H1   . ACE A 1 1   ? 2.948   -1.197  12.706  1.00 0.00  ? 100 ACE A H1   4  
HETATM 5438  H H2   . ACE A 1 1   ? 3.643   0.332   13.242  1.00 0.00  ? 100 ACE A H2   4  
HETATM 5439  H H3   . ACE A 1 1   ? 1.969   -0.062  13.635  1.00 0.00  ? 100 ACE A H3   4  
HETATM 5440  N N    . PTR A 1 2   ? 1.000   0.677   11.419  1.00 14.28 ? 101 PTR A N    4  
HETATM 5441  C CA   . PTR A 1 2   ? 0.491   1.320   10.175  1.00 13.54 ? 101 PTR A CA   4  
HETATM 5442  C C    . PTR A 1 2   ? 0.252   2.809   10.433  1.00 14.12 ? 101 PTR A C    4  
HETATM 5443  O O    . PTR A 1 2   ? 0.137   3.243   11.562  1.00 13.97 ? 101 PTR A O    4  
HETATM 5444  C CB   . PTR A 1 2   ? -0.824  0.657   9.758   1.00 13.83 ? 101 PTR A CB   4  
HETATM 5445  C CG   . PTR A 1 2   ? -0.549  -0.745  9.269   1.00 12.91 ? 101 PTR A CG   4  
HETATM 5446  C CD1  . PTR A 1 2   ? -0.226  -0.969  7.921   1.00 12.17 ? 101 PTR A CD1  4  
HETATM 5447  C CD2  . PTR A 1 2   ? -0.617  -1.827  10.164  1.00 12.70 ? 101 PTR A CD2  4  
HETATM 5448  C CE1  . PTR A 1 2   ? 0.030   -2.275  7.466   1.00 12.08 ? 101 PTR A CE1  4  
HETATM 5449  C CE2  . PTR A 1 2   ? -0.362  -3.132  9.711   1.00 11.44 ? 101 PTR A CE2  4  
HETATM 5450  C CZ   . PTR A 1 2   ? -0.038  -3.356  8.361   1.00 13.78 ? 101 PTR A CZ   4  
HETATM 5451  O OH   . PTR A 1 2   ? 0.225   -4.684  7.903   1.00 14.51 ? 101 PTR A OH   4  
HETATM 5452  P P    . PTR A 1 2   ? 1.494   -5.491  8.476   1.00 17.94 ? 101 PTR A P    4  
HETATM 5453  O O1P  . PTR A 1 2   ? 0.926   -6.813  8.821   1.00 18.17 ? 101 PTR A O1P  4  
HETATM 5454  O O2P  . PTR A 1 2   ? 1.917   -4.670  9.633   1.00 15.88 ? 101 PTR A O2P  4  
HETATM 5455  O O3P  . PTR A 1 2   ? 2.435   -5.493  7.334   1.00 18.41 ? 101 PTR A O3P  4  
HETATM 5456  H H    . PTR A 1 2   ? 0.371   0.378   12.109  1.00 0.00  ? 101 PTR A H    4  
HETATM 5457  H HA   . PTR A 1 2   ? 1.219   1.204   9.386   1.00 0.00  ? 101 PTR A HA   4  
HETATM 5458  H HB2  . PTR A 1 2   ? -1.493  0.619   10.605  1.00 0.00  ? 101 PTR A HB2  4  
HETATM 5459  H HB3  . PTR A 1 2   ? -1.280  1.230   8.964   1.00 0.00  ? 101 PTR A HB3  4  
HETATM 5460  H HD1  . PTR A 1 2   ? -0.173  -0.139  7.232   1.00 0.00  ? 101 PTR A HD1  4  
HETATM 5461  H HD2  . PTR A 1 2   ? -0.866  -1.655  11.201  1.00 0.00  ? 101 PTR A HD2  4  
HETATM 5462  H HE1  . PTR A 1 2   ? 0.279   -2.446  6.430   1.00 0.00  ? 101 PTR A HE1  4  
HETATM 5463  H HE2  . PTR A 1 2   ? -0.414  -3.962  10.398  1.00 0.00  ? 101 PTR A HE2  4  
ATOM   5464  N N    . GLU A 1 3   ? 0.176   3.597   9.395   1.00 15.01 ? 102 GLU A N    4  
ATOM   5465  C CA   . GLU A 1 3   ? -0.055  5.057   9.583   1.00 18.67 ? 102 GLU A CA   4  
ATOM   5466  C C    . GLU A 1 3   ? -1.542  5.368   9.394   1.00 23.30 ? 102 GLU A C    4  
ATOM   5467  O O    . GLU A 1 3   ? -2.305  4.537   8.942   1.00 23.42 ? 102 GLU A O    4  
ATOM   5468  C CB   . GLU A 1 3   ? 0.766   5.842   8.557   1.00 18.41 ? 102 GLU A CB   4  
ATOM   5469  C CG   . GLU A 1 3   ? 2.123   5.165   8.358   1.00 20.30 ? 102 GLU A CG   4  
ATOM   5470  C CD   . GLU A 1 3   ? 2.793   4.955   9.717   1.00 19.75 ? 102 GLU A CD   4  
ATOM   5471  O OE1  . GLU A 1 3   ? 2.686   5.838   10.552  1.00 19.69 ? 102 GLU A OE1  4  
ATOM   5472  O OE2  . GLU A 1 3   ? 3.402   3.914   9.900   1.00 21.81 ? 102 GLU A OE2  4  
ATOM   5473  H H    . GLU A 1 3   ? 0.271   3.228   8.492   1.00 0.00  ? 102 GLU A H    4  
ATOM   5474  H HA   . GLU A 1 3   ? 0.248   5.344   10.580  1.00 0.00  ? 102 GLU A HA   4  
ATOM   5475  H HB2  . GLU A 1 3   ? 0.234   5.867   7.616   1.00 0.00  ? 102 GLU A HB2  4  
ATOM   5476  H HB3  . GLU A 1 3   ? 0.916   6.850   8.911   1.00 0.00  ? 102 GLU A HB3  4  
ATOM   5477  H HG2  . GLU A 1 3   ? 1.982   4.210   7.874   1.00 0.00  ? 102 GLU A HG2  4  
ATOM   5478  H HG3  . GLU A 1 3   ? 2.751   5.792   7.743   1.00 0.00  ? 102 GLU A HG3  4  
ATOM   5479  N N    . GLU A 1 4   ? -1.958  6.556   9.735   1.00 29.30 ? 103 GLU A N    4  
ATOM   5480  C CA   . GLU A 1 4   ? -3.396  6.918   9.574   1.00 35.63 ? 103 GLU A CA   4  
ATOM   5481  C C    . GLU A 1 4   ? -3.517  8.120   8.634   1.00 37.94 ? 103 GLU A C    4  
ATOM   5482  O O    . GLU A 1 4   ? -2.702  9.020   8.654   1.00 40.44 ? 103 GLU A O    4  
ATOM   5483  C CB   . GLU A 1 4   ? -3.988  7.276   10.939  1.00 38.84 ? 103 GLU A CB   4  
ATOM   5484  C CG   . GLU A 1 4   ? -4.544  6.015   11.603  1.00 44.99 ? 103 GLU A CG   4  
ATOM   5485  C CD   . GLU A 1 4   ? -5.793  5.552   10.853  1.00 50.48 ? 103 GLU A CD   4  
ATOM   5486  O OE1  . GLU A 1 4   ? -6.143  6.189   9.873   1.00 53.04 ? 103 GLU A OE1  4  
ATOM   5487  O OE2  . GLU A 1 4   ? -6.381  4.568   11.272  1.00 53.57 ? 103 GLU A OE2  4  
ATOM   5488  H H    . GLU A 1 4   ? -1.327  7.211   10.098  1.00 0.00  ? 103 GLU A H    4  
ATOM   5489  H HA   . GLU A 1 4   ? -3.934  6.078   9.158   1.00 0.00  ? 103 GLU A HA   4  
ATOM   5490  H HB2  . GLU A 1 4   ? -3.216  7.702   11.565  1.00 0.00  ? 103 GLU A HB2  4  
ATOM   5491  H HB3  . GLU A 1 4   ? -4.784  7.993   10.810  1.00 0.00  ? 103 GLU A HB3  4  
ATOM   5492  H HG2  . GLU A 1 4   ? -3.796  5.235   11.576  1.00 0.00  ? 103 GLU A HG2  4  
ATOM   5493  H HG3  . GLU A 1 4   ? -4.801  6.232   12.629  1.00 0.00  ? 103 GLU A HG3  4  
ATOM   5494  N N    . ILE A 1 5   ? -4.532  8.143   7.813   1.00 39.26 ? 104 ILE A N    4  
ATOM   5495  C CA   . ILE A 1 5   ? -4.704  9.288   6.874   1.00 40.91 ? 104 ILE A CA   4  
ATOM   5496  C C    . ILE A 1 5   ? -5.381  10.449  7.606   1.00 42.72 ? 104 ILE A C    4  
ATOM   5497  O O    . ILE A 1 5   ? -6.586  10.489  7.745   1.00 43.33 ? 104 ILE A O    4  
ATOM   5498  C CB   . ILE A 1 5   ? -5.575  8.854   5.692   1.00 40.30 ? 104 ILE A CB   4  
ATOM   5499  C CG1  . ILE A 1 5   ? -4.881  7.720   4.933   1.00 39.28 ? 104 ILE A CG1  4  
ATOM   5500  C CG2  . ILE A 1 5   ? -5.789  10.042  4.751   1.00 41.44 ? 104 ILE A CG2  4  
ATOM   5501  C CD1  . ILE A 1 5   ? -3.586  8.239   4.305   1.00 37.66 ? 104 ILE A CD1  4  
ATOM   5502  H H    . ILE A 1 5   ? -5.180  7.408   7.812   1.00 0.00  ? 104 ILE A H    4  
ATOM   5503  H HA   . ILE A 1 5   ? -3.737  9.605   6.512   1.00 0.00  ? 104 ILE A HA   4  
ATOM   5504  H HB   . ILE A 1 5   ? -6.532  8.511   6.060   1.00 0.00  ? 104 ILE A HB   4  
ATOM   5505  H HG12 . ILE A 1 5   ? -4.654  6.915   5.617   1.00 0.00  ? 104 ILE A HG12 4  
ATOM   5506  H HG13 . ILE A 1 5   ? -5.534  7.356   4.154   1.00 0.00  ? 104 ILE A HG13 4  
ATOM   5507  H HG21 . ILE A 1 5   ? -6.033  10.921  5.330   1.00 0.00  ? 104 ILE A HG21 4  
ATOM   5508  H HG22 . ILE A 1 5   ? -4.885  10.222  4.188   1.00 0.00  ? 104 ILE A HG22 4  
ATOM   5509  H HG23 . ILE A 1 5   ? -6.598  9.822   4.072   1.00 0.00  ? 104 ILE A HG23 4  
ATOM   5510  H HD11 . ILE A 1 5   ? -3.361  9.219   4.699   1.00 0.00  ? 104 ILE A HD11 4  
ATOM   5511  H HD12 . ILE A 1 5   ? -2.776  7.562   4.538   1.00 0.00  ? 104 ILE A HD12 4  
ATOM   5512  H HD13 . ILE A 1 5   ? -3.705  8.301   3.234   1.00 0.00  ? 104 ILE A HD13 4  
ATOM   5513  N N    . GLU A 1 6   ? -4.614  11.395  8.075   1.00 0.00  ? 105 GLU A N    4  
ATOM   5514  C CA   . GLU A 1 6   ? -5.215  12.552  8.797   1.00 0.00  ? 105 GLU A CA   4  
ATOM   5515  C C    . GLU A 1 6   ? -4.645  13.857  8.236   1.00 0.00  ? 105 GLU A C    4  
ATOM   5516  O O    . GLU A 1 6   ? -5.301  14.456  7.399   1.00 0.00  ? 105 GLU A O    4  
ATOM   5517  C CB   . GLU A 1 6   ? -4.884  12.451  10.287  1.00 0.00  ? 105 GLU A CB   4  
ATOM   5518  C CG   . GLU A 1 6   ? -5.723  11.341  10.923  1.00 0.00  ? 105 GLU A CG   4  
ATOM   5519  C CD   . GLU A 1 6   ? -6.145  11.764  12.331  1.00 0.00  ? 105 GLU A CD   4  
ATOM   5520  O OE1  . GLU A 1 6   ? -5.294  12.238  13.066  1.00 0.00  ? 105 GLU A OE1  4  
ATOM   5521  O OE2  . GLU A 1 6   ? -7.313  11.608  12.650  1.00 0.00  ? 105 GLU A OE2  4  
ATOM   5522  O OXT  . GLU A 1 6   ? -3.564  14.236  8.654   1.00 0.00  ? 105 GLU A OXT  4  
ATOM   5523  H H    . GLU A 1 6   ? -3.642  11.346  7.951   1.00 0.00  ? 105 GLU A H    4  
ATOM   5524  H HA   . GLU A 1 6   ? -6.287  12.541  8.665   1.00 0.00  ? 105 GLU A HA   4  
ATOM   5525  H HB2  . GLU A 1 6   ? -3.834  12.223  10.407  1.00 0.00  ? 105 GLU A HB2  4  
ATOM   5526  H HB3  . GLU A 1 6   ? -5.105  13.390  10.770  1.00 0.00  ? 105 GLU A HB3  4  
ATOM   5527  H HG2  . GLU A 1 6   ? -6.603  11.165  10.320  1.00 0.00  ? 105 GLU A HG2  4  
ATOM   5528  H HG3  . GLU A 1 6   ? -5.139  10.435  10.981  1.00 0.00  ? 105 GLU A HG3  4  
ATOM   5529  N N    . MET B 2 1   ? -5.870  -12.602 -20.313 1.00 0.00  ? 140 MET B N    4  
ATOM   5530  C CA   . MET B 2 1   ? -6.616  -13.099 -19.123 1.00 0.00  ? 140 MET B CA   4  
ATOM   5531  C C    . MET B 2 1   ? -6.714  -11.984 -18.078 1.00 0.00  ? 140 MET B C    4  
ATOM   5532  O O    . MET B 2 1   ? -7.776  -11.457 -17.816 1.00 0.00  ? 140 MET B O    4  
ATOM   5533  C CB   . MET B 2 1   ? -5.880  -14.298 -18.522 1.00 0.00  ? 140 MET B CB   4  
ATOM   5534  C CG   . MET B 2 1   ? -6.524  -15.593 -19.019 1.00 0.00  ? 140 MET B CG   4  
ATOM   5535  S SD   . MET B 2 1   ? -5.579  -17.011 -18.410 1.00 0.00  ? 140 MET B SD   4  
ATOM   5536  C CE   . MET B 2 1   ? -6.867  -18.259 -18.648 1.00 0.00  ? 140 MET B CE   4  
ATOM   5537  H H1   . MET B 2 1   ? -4.973  -12.175 -20.006 1.00 0.00  ? 140 MET B H1   4  
ATOM   5538  H H2   . MET B 2 1   ? -5.674  -13.397 -20.955 1.00 0.00  ? 140 MET B H2   4  
ATOM   5539  H H3   . MET B 2 1   ? -6.440  -11.888 -20.808 1.00 0.00  ? 140 MET B H3   4  
ATOM   5540  H HA   . MET B 2 1   ? -7.610  -13.399 -19.421 1.00 0.00  ? 140 MET B HA   4  
ATOM   5541  H HB2  . MET B 2 1   ? -4.843  -14.270 -18.826 1.00 0.00  ? 140 MET B HB2  4  
ATOM   5542  H HB3  . MET B 2 1   ? -5.942  -14.257 -17.446 1.00 0.00  ? 140 MET B HB3  4  
ATOM   5543  H HG2  . MET B 2 1   ? -7.539  -15.652 -18.655 1.00 0.00  ? 140 MET B HG2  4  
ATOM   5544  H HG3  . MET B 2 1   ? -6.528  -15.601 -20.099 1.00 0.00  ? 140 MET B HG3  4  
ATOM   5545  H HE1  . MET B 2 1   ? -7.800  -17.895 -18.239 1.00 0.00  ? 140 MET B HE1  4  
ATOM   5546  H HE2  . MET B 2 1   ? -6.990  -18.455 -19.701 1.00 0.00  ? 140 MET B HE2  4  
ATOM   5547  H HE3  . MET B 2 1   ? -6.578  -19.172 -18.145 1.00 0.00  ? 140 MET B HE3  4  
ATOM   5548  N N    . ASP B 2 2   ? -5.611  -11.620 -17.481 1.00 0.00  ? 141 ASP B N    4  
ATOM   5549  C CA   . ASP B 2 2   ? -5.642  -10.539 -16.456 1.00 0.00  ? 141 ASP B CA   4  
ATOM   5550  C C    . ASP B 2 2   ? -6.450  -11.009 -15.243 1.00 0.00  ? 141 ASP B C    4  
ATOM   5551  O O    . ASP B 2 2   ? -7.382  -11.778 -15.367 1.00 0.00  ? 141 ASP B O    4  
ATOM   5552  C CB   . ASP B 2 2   ? -6.294  -9.290  -17.051 1.00 0.00  ? 141 ASP B CB   4  
ATOM   5553  C CG   . ASP B 2 2   ? -5.689  -9.004  -18.426 1.00 0.00  ? 141 ASP B CG   4  
ATOM   5554  O OD1  . ASP B 2 2   ? -5.981  -9.750  -19.347 1.00 0.00  ? 141 ASP B OD1  4  
ATOM   5555  O OD2  . ASP B 2 2   ? -4.944  -8.044  -18.536 1.00 0.00  ? 141 ASP B OD2  4  
ATOM   5556  H H    . ASP B 2 2   ? -4.764  -12.058 -17.708 1.00 0.00  ? 141 ASP B H    4  
ATOM   5557  H HA   . ASP B 2 2   ? -4.633  -10.307 -16.148 1.00 0.00  ? 141 ASP B HA   4  
ATOM   5558  H HB2  . ASP B 2 2   ? -7.357  -9.452  -17.151 1.00 0.00  ? 141 ASP B HB2  4  
ATOM   5559  H HB3  . ASP B 2 2   ? -6.118  -8.446  -16.400 1.00 0.00  ? 141 ASP B HB3  4  
ATOM   5560  N N    . SER B 2 3   ? -6.100  -10.551 -14.072 1.00 0.00  ? 142 SER B N    4  
ATOM   5561  C CA   . SER B 2 3   ? -6.849  -10.970 -12.853 1.00 0.00  ? 142 SER B CA   4  
ATOM   5562  C C    . SER B 2 3   ? -6.110  -10.480 -11.605 1.00 0.00  ? 142 SER B C    4  
ATOM   5563  O O    . SER B 2 3   ? -4.915  -10.262 -11.626 1.00 0.00  ? 142 SER B O    4  
ATOM   5564  C CB   . SER B 2 3   ? -6.950  -12.496 -12.817 1.00 0.00  ? 142 SER B CB   4  
ATOM   5565  O OG   . SER B 2 3   ? -5.782  -13.058 -13.399 1.00 0.00  ? 142 SER B OG   4  
ATOM   5566  H H    . SER B 2 3   ? -5.345  -9.930  -13.993 1.00 0.00  ? 142 SER B H    4  
ATOM   5567  H HA   . SER B 2 3   ? -7.841  -10.544 -12.875 1.00 0.00  ? 142 SER B HA   4  
ATOM   5568  H HB2  . SER B 2 3   ? -7.032  -12.830 -11.796 1.00 0.00  ? 142 SER B HB2  4  
ATOM   5569  H HB3  . SER B 2 3   ? -7.827  -12.811 -13.367 1.00 0.00  ? 142 SER B HB3  4  
ATOM   5570  H HG   . SER B 2 3   ? -5.737  -13.982 -13.145 1.00 0.00  ? 142 SER B HG   4  
ATOM   5571  N N    . ILE B 2 4   ? -6.813  -10.305 -10.520 1.00 0.00  ? 143 ILE B N    4  
ATOM   5572  C CA   . ILE B 2 4   ? -6.150  -9.829  -9.273  1.00 0.00  ? 143 ILE B CA   4  
ATOM   5573  C C    . ILE B 2 4   ? -5.195  -10.907 -8.759  1.00 0.00  ? 143 ILE B C    4  
ATOM   5574  O O    . ILE B 2 4   ? -4.305  -10.641 -7.976  1.00 0.00  ? 143 ILE B O    4  
ATOM   5575  C CB   . ILE B 2 4   ? -7.210  -9.536  -8.209  1.00 0.00  ? 143 ILE B CB   4  
ATOM   5576  C CG1  . ILE B 2 4   ? -6.536  -8.947  -6.968  1.00 0.00  ? 143 ILE B CG1  4  
ATOM   5577  C CG2  . ILE B 2 4   ? -7.926  -10.834 -7.832  1.00 0.00  ? 143 ILE B CG2  4  
ATOM   5578  C CD1  . ILE B 2 4   ? -7.548  -8.110  -6.185  1.00 0.00  ? 143 ILE B CD1  4  
ATOM   5579  H H    . ILE B 2 4   ? -7.776  -10.487 -10.523 1.00 0.00  ? 143 ILE B H    4  
ATOM   5580  H HA   . ILE B 2 4   ? -5.593  -8.927  -9.484  1.00 0.00  ? 143 ILE B HA   4  
ATOM   5581  H HB   . ILE B 2 4   ? -7.928  -8.830  -8.601  1.00 0.00  ? 143 ILE B HB   4  
ATOM   5582  H HG12 . ILE B 2 4   ? -6.169  -9.750  -6.343  1.00 0.00  ? 143 ILE B HG12 4  
ATOM   5583  H HG13 . ILE B 2 4   ? -5.710  -8.321  -7.270  1.00 0.00  ? 143 ILE B HG13 4  
ATOM   5584  H HG21 . ILE B 2 4   ? -7.566  -11.639 -8.457  1.00 0.00  ? 143 ILE B HG21 4  
ATOM   5585  H HG22 . ILE B 2 4   ? -7.729  -11.067 -6.796  1.00 0.00  ? 143 ILE B HG22 4  
ATOM   5586  H HG23 . ILE B 2 4   ? -8.989  -10.715 -7.978  1.00 0.00  ? 143 ILE B HG23 4  
ATOM   5587  H HD11 . ILE B 2 4   ? -8.548  -8.443  -6.419  1.00 0.00  ? 143 ILE B HD11 4  
ATOM   5588  H HD12 . ILE B 2 4   ? -7.369  -8.226  -5.126  1.00 0.00  ? 143 ILE B HD12 4  
ATOM   5589  H HD13 . ILE B 2 4   ? -7.442  -7.070  -6.457  1.00 0.00  ? 143 ILE B HD13 4  
ATOM   5590  N N    . GLN B 2 5   ? -5.373  -12.126 -9.192  1.00 0.00  ? 144 GLN B N    4  
ATOM   5591  C CA   . GLN B 2 5   ? -4.476  -13.220 -8.727  1.00 0.00  ? 144 GLN B CA   4  
ATOM   5592  C C    . GLN B 2 5   ? -3.019  -12.826 -8.975  1.00 0.00  ? 144 GLN B C    4  
ATOM   5593  O O    . GLN B 2 5   ? -2.112  -13.348 -8.359  1.00 0.00  ? 144 GLN B O    4  
ATOM   5594  C CB   . GLN B 2 5   ? -4.795  -14.503 -9.497  1.00 0.00  ? 144 GLN B CB   4  
ATOM   5595  C CG   . GLN B 2 5   ? -4.223  -15.706 -8.744  1.00 0.00  ? 144 GLN B CG   4  
ATOM   5596  C CD   . GLN B 2 5   ? -3.288  -16.489 -9.667  1.00 0.00  ? 144 GLN B CD   4  
ATOM   5597  O OE1  . GLN B 2 5   ? -2.084  -16.447 -9.509  1.00 0.00  ? 144 GLN B OE1  4  
ATOM   5598  N NE2  . GLN B 2 5   ? -3.795  -17.208 -10.630 1.00 0.00  ? 144 GLN B NE2  4  
ATOM   5599  H H    . GLN B 2 5   ? -6.098  -12.320 -9.823  1.00 0.00  ? 144 GLN B H    4  
ATOM   5600  H HA   . GLN B 2 5   ? -4.630  -13.386 -7.671  1.00 0.00  ? 144 GLN B HA   4  
ATOM   5601  H HB2  . GLN B 2 5   ? -5.867  -14.611 -9.589  1.00 0.00  ? 144 GLN B HB2  4  
ATOM   5602  H HB3  . GLN B 2 5   ? -4.353  -14.453 -10.480 1.00 0.00  ? 144 GLN B HB3  4  
ATOM   5603  H HG2  . GLN B 2 5   ? -3.672  -15.359 -7.880  1.00 0.00  ? 144 GLN B HG2  4  
ATOM   5604  H HG3  . GLN B 2 5   ? -5.030  -16.347 -8.423  1.00 0.00  ? 144 GLN B HG3  4  
ATOM   5605  H HE21 . GLN B 2 5   ? -4.766  -17.242 -10.758 1.00 0.00  ? 144 GLN B HE21 4  
ATOM   5606  H HE22 . GLN B 2 5   ? -3.204  -17.713 -11.227 1.00 0.00  ? 144 GLN B HE22 4  
ATOM   5607  N N    . ALA B 2 6   ? -2.787  -11.909 -9.873  1.00 42.36 ? 145 ALA B N    4  
ATOM   5608  C CA   . ALA B 2 6   ? -1.389  -11.483 -10.159 1.00 39.52 ? 145 ALA B CA   4  
ATOM   5609  C C    . ALA B 2 6   ? -1.385  -10.022 -10.614 1.00 36.36 ? 145 ALA B C    4  
ATOM   5610  O O    . ALA B 2 6   ? -0.717  -9.660  -11.563 1.00 36.34 ? 145 ALA B O    4  
ATOM   5611  C CB   . ALA B 2 6   ? -0.804  -12.363 -11.266 1.00 40.62 ? 145 ALA B CB   4  
ATOM   5612  H H    . ALA B 2 6   ? -3.533  -11.500 -10.360 1.00 0.00  ? 145 ALA B H    4  
ATOM   5613  H HA   . ALA B 2 6   ? -0.791  -11.583 -9.265  1.00 0.00  ? 145 ALA B HA   4  
ATOM   5614  H HB1  . ALA B 2 6   ? -1.465  -13.195 -11.451 1.00 0.00  ? 145 ALA B HB1  4  
ATOM   5615  H HB2  . ALA B 2 6   ? -0.695  -11.780 -12.169 1.00 0.00  ? 145 ALA B HB2  4  
ATOM   5616  H HB3  . ALA B 2 6   ? 0.164   -12.733 -10.958 1.00 0.00  ? 145 ALA B HB3  4  
ATOM   5617  N N    . GLU B 2 7   ? -2.124  -9.181  -9.946  1.00 32.22 ? 146 GLU B N    4  
ATOM   5618  C CA   . GLU B 2 7   ? -2.162  -7.745  -10.341 1.00 28.03 ? 146 GLU B CA   4  
ATOM   5619  C C    . GLU B 2 7   ? -0.737  -7.187  -10.374 1.00 24.38 ? 146 GLU B C    4  
ATOM   5620  O O    . GLU B 2 7   ? 0.183   -7.777  -9.844  1.00 22.48 ? 146 GLU B O    4  
ATOM   5621  C CB   . GLU B 2 7   ? -2.997  -6.959  -9.328  1.00 27.81 ? 146 GLU B CB   4  
ATOM   5622  C CG   . GLU B 2 7   ? -4.177  -6.298  -10.041 1.00 30.44 ? 146 GLU B CG   4  
ATOM   5623  C CD   . GLU B 2 7   ? -3.656  -5.388  -11.155 1.00 31.15 ? 146 GLU B CD   4  
ATOM   5624  O OE1  . GLU B 2 7   ? -3.337  -4.248  -10.861 1.00 34.56 ? 146 GLU B OE1  4  
ATOM   5625  O OE2  . GLU B 2 7   ? -3.585  -5.847  -12.283 1.00 30.91 ? 146 GLU B OE2  4  
ATOM   5626  H H    . GLU B 2 7   ? -2.655  -9.493  -9.183  1.00 0.00  ? 146 GLU B H    4  
ATOM   5627  H HA   . GLU B 2 7   ? -2.607  -7.653  -11.321 1.00 0.00  ? 146 GLU B HA   4  
ATOM   5628  H HB2  . GLU B 2 7   ? -3.367  -7.633  -8.568  1.00 0.00  ? 146 GLU B HB2  4  
ATOM   5629  H HB3  . GLU B 2 7   ? -2.385  -6.199  -8.868  1.00 0.00  ? 146 GLU B HB3  4  
ATOM   5630  H HG2  . GLU B 2 7   ? -4.814  -7.061  -10.466 1.00 0.00  ? 146 GLU B HG2  4  
ATOM   5631  H HG3  . GLU B 2 7   ? -4.743  -5.711  -9.334  1.00 0.00  ? 146 GLU B HG3  4  
ATOM   5632  N N    . GLU B 2 8   ? -0.548  -6.055  -10.995 1.00 21.92 ? 147 GLU B N    4  
ATOM   5633  C CA   . GLU B 2 8   ? 0.818   -5.461  -11.064 1.00 21.70 ? 147 GLU B CA   4  
ATOM   5634  C C    . GLU B 2 8   ? 1.302   -5.115  -9.655  1.00 19.46 ? 147 GLU B C    4  
ATOM   5635  O O    . GLU B 2 8   ? 2.467   -4.845  -9.438  1.00 19.28 ? 147 GLU B O    4  
ATOM   5636  C CB   . GLU B 2 8   ? 0.777   -4.189  -11.914 1.00 26.72 ? 147 GLU B CB   4  
ATOM   5637  C CG   . GLU B 2 8   ? -0.262  -3.223  -11.338 1.00 37.15 ? 147 GLU B CG   4  
ATOM   5638  C CD   . GLU B 2 8   ? -1.107  -2.644  -12.475 1.00 41.71 ? 147 GLU B CD   4  
ATOM   5639  O OE1  . GLU B 2 8   ? -0.553  -2.404  -13.535 1.00 45.02 ? 147 GLU B OE1  4  
ATOM   5640  O OE2  . GLU B 2 8   ? -2.294  -2.451  -12.266 1.00 46.00 ? 147 GLU B OE2  4  
ATOM   5641  H H    . GLU B 2 8   ? -1.303  -5.596  -11.417 1.00 0.00  ? 147 GLU B H    4  
ATOM   5642  H HA   . GLU B 2 8   ? 1.496   -6.170  -11.513 1.00 0.00  ? 147 GLU B HA   4  
ATOM   5643  H HB2  . GLU B 2 8   ? 1.749   -3.718  -11.906 1.00 0.00  ? 147 GLU B HB2  4  
ATOM   5644  H HB3  . GLU B 2 8   ? 0.507   -4.440  -12.928 1.00 0.00  ? 147 GLU B HB3  4  
ATOM   5645  H HG2  . GLU B 2 8   ? -0.900  -3.753  -10.647 1.00 0.00  ? 147 GLU B HG2  4  
ATOM   5646  H HG3  . GLU B 2 8   ? 0.241   -2.419  -10.821 1.00 0.00  ? 147 GLU B HG3  4  
ATOM   5647  N N    . TRP B 2 9   ? 0.420   -5.118  -8.693  1.00 17.10 ? 148 TRP B N    4  
ATOM   5648  C CA   . TRP B 2 9   ? 0.836   -4.787  -7.300  1.00 12.75 ? 148 TRP B CA   4  
ATOM   5649  C C    . TRP B 2 9   ? 0.276   -5.834  -6.335  1.00 12.19 ? 148 TRP B C    4  
ATOM   5650  O O    . TRP B 2 9   ? 0.048   -5.562  -5.173  1.00 11.66 ? 148 TRP B O    4  
ATOM   5651  C CB   . TRP B 2 9   ? 0.303   -3.402  -6.917  1.00 14.42 ? 148 TRP B CB   4  
ATOM   5652  C CG   . TRP B 2 9   ? -1.049  -3.193  -7.522  1.00 13.12 ? 148 TRP B CG   4  
ATOM   5653  C CD1  . TRP B 2 9   ? -1.300  -2.430  -8.612  1.00 13.11 ? 148 TRP B CD1  4  
ATOM   5654  C CD2  . TRP B 2 9   ? -2.334  -3.732  -7.095  1.00 12.81 ? 148 TRP B CD2  4  
ATOM   5655  N NE1  . TRP B 2 9   ? -2.657  -2.466  -8.883  1.00 12.63 ? 148 TRP B NE1  4  
ATOM   5656  C CE2  . TRP B 2 9   ? -3.337  -3.255  -7.978  1.00 13.14 ? 148 TRP B CE2  4  
ATOM   5657  C CE3  . TRP B 2 9   ? -2.725  -4.583  -6.039  1.00 10.52 ? 148 TRP B CE3  4  
ATOM   5658  C CZ2  . TRP B 2 9   ? -4.681  -3.609  -7.819  1.00 13.39 ? 148 TRP B CZ2  4  
ATOM   5659  C CZ3  . TRP B 2 9   ? -4.078  -4.942  -5.874  1.00 12.83 ? 148 TRP B CZ3  4  
ATOM   5660  C CH2  . TRP B 2 9   ? -5.054  -4.455  -6.763  1.00 12.53 ? 148 TRP B CH2  4  
ATOM   5661  H H    . TRP B 2 9   ? -0.516  -5.337  -8.886  1.00 0.00  ? 148 TRP B H    4  
ATOM   5662  H HA   . TRP B 2 9   ? 1.915   -4.786  -7.239  1.00 0.00  ? 148 TRP B HA   4  
ATOM   5663  H HB2  . TRP B 2 9   ? 0.231   -3.330  -5.842  1.00 0.00  ? 148 TRP B HB2  4  
ATOM   5664  H HB3  . TRP B 2 9   ? 0.981   -2.645  -7.281  1.00 0.00  ? 148 TRP B HB3  4  
ATOM   5665  H HD1  . TRP B 2 9   ? -0.562  -1.881  -9.178  1.00 0.00  ? 148 TRP B HD1  4  
ATOM   5666  H HE1  . TRP B 2 9   ? -3.099  -1.997  -9.620  1.00 0.00  ? 148 TRP B HE1  4  
ATOM   5667  H HE3  . TRP B 2 9   ? -1.984  -4.960  -5.352  1.00 0.00  ? 148 TRP B HE3  4  
ATOM   5668  H HZ2  . TRP B 2 9   ? -5.428  -3.233  -8.503  1.00 0.00  ? 148 TRP B HZ2  4  
ATOM   5669  H HZ3  . TRP B 2 9   ? -4.367  -5.592  -5.063  1.00 0.00  ? 148 TRP B HZ3  4  
ATOM   5670  H HH2  . TRP B 2 9   ? -6.088  -4.732  -6.634  1.00 0.00  ? 148 TRP B HH2  4  
ATOM   5671  N N    . TYR B 2 10  ? 0.054   -7.030  -6.805  1.00 11.66 ? 149 TYR B N    4  
ATOM   5672  C CA   . TYR B 2 10  ? -0.491  -8.092  -5.914  1.00 13.63 ? 149 TYR B CA   4  
ATOM   5673  C C    . TYR B 2 10  ? 0.572   -9.170  -5.692  1.00 14.73 ? 149 TYR B C    4  
ATOM   5674  O O    . TYR B 2 10  ? 0.882   -9.941  -6.578  1.00 16.34 ? 149 TYR B O    4  
ATOM   5675  C CB   . TYR B 2 10  ? -1.725  -8.719  -6.564  1.00 12.52 ? 149 TYR B CB   4  
ATOM   5676  C CG   . TYR B 2 10  ? -2.540  -9.436  -5.515  1.00 15.49 ? 149 TYR B CG   4  
ATOM   5677  C CD1  . TYR B 2 10  ? -3.286  -8.699  -4.579  1.00 14.45 ? 149 TYR B CD1  4  
ATOM   5678  C CD2  . TYR B 2 10  ? -2.554  -10.840 -5.475  1.00 19.03 ? 149 TYR B CD2  4  
ATOM   5679  C CE1  . TYR B 2 10  ? -4.044  -9.366  -3.603  1.00 15.99 ? 149 TYR B CE1  4  
ATOM   5680  C CE2  . TYR B 2 10  ? -3.312  -11.508 -4.498  1.00 20.41 ? 149 TYR B CE2  4  
ATOM   5681  C CZ   . TYR B 2 10  ? -4.057  -10.771 -3.562  1.00 21.15 ? 149 TYR B CZ   4  
ATOM   5682  O OH   . TYR B 2 10  ? -4.802  -11.425 -2.602  1.00 23.67 ? 149 TYR B OH   4  
ATOM   5683  H H    . TYR B 2 10  ? 0.245   -7.231  -7.746  1.00 0.00  ? 149 TYR B H    4  
ATOM   5684  H HA   . TYR B 2 10  ? -0.767  -7.658  -4.964  1.00 0.00  ? 149 TYR B HA   4  
ATOM   5685  H HB2  . TYR B 2 10  ? -2.325  -7.944  -7.018  1.00 0.00  ? 149 TYR B HB2  4  
ATOM   5686  H HB3  . TYR B 2 10  ? -1.416  -9.424  -7.321  1.00 0.00  ? 149 TYR B HB3  4  
ATOM   5687  H HD1  . TYR B 2 10  ? -3.275  -7.619  -4.610  1.00 0.00  ? 149 TYR B HD1  4  
ATOM   5688  H HD2  . TYR B 2 10  ? -1.982  -11.407 -6.194  1.00 0.00  ? 149 TYR B HD2  4  
ATOM   5689  H HE1  . TYR B 2 10  ? -4.616  -8.800  -2.883  1.00 0.00  ? 149 TYR B HE1  4  
ATOM   5690  H HE2  . TYR B 2 10  ? -3.323  -12.587 -4.467  1.00 0.00  ? 149 TYR B HE2  4  
ATOM   5691  H HH   . TYR B 2 10  ? -4.265  -12.137 -2.245  1.00 0.00  ? 149 TYR B HH   4  
ATOM   5692  N N    . PHE B 2 11  ? 1.130   -9.232  -4.514  1.00 14.41 ? 150 PHE B N    4  
ATOM   5693  C CA   . PHE B 2 11  ? 2.170   -10.262 -4.235  1.00 13.20 ? 150 PHE B CA   4  
ATOM   5694  C C    . PHE B 2 11  ? 1.517   -11.479 -3.578  1.00 12.95 ? 150 PHE B C    4  
ATOM   5695  O O    . PHE B 2 11  ? 1.864   -12.610 -3.859  1.00 12.44 ? 150 PHE B O    4  
ATOM   5696  C CB   . PHE B 2 11  ? 3.228   -9.679  -3.294  1.00 13.34 ? 150 PHE B CB   4  
ATOM   5697  C CG   . PHE B 2 11  ? 4.513   -9.464  -4.056  1.00 10.91 ? 150 PHE B CG   4  
ATOM   5698  C CD1  . PHE B 2 11  ? 5.172   -10.557 -4.645  1.00 10.09 ? 150 PHE B CD1  4  
ATOM   5699  C CD2  . PHE B 2 11  ? 5.051   -8.172  -4.177  1.00 10.43 ? 150 PHE B CD2  4  
ATOM   5700  C CE1  . PHE B 2 11  ? 6.368   -10.356 -5.354  1.00 7.94  ? 150 PHE B CE1  4  
ATOM   5701  C CE2  . PHE B 2 11  ? 6.247   -7.971  -4.886  1.00 9.38  ? 150 PHE B CE2  4  
ATOM   5702  C CZ   . PHE B 2 11  ? 6.906   -9.063  -5.474  1.00 8.81  ? 150 PHE B CZ   4  
ATOM   5703  H H    . PHE B 2 11  ? 0.865   -8.602  -3.812  1.00 0.00  ? 150 PHE B H    4  
ATOM   5704  H HA   . PHE B 2 11  ? 2.638   -10.561 -5.161  1.00 0.00  ? 150 PHE B HA   4  
ATOM   5705  H HB2  . PHE B 2 11  ? 2.879   -8.735  -2.902  1.00 0.00  ? 150 PHE B HB2  4  
ATOM   5706  H HB3  . PHE B 2 11  ? 3.403   -10.366 -2.480  1.00 0.00  ? 150 PHE B HB3  4  
ATOM   5707  H HD1  . PHE B 2 11  ? 4.760   -11.550 -4.552  1.00 0.00  ? 150 PHE B HD1  4  
ATOM   5708  H HD2  . PHE B 2 11  ? 4.543   -7.331  -3.724  1.00 0.00  ? 150 PHE B HD2  4  
ATOM   5709  H HE1  . PHE B 2 11  ? 6.876   -11.195 -5.807  1.00 0.00  ? 150 PHE B HE1  4  
ATOM   5710  H HE2  . PHE B 2 11  ? 6.659   -6.977  -4.978  1.00 0.00  ? 150 PHE B HE2  4  
ATOM   5711  H HZ   . PHE B 2 11  ? 7.825   -8.909  -6.020  1.00 0.00  ? 150 PHE B HZ   4  
ATOM   5712  N N    . GLY B 2 12  ? 0.573   -11.259 -2.705  1.00 14.57 ? 151 GLY B N    4  
ATOM   5713  C CA   . GLY B 2 12  ? -0.101  -12.401 -2.032  1.00 13.68 ? 151 GLY B CA   4  
ATOM   5714  C C    . GLY B 2 12  ? 0.269   -12.411 -0.549  1.00 15.95 ? 151 GLY B C    4  
ATOM   5715  O O    . GLY B 2 12  ? 0.601   -11.394 0.027   1.00 16.08 ? 151 GLY B O    4  
ATOM   5716  H H    . GLY B 2 12  ? 0.308   -10.341 -2.492  1.00 0.00  ? 151 GLY B H    4  
ATOM   5717  H HA2  . GLY B 2 12  ? -1.172  -12.298 -2.136  1.00 0.00  ? 151 GLY B HA2  4  
ATOM   5718  H HA3  . GLY B 2 12  ? 0.218   -13.326 -2.485  1.00 0.00  ? 151 GLY B HA3  4  
ATOM   5719  N N    . LYS B 2 13  ? 0.212   -13.555 0.073   1.00 14.92 ? 152 LYS B N    4  
ATOM   5720  C CA   . LYS B 2 13  ? 0.555   -13.642 1.514   1.00 16.57 ? 152 LYS B CA   4  
ATOM   5721  C C    . LYS B 2 13  ? 2.076   -13.610 1.683   1.00 15.79 ? 152 LYS B C    4  
ATOM   5722  O O    . LYS B 2 13  ? 2.785   -14.446 1.159   1.00 15.62 ? 152 LYS B O    4  
ATOM   5723  C CB   . LYS B 2 13  ? 0.007   -14.951 2.079   1.00 19.39 ? 152 LYS B CB   4  
ATOM   5724  C CG   . LYS B 2 13  ? 0.319   -16.102 1.119   1.00 26.20 ? 152 LYS B CG   4  
ATOM   5725  C CD   . LYS B 2 13  ? 0.991   -17.241 1.887   1.00 32.70 ? 152 LYS B CD   4  
ATOM   5726  C CE   . LYS B 2 13  ? -0.049  -18.309 2.230   1.00 38.73 ? 152 LYS B CE   4  
ATOM   5727  N NZ   . LYS B 2 13  ? 0.537   -19.280 3.197   1.00 43.61 ? 152 LYS B NZ   4  
ATOM   5728  H H    . LYS B 2 13  ? -0.060  -14.359 -0.407  1.00 0.00  ? 152 LYS B H    4  
ATOM   5729  H HA   . LYS B 2 13  ? 0.116   -12.809 2.042   1.00 0.00  ? 152 LYS B HA   4  
ATOM   5730  H HB2  . LYS B 2 13  ? 0.466   -15.146 3.028   1.00 0.00  ? 152 LYS B HB2  4  
ATOM   5731  H HB3  . LYS B 2 13  ? -1.062  -14.870 2.205   1.00 0.00  ? 152 LYS B HB3  4  
ATOM   5732  H HG2  . LYS B 2 13  ? -0.599  -16.458 0.673   1.00 0.00  ? 152 LYS B HG2  4  
ATOM   5733  H HG3  . LYS B 2 13  ? 0.985   -15.753 0.343   1.00 0.00  ? 152 LYS B HG3  4  
ATOM   5734  H HD2  . LYS B 2 13  ? 1.768   -17.677 1.278   1.00 0.00  ? 152 LYS B HD2  4  
ATOM   5735  H HD3  . LYS B 2 13  ? 1.421   -16.855 2.800   1.00 0.00  ? 152 LYS B HD3  4  
ATOM   5736  H HE2  . LYS B 2 13  ? -0.916  -17.839 2.673   1.00 0.00  ? 152 LYS B HE2  4  
ATOM   5737  H HE3  . LYS B 2 13  ? -0.342  -18.829 1.330   1.00 0.00  ? 152 LYS B HE3  4  
ATOM   5738  H HZ1  . LYS B 2 13  ? 1.503   -18.982 3.444   1.00 0.00  ? 152 LYS B HZ1  4  
ATOM   5739  H HZ2  . LYS B 2 13  ? -0.048  -19.311 4.056   1.00 0.00  ? 152 LYS B HZ2  4  
ATOM   5740  H HZ3  . LYS B 2 13  ? 0.565   -20.226 2.766   1.00 0.00  ? 152 LYS B HZ3  4  
ATOM   5741  N N    . ILE B 2 14  ? 2.581   -12.652 2.410   1.00 16.90 ? 153 ILE B N    4  
ATOM   5742  C CA   . ILE B 2 14  ? 4.055   -12.570 2.612   1.00 16.60 ? 153 ILE B CA   4  
ATOM   5743  C C    . ILE B 2 14  ? 4.349   -12.079 4.032   1.00 17.59 ? 153 ILE B C    4  
ATOM   5744  O O    . ILE B 2 14  ? 3.533   -11.431 4.656   1.00 21.20 ? 153 ILE B O    4  
ATOM   5745  C CB   . ILE B 2 14  ? 4.655   -11.591 1.601   1.00 15.36 ? 153 ILE B CB   4  
ATOM   5746  C CG1  . ILE B 2 14  ? 3.862   -10.282 1.629   1.00 14.56 ? 153 ILE B CG1  4  
ATOM   5747  C CG2  . ILE B 2 14  ? 4.587   -12.199 0.200   1.00 15.80 ? 153 ILE B CG2  4  
ATOM   5748  C CD1  . ILE B 2 14  ? 4.579   -9.234  0.776   1.00 13.00 ? 153 ILE B CD1  4  
ATOM   5749  H H    . ILE B 2 14  ? 1.992   -11.989 2.824   1.00 0.00  ? 153 ILE B H    4  
ATOM   5750  H HA   . ILE B 2 14  ? 4.494   -13.547 2.472   1.00 0.00  ? 153 ILE B HA   4  
ATOM   5751  H HB   . ILE B 2 14  ? 5.687   -11.396 1.859   1.00 0.00  ? 153 ILE B HB   4  
ATOM   5752  H HG12 . ILE B 2 14  ? 2.872   -10.454 1.235   1.00 0.00  ? 153 ILE B HG12 4  
ATOM   5753  H HG13 . ILE B 2 14  ? 3.790   -9.927  2.646   1.00 0.00  ? 153 ILE B HG13 4  
ATOM   5754  H HG21 . ILE B 2 14  ? 5.077   -13.162 0.200   1.00 0.00  ? 153 ILE B HG21 4  
ATOM   5755  H HG22 . ILE B 2 14  ? 3.554   -12.320 -0.091  1.00 0.00  ? 153 ILE B HG22 4  
ATOM   5756  H HG23 . ILE B 2 14  ? 5.083   -11.544 -0.502  1.00 0.00  ? 153 ILE B HG23 4  
ATOM   5757  H HD11 . ILE B 2 14  ? 5.327   -9.717  0.164   1.00 0.00  ? 153 ILE B HD11 4  
ATOM   5758  H HD12 . ILE B 2 14  ? 3.861   -8.736  0.141   1.00 0.00  ? 153 ILE B HD12 4  
ATOM   5759  H HD13 . ILE B 2 14  ? 5.053   -8.508  1.421   1.00 0.00  ? 153 ILE B HD13 4  
ATOM   5760  N N    . THR B 2 15  ? 5.509   -12.384 4.547   1.00 16.79 ? 154 THR B N    4  
ATOM   5761  C CA   . THR B 2 15  ? 5.855   -11.936 5.924   1.00 16.02 ? 154 THR B CA   4  
ATOM   5762  C C    . THR B 2 15  ? 5.990   -10.412 5.947   1.00 15.06 ? 154 THR B C    4  
ATOM   5763  O O    . THR B 2 15  ? 6.281   -9.790  4.945   1.00 14.17 ? 154 THR B O    4  
ATOM   5764  C CB   . THR B 2 15  ? 7.181   -12.573 6.349   1.00 18.43 ? 154 THR B CB   4  
ATOM   5765  O OG1  . THR B 2 15  ? 8.231   -12.051 5.547   1.00 22.52 ? 154 THR B OG1  4  
ATOM   5766  C CG2  . THR B 2 15  ? 7.103   -14.090 6.168   1.00 19.67 ? 154 THR B CG2  4  
ATOM   5767  H H    . THR B 2 15  ? 6.152   -12.909 4.026   1.00 0.00  ? 154 THR B H    4  
ATOM   5768  H HA   . THR B 2 15  ? 5.075   -12.239 6.608   1.00 0.00  ? 154 THR B HA   4  
ATOM   5769  H HB   . THR B 2 15  ? 7.373   -12.347 7.387   1.00 0.00  ? 154 THR B HB   4  
ATOM   5770  H HG1  . THR B 2 15  ? 9.029   -12.548 5.742   1.00 0.00  ? 154 THR B HG1  4  
ATOM   5771  H HG21 . THR B 2 15  ? 6.703   -14.315 5.190   1.00 0.00  ? 154 THR B HG21 4  
ATOM   5772  H HG22 . THR B 2 15  ? 8.091   -14.514 6.260   1.00 0.00  ? 154 THR B HG22 4  
ATOM   5773  H HG23 . THR B 2 15  ? 6.458   -14.509 6.927   1.00 0.00  ? 154 THR B HG23 4  
ATOM   5774  N N    . ARG B 2 16  ? 5.783   -9.805  7.085   1.00 15.92 ? 155 ARG B N    4  
ATOM   5775  C CA   . ARG B 2 16  ? 5.901   -8.323  7.169   1.00 14.63 ? 155 ARG B CA   4  
ATOM   5776  C C    . ARG B 2 16  ? 7.360   -7.915  6.955   1.00 15.69 ? 155 ARG B C    4  
ATOM   5777  O O    . ARG B 2 16  ? 7.654   -6.959  6.263   1.00 13.45 ? 155 ARG B O    4  
ATOM   5778  C CB   . ARG B 2 16  ? 5.438   -7.851  8.550   1.00 13.07 ? 155 ARG B CB   4  
ATOM   5779  C CG   . ARG B 2 16  ? 4.930   -6.412  8.455   1.00 14.81 ? 155 ARG B CG   4  
ATOM   5780  C CD   . ARG B 2 16  ? 5.673   -5.540  9.467   1.00 13.27 ? 155 ARG B CD   4  
ATOM   5781  N NE   . ARG B 2 16  ? 5.390   -6.028  10.847  1.00 16.05 ? 155 ARG B NE   4  
ATOM   5782  C CZ   . ARG B 2 16  ? 6.375   -6.279  11.664  1.00 8.86  ? 155 ARG B CZ   4  
ATOM   5783  N NH1  . ARG B 2 16  ? 6.921   -5.309  12.345  1.00 12.78 ? 155 ARG B NH1  4  
ATOM   5784  N NH2  . ARG B 2 16  ? 6.815   -7.500  11.800  1.00 8.73  ? 155 ARG B NH2  4  
ATOM   5785  H H    . ARG B 2 16  ? 5.551   -10.325 7.882   1.00 0.00  ? 155 ARG B H    4  
ATOM   5786  H HA   . ARG B 2 16  ? 5.284   -7.867  6.409   1.00 0.00  ? 155 ARG B HA   4  
ATOM   5787  H HB2  . ARG B 2 16  ? 4.643   -8.493  8.901   1.00 0.00  ? 155 ARG B HB2  4  
ATOM   5788  H HB3  . ARG B 2 16  ? 6.266   -7.894  9.242   1.00 0.00  ? 155 ARG B HB3  4  
ATOM   5789  H HG2  . ARG B 2 16  ? 5.104   -6.035  7.457   1.00 0.00  ? 155 ARG B HG2  4  
ATOM   5790  H HG3  . ARG B 2 16  ? 3.872   -6.388  8.669   1.00 0.00  ? 155 ARG B HG3  4  
ATOM   5791  H HD2  . ARG B 2 16  ? 6.734   -5.592  9.278   1.00 0.00  ? 155 ARG B HD2  4  
ATOM   5792  H HD3  . ARG B 2 16  ? 5.341   -4.516  9.373   1.00 0.00  ? 155 ARG B HD3  4  
ATOM   5793  H HE   . ARG B 2 16  ? 4.465   -6.161  11.139  1.00 0.00  ? 155 ARG B HE   4  
ATOM   5794  H HH11 . ARG B 2 16  ? 6.583   -4.374  12.240  1.00 0.00  ? 155 ARG B HH11 4  
ATOM   5795  H HH12 . ARG B 2 16  ? 7.676   -5.501  12.972  1.00 0.00  ? 155 ARG B HH12 4  
ATOM   5796  H HH21 . ARG B 2 16  ? 6.397   -8.243  11.278  1.00 0.00  ? 155 ARG B HH21 4  
ATOM   5797  H HH22 . ARG B 2 16  ? 7.571   -7.693  12.427  1.00 0.00  ? 155 ARG B HH22 4  
ATOM   5798  N N    . ARG B 2 17  ? 8.278   -8.633  7.542   1.00 16.92 ? 156 ARG B N    4  
ATOM   5799  C CA   . ARG B 2 17  ? 9.717   -8.288  7.374   1.00 18.61 ? 156 ARG B CA   4  
ATOM   5800  C C    . ARG B 2 17  ? 10.064  -8.253  5.884   1.00 17.01 ? 156 ARG B C    4  
ATOM   5801  O O    . ARG B 2 17  ? 10.788  -7.392  5.425   1.00 17.04 ? 156 ARG B O    4  
ATOM   5802  C CB   . ARG B 2 17  ? 10.578  -9.343  8.071   1.00 24.11 ? 156 ARG B CB   4  
ATOM   5803  C CG   . ARG B 2 17  ? 11.949  -8.750  8.397   1.00 33.87 ? 156 ARG B CG   4  
ATOM   5804  C CD   . ARG B 2 17  ? 12.871  -8.896  7.186   1.00 41.26 ? 156 ARG B CD   4  
ATOM   5805  N NE   . ARG B 2 17  ? 14.203  -9.391  7.631   1.00 49.98 ? 156 ARG B NE   4  
ATOM   5806  C CZ   . ARG B 2 17  ? 15.272  -8.676  7.409   1.00 51.87 ? 156 ARG B CZ   4  
ATOM   5807  N NH1  . ARG B 2 17  ? 15.535  -7.645  8.164   1.00 53.57 ? 156 ARG B NH1  4  
ATOM   5808  N NH2  . ARG B 2 17  ? 16.076  -8.992  6.432   1.00 52.15 ? 156 ARG B NH2  4  
ATOM   5809  H H    . ARG B 2 17  ? 8.020   -9.399  8.096   1.00 0.00  ? 156 ARG B H    4  
ATOM   5810  H HA   . ARG B 2 17  ? 9.910   -7.319  7.811   1.00 0.00  ? 156 ARG B HA   4  
ATOM   5811  H HB2  . ARG B 2 17  ? 10.094  -9.656  8.985   1.00 0.00  ? 156 ARG B HB2  4  
ATOM   5812  H HB3  . ARG B 2 17  ? 10.703  -10.195 7.420   1.00 0.00  ? 156 ARG B HB3  4  
ATOM   5813  H HG2  . ARG B 2 17  ? 11.840  -7.704  8.644   1.00 0.00  ? 156 ARG B HG2  4  
ATOM   5814  H HG3  . ARG B 2 17  ? 12.379  -9.275  9.238   1.00 0.00  ? 156 ARG B HG3  4  
ATOM   5815  H HD2  . ARG B 2 17  ? 12.440  -9.600  6.489   1.00 0.00  ? 156 ARG B HD2  4  
ATOM   5816  H HD3  . ARG B 2 17  ? 12.986  -7.936  6.703   1.00 0.00  ? 156 ARG B HD3  4  
ATOM   5817  H HE   . ARG B 2 17  ? 14.277  -10.254 8.090   1.00 0.00  ? 156 ARG B HE   4  
ATOM   5818  H HH11 . ARG B 2 17  ? 14.918  -7.402  8.912   1.00 0.00  ? 156 ARG B HH11 4  
ATOM   5819  H HH12 . ARG B 2 17  ? 16.354  -7.096  7.994   1.00 0.00  ? 156 ARG B HH12 4  
ATOM   5820  H HH21 . ARG B 2 17  ? 15.875  -9.782  5.852   1.00 0.00  ? 156 ARG B HH21 4  
ATOM   5821  H HH22 . ARG B 2 17  ? 16.897  -8.444  6.262   1.00 0.00  ? 156 ARG B HH22 4  
ATOM   5822  N N    . GLU B 2 18  ? 9.553   -9.183  5.126   1.00 15.73 ? 157 GLU B N    4  
ATOM   5823  C CA   . GLU B 2 18  ? 9.854   -9.204  3.667   1.00 15.26 ? 157 GLU B CA   4  
ATOM   5824  C C    . GLU B 2 18  ? 9.369   -7.903  3.026   1.00 14.10 ? 157 GLU B C    4  
ATOM   5825  O O    . GLU B 2 18  ? 9.981   -7.382  2.116   1.00 15.48 ? 157 GLU B O    4  
ATOM   5826  C CB   . GLU B 2 18  ? 9.138   -10.391 3.018   1.00 19.30 ? 157 GLU B CB   4  
ATOM   5827  C CG   . GLU B 2 18  ? 9.977   -10.916 1.851   1.00 28.11 ? 157 GLU B CG   4  
ATOM   5828  C CD   . GLU B 2 18  ? 10.288  -9.768  0.888   1.00 29.65 ? 157 GLU B CD   4  
ATOM   5829  O OE1  . GLU B 2 18  ? 9.478   -9.524  0.009   1.00 28.63 ? 157 GLU B OE1  4  
ATOM   5830  O OE2  . GLU B 2 18  ? 11.329  -9.153  1.047   1.00 31.13 ? 157 GLU B OE2  4  
ATOM   5831  H H    . GLU B 2 18  ? 8.972   -9.870  5.516   1.00 0.00  ? 157 GLU B H    4  
ATOM   5832  H HA   . GLU B 2 18  ? 10.919  -9.302  3.521   1.00 0.00  ? 157 GLU B HA   4  
ATOM   5833  H HB2  . GLU B 2 18  ? 9.006   -11.174 3.750   1.00 0.00  ? 157 GLU B HB2  4  
ATOM   5834  H HB3  . GLU B 2 18  ? 8.174   -10.073 2.650   1.00 0.00  ? 157 GLU B HB3  4  
ATOM   5835  H HG2  . GLU B 2 18  ? 10.900  -11.329 2.231   1.00 0.00  ? 157 GLU B HG2  4  
ATOM   5836  H HG3  . GLU B 2 18  ? 9.426   -11.683 1.329   1.00 0.00  ? 157 GLU B HG3  4  
ATOM   5837  N N    . SER B 2 19  ? 8.273   -7.372  3.495   1.00 11.43 ? 158 SER B N    4  
ATOM   5838  C CA   . SER B 2 19  ? 7.750   -6.104  2.913   1.00 9.58  ? 158 SER B CA   4  
ATOM   5839  C C    . SER B 2 19  ? 8.757   -4.978  3.149   1.00 10.15 ? 158 SER B C    4  
ATOM   5840  O O    . SER B 2 19  ? 9.204   -4.327  2.227   1.00 12.31 ? 158 SER B O    4  
ATOM   5841  C CB   . SER B 2 19  ? 6.423   -5.745  3.581   1.00 8.90  ? 158 SER B CB   4  
ATOM   5842  O OG   . SER B 2 19  ? 5.540   -6.855  3.496   1.00 11.55 ? 158 SER B OG   4  
ATOM   5843  H H    . SER B 2 19  ? 7.794   -7.807  4.230   1.00 0.00  ? 158 SER B H    4  
ATOM   5844  H HA   . SER B 2 19  ? 7.596   -6.232  1.851   1.00 0.00  ? 158 SER B HA   4  
ATOM   5845  H HB2  . SER B 2 19  ? 6.593   -5.505  4.617   1.00 0.00  ? 158 SER B HB2  4  
ATOM   5846  H HB3  . SER B 2 19  ? 5.991   -4.888  3.081   1.00 0.00  ? 158 SER B HB3  4  
ATOM   5847  H HG   . SER B 2 19  ? 5.363   -7.023  2.568   1.00 0.00  ? 158 SER B HG   4  
ATOM   5848  N N    . GLU B 2 20  ? 9.116   -4.743  4.381   1.00 11.35 ? 159 GLU B N    4  
ATOM   5849  C CA   . GLU B 2 20  ? 10.091  -3.658  4.679   1.00 12.85 ? 159 GLU B CA   4  
ATOM   5850  C C    . GLU B 2 20  ? 11.461  -4.025  4.102   1.00 15.16 ? 159 GLU B C    4  
ATOM   5851  O O    . GLU B 2 20  ? 12.330  -3.188  3.966   1.00 13.16 ? 159 GLU B O    4  
ATOM   5852  C CB   . GLU B 2 20  ? 10.205  -3.483  6.194   1.00 13.71 ? 159 GLU B CB   4  
ATOM   5853  C CG   . GLU B 2 20  ? 9.169   -2.461  6.666   1.00 16.00 ? 159 GLU B CG   4  
ATOM   5854  C CD   . GLU B 2 20  ? 9.413   -2.129  8.139   1.00 19.40 ? 159 GLU B CD   4  
ATOM   5855  O OE1  . GLU B 2 20  ? 10.489  -1.645  8.447   1.00 21.73 ? 159 GLU B OE1  4  
ATOM   5856  O OE2  . GLU B 2 20  ? 8.518   -2.367  8.934   1.00 26.69 ? 159 GLU B OE2  4  
ATOM   5857  H H    . GLU B 2 20  ? 8.743   -5.279  5.112   1.00 0.00  ? 159 GLU B H    4  
ATOM   5858  H HA   . GLU B 2 20  ? 9.750   -2.735  4.235   1.00 0.00  ? 159 GLU B HA   4  
ATOM   5859  H HB2  . GLU B 2 20  ? 10.023  -4.432  6.680   1.00 0.00  ? 159 GLU B HB2  4  
ATOM   5860  H HB3  . GLU B 2 20  ? 11.193  -3.133  6.443   1.00 0.00  ? 159 GLU B HB3  4  
ATOM   5861  H HG2  . GLU B 2 20  ? 9.257   -1.561  6.074   1.00 0.00  ? 159 GLU B HG2  4  
ATOM   5862  H HG3  . GLU B 2 20  ? 8.178   -2.873  6.551   1.00 0.00  ? 159 GLU B HG3  4  
ATOM   5863  N N    . ARG B 2 21  ? 11.659  -5.268  3.761   1.00 15.73 ? 160 ARG B N    4  
ATOM   5864  C CA   . ARG B 2 21  ? 12.971  -5.686  3.192   1.00 17.77 ? 160 ARG B CA   4  
ATOM   5865  C C    . ARG B 2 21  ? 13.038  -5.290  1.716   1.00 17.96 ? 160 ARG B C    4  
ATOM   5866  O O    . ARG B 2 21  ? 14.073  -4.907  1.210   1.00 17.67 ? 160 ARG B O    4  
ATOM   5867  C CB   . ARG B 2 21  ? 13.120  -7.203  3.313   1.00 21.81 ? 160 ARG B CB   4  
ATOM   5868  C CG   . ARG B 2 21  ? 14.509  -7.541  3.856   1.00 30.59 ? 160 ARG B CG   4  
ATOM   5869  C CD   . ARG B 2 21  ? 15.125  -8.662  3.017   1.00 37.74 ? 160 ARG B CD   4  
ATOM   5870  N NE   . ARG B 2 21  ? 15.196  -8.232  1.592   1.00 43.93 ? 160 ARG B NE   4  
ATOM   5871  C CZ   . ARG B 2 21  ? 16.123  -8.713  0.811   1.00 48.64 ? 160 ARG B CZ   4  
ATOM   5872  N NH1  . ARG B 2 21  ? 15.920  -9.830  0.167   1.00 50.79 ? 160 ARG B NH1  4  
ATOM   5873  N NH2  . ARG B 2 21  ? 17.255  -8.077  0.674   1.00 51.68 ? 160 ARG B NH2  4  
ATOM   5874  H H    . ARG B 2 21  ? 10.943  -5.928  3.877   1.00 0.00  ? 160 ARG B H    4  
ATOM   5875  H HA   . ARG B 2 21  ? 13.770  -5.200  3.731   1.00 0.00  ? 160 ARG B HA   4  
ATOM   5876  H HB2  . ARG B 2 21  ? 12.365  -7.585  3.985   1.00 0.00  ? 160 ARG B HB2  4  
ATOM   5877  H HB3  . ARG B 2 21  ? 12.996  -7.652  2.340   1.00 0.00  ? 160 ARG B HB3  4  
ATOM   5878  H HG2  . ARG B 2 21  ? 15.139  -6.664  3.806   1.00 0.00  ? 160 ARG B HG2  4  
ATOM   5879  H HG3  . ARG B 2 21  ? 14.425  -7.867  4.883   1.00 0.00  ? 160 ARG B HG3  4  
ATOM   5880  H HD2  . ARG B 2 21  ? 16.119  -8.878  3.379   1.00 0.00  ? 160 ARG B HD2  4  
ATOM   5881  H HD3  . ARG B 2 21  ? 14.512  -9.548  3.095   1.00 0.00  ? 160 ARG B HD3  4  
ATOM   5882  H HE   . ARG B 2 21  ? 14.546  -7.588  1.242   1.00 0.00  ? 160 ARG B HE   4  
ATOM   5883  H HH11 . ARG B 2 21  ? 15.053  -10.317 0.273   1.00 0.00  ? 160 ARG B HH11 4  
ATOM   5884  H HH12 . ARG B 2 21  ? 16.631  -10.198 -0.433  1.00 0.00  ? 160 ARG B HH12 4  
ATOM   5885  H HH21 . ARG B 2 21  ? 17.411  -7.221  1.168   1.00 0.00  ? 160 ARG B HH21 4  
ATOM   5886  H HH22 . ARG B 2 21  ? 17.967  -8.445  0.075   1.00 0.00  ? 160 ARG B HH22 4  
ATOM   5887  N N    . LEU B 2 22  ? 11.940  -5.388  1.020   1.00 16.19 ? 161 LEU B N    4  
ATOM   5888  C CA   . LEU B 2 22  ? 11.937  -5.027  -0.425  1.00 12.63 ? 161 LEU B CA   4  
ATOM   5889  C C    . LEU B 2 22  ? 11.993  -3.506  -0.578  1.00 13.41 ? 161 LEU B C    4  
ATOM   5890  O O    . LEU B 2 22  ? 12.775  -2.977  -1.344  1.00 14.12 ? 161 LEU B O    4  
ATOM   5891  C CB   . LEU B 2 22  ? 10.656  -5.553  -1.076  1.00 10.23 ? 161 LEU B CB   4  
ATOM   5892  C CG   . LEU B 2 22  ? 10.892  -6.970  -1.604  1.00 11.74 ? 161 LEU B CG   4  
ATOM   5893  C CD1  . LEU B 2 22  ? 9.641   -7.457  -2.337  1.00 10.85 ? 161 LEU B CD1  4  
ATOM   5894  C CD2  . LEU B 2 22  ? 12.077  -6.967  -2.572  1.00 15.84 ? 161 LEU B CD2  4  
ATOM   5895  H H    . LEU B 2 22  ? 11.116  -5.703  1.446   1.00 0.00  ? 161 LEU B H    4  
ATOM   5896  H HA   . LEU B 2 22  ? 12.796  -5.467  -0.907  1.00 0.00  ? 161 LEU B HA   4  
ATOM   5897  H HB2  . LEU B 2 22  ? 9.863   -5.571  -0.342  1.00 0.00  ? 161 LEU B HB2  4  
ATOM   5898  H HB3  . LEU B 2 22  ? 10.375  -4.907  -1.893  1.00 0.00  ? 161 LEU B HB3  4  
ATOM   5899  H HG   . LEU B 2 22  ? 11.103  -7.632  -0.776  1.00 0.00  ? 161 LEU B HG   4  
ATOM   5900  H HD11 . LEU B 2 22  ? 8.822   -6.779  -2.142  1.00 0.00  ? 161 LEU B HD11 4  
ATOM   5901  H HD12 . LEU B 2 22  ? 9.836   -7.489  -3.399  1.00 0.00  ? 161 LEU B HD12 4  
ATOM   5902  H HD13 . LEU B 2 22  ? 9.381   -8.445  -1.988  1.00 0.00  ? 161 LEU B HD13 4  
ATOM   5903  H HD21 . LEU B 2 22  ? 12.096  -6.033  -3.114  1.00 0.00  ? 161 LEU B HD21 4  
ATOM   5904  H HD22 . LEU B 2 22  ? 12.996  -7.077  -2.015  1.00 0.00  ? 161 LEU B HD22 4  
ATOM   5905  H HD23 . LEU B 2 22  ? 11.976  -7.785  -3.268  1.00 0.00  ? 161 LEU B HD23 4  
ATOM   5906  N N    . LEU B 2 23  ? 11.162  -2.800  0.135   1.00 12.10 ? 162 LEU B N    4  
ATOM   5907  C CA   . LEU B 2 23  ? 11.158  -1.315  0.025   1.00 13.70 ? 162 LEU B CA   4  
ATOM   5908  C C    . LEU B 2 23  ? 12.461  -0.744  0.586   1.00 15.43 ? 162 LEU B C    4  
ATOM   5909  O O    . LEU B 2 23  ? 13.031  0.179   0.037   1.00 15.50 ? 162 LEU B O    4  
ATOM   5910  C CB   . LEU B 2 23  ? 9.972   -0.757  0.810   1.00 13.91 ? 162 LEU B CB   4  
ATOM   5911  C CG   . LEU B 2 23  ? 8.685   -1.423  0.319   1.00 12.97 ? 162 LEU B CG   4  
ATOM   5912  C CD1  . LEU B 2 23  ? 7.676   -1.494  1.467   1.00 9.03  ? 162 LEU B CD1  4  
ATOM   5913  C CD2  . LEU B 2 23  ? 8.095   -0.602  -0.828  1.00 11.59 ? 162 LEU B CD2  4  
ATOM   5914  H H    . LEU B 2 23  ? 10.535  -3.247  0.741   1.00 0.00  ? 162 LEU B H    4  
ATOM   5915  H HA   . LEU B 2 23  ? 11.062  -1.035  -1.014  1.00 0.00  ? 162 LEU B HA   4  
ATOM   5916  H HB2  . LEU B 2 23  ? 10.108  -0.962  1.863   1.00 0.00  ? 162 LEU B HB2  4  
ATOM   5917  H HB3  . LEU B 2 23  ? 9.905   0.309   0.654   1.00 0.00  ? 162 LEU B HB3  4  
ATOM   5918  H HG   . LEU B 2 23  ? 8.908   -2.424  -0.027  1.00 0.00  ? 162 LEU B HG   4  
ATOM   5919  H HD11 . LEU B 2 23  ? 8.204   -1.607  2.404   1.00 0.00  ? 162 LEU B HD11 4  
ATOM   5920  H HD12 . LEU B 2 23  ? 7.093   -0.586  1.490   1.00 0.00  ? 162 LEU B HD12 4  
ATOM   5921  H HD13 . LEU B 2 23  ? 7.022   -2.340  1.319   1.00 0.00  ? 162 LEU B HD13 4  
ATOM   5922  H HD21 . LEU B 2 23  ? 8.830   0.106   -1.180  1.00 0.00  ? 162 LEU B HD21 4  
ATOM   5923  H HD22 . LEU B 2 23  ? 7.816   -1.262  -1.637  1.00 0.00  ? 162 LEU B HD22 4  
ATOM   5924  H HD23 . LEU B 2 23  ? 7.222   -0.071  -0.480  1.00 0.00  ? 162 LEU B HD23 4  
ATOM   5925  N N    . LEU B 2 24  ? 12.939  -1.277  1.677   1.00 17.97 ? 163 LEU B N    4  
ATOM   5926  C CA   . LEU B 2 24  ? 14.200  -0.755  2.267   1.00 23.68 ? 163 LEU B CA   4  
ATOM   5927  C C    . LEU B 2 24  ? 15.390  -1.561  1.739   1.00 29.76 ? 163 LEU B C    4  
ATOM   5928  O O    . LEU B 2 24  ? 16.023  -2.297  2.469   1.00 34.43 ? 163 LEU B O    4  
ATOM   5929  C CB   . LEU B 2 24  ? 14.134  -0.883  3.789   1.00 20.30 ? 163 LEU B CB   4  
ATOM   5930  C CG   . LEU B 2 24  ? 12.930  -0.102  4.315   1.00 19.42 ? 163 LEU B CG   4  
ATOM   5931  C CD1  . LEU B 2 24  ? 12.941  -0.116  5.845   1.00 19.86 ? 163 LEU B CD1  4  
ATOM   5932  C CD2  . LEU B 2 24  ? 13.005  1.344   3.819   1.00 19.28 ? 163 LEU B CD2  4  
ATOM   5933  H H    . LEU B 2 24  ? 12.467  -2.017  2.110   1.00 0.00  ? 163 LEU B H    4  
ATOM   5934  H HA   . LEU B 2 24  ? 14.321  0.284   1.999   1.00 0.00  ? 163 LEU B HA   4  
ATOM   5935  H HB2  . LEU B 2 24  ? 14.036  -1.924  4.058   1.00 0.00  ? 163 LEU B HB2  4  
ATOM   5936  H HB3  . LEU B 2 24  ? 15.037  -0.484  4.221   1.00 0.00  ? 163 LEU B HB3  4  
ATOM   5937  H HG   . LEU B 2 24  ? 12.020  -0.561  3.959   1.00 0.00  ? 163 LEU B HG   4  
ATOM   5938  H HD11 . LEU B 2 24  ? 13.647  -0.856  6.193   1.00 0.00  ? 163 LEU B HD11 4  
ATOM   5939  H HD12 . LEU B 2 24  ? 13.230  0.858   6.212   1.00 0.00  ? 163 LEU B HD12 4  
ATOM   5940  H HD13 . LEU B 2 24  ? 11.955  -0.361  6.210   1.00 0.00  ? 163 LEU B HD13 4  
ATOM   5941  H HD21 . LEU B 2 24  ? 14.031  1.598   3.602   1.00 0.00  ? 163 LEU B HD21 4  
ATOM   5942  H HD22 . LEU B 2 24  ? 12.410  1.449   2.924   1.00 0.00  ? 163 LEU B HD22 4  
ATOM   5943  H HD23 . LEU B 2 24  ? 12.624  2.006   4.584   1.00 0.00  ? 163 LEU B HD23 4  
ATOM   5944  N N    . ASN B 2 25  ? 15.704  -1.424  0.479   1.00 33.44 ? 164 ASN B N    4  
ATOM   5945  C CA   . ASN B 2 25  ? 16.858  -2.182  -0.081  1.00 37.75 ? 164 ASN B CA   4  
ATOM   5946  C C    . ASN B 2 25  ? 17.634  -1.290  -1.047  1.00 40.49 ? 164 ASN B C    4  
ATOM   5947  O O    . ASN B 2 25  ? 18.128  -1.738  -2.063  1.00 41.14 ? 164 ASN B O    4  
ATOM   5948  C CB   . ASN B 2 25  ? 16.353  -3.425  -0.818  1.00 39.08 ? 164 ASN B CB   4  
ATOM   5949  C CG   . ASN B 2 25  ? 17.324  -4.584  -0.588  1.00 42.87 ? 164 ASN B CG   4  
ATOM   5950  O OD1  . ASN B 2 25  ? 17.697  -5.274  -1.516  1.00 47.61 ? 164 ASN B OD1  4  
ATOM   5951  N ND2  . ASN B 2 25  ? 17.751  -4.831  0.621   1.00 46.52 ? 164 ASN B ND2  4  
ATOM   5952  H H    . ASN B 2 25  ? 15.184  -0.823  -0.095  1.00 0.00  ? 164 ASN B H    4  
ATOM   5953  H HA   . ASN B 2 25  ? 17.510  -2.478  0.723   1.00 0.00  ? 164 ASN B HA   4  
ATOM   5954  H HB2  . ASN B 2 25  ? 15.375  -3.692  -0.443  1.00 0.00  ? 164 ASN B HB2  4  
ATOM   5955  H HB3  . ASN B 2 25  ? 16.288  -3.217  -1.875  1.00 0.00  ? 164 ASN B HB3  4  
ATOM   5956  H HD21 . ASN B 2 25  ? 17.448  -4.273  1.372   1.00 0.00  ? 164 ASN B HD21 4  
ATOM   5957  H HD22 . ASN B 2 25  ? 18.375  -5.576  0.778   1.00 0.00  ? 164 ASN B HD22 4  
ATOM   5958  N N    . ALA B 2 26  ? 17.751  -0.034  -0.716  1.00 41.13 ? 165 ALA B N    4  
ATOM   5959  C CA   . ALA B 2 26  ? 18.499  0.929   -1.582  1.00 40.91 ? 165 ALA B CA   4  
ATOM   5960  C C    . ALA B 2 26  ? 18.265  0.615   -3.063  1.00 39.78 ? 165 ALA B C    4  
ATOM   5961  O O    . ALA B 2 26  ? 19.121  0.838   -3.895  1.00 42.37 ? 165 ALA B O    4  
ATOM   5962  C CB   . ALA B 2 26  ? 19.994  0.826   -1.275  1.00 43.50 ? 165 ALA B CB   4  
ATOM   5963  H H    . ALA B 2 26  ? 17.346  0.277   0.120   1.00 0.00  ? 165 ALA B H    4  
ATOM   5964  H HA   . ALA B 2 26  ? 18.162  1.933   -1.373  1.00 0.00  ? 165 ALA B HA   4  
ATOM   5965  H HB1  . ALA B 2 26  ? 20.134  0.353   -0.315  1.00 0.00  ? 165 ALA B HB1  4  
ATOM   5966  H HB2  . ALA B 2 26  ? 20.479  0.236   -2.040  1.00 0.00  ? 165 ALA B HB2  4  
ATOM   5967  H HB3  . ALA B 2 26  ? 20.427  1.816   -1.256  1.00 0.00  ? 165 ALA B HB3  4  
ATOM   5968  N N    . GLU B 2 27  ? 17.116  0.096   -3.401  1.00 36.31 ? 166 GLU B N    4  
ATOM   5969  C CA   . GLU B 2 27  ? 16.845  -0.231  -4.828  1.00 32.86 ? 166 GLU B CA   4  
ATOM   5970  C C    . GLU B 2 27  ? 15.589  0.505   -5.298  1.00 28.56 ? 166 GLU B C    4  
ATOM   5971  O O    . GLU B 2 27  ? 15.501  0.940   -6.429  1.00 27.16 ? 166 GLU B O    4  
ATOM   5972  C CB   . GLU B 2 27  ? 16.636  -1.739  -4.973  1.00 35.96 ? 166 GLU B CB   4  
ATOM   5973  C CG   . GLU B 2 27  ? 17.979  -2.418  -5.251  1.00 44.79 ? 166 GLU B CG   4  
ATOM   5974  C CD   . GLU B 2 27  ? 18.142  -2.632  -6.758  1.00 50.54 ? 166 GLU B CD   4  
ATOM   5975  O OE1  . GLU B 2 27  ? 17.599  -1.841  -7.511  1.00 52.17 ? 166 GLU B OE1  4  
ATOM   5976  O OE2  . GLU B 2 27  ? 18.809  -3.583  -7.132  1.00 54.06 ? 166 GLU B OE2  4  
ATOM   5977  H H    . GLU B 2 27  ? 16.436  -0.082  -2.719  1.00 0.00  ? 166 GLU B H    4  
ATOM   5978  H HA   . GLU B 2 27  ? 17.687  0.074   -5.433  1.00 0.00  ? 166 GLU B HA   4  
ATOM   5979  H HB2  . GLU B 2 27  ? 16.214  -2.133  -4.060  1.00 0.00  ? 166 GLU B HB2  4  
ATOM   5980  H HB3  . GLU B 2 27  ? 15.962  -1.931  -5.794  1.00 0.00  ? 166 GLU B HB3  4  
ATOM   5981  H HG2  . GLU B 2 27  ? 18.780  -1.791  -4.887  1.00 0.00  ? 166 GLU B HG2  4  
ATOM   5982  H HG3  . GLU B 2 27  ? 18.012  -3.372  -4.749  1.00 0.00  ? 166 GLU B HG3  4  
ATOM   5983  N N    . ASN B 2 28  ? 14.614  0.646   -4.443  1.00 24.51 ? 167 ASN B N    4  
ATOM   5984  C CA   . ASN B 2 28  ? 13.368  1.351   -4.853  1.00 21.82 ? 167 ASN B CA   4  
ATOM   5985  C C    . ASN B 2 28  ? 13.343  2.756   -4.232  1.00 19.62 ? 167 ASN B C    4  
ATOM   5986  O O    . ASN B 2 28  ? 13.612  2.909   -3.057  1.00 20.78 ? 167 ASN B O    4  
ATOM   5987  C CB   . ASN B 2 28  ? 12.151  0.560   -4.367  1.00 20.91 ? 167 ASN B CB   4  
ATOM   5988  C CG   . ASN B 2 28  ? 12.427  -0.938  -4.502  1.00 21.84 ? 167 ASN B CG   4  
ATOM   5989  O OD1  . ASN B 2 28  ? 12.760  -1.414  -5.569  1.00 20.75 ? 167 ASN B OD1  4  
ATOM   5990  N ND2  . ASN B 2 28  ? 12.304  -1.707  -3.456  1.00 24.01 ? 167 ASN B ND2  4  
ATOM   5991  H H    . ASN B 2 28  ? 14.700  0.287   -3.535  1.00 0.00  ? 167 ASN B H    4  
ATOM   5992  H HA   . ASN B 2 28  ? 13.341  1.423   -5.929  1.00 0.00  ? 167 ASN B HA   4  
ATOM   5993  H HB2  . ASN B 2 28  ? 11.956  0.799   -3.332  1.00 0.00  ? 167 ASN B HB2  4  
ATOM   5994  H HB3  . ASN B 2 28  ? 11.291  0.819   -4.965  1.00 0.00  ? 167 ASN B HB3  4  
ATOM   5995  H HD21 . ASN B 2 28  ? 12.036  -1.320  -2.592  1.00 0.00  ? 167 ASN B HD21 4  
ATOM   5996  H HD22 . ASN B 2 28  ? 12.477  -2.672  -3.531  1.00 0.00  ? 167 ASN B HD22 4  
ATOM   5997  N N    . PRO B 2 29  ? 13.017  3.743   -5.036  1.00 18.42 ? 168 PRO B N    4  
ATOM   5998  C CA   . PRO B 2 29  ? 12.949  5.142   -4.577  1.00 16.88 ? 168 PRO B CA   4  
ATOM   5999  C C    . PRO B 2 29  ? 11.637  5.389   -3.825  1.00 16.36 ? 168 PRO B C    4  
ATOM   6000  O O    . PRO B 2 29  ? 10.838  4.493   -3.640  1.00 15.23 ? 168 PRO B O    4  
ATOM   6001  C CB   . PRO B 2 29  ? 12.992  5.950   -5.876  1.00 18.00 ? 168 PRO B CB   4  
ATOM   6002  C CG   . PRO B 2 29  ? 12.512  4.998   -6.998  1.00 17.15 ? 168 PRO B CG   4  
ATOM   6003  C CD   . PRO B 2 29  ? 12.690  3.564   -6.466  1.00 16.33 ? 168 PRO B CD   4  
ATOM   6004  H HA   . PRO B 2 29  ? 13.798  5.385   -3.959  1.00 0.00  ? 168 PRO B HA   4  
ATOM   6005  H HB2  . PRO B 2 29  ? 12.333  6.805   -5.803  1.00 0.00  ? 168 PRO B HB2  4  
ATOM   6006  H HB3  . PRO B 2 29  ? 14.001  6.272   -6.081  1.00 0.00  ? 168 PRO B HB3  4  
ATOM   6007  H HG2  . PRO B 2 29  ? 11.471  5.187   -7.223  1.00 0.00  ? 168 PRO B HG2  4  
ATOM   6008  H HG3  . PRO B 2 29  ? 13.114  5.135   -7.884  1.00 0.00  ? 168 PRO B HG3  4  
ATOM   6009  H HD2  . PRO B 2 29  ? 11.771  3.004   -6.580  1.00 0.00  ? 168 PRO B HD2  4  
ATOM   6010  H HD3  . PRO B 2 29  ? 13.503  3.070   -6.975  1.00 0.00  ? 168 PRO B HD3  4  
ATOM   6011  N N    . ARG B 2 30  ? 11.407  6.599   -3.394  1.00 16.48 ? 169 ARG B N    4  
ATOM   6012  C CA   . ARG B 2 30  ? 10.147  6.900   -2.658  1.00 15.86 ? 169 ARG B CA   4  
ATOM   6013  C C    . ARG B 2 30  ? 8.965   6.830   -3.627  1.00 13.88 ? 169 ARG B C    4  
ATOM   6014  O O    . ARG B 2 30  ? 8.938   7.502   -4.639  1.00 15.48 ? 169 ARG B O    4  
ATOM   6015  C CB   . ARG B 2 30  ? 10.227  8.304   -2.057  1.00 15.75 ? 169 ARG B CB   4  
ATOM   6016  C CG   . ARG B 2 30  ? 10.454  9.324   -3.169  1.00 19.73 ? 169 ARG B CG   4  
ATOM   6017  C CD   . ARG B 2 30  ? 10.718  10.701  -2.558  1.00 22.87 ? 169 ARG B CD   4  
ATOM   6018  N NE   . ARG B 2 30  ? 11.719  11.427  -3.388  1.00 21.47 ? 169 ARG B NE   4  
ATOM   6019  C CZ   . ARG B 2 30  ? 11.547  11.528  -4.678  1.00 20.61 ? 169 ARG B CZ   4  
ATOM   6020  N NH1  . ARG B 2 30  ? 10.851  12.518  -5.167  1.00 23.69 ? 169 ARG B NH1  4  
ATOM   6021  N NH2  . ARG B 2 30  ? 12.072  10.641  -5.478  1.00 22.31 ? 169 ARG B NH2  4  
ATOM   6022  H H    . ARG B 2 30  ? 12.064  7.309   -3.554  1.00 0.00  ? 169 ARG B H    4  
ATOM   6023  H HA   . ARG B 2 30  ? 10.008  6.176   -1.869  1.00 0.00  ? 169 ARG B HA   4  
ATOM   6024  H HB2  . ARG B 2 30  ? 9.302   8.531   -1.547  1.00 0.00  ? 169 ARG B HB2  4  
ATOM   6025  H HB3  . ARG B 2 30  ? 11.047  8.351   -1.356  1.00 0.00  ? 169 ARG B HB3  4  
ATOM   6026  H HG2  . ARG B 2 30  ? 11.302  9.024   -3.763  1.00 0.00  ? 169 ARG B HG2  4  
ATOM   6027  H HG3  . ARG B 2 30  ? 9.575   9.373   -3.794  1.00 0.00  ? 169 ARG B HG3  4  
ATOM   6028  H HD2  . ARG B 2 30  ? 9.798   11.265  -2.528  1.00 0.00  ? 169 ARG B HD2  4  
ATOM   6029  H HD3  . ARG B 2 30  ? 11.100  10.582  -1.555  1.00 0.00  ? 169 ARG B HD3  4  
ATOM   6030  H HE   . ARG B 2 30  ? 12.508  11.828  -2.966  1.00 0.00  ? 169 ARG B HE   4  
ATOM   6031  H HH11 . ARG B 2 30  ? 10.449  13.197  -4.554  1.00 0.00  ? 169 ARG B HH11 4  
ATOM   6032  H HH12 . ARG B 2 30  ? 10.719  12.595  -6.155  1.00 0.00  ? 169 ARG B HH12 4  
ATOM   6033  H HH21 . ARG B 2 30  ? 12.606  9.883   -5.102  1.00 0.00  ? 169 ARG B HH21 4  
ATOM   6034  H HH22 . ARG B 2 30  ? 11.939  10.718  -6.466  1.00 0.00  ? 169 ARG B HH22 4  
ATOM   6035  N N    . GLY B 2 31  ? 7.986   6.021   -3.327  1.00 11.61 ? 170 GLY B N    4  
ATOM   6036  C CA   . GLY B 2 31  ? 6.808   5.909   -4.231  1.00 10.78 ? 170 GLY B CA   4  
ATOM   6037  C C    . GLY B 2 31  ? 6.517   4.434   -4.513  1.00 11.90 ? 170 GLY B C    4  
ATOM   6038  O O    . GLY B 2 31  ? 5.449   4.079   -4.973  1.00 11.93 ? 170 GLY B O    4  
ATOM   6039  H H    . GLY B 2 31  ? 8.027   5.488   -2.506  1.00 0.00  ? 170 GLY B H    4  
ATOM   6040  H HA2  . GLY B 2 31  ? 5.947   6.364   -3.759  1.00 0.00  ? 170 GLY B HA2  4  
ATOM   6041  H HA3  . GLY B 2 31  ? 7.017   6.416   -5.161  1.00 0.00  ? 170 GLY B HA3  4  
ATOM   6042  N N    . THR B 2 32  ? 7.458   3.572   -4.241  1.00 11.18 ? 171 THR B N    4  
ATOM   6043  C CA   . THR B 2 32  ? 7.232   2.120   -4.492  1.00 10.98 ? 171 THR B CA   4  
ATOM   6044  C C    . THR B 2 32  ? 6.220   1.582   -3.478  1.00 10.39 ? 171 THR B C    4  
ATOM   6045  O O    . THR B 2 32  ? 6.317   1.839   -2.296  1.00 11.11 ? 171 THR B O    4  
ATOM   6046  C CB   . THR B 2 32  ? 8.556   1.365   -4.344  1.00 12.81 ? 171 THR B CB   4  
ATOM   6047  O OG1  . THR B 2 32  ? 9.580   2.077   -5.024  1.00 15.73 ? 171 THR B OG1  4  
ATOM   6048  C CG2  . THR B 2 32  ? 8.418   -0.035  -4.945  1.00 10.54 ? 171 THR B CG2  4  
ATOM   6049  H H    . THR B 2 32  ? 8.311   3.877   -3.869  1.00 0.00  ? 171 THR B H    4  
ATOM   6050  H HA   . THR B 2 32  ? 6.849   1.983   -5.493  1.00 0.00  ? 171 THR B HA   4  
ATOM   6051  H HB   . THR B 2 32  ? 8.808   1.281   -3.298  1.00 0.00  ? 171 THR B HB   4  
ATOM   6052  H HG1  . THR B 2 32  ? 9.300   2.202   -5.934  1.00 0.00  ? 171 THR B HG1  4  
ATOM   6053  H HG21 . THR B 2 32  ? 7.696   -0.012  -5.747  1.00 0.00  ? 171 THR B HG21 4  
ATOM   6054  H HG22 . THR B 2 32  ? 9.374   -0.357  -5.329  1.00 0.00  ? 171 THR B HG22 4  
ATOM   6055  H HG23 . THR B 2 32  ? 8.087   -0.723  -4.182  1.00 0.00  ? 171 THR B HG23 4  
ATOM   6056  N N    . PHE B 2 33  ? 5.246   0.840   -3.931  1.00 9.86  ? 172 PHE B N    4  
ATOM   6057  C CA   . PHE B 2 33  ? 4.230   0.293   -2.988  1.00 10.31 ? 172 PHE B CA   4  
ATOM   6058  C C    . PHE B 2 33  ? 3.997   -1.190  -3.281  1.00 9.74  ? 172 PHE B C    4  
ATOM   6059  O O    . PHE B 2 33  ? 4.446   -1.715  -4.280  1.00 10.89 ? 172 PHE B O    4  
ATOM   6060  C CB   . PHE B 2 33  ? 2.915   1.057   -3.152  1.00 8.42  ? 172 PHE B CB   4  
ATOM   6061  C CG   . PHE B 2 33  ? 2.502   1.048   -4.604  1.00 10.33 ? 172 PHE B CG   4  
ATOM   6062  C CD1  . PHE B 2 33  ? 3.224   1.800   -5.545  1.00 9.32  ? 172 PHE B CD1  4  
ATOM   6063  C CD2  . PHE B 2 33  ? 1.392   0.288   -5.014  1.00 10.22 ? 172 PHE B CD2  4  
ATOM   6064  C CE1  . PHE B 2 33  ? 2.838   1.793   -6.896  1.00 10.82 ? 172 PHE B CE1  4  
ATOM   6065  C CE2  . PHE B 2 33  ? 1.007   0.281   -6.365  1.00 9.66  ? 172 PHE B CE2  4  
ATOM   6066  C CZ   . PHE B 2 33  ? 1.730   1.033   -7.306  1.00 11.64 ? 172 PHE B CZ   4  
ATOM   6067  H H    . PHE B 2 33  ? 5.183   0.644   -4.890  1.00 0.00  ? 172 PHE B H    4  
ATOM   6068  H HA   . PHE B 2 33  ? 4.586   0.405   -1.975  1.00 0.00  ? 172 PHE B HA   4  
ATOM   6069  H HB2  . PHE B 2 33  ? 2.148   0.585   -2.556  1.00 0.00  ? 172 PHE B HB2  4  
ATOM   6070  H HB3  . PHE B 2 33  ? 3.048   2.077   -2.825  1.00 0.00  ? 172 PHE B HB3  4  
ATOM   6071  H HD1  . PHE B 2 33  ? 4.075   2.385   -5.229  1.00 0.00  ? 172 PHE B HD1  4  
ATOM   6072  H HD2  . PHE B 2 33  ? 0.837   -0.291  -4.291  1.00 0.00  ? 172 PHE B HD2  4  
ATOM   6073  H HE1  . PHE B 2 33  ? 3.394   2.371   -7.619  1.00 0.00  ? 172 PHE B HE1  4  
ATOM   6074  H HE2  . PHE B 2 33  ? 0.155   -0.303  -6.681  1.00 0.00  ? 172 PHE B HE2  4  
ATOM   6075  H HZ   . PHE B 2 33  ? 1.433   1.028   -8.345  1.00 0.00  ? 172 PHE B HZ   4  
ATOM   6076  N N    . LEU B 2 34  ? 3.297   -1.867  -2.413  1.00 8.06  ? 173 LEU B N    4  
ATOM   6077  C CA   . LEU B 2 34  ? 3.031   -3.316  -2.633  1.00 6.70  ? 173 LEU B CA   4  
ATOM   6078  C C    . LEU B 2 34  ? 1.775   -3.725  -1.860  1.00 8.22  ? 173 LEU B C    4  
ATOM   6079  O O    . LEU B 2 34  ? 1.697   -3.568  -0.658  1.00 8.04  ? 173 LEU B O    4  
ATOM   6080  C CB   . LEU B 2 34  ? 4.225   -4.135  -2.138  1.00 7.47  ? 173 LEU B CB   4  
ATOM   6081  C CG   . LEU B 2 34  ? 4.319   -4.030  -0.615  1.00 8.31  ? 173 LEU B CG   4  
ATOM   6082  C CD1  . LEU B 2 34  ? 3.703   -5.277  0.022   1.00 7.11  ? 173 LEU B CD1  4  
ATOM   6083  C CD2  . LEU B 2 34  ? 5.789   -3.923  -0.203  1.00 7.67  ? 173 LEU B CD2  4  
ATOM   6084  H H    . LEU B 2 34  ? 2.945   -1.422  -1.614  1.00 0.00  ? 173 LEU B H    4  
ATOM   6085  H HA   . LEU B 2 34  ? 2.880   -3.499  -3.688  1.00 0.00  ? 173 LEU B HA   4  
ATOM   6086  H HB2  . LEU B 2 34  ? 4.095   -5.169  -2.422  1.00 0.00  ? 173 LEU B HB2  4  
ATOM   6087  H HB3  . LEU B 2 34  ? 5.132   -3.751  -2.580  1.00 0.00  ? 173 LEU B HB3  4  
ATOM   6088  H HG   . LEU B 2 34  ? 3.784   -3.154  -0.281  1.00 0.00  ? 173 LEU B HG   4  
ATOM   6089  H HD11 . LEU B 2 34  ? 2.716   -5.438  -0.383  1.00 0.00  ? 173 LEU B HD11 4  
ATOM   6090  H HD12 . LEU B 2 34  ? 4.324   -6.135  -0.190  1.00 0.00  ? 173 LEU B HD12 4  
ATOM   6091  H HD13 . LEU B 2 34  ? 3.635   -5.138  1.091   1.00 0.00  ? 173 LEU B HD13 4  
ATOM   6092  H HD21 . LEU B 2 34  ? 6.352   -4.720  -0.665  1.00 0.00  ? 173 LEU B HD21 4  
ATOM   6093  H HD22 . LEU B 2 34  ? 6.184   -2.970  -0.524  1.00 0.00  ? 173 LEU B HD22 4  
ATOM   6094  H HD23 . LEU B 2 34  ? 5.868   -4.001  0.871   1.00 0.00  ? 173 LEU B HD23 4  
ATOM   6095  N N    . VAL B 2 35  ? 0.791   -4.248  -2.538  1.00 9.95  ? 174 VAL B N    4  
ATOM   6096  C CA   . VAL B 2 35  ? -0.457  -4.666  -1.838  1.00 10.61 ? 174 VAL B CA   4  
ATOM   6097  C C    . VAL B 2 35  ? -0.396  -6.164  -1.537  1.00 10.97 ? 174 VAL B C    4  
ATOM   6098  O O    . VAL B 2 35  ? -0.266  -6.982  -2.426  1.00 13.68 ? 174 VAL B O    4  
ATOM   6099  C CB   . VAL B 2 35  ? -1.664  -4.374  -2.732  1.00 8.85  ? 174 VAL B CB   4  
ATOM   6100  C CG1  . VAL B 2 35  ? -2.935  -4.345  -1.881  1.00 7.48  ? 174 VAL B CG1  4  
ATOM   6101  C CG2  . VAL B 2 35  ? -1.476  -3.017  -3.414  1.00 7.46  ? 174 VAL B CG2  4  
ATOM   6102  H H    . VAL B 2 35  ? 0.873   -4.367  -3.508  1.00 0.00  ? 174 VAL B H    4  
ATOM   6103  H HA   . VAL B 2 35  ? -0.553  -4.116  -0.914  1.00 0.00  ? 174 VAL B HA   4  
ATOM   6104  H HB   . VAL B 2 35  ? -1.751  -5.147  -3.481  1.00 0.00  ? 174 VAL B HB   4  
ATOM   6105  H HG11 . VAL B 2 35  ? -2.687  -4.039  -0.876  1.00 0.00  ? 174 VAL B HG11 4  
ATOM   6106  H HG12 . VAL B 2 35  ? -3.637  -3.643  -2.308  1.00 0.00  ? 174 VAL B HG12 4  
ATOM   6107  H HG13 . VAL B 2 35  ? -3.377  -5.329  -1.861  1.00 0.00  ? 174 VAL B HG13 4  
ATOM   6108  H HG21 . VAL B 2 35  ? -0.599  -2.532  -3.012  1.00 0.00  ? 174 VAL B HG21 4  
ATOM   6109  H HG22 . VAL B 2 35  ? -1.353  -3.162  -4.476  1.00 0.00  ? 174 VAL B HG22 4  
ATOM   6110  H HG23 . VAL B 2 35  ? -2.343  -2.400  -3.232  1.00 0.00  ? 174 VAL B HG23 4  
ATOM   6111  N N    . ARG B 2 36  ? -0.490  -6.532  -0.288  1.00 12.04 ? 175 ARG B N    4  
ATOM   6112  C CA   . ARG B 2 36  ? -0.436  -7.978  0.068   1.00 13.07 ? 175 ARG B CA   4  
ATOM   6113  C C    . ARG B 2 36  ? -1.637  -8.333  0.947   1.00 15.49 ? 175 ARG B C    4  
ATOM   6114  O O    . ARG B 2 36  ? -2.486  -7.506  1.219   1.00 11.34 ? 175 ARG B O    4  
ATOM   6115  C CB   . ARG B 2 36  ? 0.856   -8.268  0.833   1.00 10.24 ? 175 ARG B CB   4  
ATOM   6116  C CG   . ARG B 2 36  ? 0.861   -7.480  2.145   1.00 10.97 ? 175 ARG B CG   4  
ATOM   6117  C CD   . ARG B 2 36  ? 1.299   -8.395  3.290   1.00 8.81  ? 175 ARG B CD   4  
ATOM   6118  N NE   . ARG B 2 36  ? 1.906   -7.575  4.377   1.00 7.82  ? 175 ARG B NE   4  
ATOM   6119  C CZ   . ARG B 2 36  ? 1.160   -6.767  5.081   1.00 8.03  ? 175 ARG B CZ   4  
ATOM   6120  N NH1  . ARG B 2 36  ? 0.238   -7.249  5.868   1.00 7.60  ? 175 ARG B NH1  4  
ATOM   6121  N NH2  . ARG B 2 36  ? 1.337   -5.477  4.997   1.00 11.06 ? 175 ARG B NH2  4  
ATOM   6122  H H    . ARG B 2 36  ? -0.595  -5.857  0.415   1.00 0.00  ? 175 ARG B H    4  
ATOM   6123  H HA   . ARG B 2 36  ? -0.463  -8.572  -0.834  1.00 0.00  ? 175 ARG B HA   4  
ATOM   6124  H HB2  . ARG B 2 36  ? 0.918   -9.325  1.047   1.00 0.00  ? 175 ARG B HB2  4  
ATOM   6125  H HB3  . ARG B 2 36  ? 1.704   -7.971  0.234   1.00 0.00  ? 175 ARG B HB3  4  
ATOM   6126  H HG2  . ARG B 2 36  ? 1.547   -6.650  2.062   1.00 0.00  ? 175 ARG B HG2  4  
ATOM   6127  H HG3  . ARG B 2 36  ? -0.133  -7.107  2.344   1.00 0.00  ? 175 ARG B HG3  4  
ATOM   6128  H HD2  . ARG B 2 36  ? 0.442   -8.925  3.675   1.00 0.00  ? 175 ARG B HD2  4  
ATOM   6129  H HD3  . ARG B 2 36  ? 2.027   -9.104  2.925   1.00 0.00  ? 175 ARG B HD3  4  
ATOM   6130  H HE   . ARG B 2 36  ? 2.866   -7.643  4.564   1.00 0.00  ? 175 ARG B HE   4  
ATOM   6131  H HH11 . ARG B 2 36  ? 0.102   -8.238  5.933   1.00 0.00  ? 175 ARG B HH11 4  
ATOM   6132  H HH12 . ARG B 2 36  ? -0.333  -6.630  6.407   1.00 0.00  ? 175 ARG B HH12 4  
ATOM   6133  H HH21 . ARG B 2 36  ? 2.044   -5.108  4.394   1.00 0.00  ? 175 ARG B HH21 4  
ATOM   6134  H HH22 . ARG B 2 36  ? 0.765   -4.858  5.536   1.00 0.00  ? 175 ARG B HH22 4  
ATOM   6135  N N    . GLU B 2 37  ? -1.716  -9.556  1.394   1.00 20.91 ? 176 GLU B N    4  
ATOM   6136  C CA   . GLU B 2 37  ? -2.861  -9.962  2.256   1.00 26.31 ? 176 GLU B CA   4  
ATOM   6137  C C    . GLU B 2 37  ? -2.473  -9.801  3.727   1.00 29.76 ? 176 GLU B C    4  
ATOM   6138  O O    . GLU B 2 37  ? -1.538  -10.414 4.203   1.00 30.61 ? 176 GLU B O    4  
ATOM   6139  C CB   . GLU B 2 37  ? -3.218  -11.425 1.978   1.00 25.39 ? 176 GLU B CB   4  
ATOM   6140  C CG   . GLU B 2 37  ? -4.718  -11.633 2.194   1.00 29.84 ? 176 GLU B CG   4  
ATOM   6141  C CD   . GLU B 2 37  ? -5.146  -12.961 1.567   1.00 32.50 ? 176 GLU B CD   4  
ATOM   6142  O OE1  . GLU B 2 37  ? -5.113  -13.056 0.351   1.00 36.79 ? 176 GLU B OE1  4  
ATOM   6143  O OE2  . GLU B 2 37  ? -5.502  -13.859 2.312   1.00 34.32 ? 176 GLU B OE2  4  
ATOM   6144  H H    . GLU B 2 37  ? -1.020  -10.208 1.163   1.00 0.00  ? 176 GLU B H    4  
ATOM   6145  H HA   . GLU B 2 37  ? -3.714  -9.336  2.038   1.00 0.00  ? 176 GLU B HA   4  
ATOM   6146  H HB2  . GLU B 2 37  ? -2.962  -11.670 0.958   1.00 0.00  ? 176 GLU B HB2  4  
ATOM   6147  H HB3  . GLU B 2 37  ? -2.667  -12.065 2.651   1.00 0.00  ? 176 GLU B HB3  4  
ATOM   6148  H HG2  . GLU B 2 37  ? -4.930  -11.651 3.254   1.00 0.00  ? 176 GLU B HG2  4  
ATOM   6149  H HG3  . GLU B 2 37  ? -5.264  -10.826 1.731   1.00 0.00  ? 176 GLU B HG3  4  
ATOM   6150  N N    . SER B 2 38  ? -3.185  -8.980  4.450   1.00 36.14 ? 177 SER B N    4  
ATOM   6151  C CA   . SER B 2 38  ? -2.855  -8.780  5.890   1.00 41.98 ? 177 SER B CA   4  
ATOM   6152  C C    . SER B 2 38  ? -2.864  -10.131 6.607   1.00 43.00 ? 177 SER B C    4  
ATOM   6153  O O    . SER B 2 38  ? -3.883  -10.785 6.706   1.00 43.66 ? 177 SER B O    4  
ATOM   6154  C CB   . SER B 2 38  ? -3.895  -7.857  6.526   1.00 45.78 ? 177 SER B CB   4  
ATOM   6155  O OG   . SER B 2 38  ? -5.154  -8.061  5.895   1.00 51.84 ? 177 SER B OG   4  
ATOM   6156  H H    . SER B 2 38  ? -3.935  -8.495  4.047   1.00 0.00  ? 177 SER B H    4  
ATOM   6157  H HA   . SER B 2 38  ? -1.876  -8.332  5.976   1.00 0.00  ? 177 SER B HA   4  
ATOM   6158  H HB2  . SER B 2 38  ? -3.985  -8.080  7.576   1.00 0.00  ? 177 SER B HB2  4  
ATOM   6159  H HB3  . SER B 2 38  ? -3.584  -6.827  6.405   1.00 0.00  ? 177 SER B HB3  4  
ATOM   6160  H HG   . SER B 2 38  ? -5.205  -8.982  5.628   1.00 0.00  ? 177 SER B HG   4  
ATOM   6161  N N    . GLU B 2 39  ? -1.737  -10.554 7.109   1.00 23.97 ? 178 GLU B N    4  
ATOM   6162  C CA   . GLU B 2 39  ? -1.683  -11.864 7.820   1.00 25.52 ? 178 GLU B CA   4  
ATOM   6163  C C    . GLU B 2 39  ? -2.447  -11.757 9.142   1.00 30.02 ? 178 GLU B C    4  
ATOM   6164  O O    . GLU B 2 39  ? -3.178  -12.650 9.522   1.00 31.55 ? 178 GLU B O    4  
ATOM   6165  C CB   . GLU B 2 39  ? -0.226  -12.234 8.101   1.00 23.29 ? 178 GLU B CB   4  
ATOM   6166  C CG   . GLU B 2 39  ? 0.622   -11.949 6.860   1.00 29.79 ? 178 GLU B CG   4  
ATOM   6167  C CD   . GLU B 2 39  ? 1.585   -10.797 7.155   1.00 33.17 ? 178 GLU B CD   4  
ATOM   6168  O OE1  . GLU B 2 39  ? 2.112   -10.755 8.254   1.00 21.15 ? 178 GLU B OE1  4  
ATOM   6169  O OE2  . GLU B 2 39  ? 1.778   -9.974  6.274   1.00 39.84 ? 178 GLU B OE2  4  
ATOM   6170  H H    . GLU B 2 39  ? -0.925  -10.012 7.020   1.00 0.00  ? 178 GLU B H    4  
ATOM   6171  H HA   . GLU B 2 39  ? -2.136  -12.626 7.203   1.00 0.00  ? 178 GLU B HA   4  
ATOM   6172  H HB2  . GLU B 2 39  ? 0.140   -11.647 8.932   1.00 0.00  ? 178 GLU B HB2  4  
ATOM   6173  H HB3  . GLU B 2 39  ? -0.161  -13.283 8.345   1.00 0.00  ? 178 GLU B HB3  4  
ATOM   6174  H HG2  . GLU B 2 39  ? 1.186   -12.832 6.599   1.00 0.00  ? 178 GLU B HG2  4  
ATOM   6175  H HG3  . GLU B 2 39  ? -0.022  -11.676 6.039   1.00 0.00  ? 178 GLU B HG3  4  
ATOM   6176  N N    . THR B 2 40  ? -2.284  -10.670 9.845   1.00 26.98 ? 179 THR B N    4  
ATOM   6177  C CA   . THR B 2 40  ? -3.001  -10.506 11.140  1.00 31.67 ? 179 THR B CA   4  
ATOM   6178  C C    . THR B 2 40  ? -4.464  -10.151 10.870  1.00 34.54 ? 179 THR B C    4  
ATOM   6179  O O    . THR B 2 40  ? -5.350  -10.518 11.616  1.00 34.85 ? 179 THR B O    4  
ATOM   6180  C CB   . THR B 2 40  ? -2.342  -9.386  11.947  1.00 26.17 ? 179 THR B CB   4  
ATOM   6181  O OG1  . THR B 2 40  ? -2.816  -8.129  11.484  1.00 28.58 ? 179 THR B OG1  4  
ATOM   6182  C CG2  . THR B 2 40  ? -0.824  -9.457  11.776  1.00 35.55 ? 179 THR B CG2  4  
ATOM   6183  H H    . THR B 2 40  ? -1.691  -9.961  9.521   1.00 0.00  ? 179 THR B H    4  
ATOM   6184  H HA   . THR B 2 40  ? -2.951  -11.430 11.699  1.00 0.00  ? 179 THR B HA   4  
ATOM   6185  H HB   . THR B 2 40  ? -2.588  -9.501  12.990  1.00 0.00  ? 179 THR B HB   4  
ATOM   6186  H HG1  . THR B 2 40  ? -2.786  -8.136  10.524  1.00 0.00  ? 179 THR B HG1  4  
ATOM   6187  H HG21 . THR B 2 40  ? -0.519  -10.489 11.687  1.00 0.00  ? 179 THR B HG21 4  
ATOM   6188  H HG22 . THR B 2 40  ? -0.536  -8.918  10.884  1.00 0.00  ? 179 THR B HG22 4  
ATOM   6189  H HG23 . THR B 2 40  ? -0.343  -9.011  12.635  1.00 0.00  ? 179 THR B HG23 4  
ATOM   6190  N N    . THR B 2 41  ? -4.725  -9.437  9.809   1.00 27.03 ? 180 THR B N    4  
ATOM   6191  C CA   . THR B 2 41  ? -6.132  -9.060  9.493   1.00 25.08 ? 180 THR B CA   4  
ATOM   6192  C C    . THR B 2 41  ? -6.627  -9.886  8.304   1.00 30.09 ? 180 THR B C    4  
ATOM   6193  O O    . THR B 2 41  ? -6.793  -9.381  7.211   1.00 30.04 ? 180 THR B O    4  
ATOM   6194  C CB   . THR B 2 41  ? -6.194  -7.572  9.142   1.00 29.37 ? 180 THR B CB   4  
ATOM   6195  O OG1  . THR B 2 41  ? -5.178  -6.877  9.851   1.00 38.10 ? 180 THR B OG1  4  
ATOM   6196  C CG2  . THR B 2 41  ? -7.563  -7.010  9.528   1.00 40.88 ? 180 THR B CG2  4  
ATOM   6197  H H    . THR B 2 41  ? -3.997  -9.152  9.219   1.00 0.00  ? 180 THR B H    4  
ATOM   6198  H HA   . THR B 2 41  ? -6.758  -9.254  10.351  1.00 0.00  ? 180 THR B HA   4  
ATOM   6199  H HB   . THR B 2 41  ? -6.044  -7.445  8.080   1.00 0.00  ? 180 THR B HB   4  
ATOM   6200  H HG1  . THR B 2 41  ? -5.421  -6.862  10.779  1.00 0.00  ? 180 THR B HG1  4  
ATOM   6201  H HG21 . THR B 2 41  ? -8.321  -7.760  9.354   1.00 0.00  ? 180 THR B HG21 4  
ATOM   6202  H HG22 . THR B 2 41  ? -7.559  -6.739  10.574  1.00 0.00  ? 180 THR B HG22 4  
ATOM   6203  H HG23 . THR B 2 41  ? -7.776  -6.137  8.930   1.00 0.00  ? 180 THR B HG23 4  
ATOM   6204  N N    . LYS B 2 42  ? -6.862  -11.153 8.508   1.00 32.42 ? 181 LYS B N    4  
ATOM   6205  C CA   . LYS B 2 42  ? -7.344  -12.010 7.389   1.00 38.97 ? 181 LYS B CA   4  
ATOM   6206  C C    . LYS B 2 42  ? -8.624  -11.411 6.801   1.00 35.28 ? 181 LYS B C    4  
ATOM   6207  O O    . LYS B 2 42  ? -9.480  -10.928 7.515   1.00 34.92 ? 181 LYS B O    4  
ATOM   6208  C CB   . LYS B 2 42  ? -7.637  -13.418 7.912   1.00 51.02 ? 181 LYS B CB   4  
ATOM   6209  C CG   . LYS B 2 42  ? -8.047  -14.321 6.748   1.00 72.35 ? 181 LYS B CG   4  
ATOM   6210  C CD   . LYS B 2 42  ? -8.814  -15.531 7.283   1.00 84.05 ? 181 LYS B CD   4  
ATOM   6211  C CE   . LYS B 2 42  ? -7.963  -16.253 8.329   1.00 88.20 ? 181 LYS B CE   4  
ATOM   6212  N NZ   . LYS B 2 42  ? -8.487  -17.634 8.528   1.00 87.98 ? 181 LYS B NZ   4  
ATOM   6213  H H    . LYS B 2 42  ? -6.720  -11.541 9.397   1.00 0.00  ? 181 LYS B H    4  
ATOM   6214  H HA   . LYS B 2 42  ? -6.586  -12.063 6.622   1.00 0.00  ? 181 LYS B HA   4  
ATOM   6215  H HB2  . LYS B 2 42  ? -6.751  -13.818 8.384   1.00 0.00  ? 181 LYS B HB2  4  
ATOM   6216  H HB3  . LYS B 2 42  ? -8.441  -13.375 8.632   1.00 0.00  ? 181 LYS B HB3  4  
ATOM   6217  H HG2  . LYS B 2 42  ? -8.679  -13.766 6.068   1.00 0.00  ? 181 LYS B HG2  4  
ATOM   6218  H HG3  . LYS B 2 42  ? -7.165  -14.658 6.225   1.00 0.00  ? 181 LYS B HG3  4  
ATOM   6219  H HD2  . LYS B 2 42  ? -9.738  -15.200 7.735   1.00 0.00  ? 181 LYS B HD2  4  
ATOM   6220  H HD3  . LYS B 2 42  ? -9.033  -16.207 6.471   1.00 0.00  ? 181 LYS B HD3  4  
ATOM   6221  H HE2  . LYS B 2 42  ? -6.939  -16.302 7.988   1.00 0.00  ? 181 LYS B HE2  4  
ATOM   6222  H HE3  . LYS B 2 42  ? -8.006  -15.713 9.264   1.00 0.00  ? 181 LYS B HE3  4  
ATOM   6223  H HZ1  . LYS B 2 42  ? -9.189  -17.848 7.792   1.00 0.00  ? 181 LYS B HZ1  4  
ATOM   6224  H HZ2  . LYS B 2 42  ? -7.704  -18.315 8.464   1.00 0.00  ? 181 LYS B HZ2  4  
ATOM   6225  H HZ3  . LYS B 2 42  ? -8.933  -17.704 9.465   1.00 0.00  ? 181 LYS B HZ3  4  
ATOM   6226  N N    . GLY B 2 43  ? -8.760  -11.438 5.503   1.00 38.03 ? 182 GLY B N    4  
ATOM   6227  C CA   . GLY B 2 43  ? -9.985  -10.872 4.871   1.00 30.70 ? 182 GLY B CA   4  
ATOM   6228  C C    . GLY B 2 43  ? -9.679  -9.480  4.316   1.00 29.58 ? 182 GLY B C    4  
ATOM   6229  O O    . GLY B 2 43  ? -10.391 -8.967  3.476   1.00 31.67 ? 182 GLY B O    4  
ATOM   6230  H H    . GLY B 2 43  ? -8.059  -11.833 4.945   1.00 0.00  ? 182 GLY B H    4  
ATOM   6231  H HA2  . GLY B 2 43  ? -10.307 -11.518 4.068   1.00 0.00  ? 182 GLY B HA2  4  
ATOM   6232  H HA3  . GLY B 2 43  ? -10.770 -10.796 5.609   1.00 0.00  ? 182 GLY B HA3  4  
ATOM   6233  N N    . ALA B 2 44  ? -8.627  -8.864  4.779   1.00 35.86 ? 183 ALA B N    4  
ATOM   6234  C CA   . ALA B 2 44  ? -8.281  -7.504  4.276   1.00 32.70 ? 183 ALA B CA   4  
ATOM   6235  C C    . ALA B 2 44  ? -6.876  -7.526  3.668   1.00 28.65 ? 183 ALA B C    4  
ATOM   6236  O O    . ALA B 2 44  ? -6.182  -8.521  3.720   1.00 29.39 ? 183 ALA B O    4  
ATOM   6237  C CB   . ALA B 2 44  ? -8.319  -6.507  5.436   1.00 31.44 ? 183 ALA B CB   4  
ATOM   6238  H H    . ALA B 2 44  ? -8.065  -9.293  5.457   1.00 0.00  ? 183 ALA B H    4  
ATOM   6239  H HA   . ALA B 2 44  ? -8.994  -7.206  3.523   1.00 0.00  ? 183 ALA B HA   4  
ATOM   6240  H HB1  . ALA B 2 44  ? -8.366  -7.044  6.372   1.00 0.00  ? 183 ALA B HB1  4  
ATOM   6241  H HB2  . ALA B 2 44  ? -7.429  -5.896  5.416   1.00 0.00  ? 183 ALA B HB2  4  
ATOM   6242  H HB3  . ALA B 2 44  ? -9.191  -5.876  5.340   1.00 0.00  ? 183 ALA B HB3  4  
ATOM   6243  N N    . TYR B 2 45  ? -6.453  -6.433  3.092   1.00 24.43 ? 184 TYR B N    4  
ATOM   6244  C CA   . TYR B 2 45  ? -5.096  -6.389  2.481   1.00 19.69 ? 184 TYR B CA   4  
ATOM   6245  C C    . TYR B 2 45  ? -4.281  -5.271  3.132   1.00 15.67 ? 184 TYR B C    4  
ATOM   6246  O O    . TYR B 2 45  ? -4.695  -4.675  4.107   1.00 11.54 ? 184 TYR B O    4  
ATOM   6247  C CB   . TYR B 2 45  ? -5.219  -6.122  0.980   1.00 20.89 ? 184 TYR B CB   4  
ATOM   6248  C CG   . TYR B 2 45  ? -6.161  -7.130  0.366   1.00 21.46 ? 184 TYR B CG   4  
ATOM   6249  C CD1  . TYR B 2 45  ? -7.548  -6.990  0.536   1.00 23.38 ? 184 TYR B CD1  4  
ATOM   6250  C CD2  . TYR B 2 45  ? -5.650  -8.207  -0.376  1.00 21.81 ? 184 TYR B CD2  4  
ATOM   6251  C CE1  . TYR B 2 45  ? -8.425  -7.928  -0.035  1.00 24.77 ? 184 TYR B CE1  4  
ATOM   6252  C CE2  . TYR B 2 45  ? -6.526  -9.145  -0.948  1.00 21.77 ? 184 TYR B CE2  4  
ATOM   6253  C CZ   . TYR B 2 45  ? -7.913  -9.006  -0.777  1.00 25.72 ? 184 TYR B CZ   4  
ATOM   6254  O OH   . TYR B 2 45  ? -8.774  -9.927  -1.338  1.00 27.17 ? 184 TYR B OH   4  
ATOM   6255  H H    . TYR B 2 45  ? -7.030  -5.641  3.061   1.00 0.00  ? 184 TYR B H    4  
ATOM   6256  H HA   . TYR B 2 45  ? -4.598  -7.336  2.639   1.00 0.00  ? 184 TYR B HA   4  
ATOM   6257  H HB2  . TYR B 2 45  ? -5.604  -5.126  0.822   1.00 0.00  ? 184 TYR B HB2  4  
ATOM   6258  H HB3  . TYR B 2 45  ? -4.247  -6.211  0.517   1.00 0.00  ? 184 TYR B HB3  4  
ATOM   6259  H HD1  . TYR B 2 45  ? -7.942  -6.162  1.107   1.00 0.00  ? 184 TYR B HD1  4  
ATOM   6260  H HD2  . TYR B 2 45  ? -4.583  -8.315  -0.508  1.00 0.00  ? 184 TYR B HD2  4  
ATOM   6261  H HE1  . TYR B 2 45  ? -9.491  -7.821  0.097   1.00 0.00  ? 184 TYR B HE1  4  
ATOM   6262  H HE2  . TYR B 2 45  ? -6.133  -9.974  -1.518  1.00 0.00  ? 184 TYR B HE2  4  
ATOM   6263  H HH   . TYR B 2 45  ? -8.422  -10.804 -1.165  1.00 0.00  ? 184 TYR B HH   4  
ATOM   6264  N N    . CYS B 2 46  ? -3.125  -4.980  2.604   1.00 12.49 ? 185 CYS B N    4  
ATOM   6265  C CA   . CYS B 2 46  ? -2.287  -3.900  3.196   1.00 13.07 ? 185 CYS B CA   4  
ATOM   6266  C C    . CYS B 2 46  ? -1.476  -3.219  2.093   1.00 11.90 ? 185 CYS B C    4  
ATOM   6267  O O    . CYS B 2 46  ? -0.609  -3.817  1.488   1.00 11.52 ? 185 CYS B O    4  
ATOM   6268  C CB   . CYS B 2 46  ? -1.336  -4.503  4.231   1.00 13.05 ? 185 CYS B CB   4  
ATOM   6269  S SG   . CYS B 2 46  ? -2.067  -4.352  5.880   1.00 27.90 ? 185 CYS B SG   4  
ATOM   6270  H H    . CYS B 2 46  ? -2.807  -5.472  1.818   1.00 0.00  ? 185 CYS B H    4  
ATOM   6271  H HA   . CYS B 2 46  ? -2.925  -3.172  3.674   1.00 0.00  ? 185 CYS B HA   4  
ATOM   6272  H HB2  . CYS B 2 46  ? -1.171  -5.546  4.003   1.00 0.00  ? 185 CYS B HB2  4  
ATOM   6273  H HB3  . CYS B 2 46  ? -0.394  -3.975  4.204   1.00 0.00  ? 185 CYS B HB3  4  
ATOM   6274  H HG   . CYS B 2 46  ? -2.722  -5.047  5.979   1.00 0.00  ? 185 CYS B HG   4  
ATOM   6275  N N    . LEU B 2 47  ? -1.749  -1.971  1.826   1.00 10.41 ? 186 LEU B N    4  
ATOM   6276  C CA   . LEU B 2 47  ? -0.990  -1.255  0.765   1.00 10.82 ? 186 LEU B CA   4  
ATOM   6277  C C    . LEU B 2 47  ? 0.164   -0.478  1.402   1.00 10.91 ? 186 LEU B C    4  
ATOM   6278  O O    . LEU B 2 47  ? -0.032  0.557   2.006   1.00 11.30 ? 186 LEU B O    4  
ATOM   6279  C CB   . LEU B 2 47  ? -1.920  -0.281  0.037   1.00 8.57  ? 186 LEU B CB   4  
ATOM   6280  C CG   . LEU B 2 47  ? -1.102  0.579   -0.926  1.00 8.23  ? 186 LEU B CG   4  
ATOM   6281  C CD1  . LEU B 2 47  ? -0.559  -0.296  -2.057  1.00 10.17 ? 186 LEU B CD1  4  
ATOM   6282  C CD2  . LEU B 2 47  ? -1.994  1.675   -1.514  1.00 8.76  ? 186 LEU B CD2  4  
ATOM   6283  H H    . LEU B 2 47  ? -2.452  -1.504  2.327   1.00 0.00  ? 186 LEU B H    4  
ATOM   6284  H HA   . LEU B 2 47  ? -0.595  -1.971  0.059   1.00 0.00  ? 186 LEU B HA   4  
ATOM   6285  H HB2  . LEU B 2 47  ? -2.662  -0.838  -0.516  1.00 0.00  ? 186 LEU B HB2  4  
ATOM   6286  H HB3  . LEU B 2 47  ? -2.409  0.356   0.758   1.00 0.00  ? 186 LEU B HB3  4  
ATOM   6287  H HG   . LEU B 2 47  ? -0.277  1.030   -0.394  1.00 0.00  ? 186 LEU B HG   4  
ATOM   6288  H HD11 . LEU B 2 47  ? -0.213  -1.236  -1.650  1.00 0.00  ? 186 LEU B HD11 4  
ATOM   6289  H HD12 . LEU B 2 47  ? -1.342  -0.482  -2.777  1.00 0.00  ? 186 LEU B HD12 4  
ATOM   6290  H HD13 . LEU B 2 47  ? 0.263   0.210   -2.542  1.00 0.00  ? 186 LEU B HD13 4  
ATOM   6291  H HD21 . LEU B 2 47  ? -2.429  2.254   -0.713  1.00 0.00  ? 186 LEU B HD21 4  
ATOM   6292  H HD22 . LEU B 2 47  ? -1.402  2.321   -2.146  1.00 0.00  ? 186 LEU B HD22 4  
ATOM   6293  H HD23 . LEU B 2 47  ? -2.782  1.223   -2.099  1.00 0.00  ? 186 LEU B HD23 4  
ATOM   6294  N N    . SER B 2 48  ? 1.365   -0.969  1.274   1.00 10.50 ? 187 SER B N    4  
ATOM   6295  C CA   . SER B 2 48  ? 2.527   -0.256  1.874   1.00 9.18  ? 187 SER B CA   4  
ATOM   6296  C C    . SER B 2 48  ? 3.211   0.596   0.805   1.00 8.50  ? 187 SER B C    4  
ATOM   6297  O O    . SER B 2 48  ? 2.934   0.475   -0.372  1.00 9.53  ? 187 SER B O    4  
ATOM   6298  C CB   . SER B 2 48  ? 3.523   -1.277  2.424   1.00 7.49  ? 187 SER B CB   4  
ATOM   6299  O OG   . SER B 2 48  ? 2.843   -2.177  3.289   1.00 5.18  ? 187 SER B OG   4  
ATOM   6300  H H    . SER B 2 48  ? 1.504   -1.805  0.782   1.00 0.00  ? 187 SER B H    4  
ATOM   6301  H HA   . SER B 2 48  ? 2.184   0.380   2.676   1.00 0.00  ? 187 SER B HA   4  
ATOM   6302  H HB2  . SER B 2 48  ? 3.961   -1.830  1.612   1.00 0.00  ? 187 SER B HB2  4  
ATOM   6303  H HB3  . SER B 2 48  ? 4.303   -0.760  2.968   1.00 0.00  ? 187 SER B HB3  4  
ATOM   6304  H HG   . SER B 2 48  ? 2.822   -1.786  4.167   1.00 0.00  ? 187 SER B HG   4  
ATOM   6305  N N    . VAL B 2 49  ? 4.105   1.458   1.204   1.00 11.78 ? 188 VAL B N    4  
ATOM   6306  C CA   . VAL B 2 49  ? 4.810   2.318   0.213   1.00 12.79 ? 188 VAL B CA   4  
ATOM   6307  C C    . VAL B 2 49  ? 6.220   2.620   0.720   1.00 14.65 ? 188 VAL B C    4  
ATOM   6308  O O    . VAL B 2 49  ? 6.597   2.225   1.805   1.00 14.43 ? 188 VAL B O    4  
ATOM   6309  C CB   . VAL B 2 49  ? 4.039   3.627   0.030   1.00 12.22 ? 188 VAL B CB   4  
ATOM   6310  C CG1  . VAL B 2 49  ? 4.411   4.255   -1.315  1.00 11.34 ? 188 VAL B CG1  4  
ATOM   6311  C CG2  . VAL B 2 49  ? 2.535   3.341   0.057   1.00 12.23 ? 188 VAL B CG2  4  
ATOM   6312  H H    . VAL B 2 49  ? 4.315   1.539   2.158   1.00 0.00  ? 188 VAL B H    4  
ATOM   6313  H HA   . VAL B 2 49  ? 4.872   1.799   -0.733  1.00 0.00  ? 188 VAL B HA   4  
ATOM   6314  H HB   . VAL B 2 49  ? 4.294   4.309   0.828   1.00 0.00  ? 188 VAL B HB   4  
ATOM   6315  H HG11 . VAL B 2 49  ? 4.866   3.507   -1.949  1.00 0.00  ? 188 VAL B HG11 4  
ATOM   6316  H HG12 . VAL B 2 49  ? 3.522   4.638   -1.792  1.00 0.00  ? 188 VAL B HG12 4  
ATOM   6317  H HG13 . VAL B 2 49  ? 5.110   5.062   -1.153  1.00 0.00  ? 188 VAL B HG13 4  
ATOM   6318  H HG21 . VAL B 2 49  ? 2.307   2.548   -0.640  1.00 0.00  ? 188 VAL B HG21 4  
ATOM   6319  H HG22 . VAL B 2 49  ? 2.246   3.039   1.053   1.00 0.00  ? 188 VAL B HG22 4  
ATOM   6320  H HG23 . VAL B 2 49  ? 1.994   4.232   -0.221  1.00 0.00  ? 188 VAL B HG23 4  
ATOM   6321  N N    . SER B 2 50  ? 7.004   3.317   -0.056  1.00 14.39 ? 189 SER B N    4  
ATOM   6322  C CA   . SER B 2 50  ? 8.389   3.640   0.385   1.00 13.97 ? 189 SER B CA   4  
ATOM   6323  C C    . SER B 2 50  ? 8.618   5.148   0.285   1.00 14.32 ? 189 SER B C    4  
ATOM   6324  O O    . SER B 2 50  ? 7.902   5.851   -0.403  1.00 13.16 ? 189 SER B O    4  
ATOM   6325  C CB   . SER B 2 50  ? 9.392   2.912   -0.511  1.00 12.52 ? 189 SER B CB   4  
ATOM   6326  O OG   . SER B 2 50  ? 9.172   3.288   -1.864  1.00 13.11 ? 189 SER B OG   4  
ATOM   6327  H H    . SER B 2 50  ? 6.682   3.625   -0.928  1.00 0.00  ? 189 SER B H    4  
ATOM   6328  H HA   . SER B 2 50  ? 8.524   3.323   1.408   1.00 0.00  ? 189 SER B HA   4  
ATOM   6329  H HB2  . SER B 2 50  ? 10.395  3.181   -0.226  1.00 0.00  ? 189 SER B HB2  4  
ATOM   6330  H HB3  . SER B 2 50  ? 9.263   1.843   -0.399  1.00 0.00  ? 189 SER B HB3  4  
ATOM   6331  H HG   . SER B 2 50  ? 8.306   2.966   -2.125  1.00 0.00  ? 189 SER B HG   4  
ATOM   6332  N N    . ASP B 2 51  ? 9.611   5.653   0.963   1.00 17.22 ? 190 ASP B N    4  
ATOM   6333  C CA   . ASP B 2 51  ? 9.885   7.116   0.905   1.00 20.71 ? 190 ASP B CA   4  
ATOM   6334  C C    . ASP B 2 51  ? 11.395  7.348   0.843   1.00 19.82 ? 190 ASP B C    4  
ATOM   6335  O O    . ASP B 2 51  ? 12.176  6.417   0.840   1.00 20.14 ? 190 ASP B O    4  
ATOM   6336  C CB   . ASP B 2 51  ? 9.316   7.793   2.154   1.00 25.05 ? 190 ASP B CB   4  
ATOM   6337  C CG   . ASP B 2 51  ? 8.986   9.253   1.836   1.00 26.93 ? 190 ASP B CG   4  
ATOM   6338  O OD1  . ASP B 2 51  ? 8.119   9.477   1.009   1.00 30.74 ? 190 ASP B OD1  4  
ATOM   6339  O OD2  . ASP B 2 51  ? 9.607   10.123  2.427   1.00 31.13 ? 190 ASP B OD2  4  
ATOM   6340  H H    . ASP B 2 51  ? 10.177  5.070   1.512   1.00 0.00  ? 190 ASP B H    4  
ATOM   6341  H HA   . ASP B 2 51  ? 9.422   7.534   0.024   1.00 0.00  ? 190 ASP B HA   4  
ATOM   6342  H HB2  . ASP B 2 51  ? 8.419   7.279   2.465   1.00 0.00  ? 190 ASP B HB2  4  
ATOM   6343  H HB3  . ASP B 2 51  ? 10.047  7.756   2.948   1.00 0.00  ? 190 ASP B HB3  4  
ATOM   6344  N N    . PHE B 2 52  ? 11.814  8.583   0.793   1.00 21.67 ? 191 PHE B N    4  
ATOM   6345  C CA   . PHE B 2 52  ? 13.273  8.876   0.729   1.00 24.27 ? 191 PHE B CA   4  
ATOM   6346  C C    . PHE B 2 52  ? 13.606  10.008  1.710   1.00 28.02 ? 191 PHE B C    4  
ATOM   6347  O O    . PHE B 2 52  ? 12.928  11.016  1.762   1.00 25.66 ? 191 PHE B O    4  
ATOM   6348  C CB   . PHE B 2 52  ? 13.641  9.287   -0.708  1.00 23.13 ? 191 PHE B CB   4  
ATOM   6349  C CG   . PHE B 2 52  ? 14.929  10.085  -0.715  1.00 21.13 ? 191 PHE B CG   4  
ATOM   6350  C CD1  . PHE B 2 52  ? 16.164  9.431   -0.574  1.00 20.50 ? 191 PHE B CD1  4  
ATOM   6351  C CD2  . PHE B 2 52  ? 14.884  11.482  -0.854  1.00 18.20 ? 191 PHE B CD2  4  
ATOM   6352  C CE1  . PHE B 2 52  ? 17.355  10.177  -0.572  1.00 19.46 ? 191 PHE B CE1  4  
ATOM   6353  C CE2  . PHE B 2 52  ? 16.074  12.226  -0.853  1.00 16.51 ? 191 PHE B CE2  4  
ATOM   6354  C CZ   . PHE B 2 52  ? 17.310  11.575  -0.712  1.00 17.79 ? 191 PHE B CZ   4  
ATOM   6355  H H    . PHE B 2 52  ? 11.166  9.318   0.797   1.00 0.00  ? 191 PHE B H    4  
ATOM   6356  H HA   . PHE B 2 52  ? 13.828  7.991   1.000   1.00 0.00  ? 191 PHE B HA   4  
ATOM   6357  H HB2  . PHE B 2 52  ? 13.767  8.401   -1.312  1.00 0.00  ? 191 PHE B HB2  4  
ATOM   6358  H HB3  . PHE B 2 52  ? 12.846  9.890   -1.122  1.00 0.00  ? 191 PHE B HB3  4  
ATOM   6359  H HD1  . PHE B 2 52  ? 16.198  8.357   -0.467  1.00 0.00  ? 191 PHE B HD1  4  
ATOM   6360  H HD2  . PHE B 2 52  ? 13.934  11.983  -0.963  1.00 0.00  ? 191 PHE B HD2  4  
ATOM   6361  H HE1  . PHE B 2 52  ? 18.306  9.675   -0.463  1.00 0.00  ? 191 PHE B HE1  4  
ATOM   6362  H HE2  . PHE B 2 52  ? 16.039  13.300  -0.960  1.00 0.00  ? 191 PHE B HE2  4  
ATOM   6363  H HZ   . PHE B 2 52  ? 18.224  12.149  -0.707  1.00 0.00  ? 191 PHE B HZ   4  
ATOM   6364  N N    . ASP B 2 53  ? 14.651  9.853   2.477   1.00 32.66 ? 192 ASP B N    4  
ATOM   6365  C CA   . ASP B 2 53  ? 15.031  10.922  3.441   1.00 38.82 ? 192 ASP B CA   4  
ATOM   6366  C C    . ASP B 2 53  ? 15.904  11.952  2.724   1.00 41.14 ? 192 ASP B C    4  
ATOM   6367  O O    . ASP B 2 53  ? 16.596  11.638  1.778   1.00 38.49 ? 192 ASP B O    4  
ATOM   6368  C CB   . ASP B 2 53  ? 15.817  10.310  4.602   1.00 42.78 ? 192 ASP B CB   4  
ATOM   6369  C CG   . ASP B 2 53  ? 15.077  10.570  5.916   1.00 45.03 ? 192 ASP B CG   4  
ATOM   6370  O OD1  . ASP B 2 53  ? 14.673  11.702  6.130   1.00 46.40 ? 192 ASP B OD1  4  
ATOM   6371  O OD2  . ASP B 2 53  ? 14.929  9.635   6.684   1.00 49.15 ? 192 ASP B OD2  4  
ATOM   6372  H H    . ASP B 2 53  ? 15.190  9.037   2.415   1.00 0.00  ? 192 ASP B H    4  
ATOM   6373  H HA   . ASP B 2 53  ? 14.141  11.402  3.820   1.00 0.00  ? 192 ASP B HA   4  
ATOM   6374  H HB2  . ASP B 2 53  ? 15.915  9.246   4.447   1.00 0.00  ? 192 ASP B HB2  4  
ATOM   6375  H HB3  . ASP B 2 53  ? 16.796  10.760  4.648   1.00 0.00  ? 192 ASP B HB3  4  
ATOM   6376  N N    . ASN B 2 54  ? 15.876  13.178  3.161   1.00 45.91 ? 193 ASN B N    4  
ATOM   6377  C CA   . ASN B 2 54  ? 16.702  14.226  2.496   1.00 50.53 ? 193 ASN B CA   4  
ATOM   6378  C C    . ASN B 2 54  ? 18.136  13.721  2.322   1.00 51.37 ? 193 ASN B C    4  
ATOM   6379  O O    . ASN B 2 54  ? 18.634  13.612  1.219   1.00 52.38 ? 193 ASN B O    4  
ATOM   6380  C CB   . ASN B 2 54  ? 16.707  15.492  3.354   1.00 54.84 ? 193 ASN B CB   4  
ATOM   6381  C CG   . ASN B 2 54  ? 15.267  15.895  3.679   1.00 60.46 ? 193 ASN B CG   4  
ATOM   6382  O OD1  . ASN B 2 54  ? 14.335  15.205  3.316   1.00 63.78 ? 193 ASN B OD1  4  
ATOM   6383  N ND2  . ASN B 2 54  ? 15.044  16.991  4.354   1.00 62.09 ? 193 ASN B ND2  4  
ATOM   6384  H H    . ASN B 2 54  ? 15.309  13.412  3.926   1.00 0.00  ? 193 ASN B H    4  
ATOM   6385  H HA   . ASN B 2 54  ? 16.284  14.449  1.527   1.00 0.00  ? 193 ASN B HA   4  
ATOM   6386  H HB2  . ASN B 2 54  ? 17.245  15.305  4.272   1.00 0.00  ? 193 ASN B HB2  4  
ATOM   6387  H HB3  . ASN B 2 54  ? 17.188  16.292  2.812   1.00 0.00  ? 193 ASN B HB3  4  
ATOM   6388  H HD21 . ASN B 2 54  ? 15.800  17.547  4.647   1.00 0.00  ? 193 ASN B HD21 4  
ATOM   6389  H HD22 . ASN B 2 54  ? 14.121  17.256  4.566   1.00 0.00  ? 193 ASN B HD22 4  
ATOM   6390  N N    . ALA B 2 55  ? 18.809  13.418  3.399   1.00 51.03 ? 194 ALA B N    4  
ATOM   6391  C CA   . ALA B 2 55  ? 20.211  12.928  3.281   1.00 49.87 ? 194 ALA B CA   4  
ATOM   6392  C C    . ALA B 2 55  ? 20.452  11.799  4.285   1.00 48.78 ? 194 ALA B C    4  
ATOM   6393  O O    . ALA B 2 55  ? 21.403  11.822  5.041   1.00 50.16 ? 194 ALA B O    4  
ATOM   6394  C CB   . ALA B 2 55  ? 21.178  14.079  3.569   1.00 50.70 ? 194 ALA B CB   4  
ATOM   6395  H H    . ALA B 2 55  ? 18.395  13.516  4.281   1.00 0.00  ? 194 ALA B H    4  
ATOM   6396  H HA   . ALA B 2 55  ? 20.380  12.560  2.280   1.00 0.00  ? 194 ALA B HA   4  
ATOM   6397  H HB1  . ALA B 2 55  ? 20.956  14.908  2.913   1.00 0.00  ? 194 ALA B HB1  4  
ATOM   6398  H HB2  . ALA B 2 55  ? 21.068  14.392  4.597   1.00 0.00  ? 194 ALA B HB2  4  
ATOM   6399  H HB3  . ALA B 2 55  ? 22.191  13.747  3.399   1.00 0.00  ? 194 ALA B HB3  4  
ATOM   6400  N N    . LYS B 2 56  ? 19.603  10.809  4.298   1.00 45.35 ? 195 LYS B N    4  
ATOM   6401  C CA   . LYS B 2 56  ? 19.794  9.682   5.253   1.00 41.76 ? 195 LYS B CA   4  
ATOM   6402  C C    . LYS B 2 56  ? 19.533  8.354   4.540   1.00 38.59 ? 195 LYS B C    4  
ATOM   6403  O O    . LYS B 2 56  ? 20.209  7.371   4.776   1.00 39.85 ? 195 LYS B O    4  
ATOM   6404  C CB   . LYS B 2 56  ? 18.824  9.833   6.428   1.00 42.95 ? 195 LYS B CB   4  
ATOM   6405  C CG   . LYS B 2 56  ? 19.494  10.640  7.541   1.00 45.27 ? 195 LYS B CG   4  
ATOM   6406  C CD   . LYS B 2 56  ? 20.751  9.911   8.018   1.00 47.56 ? 195 LYS B CD   4  
ATOM   6407  C CE   . LYS B 2 56  ? 21.995  10.643  7.508   1.00 50.16 ? 195 LYS B CE   4  
ATOM   6408  N NZ   . LYS B 2 56  ? 23.044  10.637  8.567   1.00 50.69 ? 195 LYS B NZ   4  
ATOM   6409  H H    . LYS B 2 56  ? 18.842  10.806  3.679   1.00 0.00  ? 195 LYS B H    4  
ATOM   6410  H HA   . LYS B 2 56  ? 20.809  9.696   5.624   1.00 0.00  ? 195 LYS B HA   4  
ATOM   6411  H HB2  . LYS B 2 56  ? 17.933  10.344  6.096   1.00 0.00  ? 195 LYS B HB2  4  
ATOM   6412  H HB3  . LYS B 2 56  ? 18.560  8.855   6.805   1.00 0.00  ? 195 LYS B HB3  4  
ATOM   6413  H HG2  . LYS B 2 56  ? 19.765  11.617  7.163   1.00 0.00  ? 195 LYS B HG2  4  
ATOM   6414  H HG3  . LYS B 2 56  ? 18.809  10.752  8.368   1.00 0.00  ? 195 LYS B HG3  4  
ATOM   6415  H HD2  . LYS B 2 56  ? 20.765  9.886   9.098   1.00 0.00  ? 195 LYS B HD2  4  
ATOM   6416  H HD3  . LYS B 2 56  ? 20.749  8.901   7.634   1.00 0.00  ? 195 LYS B HD3  4  
ATOM   6417  H HE2  . LYS B 2 56  ? 22.370  10.145  6.626   1.00 0.00  ? 195 LYS B HE2  4  
ATOM   6418  H HE3  . LYS B 2 56  ? 21.737  11.663  7.263   1.00 0.00  ? 195 LYS B HE3  4  
ATOM   6419  H HZ1  . LYS B 2 56  ? 23.253  9.657   8.843   1.00 0.00  ? 195 LYS B HZ1  4  
ATOM   6420  H HZ2  . LYS B 2 56  ? 23.908  11.087  8.200   1.00 0.00  ? 195 LYS B HZ2  4  
ATOM   6421  H HZ3  . LYS B 2 56  ? 22.704  11.164  9.395   1.00 0.00  ? 195 LYS B HZ3  4  
ATOM   6422  N N    . GLY B 2 57  ? 18.561  8.310   3.669   1.00 34.40 ? 196 GLY B N    4  
ATOM   6423  C CA   . GLY B 2 57  ? 18.272  7.037   2.950   1.00 29.38 ? 196 GLY B CA   4  
ATOM   6424  C C    . GLY B 2 57  ? 16.815  7.004   2.506   1.00 25.82 ? 196 GLY B C    4  
ATOM   6425  O O    . GLY B 2 57  ? 16.434  7.616   1.528   1.00 25.14 ? 196 GLY B O    4  
ATOM   6426  H H    . GLY B 2 57  ? 18.024  9.110   3.490   1.00 0.00  ? 196 GLY B H    4  
ATOM   6427  H HA2  . GLY B 2 57  ? 18.902  6.960   2.087   1.00 0.00  ? 196 GLY B HA2  4  
ATOM   6428  H HA3  . GLY B 2 57  ? 18.460  6.202   3.608   1.00 0.00  ? 196 GLY B HA3  4  
ATOM   6429  N N    . LEU B 2 58  ? 16.007  6.279   3.213   1.00 25.09 ? 197 LEU B N    4  
ATOM   6430  C CA   . LEU B 2 58  ? 14.565  6.179   2.849   1.00 24.92 ? 197 LEU B CA   4  
ATOM   6431  C C    . LEU B 2 58  ? 13.785  5.551   4.006   1.00 23.75 ? 197 LEU B C    4  
ATOM   6432  O O    . LEU B 2 58  ? 14.350  5.143   5.001   1.00 23.93 ? 197 LEU B O    4  
ATOM   6433  C CB   . LEU B 2 58  ? 14.406  5.310   1.597   1.00 25.84 ? 197 LEU B CB   4  
ATOM   6434  C CG   . LEU B 2 58  ? 15.465  4.206   1.595   1.00 30.07 ? 197 LEU B CG   4  
ATOM   6435  C CD1  . LEU B 2 58  ? 14.807  2.869   1.251   1.00 29.71 ? 197 LEU B CD1  4  
ATOM   6436  C CD2  . LEU B 2 58  ? 16.533  4.532   0.547   1.00 30.59 ? 197 LEU B CD2  4  
ATOM   6437  H H    . LEU B 2 58  ? 16.354  5.792   3.984   1.00 0.00  ? 197 LEU B H    4  
ATOM   6438  H HA   . LEU B 2 58  ? 14.177  7.167   2.652   1.00 0.00  ? 197 LEU B HA   4  
ATOM   6439  H HB2  . LEU B 2 58  ? 13.422  4.864   1.594   1.00 0.00  ? 197 LEU B HB2  4  
ATOM   6440  H HB3  . LEU B 2 58  ? 14.526  5.922   0.717   1.00 0.00  ? 197 LEU B HB3  4  
ATOM   6441  H HG   . LEU B 2 58  ? 15.922  4.143   2.572   1.00 0.00  ? 197 LEU B HG   4  
ATOM   6442  H HD11 . LEU B 2 58  ? 13.740  3.005   1.157   1.00 0.00  ? 197 LEU B HD11 4  
ATOM   6443  H HD12 . LEU B 2 58  ? 15.207  2.500   0.319   1.00 0.00  ? 197 LEU B HD12 4  
ATOM   6444  H HD13 . LEU B 2 58  ? 15.011  2.155   2.037   1.00 0.00  ? 197 LEU B HD13 4  
ATOM   6445  H HD21 . LEU B 2 58  ? 16.774  5.583   0.595   1.00 0.00  ? 197 LEU B HD21 4  
ATOM   6446  H HD22 . LEU B 2 58  ? 17.419  3.948   0.744   1.00 0.00  ? 197 LEU B HD22 4  
ATOM   6447  H HD23 . LEU B 2 58  ? 16.156  4.294   -0.436  1.00 0.00  ? 197 LEU B HD23 4  
ATOM   6448  N N    . ASN B 2 59  ? 12.488  5.472   3.881   1.00 21.78 ? 198 ASN B N    4  
ATOM   6449  C CA   . ASN B 2 59  ? 11.668  4.871   4.972   1.00 19.17 ? 198 ASN B CA   4  
ATOM   6450  C C    . ASN B 2 59  ? 10.549  4.024   4.359   1.00 16.90 ? 198 ASN B C    4  
ATOM   6451  O O    . ASN B 2 59  ? 10.527  3.777   3.170   1.00 15.60 ? 198 ASN B O    4  
ATOM   6452  C CB   . ASN B 2 59  ? 11.059  5.988   5.823   1.00 18.45 ? 198 ASN B CB   4  
ATOM   6453  C CG   . ASN B 2 59  ? 12.164  6.940   6.284   1.00 20.04 ? 198 ASN B CG   4  
ATOM   6454  O OD1  . ASN B 2 59  ? 12.543  6.936   7.439   1.00 23.65 ? 198 ASN B OD1  4  
ATOM   6455  N ND2  . ASN B 2 59  ? 12.701  7.763   5.425   1.00 21.55 ? 198 ASN B ND2  4  
ATOM   6456  H H    . ASN B 2 59  ? 12.053  5.808   3.069   1.00 0.00  ? 198 ASN B H    4  
ATOM   6457  H HA   . ASN B 2 59  ? 12.294  4.246   5.591   1.00 0.00  ? 198 ASN B HA   4  
ATOM   6458  H HB2  . ASN B 2 59  ? 10.334  6.533   5.235   1.00 0.00  ? 198 ASN B HB2  4  
ATOM   6459  H HB3  . ASN B 2 59  ? 10.574  5.558   6.686   1.00 0.00  ? 198 ASN B HB3  4  
ATOM   6460  H HD21 . ASN B 2 59  ? 12.394  7.765   4.491   1.00 0.00  ? 198 ASN B HD21 4  
ATOM   6461  H HD22 . ASN B 2 59  ? 13.413  8.378   5.714   1.00 0.00  ? 198 ASN B HD22 4  
ATOM   6462  N N    . VAL B 2 60  ? 9.619   3.576   5.160   1.00 14.62 ? 199 VAL B N    4  
ATOM   6463  C CA   . VAL B 2 60  ? 8.507   2.746   4.616   1.00 11.82 ? 199 VAL B CA   4  
ATOM   6464  C C    . VAL B 2 60  ? 7.205   3.080   5.347   1.00 10.68 ? 199 VAL B C    4  
ATOM   6465  O O    . VAL B 2 60  ? 7.124   3.000   6.557   1.00 13.24 ? 199 VAL B O    4  
ATOM   6466  C CB   . VAL B 2 60  ? 8.831   1.264   4.815   1.00 9.61  ? 199 VAL B CB   4  
ATOM   6467  C CG1  . VAL B 2 60  ? 7.769   0.411   4.118   1.00 11.94 ? 199 VAL B CG1  4  
ATOM   6468  C CG2  . VAL B 2 60  ? 10.203  0.957   4.213   1.00 10.00 ? 199 VAL B CG2  4  
ATOM   6469  H H    . VAL B 2 60  ? 9.654   3.784   6.117   1.00 0.00  ? 199 VAL B H    4  
ATOM   6470  H HA   . VAL B 2 60  ? 8.389   2.949   3.562   1.00 0.00  ? 199 VAL B HA   4  
ATOM   6471  H HB   . VAL B 2 60  ? 8.840   1.036   5.870   1.00 0.00  ? 199 VAL B HB   4  
ATOM   6472  H HG11 . VAL B 2 60  ? 6.795   0.847   4.280   1.00 0.00  ? 199 VAL B HG11 4  
ATOM   6473  H HG12 . VAL B 2 60  ? 7.974   0.374   3.059   1.00 0.00  ? 199 VAL B HG12 4  
ATOM   6474  H HG13 . VAL B 2 60  ? 7.788   -0.590  4.524   1.00 0.00  ? 199 VAL B HG13 4  
ATOM   6475  H HG21 . VAL B 2 60  ? 10.414  1.661   3.420   1.00 0.00  ? 199 VAL B HG21 4  
ATOM   6476  H HG22 . VAL B 2 60  ? 10.958  1.040   4.979   1.00 0.00  ? 199 VAL B HG22 4  
ATOM   6477  H HG23 . VAL B 2 60  ? 10.204  -0.045  3.812   1.00 0.00  ? 199 VAL B HG23 4  
ATOM   6478  N N    . LYS B 2 61  ? 6.184   3.449   4.622   1.00 11.30 ? 200 LYS B N    4  
ATOM   6479  C CA   . LYS B 2 61  ? 4.887   3.782   5.274   1.00 11.14 ? 200 LYS B CA   4  
ATOM   6480  C C    . LYS B 2 61  ? 3.880   2.665   4.990   1.00 8.78  ? 200 LYS B C    4  
ATOM   6481  O O    . LYS B 2 61  ? 3.453   2.471   3.870   1.00 9.63  ? 200 LYS B O    4  
ATOM   6482  C CB   . LYS B 2 61  ? 4.361   5.102   4.709   1.00 11.27 ? 200 LYS B CB   4  
ATOM   6483  C CG   . LYS B 2 61  ? 5.112   6.268   5.356   1.00 16.97 ? 200 LYS B CG   4  
ATOM   6484  C CD   . LYS B 2 61  ? 4.112   7.206   6.036   1.00 21.04 ? 200 LYS B CD   4  
ATOM   6485  C CE   . LYS B 2 61  ? 4.538   8.658   5.807   1.00 28.12 ? 200 LYS B CE   4  
ATOM   6486  N NZ   . LYS B 2 61  ? 5.308   9.143   6.986   1.00 32.40 ? 200 LYS B NZ   4  
ATOM   6487  H H    . LYS B 2 61  ? 6.269   3.504   3.649   1.00 0.00  ? 200 LYS B H    4  
ATOM   6488  H HA   . LYS B 2 61  ? 5.032   3.877   6.340   1.00 0.00  ? 200 LYS B HA   4  
ATOM   6489  H HB2  . LYS B 2 61  ? 4.515   5.123   3.639   1.00 0.00  ? 200 LYS B HB2  4  
ATOM   6490  H HB3  . LYS B 2 61  ? 3.309   5.189   4.924   1.00 0.00  ? 200 LYS B HB3  4  
ATOM   6491  H HG2  . LYS B 2 61  ? 5.805   5.886   6.092   1.00 0.00  ? 200 LYS B HG2  4  
ATOM   6492  H HG3  . LYS B 2 61  ? 5.654   6.812   4.599   1.00 0.00  ? 200 LYS B HG3  4  
ATOM   6493  H HD2  . LYS B 2 61  ? 3.129   7.048   5.618   1.00 0.00  ? 200 LYS B HD2  4  
ATOM   6494  H HD3  . LYS B 2 61  ? 4.091   7.003   7.096   1.00 0.00  ? 200 LYS B HD3  4  
ATOM   6495  H HE2  . LYS B 2 61  ? 5.157   8.717   4.924   1.00 0.00  ? 200 LYS B HE2  4  
ATOM   6496  H HE3  . LYS B 2 61  ? 3.661   9.274   5.672   1.00 0.00  ? 200 LYS B HE3  4  
ATOM   6497  H HZ1  . LYS B 2 61  ? 5.003   8.627   7.836   1.00 0.00  ? 200 LYS B HZ1  4  
ATOM   6498  H HZ2  . LYS B 2 61  ? 6.323   8.978   6.831   1.00 0.00  ? 200 LYS B HZ2  4  
ATOM   6499  H HZ3  . LYS B 2 61  ? 5.137   10.161  7.117   1.00 0.00  ? 200 LYS B HZ3  4  
ATOM   6500  N N    . HIS B 2 62  ? 3.503   1.924   5.997   1.00 7.82  ? 201 HIS B N    4  
ATOM   6501  C CA   . HIS B 2 62  ? 2.530   0.816   5.781   1.00 7.41  ? 201 HIS B CA   4  
ATOM   6502  C C    . HIS B 2 62  ? 1.101   1.349   5.895   1.00 9.79  ? 201 HIS B C    4  
ATOM   6503  O O    . HIS B 2 62  ? 0.681   1.814   6.936   1.00 10.36 ? 201 HIS B O    4  
ATOM   6504  C CB   . HIS B 2 62  ? 2.753   -0.269  6.838   1.00 6.15  ? 201 HIS B CB   4  
ATOM   6505  C CG   . HIS B 2 62  ? 3.988   -1.057  6.497   1.00 5.80  ? 201 HIS B CG   4  
ATOM   6506  N ND1  . HIS B 2 62  ? 3.968   -2.436  6.352   1.00 7.97  ? 201 HIS B ND1  4  
ATOM   6507  C CD2  . HIS B 2 62  ? 5.287   -0.675  6.269   1.00 7.69  ? 201 HIS B CD2  4  
ATOM   6508  C CE1  . HIS B 2 62  ? 5.219   -2.830  6.052   1.00 7.75  ? 201 HIS B CE1  4  
ATOM   6509  N NE2  . HIS B 2 62  ? 6.063   -1.796  5.988   1.00 6.51  ? 201 HIS B NE2  4  
ATOM   6510  H H    . HIS B 2 62  ? 3.862   2.095   6.892   1.00 0.00  ? 201 HIS B H    4  
ATOM   6511  H HA   . HIS B 2 62  ? 2.678   0.394   4.799   1.00 0.00  ? 201 HIS B HA   4  
ATOM   6512  H HB2  . HIS B 2 62  ? 2.876   0.193   7.807   1.00 0.00  ? 201 HIS B HB2  4  
ATOM   6513  H HB3  . HIS B 2 62  ? 1.899   -0.930  6.861   1.00 0.00  ? 201 HIS B HB3  4  
ATOM   6514  H HD1  . HIS B 2 62  ? 3.186   -3.017  6.451   1.00 0.00  ? 201 HIS B HD1  4  
ATOM   6515  H HD2  . HIS B 2 62  ? 5.651   0.341   6.303   1.00 0.00  ? 201 HIS B HD2  4  
ATOM   6516  H HE1  . HIS B 2 62  ? 5.506   -3.857  5.881   1.00 0.00  ? 201 HIS B HE1  4  
ATOM   6517  N N    . TYR B 2 63  ? 0.350   1.282   4.831   1.00 10.61 ? 202 TYR B N    4  
ATOM   6518  C CA   . TYR B 2 63  ? -1.052  1.777   4.872   1.00 10.61 ? 202 TYR B CA   4  
ATOM   6519  C C    . TYR B 2 63  ? -2.008  0.591   4.735   1.00 10.67 ? 202 TYR B C    4  
ATOM   6520  O O    . TYR B 2 63  ? -2.436  0.249   3.650   1.00 11.97 ? 202 TYR B O    4  
ATOM   6521  C CB   . TYR B 2 63  ? -1.279  2.749   3.714   1.00 10.02 ? 202 TYR B CB   4  
ATOM   6522  C CG   . TYR B 2 63  ? -0.670  4.090   4.051   1.00 10.20 ? 202 TYR B CG   4  
ATOM   6523  C CD1  . TYR B 2 63  ? -1.388  5.011   4.833   1.00 9.08  ? 202 TYR B CD1  4  
ATOM   6524  C CD2  . TYR B 2 63  ? 0.615   4.415   3.585   1.00 10.92 ? 202 TYR B CD2  4  
ATOM   6525  C CE1  . TYR B 2 63  ? -0.819  6.258   5.148   1.00 11.32 ? 202 TYR B CE1  4  
ATOM   6526  C CE2  . TYR B 2 63  ? 1.183   5.661   3.900   1.00 11.72 ? 202 TYR B CE2  4  
ATOM   6527  C CZ   . TYR B 2 63  ? 0.465   6.583   4.680   1.00 12.88 ? 202 TYR B CZ   4  
ATOM   6528  O OH   . TYR B 2 63  ? 1.023   7.807   4.990   1.00 13.22 ? 202 TYR B OH   4  
ATOM   6529  H H    . TYR B 2 63  ? 0.707   0.902   4.002   1.00 0.00  ? 202 TYR B H    4  
ATOM   6530  H HA   . TYR B 2 63  ? -1.232  2.282   5.809   1.00 0.00  ? 202 TYR B HA   4  
ATOM   6531  H HB2  . TYR B 2 63  ? -0.817  2.358   2.820   1.00 0.00  ? 202 TYR B HB2  4  
ATOM   6532  H HB3  . TYR B 2 63  ? -2.338  2.867   3.549   1.00 0.00  ? 202 TYR B HB3  4  
ATOM   6533  H HD1  . TYR B 2 63  ? -2.375  4.762   5.191   1.00 0.00  ? 202 TYR B HD1  4  
ATOM   6534  H HD2  . TYR B 2 63  ? 1.166   3.707   2.984   1.00 0.00  ? 202 TYR B HD2  4  
ATOM   6535  H HE1  . TYR B 2 63  ? -1.371  6.966   5.748   1.00 0.00  ? 202 TYR B HE1  4  
ATOM   6536  H HE2  . TYR B 2 63  ? 2.170   5.912   3.540   1.00 0.00  ? 202 TYR B HE2  4  
ATOM   6537  H HH   . TYR B 2 63  ? 1.478   8.131   4.210   1.00 0.00  ? 202 TYR B HH   4  
ATOM   6538  N N    . LYS B 2 64  ? -2.341  -0.043  5.824   1.00 11.16 ? 203 LYS B N    4  
ATOM   6539  C CA   . LYS B 2 64  ? -3.263  -1.211  5.754   1.00 13.85 ? 203 LYS B CA   4  
ATOM   6540  C C    . LYS B 2 64  ? -4.588  -0.785  5.116   1.00 13.44 ? 203 LYS B C    4  
ATOM   6541  O O    . LYS B 2 64  ? -5.159  0.230   5.463   1.00 12.80 ? 203 LYS B O    4  
ATOM   6542  C CB   . LYS B 2 64  ? -3.525  -1.740  7.166   1.00 19.04 ? 203 LYS B CB   4  
ATOM   6543  C CG   . LYS B 2 64  ? -4.018  -0.600  8.058   1.00 23.92 ? 203 LYS B CG   4  
ATOM   6544  C CD   . LYS B 2 64  ? -5.186  -1.089  8.917   1.00 29.39 ? 203 LYS B CD   4  
ATOM   6545  C CE   . LYS B 2 64  ? -4.898  -0.787  10.390  1.00 31.37 ? 203 LYS B CE   4  
ATOM   6546  N NZ   . LYS B 2 64  ? -6.135  -1.007  11.191  1.00 36.57 ? 203 LYS B NZ   4  
ATOM   6547  H H    . LYS B 2 64  ? -1.981  0.246   6.689   1.00 0.00  ? 203 LYS B H    4  
ATOM   6548  H HA   . LYS B 2 64  ? -2.811  -1.989  5.156   1.00 0.00  ? 203 LYS B HA   4  
ATOM   6549  H HB2  . LYS B 2 64  ? -4.276  -2.518  7.125   1.00 0.00  ? 203 LYS B HB2  4  
ATOM   6550  H HB3  . LYS B 2 64  ? -2.611  -2.145  7.575   1.00 0.00  ? 203 LYS B HB3  4  
ATOM   6551  H HG2  . LYS B 2 64  ? -3.212  -0.269  8.697   1.00 0.00  ? 203 LYS B HG2  4  
ATOM   6552  H HG3  . LYS B 2 64  ? -4.349  0.223   7.440   1.00 0.00  ? 203 LYS B HG3  4  
ATOM   6553  H HD2  . LYS B 2 64  ? -6.091  -0.583  8.615   1.00 0.00  ? 203 LYS B HD2  4  
ATOM   6554  H HD3  . LYS B 2 64  ? -5.307  -2.154  8.787   1.00 0.00  ? 203 LYS B HD3  4  
ATOM   6555  H HE2  . LYS B 2 64  ? -4.117  -1.443  10.745  1.00 0.00  ? 203 LYS B HE2  4  
ATOM   6556  H HE3  . LYS B 2 64  ? -4.580  0.240   10.491  1.00 0.00  ? 203 LYS B HE3  4  
ATOM   6557  H HZ1  . LYS B 2 64  ? -6.830  -1.527  10.621  1.00 0.00  ? 203 LYS B HZ1  4  
ATOM   6558  H HZ2  . LYS B 2 64  ? -5.904  -1.558  12.041  1.00 0.00  ? 203 LYS B HZ2  4  
ATOM   6559  H HZ3  . LYS B 2 64  ? -6.534  -0.087  11.470  1.00 0.00  ? 203 LYS B HZ3  4  
ATOM   6560  N N    . ILE B 2 65  ? -5.084  -1.560  4.188   1.00 14.05 ? 204 ILE B N    4  
ATOM   6561  C CA   . ILE B 2 65  ? -6.374  -1.210  3.532   1.00 13.51 ? 204 ILE B CA   4  
ATOM   6562  C C    . ILE B 2 65  ? -7.517  -1.838  4.330   1.00 14.04 ? 204 ILE B C    4  
ATOM   6563  O O    . ILE B 2 65  ? -7.533  -3.027  4.577   1.00 15.82 ? 204 ILE B O    4  
ATOM   6564  C CB   . ILE B 2 65  ? -6.377  -1.751  2.098   1.00 12.30 ? 204 ILE B CB   4  
ATOM   6565  C CG1  . ILE B 2 65  ? -5.423  -0.916  1.240   1.00 11.29 ? 204 ILE B CG1  4  
ATOM   6566  C CG2  . ILE B 2 65  ? -7.789  -1.666  1.514   1.00 14.21 ? 204 ILE B CG2  4  
ATOM   6567  C CD1  . ILE B 2 65  ? -4.941  -1.751  0.052   1.00 13.89 ? 204 ILE B CD1  4  
ATOM   6568  H H    . ILE B 2 65  ? -4.609  -2.376  3.929   1.00 0.00  ? 204 ILE B H    4  
ATOM   6569  H HA   . ILE B 2 65  ? -6.493  -0.136  3.515   1.00 0.00  ? 204 ILE B HA   4  
ATOM   6570  H HB   . ILE B 2 65  ? -6.049  -2.781  2.103   1.00 0.00  ? 204 ILE B HB   4  
ATOM   6571  H HG12 . ILE B 2 65  ? -5.939  -0.038  0.880   1.00 0.00  ? 204 ILE B HG12 4  
ATOM   6572  H HG13 . ILE B 2 65  ? -4.573  -0.618  1.835   1.00 0.00  ? 204 ILE B HG13 4  
ATOM   6573  H HG21 . ILE B 2 65  ? -8.248  -0.737  1.815   1.00 0.00  ? 204 ILE B HG21 4  
ATOM   6574  H HG22 . ILE B 2 65  ? -7.735  -1.709  0.436   1.00 0.00  ? 204 ILE B HG22 4  
ATOM   6575  H HG23 . ILE B 2 65  ? -8.379  -2.494  1.879   1.00 0.00  ? 204 ILE B HG23 4  
ATOM   6576  H HD11 . ILE B 2 65  ? -5.606  -2.591  -0.092  1.00 0.00  ? 204 ILE B HD11 4  
ATOM   6577  H HD12 . ILE B 2 65  ? -4.937  -1.140  -0.839  1.00 0.00  ? 204 ILE B HD12 4  
ATOM   6578  H HD13 . ILE B 2 65  ? -3.943  -2.112  0.245   1.00 0.00  ? 204 ILE B HD13 4  
ATOM   6579  N N    . ARG B 2 66  ? -8.466  -1.047  4.749   1.00 15.56 ? 205 ARG B N    4  
ATOM   6580  C CA   . ARG B 2 66  ? -9.594  -1.601  5.547   1.00 13.76 ? 205 ARG B CA   4  
ATOM   6581  C C    . ARG B 2 66  ? -10.668 -2.166  4.622   1.00 13.72 ? 205 ARG B C    4  
ATOM   6582  O O    . ARG B 2 66  ? -10.616 -2.018  3.416   1.00 13.25 ? 205 ARG B O    4  
ATOM   6583  C CB   . ARG B 2 66  ? -10.201 -0.499  6.410   1.00 15.23 ? 205 ARG B CB   4  
ATOM   6584  C CG   . ARG B 2 66  ? -9.094  0.164   7.221   1.00 20.69 ? 205 ARG B CG   4  
ATOM   6585  C CD   . ARG B 2 66  ? -9.241  -0.214  8.697   1.00 28.70 ? 205 ARG B CD   4  
ATOM   6586  N NE   . ARG B 2 66  ? -10.294 0.630   9.326   1.00 38.45 ? 205 ARG B NE   4  
ATOM   6587  C CZ   . ARG B 2 66  ? -11.012 0.154   10.307  1.00 41.91 ? 205 ARG B CZ   4  
ATOM   6588  N NH1  . ARG B 2 66  ? -10.580 0.246   11.536  1.00 41.78 ? 205 ARG B NH1  4  
ATOM   6589  N NH2  . ARG B 2 66  ? -12.162 -0.412  10.063  1.00 44.96 ? 205 ARG B NH2  4  
ATOM   6590  H H    . ARG B 2 66  ? -8.429  -0.089  4.551   1.00 0.00  ? 205 ARG B H    4  
ATOM   6591  H HA   . ARG B 2 66  ? -9.225  -2.390  6.186   1.00 0.00  ? 205 ARG B HA   4  
ATOM   6592  H HB2  . ARG B 2 66  ? -10.676 0.237   5.776   1.00 0.00  ? 205 ARG B HB2  4  
ATOM   6593  H HB3  . ARG B 2 66  ? -10.933 -0.925  7.080   1.00 0.00  ? 205 ARG B HB3  4  
ATOM   6594  H HG2  . ARG B 2 66  ? -8.136  -0.174  6.856   1.00 0.00  ? 205 ARG B HG2  4  
ATOM   6595  H HG3  . ARG B 2 66  ? -9.166  1.233   7.115   1.00 0.00  ? 205 ARG B HG3  4  
ATOM   6596  H HD2  . ARG B 2 66  ? -9.519  -1.255  8.776   1.00 0.00  ? 205 ARG B HD2  4  
ATOM   6597  H HD3  . ARG B 2 66  ? -8.301  -0.054  9.205   1.00 0.00  ? 205 ARG B HD3  4  
ATOM   6598  H HE   . ARG B 2 66  ? -10.447 1.542   9.003   1.00 0.00  ? 205 ARG B HE   4  
ATOM   6599  H HH11 . ARG B 2 66  ? -9.698  0.681   11.724  1.00 0.00  ? 205 ARG B HH11 4  
ATOM   6600  H HH12 . ARG B 2 66  ? -11.128 -0.118  12.288  1.00 0.00  ? 205 ARG B HH12 4  
ATOM   6601  H HH21 . ARG B 2 66  ? -12.495 -0.482  9.122   1.00 0.00  ? 205 ARG B HH21 4  
ATOM   6602  H HH22 . ARG B 2 66  ? -12.711 -0.776  10.816  1.00 0.00  ? 205 ARG B HH22 4  
ATOM   6603  N N    . LYS B 2 67  ? -11.641 -2.816  5.192   1.00 14.89 ? 206 LYS B N    4  
ATOM   6604  C CA   . LYS B 2 67  ? -12.734 -3.411  4.374   1.00 18.13 ? 206 LYS B CA   4  
ATOM   6605  C C    . LYS B 2 67  ? -14.048 -3.363  5.156   1.00 17.74 ? 206 LYS B C    4  
ATOM   6606  O O    . LYS B 2 67  ? -14.167 -3.934  6.222   1.00 18.39 ? 206 LYS B O    4  
ATOM   6607  C CB   . LYS B 2 67  ? -12.385 -4.867  4.059   1.00 21.97 ? 206 LYS B CB   4  
ATOM   6608  C CG   . LYS B 2 67  ? -13.606 -5.580  3.467   1.00 27.97 ? 206 LYS B CG   4  
ATOM   6609  C CD   . LYS B 2 67  ? -13.199 -6.968  2.970   1.00 32.27 ? 206 LYS B CD   4  
ATOM   6610  C CE   . LYS B 2 67  ? -12.964 -6.922  1.460   1.00 33.99 ? 206 LYS B CE   4  
ATOM   6611  N NZ   . LYS B 2 67  ? -13.224 -8.268  0.877   1.00 35.74 ? 206 LYS B NZ   4  
ATOM   6612  H H    . LYS B 2 67  ? -11.648 -2.914  6.166   1.00 0.00  ? 206 LYS B H    4  
ATOM   6613  H HA   . LYS B 2 67  ? -12.839 -2.858  3.453   1.00 0.00  ? 206 LYS B HA   4  
ATOM   6614  H HB2  . LYS B 2 67  ? -11.571 -4.895  3.349   1.00 0.00  ? 206 LYS B HB2  4  
ATOM   6615  H HB3  . LYS B 2 67  ? -12.086 -5.368  4.967   1.00 0.00  ? 206 LYS B HB3  4  
ATOM   6616  H HG2  . LYS B 2 67  ? -14.368 -5.679  4.229   1.00 0.00  ? 206 LYS B HG2  4  
ATOM   6617  H HG3  . LYS B 2 67  ? -13.996 -5.004  2.641   1.00 0.00  ? 206 LYS B HG3  4  
ATOM   6618  H HD2  . LYS B 2 67  ? -12.290 -7.275  3.468   1.00 0.00  ? 206 LYS B HD2  4  
ATOM   6619  H HD3  . LYS B 2 67  ? -13.985 -7.674  3.189   1.00 0.00  ? 206 LYS B HD3  4  
ATOM   6620  H HE2  . LYS B 2 67  ? -13.632 -6.200  1.013   1.00 0.00  ? 206 LYS B HE2  4  
ATOM   6621  H HE3  . LYS B 2 67  ? -11.941 -6.636  1.263   1.00 0.00  ? 206 LYS B HE3  4  
ATOM   6622  H HZ1  . LYS B 2 67  ? -13.393 -8.951  1.643   1.00 0.00  ? 206 LYS B HZ1  4  
ATOM   6623  H HZ2  . LYS B 2 67  ? -14.063 -8.224  0.263   1.00 0.00  ? 206 LYS B HZ2  4  
ATOM   6624  H HZ3  . LYS B 2 67  ? -12.400 -8.570  0.319   1.00 0.00  ? 206 LYS B HZ3  4  
ATOM   6625  N N    . LEU B 2 68  ? -15.042 -2.702  4.630   1.00 17.31 ? 207 LEU B N    4  
ATOM   6626  C CA   . LEU B 2 68  ? -16.346 -2.639  5.341   1.00 19.33 ? 207 LEU B CA   4  
ATOM   6627  C C    . LEU B 2 68  ? -17.073 -3.971  5.156   1.00 21.64 ? 207 LEU B C    4  
ATOM   6628  O O    . LEU B 2 68  ? -17.208 -4.465  4.053   1.00 21.80 ? 207 LEU B O    4  
ATOM   6629  C CB   . LEU B 2 68  ? -17.194 -1.508  4.759   1.00 19.68 ? 207 LEU B CB   4  
ATOM   6630  C CG   . LEU B 2 68  ? -16.483 -0.171  4.975   1.00 19.58 ? 207 LEU B CG   4  
ATOM   6631  C CD1  . LEU B 2 68  ? -17.362 0.967   4.454   1.00 16.81 ? 207 LEU B CD1  4  
ATOM   6632  C CD2  . LEU B 2 68  ? -16.222 0.032   6.469   1.00 16.39 ? 207 LEU B CD2  4  
ATOM   6633  H H    . LEU B 2 68  ? -14.933 -2.256  3.763   1.00 0.00  ? 207 LEU B H    4  
ATOM   6634  H HA   . LEU B 2 68  ? -16.176 -2.462  6.393   1.00 0.00  ? 207 LEU B HA   4  
ATOM   6635  H HB2  . LEU B 2 68  ? -17.340 -1.673  3.702   1.00 0.00  ? 207 LEU B HB2  4  
ATOM   6636  H HB3  . LEU B 2 68  ? -18.151 -1.488  5.257   1.00 0.00  ? 207 LEU B HB3  4  
ATOM   6637  H HG   . LEU B 2 68  ? -15.544 -0.174  4.439   1.00 0.00  ? 207 LEU B HG   4  
ATOM   6638  H HD11 . LEU B 2 68  ? -17.889 0.638   3.570   1.00 0.00  ? 207 LEU B HD11 4  
ATOM   6639  H HD12 . LEU B 2 68  ? -18.075 1.246   5.215   1.00 0.00  ? 207 LEU B HD12 4  
ATOM   6640  H HD13 . LEU B 2 68  ? -16.744 1.817   4.209   1.00 0.00  ? 207 LEU B HD13 4  
ATOM   6641  H HD21 . LEU B 2 68  ? -17.149 -0.070  7.012   1.00 0.00  ? 207 LEU B HD21 4  
ATOM   6642  H HD22 . LEU B 2 68  ? -15.518 -0.710  6.815   1.00 0.00  ? 207 LEU B HD22 4  
ATOM   6643  H HD23 . LEU B 2 68  ? -15.815 1.019   6.632   1.00 0.00  ? 207 LEU B HD23 4  
ATOM   6644  N N    . ASP B 2 69  ? -17.534 -4.561  6.220   1.00 24.31 ? 208 ASP B N    4  
ATOM   6645  C CA   . ASP B 2 69  ? -18.241 -5.866  6.095   1.00 27.33 ? 208 ASP B CA   4  
ATOM   6646  C C    . ASP B 2 69  ? -19.277 -5.780  4.973   1.00 28.23 ? 208 ASP B C    4  
ATOM   6647  O O    . ASP B 2 69  ? -19.538 -6.744  4.282   1.00 28.17 ? 208 ASP B O    4  
ATOM   6648  C CB   . ASP B 2 69  ? -18.942 -6.196  7.415   1.00 32.44 ? 208 ASP B CB   4  
ATOM   6649  C CG   . ASP B 2 69  ? -18.689 -7.663  7.773   1.00 36.84 ? 208 ASP B CG   4  
ATOM   6650  O OD1  . ASP B 2 69  ? -17.601 -7.959  8.239   1.00 40.11 ? 208 ASP B OD1  4  
ATOM   6651  O OD2  . ASP B 2 69  ? -19.588 -8.464  7.574   1.00 41.58 ? 208 ASP B OD2  4  
ATOM   6652  H H    . ASP B 2 69  ? -17.411 -4.150  7.101   1.00 0.00  ? 208 ASP B H    4  
ATOM   6653  H HA   . ASP B 2 69  ? -17.525 -6.639  5.864   1.00 0.00  ? 208 ASP B HA   4  
ATOM   6654  H HB2  . ASP B 2 69  ? -18.554 -5.561  8.198   1.00 0.00  ? 208 ASP B HB2  4  
ATOM   6655  H HB3  . ASP B 2 69  ? -20.004 -6.032  7.311   1.00 0.00  ? 208 ASP B HB3  4  
ATOM   6656  N N    . SER B 2 70  ? -19.866 -4.633  4.785   1.00 30.57 ? 209 SER B N    4  
ATOM   6657  C CA   . SER B 2 70  ? -20.877 -4.478  3.713   1.00 30.81 ? 209 SER B CA   4  
ATOM   6658  C C    . SER B 2 70  ? -20.305 -4.985  2.388   1.00 31.86 ? 209 SER B C    4  
ATOM   6659  O O    . SER B 2 70  ? -20.915 -5.778  1.699   1.00 34.96 ? 209 SER B O    4  
ATOM   6660  C CB   . SER B 2 70  ? -21.231 -3.003  3.590   1.00 29.35 ? 209 SER B CB   4  
ATOM   6661  O OG   . SER B 2 70  ? -20.371 -2.388  2.641   1.00 27.77 ? 209 SER B OG   4  
ATOM   6662  H H    . SER B 2 70  ? -19.642 -3.867  5.350   1.00 0.00  ? 209 SER B H    4  
ATOM   6663  H HA   . SER B 2 70  ? -21.762 -5.040  3.967   1.00 0.00  ? 209 SER B HA   4  
ATOM   6664  H HB2  . SER B 2 70  ? -22.247 -2.904  3.270   1.00 0.00  ? 209 SER B HB2  4  
ATOM   6665  H HB3  . SER B 2 70  ? -21.116 -2.531  4.555   1.00 0.00  ? 209 SER B HB3  4  
ATOM   6666  H HG   . SER B 2 70  ? -19.589 -2.079  3.104   1.00 0.00  ? 209 SER B HG   4  
ATOM   6667  N N    . GLY B 2 71  ? -19.134 -4.534  2.027   1.00 31.91 ? 210 GLY B N    4  
ATOM   6668  C CA   . GLY B 2 71  ? -18.522 -4.990  0.747   1.00 30.37 ? 210 GLY B CA   4  
ATOM   6669  C C    . GLY B 2 71  ? -17.751 -3.834  0.109   1.00 29.39 ? 210 GLY B C    4  
ATOM   6670  O O    . GLY B 2 71  ? -17.938 -3.515  -1.049  1.00 32.51 ? 210 GLY B O    4  
ATOM   6671  H H    . GLY B 2 71  ? -18.659 -3.895  2.598   1.00 0.00  ? 210 GLY B H    4  
ATOM   6672  H HA2  . GLY B 2 71  ? -17.848 -5.810  0.945   1.00 0.00  ? 210 GLY B HA2  4  
ATOM   6673  H HA3  . GLY B 2 71  ? -19.299 -5.316  0.073   1.00 0.00  ? 210 GLY B HA3  4  
ATOM   6674  N N    . GLY B 2 72  ? -16.882 -3.205  0.853   1.00 27.09 ? 211 GLY B N    4  
ATOM   6675  C CA   . GLY B 2 72  ? -16.099 -2.071  0.286   1.00 22.75 ? 211 GLY B CA   4  
ATOM   6676  C C    . GLY B 2 72  ? -14.727 -2.010  0.960   1.00 20.54 ? 211 GLY B C    4  
ATOM   6677  O O    . GLY B 2 72  ? -14.331 -2.917  1.665   1.00 21.66 ? 211 GLY B O    4  
ATOM   6678  H H    . GLY B 2 72  ? -16.746 -3.478  1.784   1.00 0.00  ? 211 GLY B H    4  
ATOM   6679  H HA2  . GLY B 2 72  ? -15.974 -2.217  -0.777  1.00 0.00  ? 211 GLY B HA2  4  
ATOM   6680  H HA3  . GLY B 2 72  ? -16.624 -1.145  0.464   1.00 0.00  ? 211 GLY B HA3  4  
ATOM   6681  N N    . PHE B 2 73  ? -14.000 -0.948  0.751   1.00 18.17 ? 212 PHE B N    4  
ATOM   6682  C CA   . PHE B 2 73  ? -12.653 -0.828  1.381   1.00 17.54 ? 212 PHE B CA   4  
ATOM   6683  C C    . PHE B 2 73  ? -12.351 0.649   1.622   1.00 15.84 ? 212 PHE B C    4  
ATOM   6684  O O    . PHE B 2 73  ? -13.000 1.516   1.075   1.00 18.26 ? 212 PHE B O    4  
ATOM   6685  C CB   . PHE B 2 73  ? -11.586 -1.420  0.451   1.00 16.88 ? 212 PHE B CB   4  
ATOM   6686  C CG   . PHE B 2 73  ? -12.167 -2.573  -0.335  1.00 18.16 ? 212 PHE B CG   4  
ATOM   6687  C CD1  . PHE B 2 73  ? -13.077 -2.326  -1.378  1.00 18.25 ? 212 PHE B CD1  4  
ATOM   6688  C CD2  . PHE B 2 73  ? -11.798 -3.892  -0.023  1.00 18.64 ? 212 PHE B CD2  4  
ATOM   6689  C CE1  . PHE B 2 73  ? -13.616 -3.398  -2.109  1.00 18.17 ? 212 PHE B CE1  4  
ATOM   6690  C CE2  . PHE B 2 73  ? -12.338 -4.964  -0.755  1.00 19.59 ? 212 PHE B CE2  4  
ATOM   6691  C CZ   . PHE B 2 73  ? -13.247 -4.717  -1.796  1.00 18.19 ? 212 PHE B CZ   4  
ATOM   6692  H H    . PHE B 2 73  ? -14.339 -0.227  0.179   1.00 0.00  ? 212 PHE B H    4  
ATOM   6693  H HA   . PHE B 2 73  ? -12.647 -1.357  2.322   1.00 0.00  ? 212 PHE B HA   4  
ATOM   6694  H HB2  . PHE B 2 73  ? -11.243 -0.657  -0.232  1.00 0.00  ? 212 PHE B HB2  4  
ATOM   6695  H HB3  . PHE B 2 73  ? -10.753 -1.773  1.042   1.00 0.00  ? 212 PHE B HB3  4  
ATOM   6696  H HD1  . PHE B 2 73  ? -13.360 -1.311  -1.617  1.00 0.00  ? 212 PHE B HD1  4  
ATOM   6697  H HD2  . PHE B 2 73  ? -11.099 -4.082  0.778   1.00 0.00  ? 212 PHE B HD2  4  
ATOM   6698  H HE1  . PHE B 2 73  ? -14.315 -3.207  -2.910  1.00 0.00  ? 212 PHE B HE1  4  
ATOM   6699  H HE2  . PHE B 2 73  ? -12.054 -5.978  -0.515  1.00 0.00  ? 212 PHE B HE2  4  
ATOM   6700  H HZ   . PHE B 2 73  ? -13.662 -5.541  -2.358  1.00 0.00  ? 212 PHE B HZ   4  
ATOM   6701  N N    . TYR B 2 74  ? -11.371 0.949   2.430   1.00 14.56 ? 213 TYR B N    4  
ATOM   6702  C CA   . TYR B 2 74  ? -11.048 2.383   2.682   1.00 12.35 ? 213 TYR B CA   4  
ATOM   6703  C C    . TYR B 2 74  ? -9.856  2.494   3.637   1.00 12.92 ? 213 TYR B C    4  
ATOM   6704  O O    . TYR B 2 74  ? -9.789  1.821   4.647   1.00 12.14 ? 213 TYR B O    4  
ATOM   6705  C CB   . TYR B 2 74  ? -12.271 3.086   3.292   1.00 12.55 ? 213 TYR B CB   4  
ATOM   6706  C CG   . TYR B 2 74  ? -12.406 2.724   4.755   1.00 14.01 ? 213 TYR B CG   4  
ATOM   6707  C CD1  . TYR B 2 74  ? -13.067 1.543   5.131   1.00 13.18 ? 213 TYR B CD1  4  
ATOM   6708  C CD2  . TYR B 2 74  ? -11.865 3.571   5.736   1.00 13.49 ? 213 TYR B CD2  4  
ATOM   6709  C CE1  . TYR B 2 74  ? -13.189 1.211   6.491   1.00 14.46 ? 213 TYR B CE1  4  
ATOM   6710  C CE2  . TYR B 2 74  ? -11.987 3.239   7.096   1.00 13.06 ? 213 TYR B CE2  4  
ATOM   6711  C CZ   . TYR B 2 74  ? -12.648 2.058   7.474   1.00 15.80 ? 213 TYR B CZ   4  
ATOM   6712  O OH   . TYR B 2 74  ? -12.768 1.730   8.808   1.00 18.90 ? 213 TYR B OH   4  
ATOM   6713  H H    . TYR B 2 74  ? -10.850 0.239   2.864   1.00 0.00  ? 213 TYR B H    4  
ATOM   6714  H HA   . TYR B 2 74  ? -10.796 2.858   1.746   1.00 0.00  ? 213 TYR B HA   4  
ATOM   6715  H HB2  . TYR B 2 74  ? -12.151 4.155   3.198   1.00 0.00  ? 213 TYR B HB2  4  
ATOM   6716  H HB3  . TYR B 2 74  ? -13.161 2.779   2.765   1.00 0.00  ? 213 TYR B HB3  4  
ATOM   6717  H HD1  . TYR B 2 74  ? -13.482 0.892   4.376   1.00 0.00  ? 213 TYR B HD1  4  
ATOM   6718  H HD2  . TYR B 2 74  ? -11.357 4.478   5.446   1.00 0.00  ? 213 TYR B HD2  4  
ATOM   6719  H HE1  . TYR B 2 74  ? -13.697 0.303   6.781   1.00 0.00  ? 213 TYR B HE1  4  
ATOM   6720  H HE2  . TYR B 2 74  ? -11.572 3.890   7.850   1.00 0.00  ? 213 TYR B HE2  4  
ATOM   6721  H HH   . TYR B 2 74  ? -12.156 2.280   9.304   1.00 0.00  ? 213 TYR B HH   4  
ATOM   6722  N N    . ILE B 2 75  ? -8.925  3.353   3.333   1.00 13.74 ? 214 ILE B N    4  
ATOM   6723  C CA   . ILE B 2 75  ? -7.747  3.527   4.226   1.00 13.80 ? 214 ILE B CA   4  
ATOM   6724  C C    . ILE B 2 75  ? -7.930  4.812   5.046   1.00 14.16 ? 214 ILE B C    4  
ATOM   6725  O O    . ILE B 2 75  ? -7.145  5.116   5.923   1.00 12.50 ? 214 ILE B O    4  
ATOM   6726  C CB   . ILE B 2 75  ? -6.474  3.609   3.376   1.00 10.15 ? 214 ILE B CB   4  
ATOM   6727  C CG1  . ILE B 2 75  ? -6.074  2.199   2.939   1.00 9.57  ? 214 ILE B CG1  4  
ATOM   6728  C CG2  . ILE B 2 75  ? -5.330  4.225   4.189   1.00 8.37  ? 214 ILE B CG2  4  
ATOM   6729  C CD1  . ILE B 2 75  ? -4.869  2.279   1.999   1.00 7.18  ? 214 ILE B CD1  4  
ATOM   6730  H H    . ILE B 2 75  ? -9.006  3.895   2.520   1.00 0.00  ? 214 ILE B H    4  
ATOM   6731  H HA   . ILE B 2 75  ? -7.680  2.682   4.897   1.00 0.00  ? 214 ILE B HA   4  
ATOM   6732  H HB   . ILE B 2 75  ? -6.663  4.216   2.500   1.00 0.00  ? 214 ILE B HB   4  
ATOM   6733  H HG12 . ILE B 2 75  ? -5.814  1.614   3.811   1.00 0.00  ? 214 ILE B HG12 4  
ATOM   6734  H HG13 . ILE B 2 75  ? -6.901  1.733   2.426   1.00 0.00  ? 214 ILE B HG13 4  
ATOM   6735  H HG21 . ILE B 2 75  ? -5.398  3.893   5.215   1.00 0.00  ? 214 ILE B HG21 4  
ATOM   6736  H HG22 . ILE B 2 75  ? -4.383  3.916   3.771   1.00 0.00  ? 214 ILE B HG22 4  
ATOM   6737  H HG23 . ILE B 2 75  ? -5.405  5.303   4.155   1.00 0.00  ? 214 ILE B HG23 4  
ATOM   6738  H HD11 . ILE B 2 75  ? -5.013  3.087   1.299   1.00 0.00  ? 214 ILE B HD11 4  
ATOM   6739  H HD12 . ILE B 2 75  ? -3.974  2.457   2.576   1.00 0.00  ? 214 ILE B HD12 4  
ATOM   6740  H HD13 . ILE B 2 75  ? -4.771  1.349   1.461   1.00 0.00  ? 214 ILE B HD13 4  
ATOM   6741  N N    . THR B 2 76  ? -8.962  5.565   4.769   1.00 15.77 ? 215 THR B N    4  
ATOM   6742  C CA   . THR B 2 76  ? -9.196  6.822   5.532   1.00 18.20 ? 215 THR B CA   4  
ATOM   6743  C C    . THR B 2 76  ? -10.701 7.039   5.694   1.00 17.81 ? 215 THR B C    4  
ATOM   6744  O O    . THR B 2 76  ? -11.496 6.539   4.923   1.00 15.56 ? 215 THR B O    4  
ATOM   6745  C CB   . THR B 2 76  ? -8.585  8.004   4.775   1.00 20.21 ? 215 THR B CB   4  
ATOM   6746  O OG1  . THR B 2 76  ? -8.698  9.179   5.566   1.00 26.81 ? 215 THR B OG1  4  
ATOM   6747  C CG2  . THR B 2 76  ? -9.328  8.202   3.453   1.00 22.31 ? 215 THR B CG2  4  
ATOM   6748  H H    . THR B 2 76  ? -9.586  5.304   4.062   1.00 0.00  ? 215 THR B H    4  
ATOM   6749  H HA   . THR B 2 76  ? -8.738  6.740   6.507   1.00 0.00  ? 215 THR B HA   4  
ATOM   6750  H HB   . THR B 2 76  ? -7.545  7.804   4.572   1.00 0.00  ? 215 THR B HB   4  
ATOM   6751  H HG1  . THR B 2 76  ? -8.381  8.974   6.449   1.00 0.00  ? 215 THR B HG1  4  
ATOM   6752  H HG21 . THR B 2 76  ? -9.870  7.301   3.205   1.00 0.00  ? 215 THR B HG21 4  
ATOM   6753  H HG22 . THR B 2 76  ? -10.021 9.025   3.548   1.00 0.00  ? 215 THR B HG22 4  
ATOM   6754  H HG23 . THR B 2 76  ? -8.617  8.420   2.670   1.00 0.00  ? 215 THR B HG23 4  
ATOM   6755  N N    . SER B 2 77  ? -11.101 7.779   6.691   1.00 18.97 ? 216 SER B N    4  
ATOM   6756  C CA   . SER B 2 77  ? -12.555 8.022   6.902   1.00 18.71 ? 216 SER B CA   4  
ATOM   6757  C C    . SER B 2 77  ? -13.006 9.206   6.044   1.00 18.69 ? 216 SER B C    4  
ATOM   6758  O O    . SER B 2 77  ? -13.367 10.249  6.551   1.00 20.53 ? 216 SER B O    4  
ATOM   6759  C CB   . SER B 2 77  ? -12.810 8.335   8.376   1.00 20.19 ? 216 SER B CB   4  
ATOM   6760  O OG   . SER B 2 77  ? -12.330 9.640   8.669   1.00 22.41 ? 216 SER B OG   4  
ATOM   6761  H H    . SER B 2 77  ? -10.445 8.171   7.303   1.00 0.00  ? 216 SER B H    4  
ATOM   6762  H HA   . SER B 2 77  ? -13.112 7.141   6.619   1.00 0.00  ? 216 SER B HA   4  
ATOM   6763  H HB2  . SER B 2 77  ? -13.867 8.292   8.578   1.00 0.00  ? 216 SER B HB2  4  
ATOM   6764  H HB3  . SER B 2 77  ? -12.299 7.605   8.991   1.00 0.00  ? 216 SER B HB3  4  
ATOM   6765  H HG   . SER B 2 77  ? -11.463 9.554   9.072   1.00 0.00  ? 216 SER B HG   4  
ATOM   6766  N N    . ARG B 2 78  ? -12.989 9.054   4.747   1.00 0.00  ? 217 ARG B N    4  
ATOM   6767  C CA   . ARG B 2 78  ? -13.418 10.174  3.863   1.00 0.00  ? 217 ARG B CA   4  
ATOM   6768  C C    . ARG B 2 78  ? -14.049 9.610   2.587   1.00 0.00  ? 217 ARG B C    4  
ATOM   6769  O O    . ARG B 2 78  ? -15.031 10.125  2.090   1.00 0.00  ? 217 ARG B O    4  
ATOM   6770  C CB   . ARG B 2 78  ? -12.203 11.027  3.494   1.00 0.00  ? 217 ARG B CB   4  
ATOM   6771  C CG   . ARG B 2 78  ? -12.642 12.173  2.579   1.00 0.00  ? 217 ARG B CG   4  
ATOM   6772  C CD   . ARG B 2 78  ? -12.463 13.505  3.308   1.00 0.00  ? 217 ARG B CD   4  
ATOM   6773  N NE   . ARG B 2 78  ? -13.793 14.007  3.758   1.00 0.00  ? 217 ARG B NE   4  
ATOM   6774  C CZ   . ARG B 2 78  ? -13.901 15.207  4.260   1.00 0.00  ? 217 ARG B CZ   4  
ATOM   6775  N NH1  . ARG B 2 78  ? -13.742 15.395  5.542   1.00 0.00  ? 217 ARG B NH1  4  
ATOM   6776  N NH2  . ARG B 2 78  ? -14.170 16.219  3.482   1.00 0.00  ? 217 ARG B NH2  4  
ATOM   6777  H H    . ARG B 2 78  ? -12.695 8.205   4.357   1.00 0.00  ? 217 ARG B H    4  
ATOM   6778  H HA   . ARG B 2 78  ? -14.142 10.785  4.381   1.00 0.00  ? 217 ARG B HA   4  
ATOM   6779  H HB2  . ARG B 2 78  ? -11.762 11.432  4.394   1.00 0.00  ? 217 ARG B HB2  4  
ATOM   6780  H HB3  . ARG B 2 78  ? -11.476 10.417  2.980   1.00 0.00  ? 217 ARG B HB3  4  
ATOM   6781  H HG2  . ARG B 2 78  ? -12.039 12.168  1.683   1.00 0.00  ? 217 ARG B HG2  4  
ATOM   6782  H HG3  . ARG B 2 78  ? -13.681 12.045  2.315   1.00 0.00  ? 217 ARG B HG3  4  
ATOM   6783  H HD2  . ARG B 2 78  ? -11.823 13.364  4.165   1.00 0.00  ? 217 ARG B HD2  4  
ATOM   6784  H HD3  . ARG B 2 78  ? -12.015 14.224  2.638   1.00 0.00  ? 217 ARG B HD3  4  
ATOM   6785  H HE   . ARG B 2 78  ? -14.585 13.436  3.678   1.00 0.00  ? 217 ARG B HE   4  
ATOM   6786  H HH11 . ARG B 2 78  ? -13.537 14.620  6.140   1.00 0.00  ? 217 ARG B HH11 4  
ATOM   6787  H HH12 . ARG B 2 78  ? -13.825 16.315  5.926   1.00 0.00  ? 217 ARG B HH12 4  
ATOM   6788  H HH21 . ARG B 2 78  ? -14.293 16.075  2.500   1.00 0.00  ? 217 ARG B HH21 4  
ATOM   6789  H HH22 . ARG B 2 78  ? -14.253 17.138  3.867   1.00 0.00  ? 217 ARG B HH22 4  
ATOM   6790  N N    . THR B 2 79  ? -13.494 8.558   2.050   1.00 23.45 ? 218 THR B N    4  
ATOM   6791  C CA   . THR B 2 79  ? -14.066 7.971   0.807   1.00 23.59 ? 218 THR B CA   4  
ATOM   6792  C C    . THR B 2 79  ? -13.981 6.444   0.867   1.00 19.84 ? 218 THR B C    4  
ATOM   6793  O O    . THR B 2 79  ? -13.072 5.885   1.447   1.00 20.24 ? 218 THR B O    4  
ATOM   6794  C CB   . THR B 2 79  ? -13.278 8.476   -0.404  1.00 26.45 ? 218 THR B CB   4  
ATOM   6795  O OG1  . THR B 2 79  ? -13.345 9.895   -0.453  1.00 30.31 ? 218 THR B OG1  4  
ATOM   6796  C CG2  . THR B 2 79  ? -13.875 7.889   -1.684  1.00 27.38 ? 218 THR B CG2  4  
ATOM   6797  H H    . THR B 2 79  ? -12.701 8.156   2.462   1.00 0.00  ? 218 THR B H    4  
ATOM   6798  H HA   . THR B 2 79  ? -15.101 8.270   0.711   1.00 0.00  ? 218 THR B HA   4  
ATOM   6799  H HB   . THR B 2 79  ? -12.248 8.167   -0.317  1.00 0.00  ? 218 THR B HB   4  
ATOM   6800  H HG1  . THR B 2 79  ? -14.254 10.142  -0.638  1.00 0.00  ? 218 THR B HG1  4  
ATOM   6801  H HG21 . THR B 2 79  ? -13.989 6.821   -1.571  1.00 0.00  ? 218 THR B HG21 4  
ATOM   6802  H HG22 . THR B 2 79  ? -14.840 8.336   -1.869  1.00 0.00  ? 218 THR B HG22 4  
ATOM   6803  H HG23 . THR B 2 79  ? -13.216 8.095   -2.515  1.00 0.00  ? 218 THR B HG23 4  
ATOM   6804  N N    . GLN B 2 80  ? -14.920 5.767   0.264   1.00 18.30 ? 219 GLN B N    4  
ATOM   6805  C CA   . GLN B 2 80  ? -14.896 4.278   0.278   1.00 20.11 ? 219 GLN B CA   4  
ATOM   6806  C C    . GLN B 2 80  ? -14.779 3.762   -1.158  1.00 19.45 ? 219 GLN B C    4  
ATOM   6807  O O    . GLN B 2 80  ? -15.550 4.129   -2.023  1.00 20.30 ? 219 GLN B O    4  
ATOM   6808  C CB   . GLN B 2 80  ? -16.190 3.748   0.902   1.00 20.56 ? 219 GLN B CB   4  
ATOM   6809  C CG   . GLN B 2 80  ? -16.615 4.659   2.058   1.00 23.60 ? 219 GLN B CG   4  
ATOM   6810  C CD   . GLN B 2 80  ? -17.519 3.878   3.014   1.00 19.08 ? 219 GLN B CD   4  
ATOM   6811  O OE1  . GLN B 2 80  ? -17.999 2.813   2.682   1.00 17.99 ? 219 GLN B OE1  4  
ATOM   6812  N NE2  . GLN B 2 80  ? -17.771 4.367   4.199   1.00 17.08 ? 219 GLN B NE2  4  
ATOM   6813  H H    . GLN B 2 80  ? -15.642 6.240   -0.200  1.00 0.00  ? 219 GLN B H    4  
ATOM   6814  H HA   . GLN B 2 80  ? -14.051 3.933   0.854   1.00 0.00  ? 219 GLN B HA   4  
ATOM   6815  H HB2  . GLN B 2 80  ? -16.968 3.729   0.153   1.00 0.00  ? 219 GLN B HB2  4  
ATOM   6816  H HB3  . GLN B 2 80  ? -16.027 2.750   1.276   1.00 0.00  ? 219 GLN B HB3  4  
ATOM   6817  H HG2  . GLN B 2 80  ? -15.738 5.002   2.587   1.00 0.00  ? 219 GLN B HG2  4  
ATOM   6818  H HG3  . GLN B 2 80  ? -17.155 5.507   1.668   1.00 0.00  ? 219 GLN B HG3  4  
ATOM   6819  H HE21 . GLN B 2 80  ? -17.382 5.228   4.467   1.00 0.00  ? 219 GLN B HE21 4  
ATOM   6820  H HE22 . GLN B 2 80  ? -18.350 3.869   4.821   1.00 0.00  ? 219 GLN B HE22 4  
ATOM   6821  N N    . PHE B 2 81  ? -13.821 2.918   -1.419  1.00 18.96 ? 220 PHE B N    4  
ATOM   6822  C CA   . PHE B 2 81  ? -13.655 2.382   -2.799  1.00 17.73 ? 220 PHE B CA   4  
ATOM   6823  C C    . PHE B 2 81  ? -14.482 1.105   -2.954  1.00 17.76 ? 220 PHE B C    4  
ATOM   6824  O O    . PHE B 2 81  ? -14.789 0.432   -1.990  1.00 19.11 ? 220 PHE B O    4  
ATOM   6825  C CB   . PHE B 2 81  ? -12.178 2.065   -3.048  1.00 14.17 ? 220 PHE B CB   4  
ATOM   6826  C CG   . PHE B 2 81  ? -11.341 3.280   -2.732  1.00 14.07 ? 220 PHE B CG   4  
ATOM   6827  C CD1  . PHE B 2 81  ? -10.851 3.477   -1.430  1.00 14.01 ? 220 PHE B CD1  4  
ATOM   6828  C CD2  . PHE B 2 81  ? -11.053 4.214   -3.740  1.00 12.87 ? 220 PHE B CD2  4  
ATOM   6829  C CE1  . PHE B 2 81  ? -10.073 4.610   -1.137  1.00 11.11 ? 220 PHE B CE1  4  
ATOM   6830  C CE2  . PHE B 2 81  ? -10.275 5.346   -3.447  1.00 13.31 ? 220 PHE B CE2  4  
ATOM   6831  C CZ   . PHE B 2 81  ? -9.784  5.544   -2.145  1.00 13.09 ? 220 PHE B CZ   4  
ATOM   6832  H H    . PHE B 2 81  ? -13.209 2.637   -0.708  1.00 0.00  ? 220 PHE B H    4  
ATOM   6833  H HA   . PHE B 2 81  ? -13.990 3.119   -3.514  1.00 0.00  ? 220 PHE B HA   4  
ATOM   6834  H HB2  . PHE B 2 81  ? -11.875 1.244   -2.413  1.00 0.00  ? 220 PHE B HB2  4  
ATOM   6835  H HB3  . PHE B 2 81  ? -12.039 1.791   -4.081  1.00 0.00  ? 220 PHE B HB3  4  
ATOM   6836  H HD1  . PHE B 2 81  ? -11.073 2.759   -0.655  1.00 0.00  ? 220 PHE B HD1  4  
ATOM   6837  H HD2  . PHE B 2 81  ? -11.430 4.063   -4.741  1.00 0.00  ? 220 PHE B HD2  4  
ATOM   6838  H HE1  . PHE B 2 81  ? -9.696  4.762   -0.136  1.00 0.00  ? 220 PHE B HE1  4  
ATOM   6839  H HE2  . PHE B 2 81  ? -10.054 6.065   -4.222  1.00 0.00  ? 220 PHE B HE2  4  
ATOM   6840  H HZ   . PHE B 2 81  ? -9.187  6.414   -1.920  1.00 0.00  ? 220 PHE B HZ   4  
ATOM   6841  N N    . ASN B 2 82  ? -14.847 0.768   -4.160  1.00 20.00 ? 221 ASN B N    4  
ATOM   6842  C CA   . ASN B 2 82  ? -15.654 -0.466  -4.377  1.00 21.48 ? 221 ASN B CA   4  
ATOM   6843  C C    . ASN B 2 82  ? -14.726 -1.642  -4.693  1.00 22.18 ? 221 ASN B C    4  
ATOM   6844  O O    . ASN B 2 82  ? -15.162 -2.769  -4.821  1.00 24.56 ? 221 ASN B O    4  
ATOM   6845  C CB   . ASN B 2 82  ? -16.618 -0.247  -5.546  1.00 26.12 ? 221 ASN B CB   4  
ATOM   6846  C CG   . ASN B 2 82  ? -18.041 -0.079  -5.009  1.00 28.62 ? 221 ASN B CG   4  
ATOM   6847  O OD1  . ASN B 2 82  ? -18.579 -0.977  -4.393  1.00 32.09 ? 221 ASN B OD1  4  
ATOM   6848  N ND2  . ASN B 2 82  ? -18.677 1.041   -5.218  1.00 31.44 ? 221 ASN B ND2  4  
ATOM   6849  H H    . ASN B 2 82  ? -14.589 1.325   -4.924  1.00 0.00  ? 221 ASN B H    4  
ATOM   6850  H HA   . ASN B 2 82  ? -16.219 -0.685  -3.483  1.00 0.00  ? 221 ASN B HA   4  
ATOM   6851  H HB2  . ASN B 2 82  ? -16.330 0.642   -6.089  1.00 0.00  ? 221 ASN B HB2  4  
ATOM   6852  H HB3  . ASN B 2 82  ? -16.583 -1.100  -6.206  1.00 0.00  ? 221 ASN B HB3  4  
ATOM   6853  H HD21 . ASN B 2 82  ? -18.240 1.767   -5.717  1.00 0.00  ? 221 ASN B HD21 4  
ATOM   6854  H HD22 . ASN B 2 82  ? -19.592 1.157   -4.876  1.00 0.00  ? 221 ASN B HD22 4  
ATOM   6855  N N    . SER B 2 83  ? -13.449 -1.394  -4.822  1.00 20.04 ? 222 SER B N    4  
ATOM   6856  C CA   . SER B 2 83  ? -12.505 -2.505  -5.130  1.00 17.84 ? 222 SER B CA   4  
ATOM   6857  C C    . SER B 2 83  ? -11.071 -2.051  -4.848  1.00 17.08 ? 222 SER B C    4  
ATOM   6858  O O    . SER B 2 83  ? -10.733 -0.896  -5.004  1.00 17.94 ? 222 SER B O    4  
ATOM   6859  C CB   . SER B 2 83  ? -12.636 -2.891  -6.603  1.00 15.42 ? 222 SER B CB   4  
ATOM   6860  O OG   . SER B 2 83  ? -12.219 -1.801  -7.412  1.00 19.15 ? 222 SER B OG   4  
ATOM   6861  H H    . SER B 2 83  ? -13.111 -0.480  -4.717  1.00 0.00  ? 222 SER B H    4  
ATOM   6862  H HA   . SER B 2 83  ? -12.740 -3.359  -4.511  1.00 0.00  ? 222 SER B HA   4  
ATOM   6863  H HB2  . SER B 2 83  ? -12.013 -3.746  -6.810  1.00 0.00  ? 222 SER B HB2  4  
ATOM   6864  H HB3  . SER B 2 83  ? -13.668 -3.140  -6.818  1.00 0.00  ? 222 SER B HB3  4  
ATOM   6865  H HG   . SER B 2 83  ? -12.250 -2.083  -8.329  1.00 0.00  ? 222 SER B HG   4  
ATOM   6866  N N    . LEU B 2 84  ? -10.225 -2.954  -4.432  1.00 17.11 ? 223 LEU B N    4  
ATOM   6867  C CA   . LEU B 2 84  ? -8.814  -2.577  -4.141  1.00 16.96 ? 223 LEU B CA   4  
ATOM   6868  C C    . LEU B 2 84  ? -8.216  -1.864  -5.356  1.00 17.05 ? 223 LEU B C    4  
ATOM   6869  O O    . LEU B 2 84  ? -7.334  -1.037  -5.232  1.00 18.74 ? 223 LEU B O    4  
ATOM   6870  C CB   . LEU B 2 84  ? -8.003  -3.838  -3.840  1.00 15.68 ? 223 LEU B CB   4  
ATOM   6871  C CG   . LEU B 2 84  ? -8.602  -4.558  -2.630  1.00 18.50 ? 223 LEU B CG   4  
ATOM   6872  C CD1  . LEU B 2 84  ? -8.257  -6.046  -2.700  1.00 17.89 ? 223 LEU B CD1  4  
ATOM   6873  C CD2  . LEU B 2 84  ? -8.024  -3.962  -1.344  1.00 17.50 ? 223 LEU B CD2  4  
ATOM   6874  H H    . LEU B 2 84  ? -10.517 -3.882  -4.313  1.00 0.00  ? 223 LEU B H    4  
ATOM   6875  H HA   . LEU B 2 84  ? -8.786  -1.917  -3.287  1.00 0.00  ? 223 LEU B HA   4  
ATOM   6876  H HB2  . LEU B 2 84  ? -8.026  -4.494  -4.698  1.00 0.00  ? 223 LEU B HB2  4  
ATOM   6877  H HB3  . LEU B 2 84  ? -6.981  -3.565  -3.624  1.00 0.00  ? 223 LEU B HB3  4  
ATOM   6878  H HG   . LEU B 2 84  ? -9.676  -4.436  -2.636  1.00 0.00  ? 223 LEU B HG   4  
ATOM   6879  H HD11 . LEU B 2 84  ? -8.422  -6.407  -3.704  1.00 0.00  ? 223 LEU B HD11 4  
ATOM   6880  H HD12 . LEU B 2 84  ? -7.221  -6.188  -2.432  1.00 0.00  ? 223 LEU B HD12 4  
ATOM   6881  H HD13 . LEU B 2 84  ? -8.885  -6.594  -2.013  1.00 0.00  ? 223 LEU B HD13 4  
ATOM   6882  H HD21 . LEU B 2 84  ? -8.083  -2.884  -1.389  1.00 0.00  ? 223 LEU B HD21 4  
ATOM   6883  H HD22 . LEU B 2 84  ? -8.590  -4.319  -0.497  1.00 0.00  ? 223 LEU B HD22 4  
ATOM   6884  H HD23 . LEU B 2 84  ? -6.992  -4.262  -1.241  1.00 0.00  ? 223 LEU B HD23 4  
ATOM   6885  N N    . GLN B 2 85  ? -8.685  -2.181  -6.532  1.00 17.04 ? 224 GLN B N    4  
ATOM   6886  C CA   . GLN B 2 85  ? -8.140  -1.523  -7.753  1.00 17.80 ? 224 GLN B CA   4  
ATOM   6887  C C    . GLN B 2 85  ? -8.574  -0.057  -7.781  1.00 17.42 ? 224 GLN B C    4  
ATOM   6888  O O    . GLN B 2 85  ? -7.818  0.814   -8.160  1.00 17.16 ? 224 GLN B O    4  
ATOM   6889  C CB   . GLN B 2 85  ? -8.668  -2.236  -8.999  1.00 21.63 ? 224 GLN B CB   4  
ATOM   6890  C CG   . GLN B 2 85  ? -7.588  -2.240  -10.082 1.00 27.99 ? 224 GLN B CG   4  
ATOM   6891  C CD   . GLN B 2 85  ? -7.748  -3.481  -10.962 1.00 31.34 ? 224 GLN B CD   4  
ATOM   6892  O OE1  . GLN B 2 85  ? -8.798  -3.704  -11.532 1.00 31.30 ? 224 GLN B OE1  4  
ATOM   6893  N NE2  . GLN B 2 85  ? -6.743  -4.302  -11.098 1.00 33.99 ? 224 GLN B NE2  4  
ATOM   6894  H H    . GLN B 2 85  ? -9.395  -2.852  -6.612  1.00 0.00  ? 224 GLN B H    4  
ATOM   6895  H HA   . GLN B 2 85  ? -7.060  -1.576  -7.738  1.00 0.00  ? 224 GLN B HA   4  
ATOM   6896  H HB2  . GLN B 2 85  ? -8.931  -3.253  -8.748  1.00 0.00  ? 224 GLN B HB2  4  
ATOM   6897  H HB3  . GLN B 2 85  ? -9.542  -1.718  -9.367  1.00 0.00  ? 224 GLN B HB3  4  
ATOM   6898  H HG2  . GLN B 2 85  ? -7.684  -1.351  -10.690 1.00 0.00  ? 224 GLN B HG2  4  
ATOM   6899  H HG3  . GLN B 2 85  ? -6.613  -2.253  -9.618  1.00 0.00  ? 224 GLN B HG3  4  
ATOM   6900  H HE21 . GLN B 2 85  ? -5.894  -4.119  -10.636 1.00 0.00  ? 224 GLN B HE21 4  
ATOM   6901  H HE22 . GLN B 2 85  ? -6.838  -5.102  -11.663 1.00 0.00  ? 224 GLN B HE22 4  
ATOM   6902  N N    . GLN B 2 86  ? -9.783  0.223   -7.380  1.00 17.93 ? 225 GLN B N    4  
ATOM   6903  C CA   . GLN B 2 86  ? -10.255 1.635   -7.381  1.00 17.77 ? 225 GLN B CA   4  
ATOM   6904  C C    . GLN B 2 86  ? -9.453  2.434   -6.354  1.00 14.93 ? 225 GLN B C    4  
ATOM   6905  O O    . GLN B 2 86  ? -9.145  3.592   -6.553  1.00 15.44 ? 225 GLN B O    4  
ATOM   6906  C CB   . GLN B 2 86  ? -11.740 1.679   -7.018  1.00 23.54 ? 225 GLN B CB   4  
ATOM   6907  C CG   . GLN B 2 86  ? -12.428 2.790   -7.813  1.00 32.83 ? 225 GLN B CG   4  
ATOM   6908  C CD   . GLN B 2 86  ? -13.822 3.042   -7.235  1.00 37.70 ? 225 GLN B CD   4  
ATOM   6909  O OE1  . GLN B 2 86  ? -14.604 2.127   -7.082  1.00 41.31 ? 225 GLN B OE1  4  
ATOM   6910  N NE2  . GLN B 2 86  ? -14.166 4.258   -6.906  1.00 38.92 ? 225 GLN B NE2  4  
ATOM   6911  H H    . GLN B 2 86  ? -10.377 -0.493  -7.074  1.00 0.00  ? 225 GLN B H    4  
ATOM   6912  H HA   . GLN B 2 86  ? -10.111 2.063   -8.363  1.00 0.00  ? 225 GLN B HA   4  
ATOM   6913  H HB2  . GLN B 2 86  ? -12.196 0.729   -7.256  1.00 0.00  ? 225 GLN B HB2  4  
ATOM   6914  H HB3  . GLN B 2 86  ? -11.846 1.875   -5.962  1.00 0.00  ? 225 GLN B HB3  4  
ATOM   6915  H HG2  . GLN B 2 86  ? -11.840 3.694   -7.748  1.00 0.00  ? 225 GLN B HG2  4  
ATOM   6916  H HG3  . GLN B 2 86  ? -12.517 2.491   -8.847  1.00 0.00  ? 225 GLN B HG3  4  
ATOM   6917  H HE21 . GLN B 2 86  ? -13.535 4.997   -7.028  1.00 0.00  ? 225 GLN B HE21 4  
ATOM   6918  H HE22 . GLN B 2 86  ? -15.057 4.430   -6.535  1.00 0.00  ? 225 GLN B HE22 4  
ATOM   6919  N N    . LEU B 2 87  ? -9.109  1.820   -5.255  1.00 13.83 ? 226 LEU B N    4  
ATOM   6920  C CA   . LEU B 2 87  ? -8.323  2.536   -4.213  1.00 13.09 ? 226 LEU B CA   4  
ATOM   6921  C C    . LEU B 2 87  ? -6.917  2.817   -4.746  1.00 11.87 ? 226 LEU B C    4  
ATOM   6922  O O    . LEU B 2 87  ? -6.306  3.814   -4.415  1.00 12.13 ? 226 LEU B O    4  
ATOM   6923  C CB   . LEU B 2 87  ? -8.231  1.662   -2.959  1.00 12.56 ? 226 LEU B CB   4  
ATOM   6924  C CG   . LEU B 2 87  ? -7.452  2.401   -1.869  1.00 13.63 ? 226 LEU B CG   4  
ATOM   6925  C CD1  . LEU B 2 87  ? -7.953  1.955   -0.495  1.00 13.34 ? 226 LEU B CD1  4  
ATOM   6926  C CD2  . LEU B 2 87  ? -5.962  2.073   -1.999  1.00 14.36 ? 226 LEU B CD2  4  
ATOM   6927  H H    . LEU B 2 87  ? -9.367  0.884   -5.117  1.00 0.00  ? 226 LEU B H    4  
ATOM   6928  H HA   . LEU B 2 87  ? -8.810  3.468   -3.968  1.00 0.00  ? 226 LEU B HA   4  
ATOM   6929  H HB2  . LEU B 2 87  ? -9.227  1.441   -2.602  1.00 0.00  ? 226 LEU B HB2  4  
ATOM   6930  H HB3  . LEU B 2 87  ? -7.722  0.741   -3.200  1.00 0.00  ? 226 LEU B HB3  4  
ATOM   6931  H HG   . LEU B 2 87  ? -7.599  3.466   -1.977  1.00 0.00  ? 226 LEU B HG   4  
ATOM   6932  H HD11 . LEU B 2 87  ? -7.838  0.885   -0.401  1.00 0.00  ? 226 LEU B HD11 4  
ATOM   6933  H HD12 . LEU B 2 87  ? -7.379  2.449   0.275   1.00 0.00  ? 226 LEU B HD12 4  
ATOM   6934  H HD13 . LEU B 2 87  ? -8.996  2.216   -0.390  1.00 0.00  ? 226 LEU B HD13 4  
ATOM   6935  H HD21 . LEU B 2 87  ? -5.843  1.023   -2.219  1.00 0.00  ? 226 LEU B HD21 4  
ATOM   6936  H HD22 . LEU B 2 87  ? -5.533  2.659   -2.798  1.00 0.00  ? 226 LEU B HD22 4  
ATOM   6937  H HD23 . LEU B 2 87  ? -5.461  2.306   -1.072  1.00 0.00  ? 226 LEU B HD23 4  
ATOM   6938  N N    . VAL B 2 88  ? -6.402  1.950   -5.573  1.00 11.28 ? 227 VAL B N    4  
ATOM   6939  C CA   . VAL B 2 88  ? -5.037  2.171   -6.128  1.00 13.23 ? 227 VAL B CA   4  
ATOM   6940  C C    . VAL B 2 88  ? -5.085  3.293   -7.166  1.00 13.64 ? 227 VAL B C    4  
ATOM   6941  O O    . VAL B 2 88  ? -4.190  4.109   -7.254  1.00 15.96 ? 227 VAL B O    4  
ATOM   6942  C CB   . VAL B 2 88  ? -4.544  0.885   -6.792  1.00 9.89  ? 227 VAL B CB   4  
ATOM   6943  C CG1  . VAL B 2 88  ? -3.044  0.996   -7.073  1.00 9.85  ? 227 VAL B CG1  4  
ATOM   6944  C CG2  . VAL B 2 88  ? -4.801  -0.300  -5.858  1.00 9.58  ? 227 VAL B CG2  4  
ATOM   6945  H H    . VAL B 2 88  ? -6.912  1.152   -5.830  1.00 0.00  ? 227 VAL B H    4  
ATOM   6946  H HA   . VAL B 2 88  ? -4.363  2.446   -5.330  1.00 0.00  ? 227 VAL B HA   4  
ATOM   6947  H HB   . VAL B 2 88  ? -5.073  0.733   -7.721  1.00 0.00  ? 227 VAL B HB   4  
ATOM   6948  H HG11 . VAL B 2 88  ? -2.816  1.992   -7.420  1.00 0.00  ? 227 VAL B HG11 4  
ATOM   6949  H HG12 . VAL B 2 88  ? -2.492  0.794   -6.166  1.00 0.00  ? 227 VAL B HG12 4  
ATOM   6950  H HG13 . VAL B 2 88  ? -2.766  0.277   -7.830  1.00 0.00  ? 227 VAL B HG13 4  
ATOM   6951  H HG21 . VAL B 2 88  ? -5.325  0.043   -4.978  1.00 0.00  ? 227 VAL B HG21 4  
ATOM   6952  H HG22 . VAL B 2 88  ? -5.400  -1.038  -6.369  1.00 0.00  ? 227 VAL B HG22 4  
ATOM   6953  H HG23 . VAL B 2 88  ? -3.858  -0.740  -5.567  1.00 0.00  ? 227 VAL B HG23 4  
ATOM   6954  N N    . ALA B 2 89  ? -6.125  3.340   -7.955  1.00 16.21 ? 228 ALA B N    4  
ATOM   6955  C CA   . ALA B 2 89  ? -6.231  4.408   -8.989  1.00 16.05 ? 228 ALA B CA   4  
ATOM   6956  C C    . ALA B 2 89  ? -6.270  5.777   -8.310  1.00 16.38 ? 228 ALA B C    4  
ATOM   6957  O O    . ALA B 2 89  ? -5.541  6.680   -8.667  1.00 17.42 ? 228 ALA B O    4  
ATOM   6958  C CB   . ALA B 2 89  ? -7.510  4.206   -9.802  1.00 17.50 ? 228 ALA B CB   4  
ATOM   6959  H H    . ALA B 2 89  ? -6.835  2.672   -7.867  1.00 0.00  ? 228 ALA B H    4  
ATOM   6960  H HA   . ALA B 2 89  ? -5.375  4.359   -9.647  1.00 0.00  ? 228 ALA B HA   4  
ATOM   6961  H HB1  . ALA B 2 89  ? -7.811  3.171   -9.748  1.00 0.00  ? 228 ALA B HB1  4  
ATOM   6962  H HB2  . ALA B 2 89  ? -8.295  4.830   -9.399  1.00 0.00  ? 228 ALA B HB2  4  
ATOM   6963  H HB3  . ALA B 2 89  ? -7.329  4.475   -10.832 1.00 0.00  ? 228 ALA B HB3  4  
ATOM   6964  N N    . TYR B 2 90  ? -7.118  5.942   -7.331  1.00 17.24 ? 229 TYR B N    4  
ATOM   6965  C CA   . TYR B 2 90  ? -7.200  7.254   -6.632  1.00 15.90 ? 229 TYR B CA   4  
ATOM   6966  C C    . TYR B 2 90  ? -5.821  7.622   -6.085  1.00 15.53 ? 229 TYR B C    4  
ATOM   6967  O O    . TYR B 2 90  ? -5.281  8.666   -6.390  1.00 15.40 ? 229 TYR B O    4  
ATOM   6968  C CB   . TYR B 2 90  ? -8.197  7.155   -5.475  1.00 17.41 ? 229 TYR B CB   4  
ATOM   6969  C CG   . TYR B 2 90  ? -8.834  8.504   -5.243  1.00 19.62 ? 229 TYR B CG   4  
ATOM   6970  C CD1  . TYR B 2 90  ? -9.897  8.929   -6.058  1.00 20.00 ? 229 TYR B CD1  4  
ATOM   6971  C CD2  . TYR B 2 90  ? -8.364  9.335   -4.213  1.00 19.06 ? 229 TYR B CD2  4  
ATOM   6972  C CE1  . TYR B 2 90  ? -10.489 10.184  -5.842  1.00 22.03 ? 229 TYR B CE1  4  
ATOM   6973  C CE2  . TYR B 2 90  ? -8.956  10.591  -3.997  1.00 20.67 ? 229 TYR B CE2  4  
ATOM   6974  C CZ   . TYR B 2 90  ? -10.019 11.016  -4.811  1.00 22.97 ? 229 TYR B CZ   4  
ATOM   6975  O OH   . TYR B 2 90  ? -10.600 12.249  -4.601  1.00 24.81 ? 229 TYR B OH   4  
ATOM   6976  H H    . TYR B 2 90  ? -7.699  5.202   -7.057  1.00 0.00  ? 229 TYR B H    4  
ATOM   6977  H HA   . TYR B 2 90  ? -7.527  8.013   -7.326  1.00 0.00  ? 229 TYR B HA   4  
ATOM   6978  H HB2  . TYR B 2 90  ? -8.962  6.432   -5.721  1.00 0.00  ? 229 TYR B HB2  4  
ATOM   6979  H HB3  . TYR B 2 90  ? -7.681  6.842   -4.580  1.00 0.00  ? 229 TYR B HB3  4  
ATOM   6980  H HD1  . TYR B 2 90  ? -10.259 8.290   -6.849  1.00 0.00  ? 229 TYR B HD1  4  
ATOM   6981  H HD2  . TYR B 2 90  ? -7.547  9.009   -3.586  1.00 0.00  ? 229 TYR B HD2  4  
ATOM   6982  H HE1  . TYR B 2 90  ? -11.307 10.510  -6.468  1.00 0.00  ? 229 TYR B HE1  4  
ATOM   6983  H HE2  . TYR B 2 90  ? -8.594  11.230  -3.205  1.00 0.00  ? 229 TYR B HE2  4  
ATOM   6984  H HH   . TYR B 2 90  ? -11.020 12.523  -5.419  1.00 0.00  ? 229 TYR B HH   4  
ATOM   6985  N N    . TYR B 2 91  ? -5.247  6.773   -5.277  1.00 15.18 ? 230 TYR B N    4  
ATOM   6986  C CA   . TYR B 2 91  ? -3.903  7.075   -4.711  1.00 16.33 ? 230 TYR B CA   4  
ATOM   6987  C C    . TYR B 2 91  ? -2.835  6.915   -5.796  1.00 16.83 ? 230 TYR B C    4  
ATOM   6988  O O    . TYR B 2 91  ? -1.674  7.203   -5.582  1.00 16.71 ? 230 TYR B O    4  
ATOM   6989  C CB   . TYR B 2 91  ? -3.608  6.113   -3.557  1.00 14.52 ? 230 TYR B CB   4  
ATOM   6990  C CG   . TYR B 2 91  ? -4.687  6.236   -2.508  1.00 16.10 ? 230 TYR B CG   4  
ATOM   6991  C CD1  . TYR B 2 91  ? -5.280  7.484   -2.252  1.00 15.88 ? 230 TYR B CD1  4  
ATOM   6992  C CD2  . TYR B 2 91  ? -5.099  5.102   -1.787  1.00 17.17 ? 230 TYR B CD2  4  
ATOM   6993  C CE1  . TYR B 2 91  ? -6.284  7.599   -1.276  1.00 17.12 ? 230 TYR B CE1  4  
ATOM   6994  C CE2  . TYR B 2 91  ? -6.104  5.217   -0.811  1.00 17.84 ? 230 TYR B CE2  4  
ATOM   6995  C CZ   . TYR B 2 91  ? -6.696  6.465   -0.556  1.00 17.32 ? 230 TYR B CZ   4  
ATOM   6996  O OH   . TYR B 2 91  ? -7.682  6.578   0.403   1.00 19.89 ? 230 TYR B OH   4  
ATOM   6997  H H    . TYR B 2 91  ? -5.702  5.936   -5.042  1.00 0.00  ? 230 TYR B H    4  
ATOM   6998  H HA   . TYR B 2 91  ? -3.889  8.090   -4.342  1.00 0.00  ? 230 TYR B HA   4  
ATOM   6999  H HB2  . TYR B 2 91  ? -3.583  5.099   -3.931  1.00 0.00  ? 230 TYR B HB2  4  
ATOM   7000  H HB3  . TYR B 2 91  ? -2.651  6.358   -3.119  1.00 0.00  ? 230 TYR B HB3  4  
ATOM   7001  H HD1  . TYR B 2 91  ? -4.964  8.355   -2.806  1.00 0.00  ? 230 TYR B HD1  4  
ATOM   7002  H HD2  . TYR B 2 91  ? -4.644  4.142   -1.984  1.00 0.00  ? 230 TYR B HD2  4  
ATOM   7003  H HE1  . TYR B 2 91  ? -6.740  8.558   -1.080  1.00 0.00  ? 230 TYR B HE1  4  
ATOM   7004  H HE2  . TYR B 2 91  ? -6.420  4.346   -0.257  1.00 0.00  ? 230 TYR B HE2  4  
ATOM   7005  H HH   . TYR B 2 91  ? -7.920  7.505   0.475   1.00 0.00  ? 230 TYR B HH   4  
ATOM   7006  N N    . SER B 2 92  ? -3.212  6.460   -6.961  1.00 17.92 ? 231 SER B N    4  
ATOM   7007  C CA   . SER B 2 92  ? -2.211  6.288   -8.051  1.00 22.15 ? 231 SER B CA   4  
ATOM   7008  C C    . SER B 2 92  ? -1.926  7.642   -8.703  1.00 22.66 ? 231 SER B C    4  
ATOM   7009  O O    . SER B 2 92  ? -0.962  7.802   -9.425  1.00 24.35 ? 231 SER B O    4  
ATOM   7010  C CB   . SER B 2 92  ? -2.762  5.324   -9.102  1.00 21.66 ? 231 SER B CB   4  
ATOM   7011  O OG   . SER B 2 92  ? -2.381  3.996   -8.767  1.00 28.41 ? 231 SER B OG   4  
ATOM   7012  H H    . SER B 2 92  ? -4.152  6.234   -7.119  1.00 0.00  ? 231 SER B H    4  
ATOM   7013  H HA   . SER B 2 92  ? -1.298  5.886   -7.639  1.00 0.00  ? 231 SER B HA   4  
ATOM   7014  H HB2  . SER B 2 92  ? -3.838  5.389   -9.124  1.00 0.00  ? 231 SER B HB2  4  
ATOM   7015  H HB3  . SER B 2 92  ? -2.368  5.588   -10.073 1.00 0.00  ? 231 SER B HB3  4  
ATOM   7016  H HG   . SER B 2 92  ? -1.669  3.735   -9.354  1.00 0.00  ? 231 SER B HG   4  
ATOM   7017  N N    . LYS B 2 93  ? -2.756  8.619   -8.457  1.00 24.70 ? 232 LYS B N    4  
ATOM   7018  C CA   . LYS B 2 93  ? -2.529  9.959   -9.064  1.00 27.78 ? 232 LYS B CA   4  
ATOM   7019  C C    . LYS B 2 93  ? -2.520  11.024  -7.966  1.00 29.48 ? 232 LYS B C    4  
ATOM   7020  O O    . LYS B 2 93  ? -1.638  11.857  -7.902  1.00 31.78 ? 232 LYS B O    4  
ATOM   7021  C CB   . LYS B 2 93  ? -3.649  10.263  -10.062 1.00 28.95 ? 232 LYS B CB   4  
ATOM   7022  C CG   . LYS B 2 93  ? -3.095  10.205  -11.487 1.00 35.04 ? 232 LYS B CG   4  
ATOM   7023  C CD   . LYS B 2 93  ? -3.212  8.776   -12.021 1.00 42.20 ? 232 LYS B CD   4  
ATOM   7024  C CE   . LYS B 2 93  ? -1.866  8.336   -12.601 1.00 46.43 ? 232 LYS B CE   4  
ATOM   7025  N NZ   . LYS B 2 93  ? -1.880  8.517   -14.080 1.00 50.42 ? 232 LYS B NZ   4  
ATOM   7026  H H    . LYS B 2 93  ? -3.529  8.470   -7.873  1.00 0.00  ? 232 LYS B H    4  
ATOM   7027  H HA   . LYS B 2 93  ? -1.579  9.966   -9.579  1.00 0.00  ? 232 LYS B HA   4  
ATOM   7028  H HB2  . LYS B 2 93  ? -4.435  9.533   -9.951  1.00 0.00  ? 232 LYS B HB2  4  
ATOM   7029  H HB3  . LYS B 2 93  ? -4.044  11.250  -9.871  1.00 0.00  ? 232 LYS B HB3  4  
ATOM   7030  H HG2  . LYS B 2 93  ? -3.658  10.875  -12.120 1.00 0.00  ? 232 LYS B HG2  4  
ATOM   7031  H HG3  . LYS B 2 93  ? -2.056  10.502  -11.481 1.00 0.00  ? 232 LYS B HG3  4  
ATOM   7032  H HD2  . LYS B 2 93  ? -3.492  8.113   -11.216 1.00 0.00  ? 232 LYS B HD2  4  
ATOM   7033  H HD3  . LYS B 2 93  ? -3.963  8.742   -12.795 1.00 0.00  ? 232 LYS B HD3  4  
ATOM   7034  H HE2  . LYS B 2 93  ? -1.076  8.935   -12.174 1.00 0.00  ? 232 LYS B HE2  4  
ATOM   7035  H HE3  . LYS B 2 93  ? -1.696  7.296   -12.367 1.00 0.00  ? 232 LYS B HE3  4  
ATOM   7036  H HZ1  . LYS B 2 93  ? -2.665  9.146   -14.345 1.00 0.00  ? 232 LYS B HZ1  4  
ATOM   7037  H HZ2  . LYS B 2 93  ? -0.980  8.935   -14.388 1.00 0.00  ? 232 LYS B HZ2  4  
ATOM   7038  H HZ3  . LYS B 2 93  ? -2.005  7.593   -14.542 1.00 0.00  ? 232 LYS B HZ3  4  
ATOM   7039  N N    . HIS B 2 94  ? -3.494  11.001  -7.097  1.00 31.24 ? 233 HIS B N    4  
ATOM   7040  C CA   . HIS B 2 94  ? -3.541  12.010  -6.002  1.00 31.51 ? 233 HIS B CA   4  
ATOM   7041  C C    . HIS B 2 94  ? -3.173  11.339  -4.677  1.00 28.20 ? 233 HIS B C    4  
ATOM   7042  O O    . HIS B 2 94  ? -3.979  10.664  -4.067  1.00 29.72 ? 233 HIS B O    4  
ATOM   7043  C CB   . HIS B 2 94  ? -4.952  12.593  -5.903  1.00 33.74 ? 233 HIS B CB   4  
ATOM   7044  C CG   . HIS B 2 94  ? -5.401  13.054  -7.263  1.00 39.30 ? 233 HIS B CG   4  
ATOM   7045  N ND1  . HIS B 2 94  ? -4.504  13.446  -8.244  1.00 40.06 ? 233 HIS B ND1  4  
ATOM   7046  C CD2  . HIS B 2 94  ? -6.648  13.191  -7.820  1.00 39.81 ? 233 HIS B CD2  4  
ATOM   7047  C CE1  . HIS B 2 94  ? -5.218  13.797  -9.330  1.00 41.81 ? 233 HIS B CE1  4  
ATOM   7048  N NE2  . HIS B 2 94  ? -6.531  13.661  -9.125  1.00 42.50 ? 233 HIS B NE2  4  
ATOM   7049  H H    . HIS B 2 94  ? -4.195  10.320  -7.165  1.00 0.00  ? 233 HIS B H    4  
ATOM   7050  H HA   . HIS B 2 94  ? -2.837  12.802  -6.212  1.00 0.00  ? 233 HIS B HA   4  
ATOM   7051  H HB2  . HIS B 2 94  ? -5.630  11.836  -5.538  1.00 0.00  ? 233 HIS B HB2  4  
ATOM   7052  H HB3  . HIS B 2 94  ? -4.948  13.432  -5.224  1.00 0.00  ? 233 HIS B HB3  4  
ATOM   7053  H HD1  . HIS B 2 94  ? -3.528  13.465  -8.162  1.00 0.00  ? 233 HIS B HD1  4  
ATOM   7054  H HD2  . HIS B 2 94  ? -7.580  12.969  -7.321  1.00 0.00  ? 233 HIS B HD2  4  
ATOM   7055  H HE1  . HIS B 2 94  ? -4.782  14.148  -10.254 1.00 0.00  ? 233 HIS B HE1  4  
ATOM   7056  N N    . ALA B 2 95  ? -1.961  11.516  -4.227  1.00 24.22 ? 234 ALA B N    4  
ATOM   7057  C CA   . ALA B 2 95  ? -1.544  10.886  -2.943  1.00 22.83 ? 234 ALA B CA   4  
ATOM   7058  C C    . ALA B 2 95  ? -2.512  11.300  -1.832  1.00 24.43 ? 234 ALA B C    4  
ATOM   7059  O O    . ALA B 2 95  ? -2.635  10.635  -0.823  1.00 23.70 ? 234 ALA B O    4  
ATOM   7060  C CB   . ALA B 2 95  ? -0.129  11.348  -2.583  1.00 19.43 ? 234 ALA B CB   4  
ATOM   7061  H H    . ALA B 2 95  ? -1.325  12.063  -4.734  1.00 0.00  ? 234 ALA B H    4  
ATOM   7062  H HA   . ALA B 2 95  ? -1.555  9.812   -3.048  1.00 0.00  ? 234 ALA B HA   4  
ATOM   7063  H HB1  . ALA B 2 95  ? 0.372   11.697  -3.474  1.00 0.00  ? 234 ALA B HB1  4  
ATOM   7064  H HB2  . ALA B 2 95  ? -0.185  12.151  -1.863  1.00 0.00  ? 234 ALA B HB2  4  
ATOM   7065  H HB3  . ALA B 2 95  ? 0.423   10.522  -2.160  1.00 0.00  ? 234 ALA B HB3  4  
ATOM   7066  N N    . ASP B 2 96  ? -3.198  12.396  -2.010  1.00 27.21 ? 235 ASP B N    4  
ATOM   7067  C CA   . ASP B 2 96  ? -4.156  12.853  -0.965  1.00 29.29 ? 235 ASP B CA   4  
ATOM   7068  C C    . ASP B 2 96  ? -3.392  13.178  0.320   1.00 28.86 ? 235 ASP B C    4  
ATOM   7069  O O    . ASP B 2 96  ? -3.907  13.044  1.412   1.00 29.80 ? 235 ASP B O    4  
ATOM   7070  C CB   . ASP B 2 96  ? -5.176  11.745  -0.686  1.00 35.17 ? 235 ASP B CB   4  
ATOM   7071  C CG   . ASP B 2 96  ? -6.577  12.352  -0.598  1.00 40.61 ? 235 ASP B CG   4  
ATOM   7072  O OD1  . ASP B 2 96  ? -6.883  12.943  0.424   1.00 46.14 ? 235 ASP B OD1  4  
ATOM   7073  O OD2  . ASP B 2 96  ? -7.322  12.214  -1.556  1.00 45.11 ? 235 ASP B OD2  4  
ATOM   7074  H H    . ASP B 2 96  ? -3.082  12.919  -2.831  1.00 0.00  ? 235 ASP B H    4  
ATOM   7075  H HA   . ASP B 2 96  ? -4.671  13.737  -1.311  1.00 0.00  ? 235 ASP B HA   4  
ATOM   7076  H HB2  . ASP B 2 96  ? -5.145  11.020  -1.486  1.00 0.00  ? 235 ASP B HB2  4  
ATOM   7077  H HB3  . ASP B 2 96  ? -4.936  11.262  0.249   1.00 0.00  ? 235 ASP B HB3  4  
ATOM   7078  N N    . GLY B 2 97  ? -2.164  13.606  0.198   1.00 27.14 ? 236 GLY B N    4  
ATOM   7079  C CA   . GLY B 2 97  ? -1.367  13.942  1.411   1.00 25.64 ? 236 GLY B CA   4  
ATOM   7080  C C    . GLY B 2 97  ? -0.709  12.673  1.957   1.00 24.14 ? 236 GLY B C    4  
ATOM   7081  O O    . GLY B 2 97  ? -0.299  12.617  3.099   1.00 24.47 ? 236 GLY B O    4  
ATOM   7082  H H    . GLY B 2 97  ? -1.767  13.708  -0.692  1.00 0.00  ? 236 GLY B H    4  
ATOM   7083  H HA2  . GLY B 2 97  ? -0.604  14.662  1.153   1.00 0.00  ? 236 GLY B HA2  4  
ATOM   7084  H HA3  . GLY B 2 97  ? -2.015  14.358  2.166   1.00 0.00  ? 236 GLY B HA3  4  
ATOM   7085  N N    . LEU B 2 98  ? -0.604  11.653  1.149   1.00 20.92 ? 237 LEU B N    4  
ATOM   7086  C CA   . LEU B 2 98  ? 0.028   10.389  1.623   1.00 19.13 ? 237 LEU B CA   4  
ATOM   7087  C C    . LEU B 2 98  ? 1.548   10.555  1.645   1.00 18.42 ? 237 LEU B C    4  
ATOM   7088  O O    . LEU B 2 98  ? 2.072   11.612  1.352   1.00 19.85 ? 237 LEU B O    4  
ATOM   7089  C CB   . LEU B 2 98  ? -0.344  9.246   0.675   1.00 19.72 ? 237 LEU B CB   4  
ATOM   7090  C CG   . LEU B 2 98  ? -1.334  8.308   1.367   1.00 21.67 ? 237 LEU B CG   4  
ATOM   7091  C CD1  . LEU B 2 98  ? -2.403  7.865   0.367   1.00 17.09 ? 237 LEU B CD1  4  
ATOM   7092  C CD2  . LEU B 2 98  ? -0.588  7.080   1.893   1.00 22.76 ? 237 LEU B CD2  4  
ATOM   7093  H H    . LEU B 2 98  ? -0.941  11.719  0.232   1.00 0.00  ? 237 LEU B H    4  
ATOM   7094  H HA   . LEU B 2 98  ? -0.324  10.160  2.617   1.00 0.00  ? 237 LEU B HA   4  
ATOM   7095  H HB2  . LEU B 2 98  ? -0.797  9.653   -0.218  1.00 0.00  ? 237 LEU B HB2  4  
ATOM   7096  H HB3  . LEU B 2 98  ? 0.545   8.695   0.409   1.00 0.00  ? 237 LEU B HB3  4  
ATOM   7097  H HG   . LEU B 2 98  ? -1.804  8.826   2.191   1.00 0.00  ? 237 LEU B HG   4  
ATOM   7098  H HD11 . LEU B 2 98  ? -1.926  7.498   -0.530  1.00 0.00  ? 237 LEU B HD11 4  
ATOM   7099  H HD12 . LEU B 2 98  ? -3.001  7.080   0.805   1.00 0.00  ? 237 LEU B HD12 4  
ATOM   7100  H HD13 . LEU B 2 98  ? -3.036  8.705   0.121   1.00 0.00  ? 237 LEU B HD13 4  
ATOM   7101  H HD21 . LEU B 2 98  ? 0.386   7.378   2.254   1.00 0.00  ? 237 LEU B HD21 4  
ATOM   7102  H HD22 . LEU B 2 98  ? -1.150  6.634   2.700   1.00 0.00  ? 237 LEU B HD22 4  
ATOM   7103  H HD23 . LEU B 2 98  ? -0.472  6.362   1.095   1.00 0.00  ? 237 LEU B HD23 4  
ATOM   7104  N N    . CYS B 2 99  ? 2.262   9.517   1.987   1.00 18.29 ? 238 CYS B N    4  
ATOM   7105  C CA   . CYS B 2 99  ? 3.748   9.614   2.026   1.00 17.21 ? 238 CYS B CA   4  
ATOM   7106  C C    . CYS B 2 99  ? 4.278   9.839   0.609   1.00 18.80 ? 238 CYS B C    4  
ATOM   7107  O O    . CYS B 2 99  ? 5.323   10.428  0.413   1.00 19.09 ? 238 CYS B O    4  
ATOM   7108  C CB   . CYS B 2 99  ? 4.325   8.314   2.587   1.00 17.49 ? 238 CYS B CB   4  
ATOM   7109  S SG   . CYS B 2 99  ? 3.933   6.947   1.467   1.00 18.25 ? 238 CYS B SG   4  
ATOM   7110  H H    . CYS B 2 99  ? 1.820   8.674   2.217   1.00 0.00  ? 238 CYS B H    4  
ATOM   7111  H HA   . CYS B 2 99  ? 4.039   10.440  2.657   1.00 0.00  ? 238 CYS B HA   4  
ATOM   7112  H HB2  . CYS B 2 99  ? 5.397   8.406   2.679   1.00 0.00  ? 238 CYS B HB2  4  
ATOM   7113  H HB3  . CYS B 2 99  ? 3.895   8.118   3.558   1.00 0.00  ? 238 CYS B HB3  4  
ATOM   7114  H HG   . CYS B 2 99  ? 3.132   6.524   1.785   1.00 0.00  ? 238 CYS B HG   4  
ATOM   7115  N N    . HIS B 2 100 ? 3.566   9.375   -0.381  1.00 17.96 ? 239 HIS B N    4  
ATOM   7116  C CA   . HIS B 2 100 ? 4.028   9.562   -1.787  1.00 18.41 ? 239 HIS B CA   4  
ATOM   7117  C C    . HIS B 2 100 ? 3.032   8.900   -2.741  1.00 18.79 ? 239 HIS B C    4  
ATOM   7118  O O    . HIS B 2 100 ? 2.534   7.821   -2.484  1.00 19.28 ? 239 HIS B O    4  
ATOM   7119  C CB   . HIS B 2 100 ? 5.405   8.920   -1.960  1.00 18.77 ? 239 HIS B CB   4  
ATOM   7120  C CG   . HIS B 2 100 ? 6.169   9.657   -3.026  1.00 18.40 ? 239 HIS B CG   4  
ATOM   7121  N ND1  . HIS B 2 100 ? 5.719   9.739   -4.334  1.00 18.53 ? 239 HIS B ND1  4  
ATOM   7122  C CD2  . HIS B 2 100 ? 7.352   10.351  -2.992  1.00 19.51 ? 239 HIS B CD2  4  
ATOM   7123  C CE1  . HIS B 2 100 ? 6.619   10.459  -5.027  1.00 19.04 ? 239 HIS B CE1  4  
ATOM   7124  N NE2  . HIS B 2 100 ? 7.635   10.858  -4.257  1.00 20.02 ? 239 HIS B NE2  4  
ATOM   7125  H H    . HIS B 2 100 ? 2.726   8.903   -0.201  1.00 0.00  ? 239 HIS B H    4  
ATOM   7126  H HA   . HIS B 2 100 ? 4.091   10.617  -2.007  1.00 0.00  ? 239 HIS B HA   4  
ATOM   7127  H HB2  . HIS B 2 100 ? 5.947   8.971   -1.027  1.00 0.00  ? 239 HIS B HB2  4  
ATOM   7128  H HB3  . HIS B 2 100 ? 5.287   7.887   -2.252  1.00 0.00  ? 239 HIS B HB3  4  
ATOM   7129  H HD1  . HIS B 2 100 ? 4.895   9.345   -4.688  1.00 0.00  ? 239 HIS B HD1  4  
ATOM   7130  H HD2  . HIS B 2 100 ? 7.971   10.485  -2.116  1.00 0.00  ? 239 HIS B HD2  4  
ATOM   7131  H HE1  . HIS B 2 100 ? 6.530   10.689  -6.079  1.00 0.00  ? 239 HIS B HE1  4  
ATOM   7132  N N    . ARG B 2 101 ? 2.736   9.537   -3.841  1.00 19.17 ? 240 ARG B N    4  
ATOM   7133  C CA   . ARG B 2 101 ? 1.770   8.942   -4.809  1.00 20.76 ? 240 ARG B CA   4  
ATOM   7134  C C    . ARG B 2 101 ? 2.361   7.660   -5.399  1.00 18.50 ? 240 ARG B C    4  
ATOM   7135  O O    . ARG B 2 101 ? 3.559   7.531   -5.557  1.00 17.06 ? 240 ARG B O    4  
ATOM   7136  C CB   . ARG B 2 101 ? 1.495   9.942   -5.935  1.00 25.30 ? 240 ARG B CB   4  
ATOM   7137  C CG   . ARG B 2 101 ? 0.619   9.283   -7.001  1.00 30.23 ? 240 ARG B CG   4  
ATOM   7138  C CD   . ARG B 2 101 ? 1.480   8.902   -8.207  1.00 37.22 ? 240 ARG B CD   4  
ATOM   7139  N NE   . ARG B 2 101 ? 1.484   10.023  -9.187  1.00 43.41 ? 240 ARG B NE   4  
ATOM   7140  C CZ   . ARG B 2 101 ? 2.610   10.429  -9.708  1.00 45.15 ? 240 ARG B CZ   4  
ATOM   7141  N NH1  . ARG B 2 101 ? 3.176   9.737   -10.658 1.00 46.50 ? 240 ARG B NH1  4  
ATOM   7142  N NH2  . ARG B 2 101 ? 3.169   11.527  -9.277  1.00 46.15 ? 240 ARG B NH2  4  
ATOM   7143  H H    . ARG B 2 101 ? 3.146   10.406  -4.030  1.00 0.00  ? 240 ARG B H    4  
ATOM   7144  H HA   . ARG B 2 101 ? 0.847   8.711   -4.300  1.00 0.00  ? 240 ARG B HA   4  
ATOM   7145  H HB2  . ARG B 2 101 ? 0.986   10.805  -5.532  1.00 0.00  ? 240 ARG B HB2  4  
ATOM   7146  H HB3  . ARG B 2 101 ? 2.429   10.250  -6.380  1.00 0.00  ? 240 ARG B HB3  4  
ATOM   7147  H HG2  . ARG B 2 101 ? 0.159   8.395   -6.591  1.00 0.00  ? 240 ARG B HG2  4  
ATOM   7148  H HG3  . ARG B 2 101 ? -0.149  9.974   -7.314  1.00 0.00  ? 240 ARG B HG3  4  
ATOM   7149  H HD2  . ARG B 2 101 ? 2.490   8.705   -7.880  1.00 0.00  ? 240 ARG B HD2  4  
ATOM   7150  H HD3  . ARG B 2 101 ? 1.074   8.017   -8.674  1.00 0.00  ? 240 ARG B HD3  4  
ATOM   7151  H HE   . ARG B 2 101 ? 0.643   10.456  -9.442  1.00 0.00  ? 240 ARG B HE   4  
ATOM   7152  H HH11 . ARG B 2 101 ? 2.749   8.896   -10.987 1.00 0.00  ? 240 ARG B HH11 4  
ATOM   7153  H HH12 . ARG B 2 101 ? 4.039   10.048  -11.057 1.00 0.00  ? 240 ARG B HH12 4  
ATOM   7154  H HH21 . ARG B 2 101 ? 2.735   12.057  -8.550  1.00 0.00  ? 240 ARG B HH21 4  
ATOM   7155  H HH22 . ARG B 2 101 ? 4.031   11.839  -9.675  1.00 0.00  ? 240 ARG B HH22 4  
ATOM   7156  N N    . LEU B 2 102 ? 1.528   6.712   -5.728  1.00 16.42 ? 241 LEU B N    4  
ATOM   7157  C CA   . LEU B 2 102 ? 2.037   5.437   -6.309  1.00 16.95 ? 241 LEU B CA   4  
ATOM   7158  C C    . LEU B 2 102 ? 2.802   5.736   -7.600  1.00 18.53 ? 241 LEU B C    4  
ATOM   7159  O O    . LEU B 2 102 ? 2.243   6.210   -8.568  1.00 19.32 ? 241 LEU B O    4  
ATOM   7160  C CB   . LEU B 2 102 ? 0.857   4.513   -6.618  1.00 12.02 ? 241 LEU B CB   4  
ATOM   7161  C CG   . LEU B 2 102 ? -0.044  4.402   -5.386  1.00 10.93 ? 241 LEU B CG   4  
ATOM   7162  C CD1  . LEU B 2 102 ? -1.101  3.319   -5.619  1.00 7.07  ? 241 LEU B CD1  4  
ATOM   7163  C CD2  . LEU B 2 102 ? 0.802   4.032   -4.165  1.00 9.30  ? 241 LEU B CD2  4  
ATOM   7164  H H    . LEU B 2 102 ? 0.566   6.837   -5.593  1.00 0.00  ? 241 LEU B H    4  
ATOM   7165  H HA   . LEU B 2 102 ? 2.697   4.956   -5.601  1.00 0.00  ? 241 LEU B HA   4  
ATOM   7166  H HB2  . LEU B 2 102 ? 0.293   4.917   -7.444  1.00 0.00  ? 241 LEU B HB2  4  
ATOM   7167  H HB3  . LEU B 2 102 ? 1.225   3.533   -6.880  1.00 0.00  ? 241 LEU B HB3  4  
ATOM   7168  H HG   . LEU B 2 102 ? -0.535  5.349   -5.213  1.00 0.00  ? 241 LEU B HG   4  
ATOM   7169  H HD11 . LEU B 2 102 ? -1.376  3.305   -6.663  1.00 0.00  ? 241 LEU B HD11 4  
ATOM   7170  H HD12 . LEU B 2 102 ? -0.698  2.358   -5.339  1.00 0.00  ? 241 LEU B HD12 4  
ATOM   7171  H HD13 . LEU B 2 102 ? -1.973  3.533   -5.019  1.00 0.00  ? 241 LEU B HD13 4  
ATOM   7172  H HD21 . LEU B 2 102 ? 1.724   3.575   -4.492  1.00 0.00  ? 241 LEU B HD21 4  
ATOM   7173  H HD22 . LEU B 2 102 ? 1.023   4.923   -3.597  1.00 0.00  ? 241 LEU B HD22 4  
ATOM   7174  H HD23 . LEU B 2 102 ? 0.255   3.336   -3.546  1.00 0.00  ? 241 LEU B HD23 4  
ATOM   7175  N N    . THR B 2 103 ? 4.079   5.462   -7.624  1.00 20.81 ? 242 THR B N    4  
ATOM   7176  C CA   . THR B 2 103 ? 4.876   5.731   -8.854  1.00 20.89 ? 242 THR B CA   4  
ATOM   7177  C C    . THR B 2 103 ? 5.482   4.423   -9.368  1.00 21.74 ? 242 THR B C    4  
ATOM   7178  O O    . THR B 2 103 ? 5.726   4.263   -10.547 1.00 24.76 ? 242 THR B O    4  
ATOM   7179  C CB   . THR B 2 103 ? 5.998   6.720   -8.531  1.00 20.18 ? 242 THR B CB   4  
ATOM   7180  O OG1  . THR B 2 103 ? 6.484   6.470   -7.220  1.00 22.88 ? 242 THR B OG1  4  
ATOM   7181  C CG2  . THR B 2 103 ? 5.462   8.151   -8.614  1.00 19.22 ? 242 THR B CG2  4  
ATOM   7182  H H    . THR B 2 103 ? 4.513   5.079   -6.832  1.00 0.00  ? 242 THR B H    4  
ATOM   7183  H HA   . THR B 2 103 ? 4.233   6.152   -9.614  1.00 0.00  ? 242 THR B HA   4  
ATOM   7184  H HB   . THR B 2 103 ? 6.801   6.601   -9.242  1.00 0.00  ? 242 THR B HB   4  
ATOM   7185  H HG1  . THR B 2 103 ? 7.349   6.879   -7.142  1.00 0.00  ? 242 THR B HG1  4  
ATOM   7186  H HG21 . THR B 2 103 ? 4.679   8.201   -9.355  1.00 0.00  ? 242 THR B HG21 4  
ATOM   7187  H HG22 . THR B 2 103 ? 5.065   8.443   -7.652  1.00 0.00  ? 242 THR B HG22 4  
ATOM   7188  H HG23 . THR B 2 103 ? 6.263   8.820   -8.890  1.00 0.00  ? 242 THR B HG23 4  
ATOM   7189  N N    . THR B 2 104 ? 5.729   3.488   -8.493  1.00 20.71 ? 243 THR B N    4  
ATOM   7190  C CA   . THR B 2 104 ? 6.321   2.193   -8.933  1.00 18.86 ? 243 THR B CA   4  
ATOM   7191  C C    . THR B 2 104 ? 5.838   1.072   -8.011  1.00 18.56 ? 243 THR B C    4  
ATOM   7192  O O    . THR B 2 104 ? 5.402   1.314   -6.902  1.00 18.28 ? 243 THR B O    4  
ATOM   7193  C CB   . THR B 2 104 ? 7.848   2.284   -8.868  1.00 20.42 ? 243 THR B CB   4  
ATOM   7194  O OG1  . THR B 2 104 ? 8.270   3.527   -9.412  1.00 20.70 ? 243 THR B OG1  4  
ATOM   7195  C CG2  . THR B 2 104 ? 8.467   1.139   -9.670  1.00 16.38 ? 243 THR B CG2  4  
ATOM   7196  H H    . THR B 2 104 ? 5.527   3.636   -7.545  1.00 0.00  ? 243 THR B H    4  
ATOM   7197  H HA   . THR B 2 104 ? 6.016   1.983   -9.947  1.00 0.00  ? 243 THR B HA   4  
ATOM   7198  H HB   . THR B 2 104 ? 8.170   2.212   -7.840  1.00 0.00  ? 243 THR B HB   4  
ATOM   7199  H HG1  . THR B 2 104 ? 7.853   3.632   -10.271 1.00 0.00  ? 243 THR B HG1  4  
ATOM   7200  H HG21 . THR B 2 104 ? 7.775   0.820   -10.437 1.00 0.00  ? 243 THR B HG21 4  
ATOM   7201  H HG22 . THR B 2 104 ? 9.384   1.476   -10.131 1.00 0.00  ? 243 THR B HG22 4  
ATOM   7202  H HG23 . THR B 2 104 ? 8.679   0.310   -9.010  1.00 0.00  ? 243 THR B HG23 4  
ATOM   7203  N N    . VAL B 2 105 ? 5.910   -0.151  -8.456  1.00 16.29 ? 244 VAL B N    4  
ATOM   7204  C CA   . VAL B 2 105 ? 5.454   -1.281  -7.599  1.00 16.81 ? 244 VAL B CA   4  
ATOM   7205  C C    . VAL B 2 105 ? 6.672   -2.028  -7.053  1.00 16.74 ? 244 VAL B C    4  
ATOM   7206  O O    . VAL B 2 105 ? 7.787   -1.823  -7.489  1.00 17.40 ? 244 VAL B O    4  
ATOM   7207  C CB   . VAL B 2 105 ? 4.598   -2.241  -8.428  1.00 17.29 ? 244 VAL B CB   4  
ATOM   7208  C CG1  . VAL B 2 105 ? 3.780   -3.130  -7.491  1.00 17.99 ? 244 VAL B CG1  4  
ATOM   7209  C CG2  . VAL B 2 105 ? 3.650   -1.436  -9.320  1.00 17.19 ? 244 VAL B CG2  4  
ATOM   7210  H H    . VAL B 2 105 ? 6.265   -0.327  -9.353  1.00 0.00  ? 244 VAL B H    4  
ATOM   7211  H HA   . VAL B 2 105 ? 4.870   -0.896  -6.777  1.00 0.00  ? 244 VAL B HA   4  
ATOM   7212  H HB   . VAL B 2 105 ? 5.239   -2.857  -9.042  1.00 0.00  ? 244 VAL B HB   4  
ATOM   7213  H HG11 . VAL B 2 105 ? 3.765   -2.696  -6.503  1.00 0.00  ? 244 VAL B HG11 4  
ATOM   7214  H HG12 . VAL B 2 105 ? 2.769   -3.212  -7.864  1.00 0.00  ? 244 VAL B HG12 4  
ATOM   7215  H HG13 . VAL B 2 105 ? 4.227   -4.112  -7.445  1.00 0.00  ? 244 VAL B HG13 4  
ATOM   7216  H HG21 . VAL B 2 105 ? 4.224   -0.760  -9.937  1.00 0.00  ? 244 VAL B HG21 4  
ATOM   7217  H HG22 . VAL B 2 105 ? 3.089   -2.110  -9.950  1.00 0.00  ? 244 VAL B HG22 4  
ATOM   7218  H HG23 . VAL B 2 105 ? 2.969   -0.869  -8.703  1.00 0.00  ? 244 VAL B HG23 4  
ATOM   7219  N N    . CYS B 2 106 ? 6.469   -2.896  -6.098  1.00 15.40 ? 245 CYS B N    4  
ATOM   7220  C CA   . CYS B 2 106 ? 7.617   -3.653  -5.526  1.00 16.70 ? 245 CYS B CA   4  
ATOM   7221  C C    . CYS B 2 106 ? 8.098   -4.695  -6.544  1.00 16.64 ? 245 CYS B C    4  
ATOM   7222  O O    . CYS B 2 106 ? 7.304   -5.248  -7.279  1.00 17.47 ? 245 CYS B O    4  
ATOM   7223  C CB   . CYS B 2 106 ? 7.174   -4.359  -4.243  1.00 15.93 ? 245 CYS B CB   4  
ATOM   7224  S SG   . CYS B 2 106 ? 7.913   -3.528  -2.814  1.00 18.24 ? 245 CYS B SG   4  
ATOM   7225  H H    . CYS B 2 106 ? 5.562   -3.048  -5.760  1.00 0.00  ? 245 CYS B H    4  
ATOM   7226  H HA   . CYS B 2 106 ? 8.421   -2.968  -5.302  1.00 0.00  ? 245 CYS B HA   4  
ATOM   7227  H HB2  . CYS B 2 106 ? 6.098   -4.323  -4.164  1.00 0.00  ? 245 CYS B HB2  4  
ATOM   7228  H HB3  . CYS B 2 106 ? 7.500   -5.388  -4.267  1.00 0.00  ? 245 CYS B HB3  4  
ATOM   7229  H HG   . CYS B 2 106 ? 7.428   -3.798  -2.031  1.00 0.00  ? 245 CYS B HG   4  
ATOM   7230  N N    . PRO B 2 107 ? 9.388   -4.934  -6.558  1.00 18.63 ? 246 PRO B N    4  
ATOM   7231  C CA   . PRO B 2 107 ? 10.003  -5.906  -7.478  1.00 19.52 ? 246 PRO B CA   4  
ATOM   7232  C C    . PRO B 2 107 ? 9.790   -7.335  -6.968  1.00 19.33 ? 246 PRO B C    4  
ATOM   7233  O O    . PRO B 2 107 ? 9.424   -7.483  -5.814  1.00 19.97 ? 246 PRO B O    4  
ATOM   7234  C CB   . PRO B 2 107 ? 11.488  -5.534  -7.456  1.00 18.97 ? 246 PRO B CB   4  
ATOM   7235  C CG   . PRO B 2 107 ? 11.727  -4.773  -6.130  1.00 18.88 ? 246 PRO B CG   4  
ATOM   7236  C CD   . PRO B 2 107 ? 10.353  -4.259  -5.661  1.00 17.74 ? 246 PRO B CD   4  
ATOM   7237  O OXT  . PRO B 2 107 ? 9.995   -8.256  -7.742  1.00 0.00  ? 246 PRO B OXT  4  
ATOM   7238  H HA   . PRO B 2 107 ? 9.608   -5.792  -8.475  1.00 0.00  ? 246 PRO B HA   4  
ATOM   7239  H HB2  . PRO B 2 107 ? 12.094  -6.428  -7.490  1.00 0.00  ? 246 PRO B HB2  4  
ATOM   7240  H HB3  . PRO B 2 107 ? 11.723  -4.892  -8.290  1.00 0.00  ? 246 PRO B HB3  4  
ATOM   7241  H HG2  . PRO B 2 107 ? 12.147  -5.443  -5.390  1.00 0.00  ? 246 PRO B HG2  4  
ATOM   7242  H HG3  . PRO B 2 107 ? 12.390  -3.939  -6.294  1.00 0.00  ? 246 PRO B HG3  4  
ATOM   7243  H HD2  . PRO B 2 107 ? 10.176  -4.540  -4.631  1.00 0.00  ? 246 PRO B HD2  4  
ATOM   7244  H HD3  . PRO B 2 107 ? 10.287  -3.190  -5.782  1.00 0.00  ? 246 PRO B HD3  4  
HETATM 7245  C C    . ACE A 1 1   ? 1.720   0.981   11.793  1.00 14.10 ? 100 ACE A C    5  
HETATM 7246  O O    . ACE A 1 1   ? 2.552   1.041   10.909  1.00 14.64 ? 100 ACE A O    5  
HETATM 7247  C CH3  . ACE A 1 1   ? 2.089   0.509   13.200  1.00 14.17 ? 100 ACE A CH3  5  
HETATM 7248  H H1   . ACE A 1 1   ? 1.191   0.246   13.739  1.00 0.00  ? 100 ACE A H1   5  
HETATM 7249  H H2   . ACE A 1 1   ? 2.734   -0.355  13.132  1.00 0.00  ? 100 ACE A H2   5  
HETATM 7250  H H3   . ACE A 1 1   ? 2.602   1.302   13.723  1.00 0.00  ? 100 ACE A H3   5  
HETATM 7251  N N    . PTR A 1 2   ? 0.478   1.318   11.576  1.00 14.28 ? 101 PTR A N    5  
HETATM 7252  C CA   . PTR A 1 2   ? 0.058   1.786   10.225  1.00 13.54 ? 101 PTR A CA   5  
HETATM 7253  C C    . PTR A 1 2   ? -0.229  3.289   10.274  1.00 14.12 ? 101 PTR A C    5  
HETATM 7254  O O    . PTR A 1 2   ? -0.940  3.767   11.135  1.00 13.97 ? 101 PTR A O    5  
HETATM 7255  C CB   . PTR A 1 2   ? -1.207  1.040   9.795   1.00 13.83 ? 101 PTR A CB   5  
HETATM 7256  C CG   . PTR A 1 2   ? -0.851  -0.380  9.425   1.00 12.91 ? 101 PTR A CG   5  
HETATM 7257  C CD1  . PTR A 1 2   ? -0.456  -0.686  8.113   1.00 12.17 ? 101 PTR A CD1  5  
HETATM 7258  C CD2  . PTR A 1 2   ? -0.916  -1.395  10.394  1.00 12.70 ? 101 PTR A CD2  5  
HETATM 7259  C CE1  . PTR A 1 2   ? -0.125  -2.008  7.769   1.00 12.08 ? 101 PTR A CE1  5  
HETATM 7260  C CE2  . PTR A 1 2   ? -0.585  -2.717  10.051  1.00 11.44 ? 101 PTR A CE2  5  
HETATM 7261  C CZ   . PTR A 1 2   ? -0.190  -3.023  8.738   1.00 13.78 ? 101 PTR A CZ   5  
HETATM 7262  O OH   . PTR A 1 2   ? 0.147   -4.368  8.388   1.00 14.51 ? 101 PTR A OH   5  
HETATM 7263  P P    . PTR A 1 2   ? 1.466   -5.064  8.994   1.00 17.94 ? 101 PTR A P    5  
HETATM 7264  O O1P  . PTR A 1 2   ? 2.562   -4.435  8.225   1.00 18.17 ? 101 PTR A O1P  5  
HETATM 7265  O O2P  . PTR A 1 2   ? 1.248   -6.500  8.712   1.00 15.88 ? 101 PTR A O2P  5  
HETATM 7266  O O3P  . PTR A 1 2   ? 1.414   -4.693  10.426  1.00 18.41 ? 101 PTR A O3P  5  
HETATM 7267  H H    . PTR A 1 2   ? -0.179  1.262   12.301  1.00 0.00  ? 101 PTR A H    5  
HETATM 7268  H HA   . PTR A 1 2   ? 0.849   1.595   9.515   1.00 0.00  ? 101 PTR A HA   5  
HETATM 7269  H HB2  . PTR A 1 2   ? -1.915  1.034   10.610  1.00 0.00  ? 101 PTR A HB2  5  
HETATM 7270  H HB3  . PTR A 1 2   ? -1.644  1.534   8.941   1.00 0.00  ? 101 PTR A HB3  5  
HETATM 7271  H HD1  . PTR A 1 2   ? -0.407  0.093   7.368   1.00 0.00  ? 101 PTR A HD1  5  
HETATM 7272  H HD2  . PTR A 1 2   ? -1.220  -1.160  11.404  1.00 0.00  ? 101 PTR A HD2  5  
HETATM 7273  H HE1  . PTR A 1 2   ? 0.179   -2.243  6.760   1.00 0.00  ? 101 PTR A HE1  5  
HETATM 7274  H HE2  . PTR A 1 2   ? -0.635  -3.497  10.796  1.00 0.00  ? 101 PTR A HE2  5  
ATOM   7275  N N    . GLU A 1 3   ? 0.320   4.038   9.357   1.00 15.01 ? 102 GLU A N    5  
ATOM   7276  C CA   . GLU A 1 3   ? 0.079   5.508   9.353   1.00 18.67 ? 102 GLU A CA   5  
ATOM   7277  C C    . GLU A 1 3   ? -1.345  5.791   8.871   1.00 23.30 ? 102 GLU A C    5  
ATOM   7278  O O    . GLU A 1 3   ? -1.845  5.147   7.969   1.00 23.42 ? 102 GLU A O    5  
ATOM   7279  C CB   . GLU A 1 3   ? 1.079   6.188   8.415   1.00 18.41 ? 102 GLU A CB   5  
ATOM   7280  C CG   . GLU A 1 3   ? 2.479   5.621   8.659   1.00 20.30 ? 102 GLU A CG   5  
ATOM   7281  C CD   . GLU A 1 3   ? 2.807   5.689   10.152  1.00 19.75 ? 102 GLU A CD   5  
ATOM   7282  O OE1  . GLU A 1 3   ? 3.044   6.783   10.636  1.00 19.69 ? 102 GLU A OE1  5  
ATOM   7283  O OE2  . GLU A 1 3   ? 2.815   4.646   10.785  1.00 21.81 ? 102 GLU A OE2  5  
ATOM   7284  H H    . GLU A 1 3   ? 0.891   3.633   8.671   1.00 0.00  ? 102 GLU A H    5  
ATOM   7285  H HA   . GLU A 1 3   ? 0.203   5.896   10.354  1.00 0.00  ? 102 GLU A HA   5  
ATOM   7286  H HB2  . GLU A 1 3   ? 0.790   6.006   7.389   1.00 0.00  ? 102 GLU A HB2  5  
ATOM   7287  H HB3  . GLU A 1 3   ? 1.086   7.250   8.605   1.00 0.00  ? 102 GLU A HB3  5  
ATOM   7288  H HG2  . GLU A 1 3   ? 2.513   4.592   8.328   1.00 0.00  ? 102 GLU A HG2  5  
ATOM   7289  H HG3  . GLU A 1 3   ? 3.203   6.199   8.107   1.00 0.00  ? 102 GLU A HG3  5  
ATOM   7290  N N    . GLU A 1 4   ? -2.002  6.751   9.462   1.00 29.30 ? 103 GLU A N    5  
ATOM   7291  C CA   . GLU A 1 4   ? -3.392  7.075   9.034   1.00 35.63 ? 103 GLU A CA   5  
ATOM   7292  C C    . GLU A 1 4   ? -3.354  8.181   7.977   1.00 37.94 ? 103 GLU A C    5  
ATOM   7293  O O    . GLU A 1 4   ? -2.336  8.803   7.754   1.00 40.44 ? 103 GLU A O    5  
ATOM   7294  C CB   . GLU A 1 4   ? -4.201  7.551   10.242  1.00 38.84 ? 103 GLU A CB   5  
ATOM   7295  C CG   . GLU A 1 4   ? -3.949  6.617   11.427  1.00 44.99 ? 103 GLU A CG   5  
ATOM   7296  C CD   . GLU A 1 4   ? -3.325  7.410   12.578  1.00 50.48 ? 103 GLU A CD   5  
ATOM   7297  O OE1  . GLU A 1 4   ? -3.914  8.401   12.977  1.00 53.57 ? 103 GLU A OE1  5  
ATOM   7298  O OE2  . GLU A 1 4   ? -2.269  7.011   13.041  1.00 53.04 ? 103 GLU A OE2  5  
ATOM   7299  H H    . GLU A 1 4   ? -1.582  7.260   10.186  1.00 0.00  ? 103 GLU A H    5  
ATOM   7300  H HA   . GLU A 1 4   ? -3.854  6.193   8.615   1.00 0.00  ? 103 GLU A HA   5  
ATOM   7301  H HB2  . GLU A 1 4   ? -3.900  8.555   10.504  1.00 0.00  ? 103 GLU A HB2  5  
ATOM   7302  H HB3  . GLU A 1 4   ? -5.253  7.542   9.997   1.00 0.00  ? 103 GLU A HB3  5  
ATOM   7303  H HG2  . GLU A 1 4   ? -4.885  6.186   11.752  1.00 0.00  ? 103 GLU A HG2  5  
ATOM   7304  H HG3  . GLU A 1 4   ? -3.274  5.829   11.127  1.00 0.00  ? 103 GLU A HG3  5  
ATOM   7305  N N    . ILE A 1 5   ? -4.457  8.430   7.326   1.00 39.26 ? 104 ILE A N    5  
ATOM   7306  C CA   . ILE A 1 5   ? -4.481  9.495   6.285   1.00 40.91 ? 104 ILE A CA   5  
ATOM   7307  C C    . ILE A 1 5   ? -4.915  10.819  6.920   1.00 42.72 ? 104 ILE A C    5  
ATOM   7308  O O    . ILE A 1 5   ? -6.048  10.984  7.322   1.00 43.33 ? 104 ILE A O    5  
ATOM   7309  C CB   . ILE A 1 5   ? -5.472  9.110   5.185   1.00 40.30 ? 104 ILE A CB   5  
ATOM   7310  C CG1  . ILE A 1 5   ? -4.944  7.886   4.433   1.00 39.28 ? 104 ILE A CG1  5  
ATOM   7311  C CG2  . ILE A 1 5   ? -5.632  10.276  4.208   1.00 41.44 ? 104 ILE A CG2  5  
ATOM   7312  C CD1  . ILE A 1 5   ? -3.685  8.269   3.652   1.00 37.66 ? 104 ILE A CD1  5  
ATOM   7313  H H    . ILE A 1 5   ? -5.269  7.916   7.520   1.00 0.00  ? 104 ILE A H    5  
ATOM   7314  H HA   . ILE A 1 5   ? -3.495  9.606   5.859   1.00 0.00  ? 104 ILE A HA   5  
ATOM   7315  H HB   . ILE A 1 5   ? -6.430  8.877   5.628   1.00 0.00  ? 104 ILE A HB   5  
ATOM   7316  H HG12 . ILE A 1 5   ? -4.707  7.104   5.139   1.00 0.00  ? 104 ILE A HG12 5  
ATOM   7317  H HG13 . ILE A 1 5   ? -5.697  7.533   3.744   1.00 0.00  ? 104 ILE A HG13 5  
ATOM   7318  H HG21 . ILE A 1 5   ? -4.986  11.089  4.508   1.00 0.00  ? 104 ILE A HG21 5  
ATOM   7319  H HG22 . ILE A 1 5   ? -5.365  9.953   3.213   1.00 0.00  ? 104 ILE A HG22 5  
ATOM   7320  H HG23 . ILE A 1 5   ? -6.658  10.612  4.214   1.00 0.00  ? 104 ILE A HG23 5  
ATOM   7321  H HD11 . ILE A 1 5   ? -3.350  9.247   3.968   1.00 0.00  ? 104 ILE A HD11 5  
ATOM   7322  H HD12 . ILE A 1 5   ? -2.909  7.544   3.844   1.00 0.00  ? 104 ILE A HD12 5  
ATOM   7323  H HD13 . ILE A 1 5   ? -3.909  8.288   2.596   1.00 0.00  ? 104 ILE A HD13 5  
ATOM   7324  N N    . GLU A 1 6   ? -4.018  11.764  7.014   1.00 0.00  ? 105 GLU A N    5  
ATOM   7325  C CA   . GLU A 1 6   ? -4.378  13.075  7.623   1.00 0.00  ? 105 GLU A CA   5  
ATOM   7326  C C    . GLU A 1 6   ? -3.752  14.206  6.806   1.00 0.00  ? 105 GLU A C    5  
ATOM   7327  O O    . GLU A 1 6   ? -3.535  15.267  7.368   1.00 0.00  ? 105 GLU A O    5  
ATOM   7328  C CB   . GLU A 1 6   ? -3.851  13.133  9.059   1.00 0.00  ? 105 GLU A CB   5  
ATOM   7329  C CG   . GLU A 1 6   ? -4.767  12.316  9.972   1.00 0.00  ? 105 GLU A CG   5  
ATOM   7330  C CD   . GLU A 1 6   ? -5.300  13.210  11.094  1.00 0.00  ? 105 GLU A CD   5  
ATOM   7331  O OE1  . GLU A 1 6   ? -6.115  14.070  10.801  1.00 0.00  ? 105 GLU A OE1  5  
ATOM   7332  O OE2  . GLU A 1 6   ? -4.885  13.020  12.225  1.00 0.00  ? 105 GLU A OE2  5  
ATOM   7333  O OXT  . GLU A 1 6   ? -3.503  13.994  5.630   1.00 0.00  ? 105 GLU A OXT  5  
ATOM   7334  H H    . GLU A 1 6   ? -3.108  11.611  6.683   1.00 0.00  ? 105 GLU A H    5  
ATOM   7335  H HA   . GLU A 1 6   ? -5.453  13.186  7.629   1.00 0.00  ? 105 GLU A HA   5  
ATOM   7336  H HB2  . GLU A 1 6   ? -2.851  12.725  9.092   1.00 0.00  ? 105 GLU A HB2  5  
ATOM   7337  H HB3  . GLU A 1 6   ? -3.833  14.159  9.395   1.00 0.00  ? 105 GLU A HB3  5  
ATOM   7338  H HG2  . GLU A 1 6   ? -5.595  11.927  9.397   1.00 0.00  ? 105 GLU A HG2  5  
ATOM   7339  H HG3  . GLU A 1 6   ? -4.210  11.497  10.402  1.00 0.00  ? 105 GLU A HG3  5  
ATOM   7340  N N    . MET B 2 1   ? -6.660  -12.554 -17.729 1.00 0.00  ? 140 MET B N    5  
ATOM   7341  C CA   . MET B 2 1   ? -5.213  -12.229 -17.574 1.00 0.00  ? 140 MET B CA   5  
ATOM   7342  C C    . MET B 2 1   ? -5.050  -11.097 -16.557 1.00 0.00  ? 140 MET B C    5  
ATOM   7343  O O    . MET B 2 1   ? -4.224  -11.163 -15.669 1.00 0.00  ? 140 MET B O    5  
ATOM   7344  C CB   . MET B 2 1   ? -4.643  -11.787 -18.925 1.00 0.00  ? 140 MET B CB   5  
ATOM   7345  C CG   . MET B 2 1   ? -4.174  -13.015 -19.707 1.00 0.00  ? 140 MET B CG   5  
ATOM   7346  S SD   . MET B 2 1   ? -2.524  -13.498 -19.141 1.00 0.00  ? 140 MET B SD   5  
ATOM   7347  C CE   . MET B 2 1   ? -1.599  -12.844 -20.551 1.00 0.00  ? 140 MET B CE   5  
ATOM   7348  H H1   . MET B 2 1   ? -7.140  -12.442 -16.813 1.00 0.00  ? 140 MET B H1   5  
ATOM   7349  H H2   . MET B 2 1   ? -7.086  -11.911 -18.427 1.00 0.00  ? 140 MET B H2   5  
ATOM   7350  H H3   . MET B 2 1   ? -6.763  -13.536 -18.053 1.00 0.00  ? 140 MET B H3   5  
ATOM   7351  H HA   . MET B 2 1   ? -4.682  -13.104 -17.228 1.00 0.00  ? 140 MET B HA   5  
ATOM   7352  H HB2  . MET B 2 1   ? -5.407  -11.271 -19.487 1.00 0.00  ? 140 MET B HB2  5  
ATOM   7353  H HB3  . MET B 2 1   ? -3.806  -11.126 -18.763 1.00 0.00  ? 140 MET B HB3  5  
ATOM   7354  H HG2  . MET B 2 1   ? -4.863  -13.830 -19.545 1.00 0.00  ? 140 MET B HG2  5  
ATOM   7355  H HG3  . MET B 2 1   ? -4.137  -12.778 -20.760 1.00 0.00  ? 140 MET B HG3  5  
ATOM   7356  H HE1  . MET B 2 1   ? -1.949  -13.315 -21.460 1.00 0.00  ? 140 MET B HE1  5  
ATOM   7357  H HE2  . MET B 2 1   ? -1.748  -11.775 -20.613 1.00 0.00  ? 140 MET B HE2  5  
ATOM   7358  H HE3  . MET B 2 1   ? -0.549  -13.053 -20.423 1.00 0.00  ? 140 MET B HE3  5  
ATOM   7359  N N    . ASP B 2 2   ? -5.832  -10.060 -16.680 1.00 0.00  ? 141 ASP B N    5  
ATOM   7360  C CA   . ASP B 2 2   ? -5.720  -8.926  -15.719 1.00 0.00  ? 141 ASP B CA   5  
ATOM   7361  C C    . ASP B 2 2   ? -6.697  -9.141  -14.561 1.00 0.00  ? 141 ASP B C    5  
ATOM   7362  O O    . ASP B 2 2   ? -7.898  -9.068  -14.728 1.00 0.00  ? 141 ASP B O    5  
ATOM   7363  C CB   . ASP B 2 2   ? -6.059  -7.616  -16.435 1.00 0.00  ? 141 ASP B CB   5  
ATOM   7364  C CG   . ASP B 2 2   ? -4.904  -7.224  -17.358 1.00 0.00  ? 141 ASP B CG   5  
ATOM   7365  O OD1  . ASP B 2 2   ? -3.978  -8.009  -17.482 1.00 0.00  ? 141 ASP B OD1  5  
ATOM   7366  O OD2  . ASP B 2 2   ? -4.965  -6.145  -17.925 1.00 0.00  ? 141 ASP B OD2  5  
ATOM   7367  H H    . ASP B 2 2   ? -6.492  -10.026 -17.404 1.00 0.00  ? 141 ASP B H    5  
ATOM   7368  H HA   . ASP B 2 2   ? -4.712  -8.876  -15.337 1.00 0.00  ? 141 ASP B HA   5  
ATOM   7369  H HB2  . ASP B 2 2   ? -6.959  -7.749  -17.020 1.00 0.00  ? 141 ASP B HB2  5  
ATOM   7370  H HB3  . ASP B 2 2   ? -6.216  -6.836  -15.706 1.00 0.00  ? 141 ASP B HB3  5  
ATOM   7371  N N    . SER B 2 3   ? -6.191  -9.404  -13.387 1.00 0.00  ? 142 SER B N    5  
ATOM   7372  C CA   . SER B 2 3   ? -7.092  -9.622  -12.220 1.00 0.00  ? 142 SER B CA   5  
ATOM   7373  C C    . SER B 2 3   ? -6.265  -9.648  -10.934 1.00 0.00  ? 142 SER B C    5  
ATOM   7374  O O    . SER B 2 3   ? -5.052  -9.710  -10.965 1.00 0.00  ? 142 SER B O    5  
ATOM   7375  C CB   . SER B 2 3   ? -7.824  -10.955 -12.383 1.00 0.00  ? 142 SER B CB   5  
ATOM   7376  O OG   . SER B 2 3   ? -6.875  -12.015 -12.383 1.00 0.00  ? 142 SER B OG   5  
ATOM   7377  H H    . SER B 2 3   ? -5.220  -9.459  -13.273 1.00 0.00  ? 142 SER B H    5  
ATOM   7378  H HA   . SER B 2 3   ? -7.814  -8.820  -12.168 1.00 0.00  ? 142 SER B HA   5  
ATOM   7379  H HB2  . SER B 2 3   ? -8.510  -11.093 -11.564 1.00 0.00  ? 142 SER B HB2  5  
ATOM   7380  H HB3  . SER B 2 3   ? -8.374  -10.951 -13.314 1.00 0.00  ? 142 SER B HB3  5  
ATOM   7381  H HG   . SER B 2 3   ? -6.190  -11.798 -13.018 1.00 0.00  ? 142 SER B HG   5  
ATOM   7382  N N    . ILE B 2 4   ? -6.911  -9.599  -9.801  1.00 0.00  ? 143 ILE B N    5  
ATOM   7383  C CA   . ILE B 2 4   ? -6.162  -9.619  -8.513  1.00 0.00  ? 143 ILE B CA   5  
ATOM   7384  C C    . ILE B 2 4   ? -5.163  -10.778 -8.518  1.00 0.00  ? 143 ILE B C    5  
ATOM   7385  O O    . ILE B 2 4   ? -3.996  -10.603 -8.229  1.00 0.00  ? 143 ILE B O    5  
ATOM   7386  C CB   . ILE B 2 4   ? -7.143  -9.795  -7.357  1.00 0.00  ? 143 ILE B CB   5  
ATOM   7387  C CG1  . ILE B 2 4   ? -8.002  -8.535  -7.221  1.00 0.00  ? 143 ILE B CG1  5  
ATOM   7388  C CG2  . ILE B 2 4   ? -6.371  -10.027 -6.057  1.00 0.00  ? 143 ILE B CG2  5  
ATOM   7389  C CD1  . ILE B 2 4   ? -8.847  -8.627  -5.949  1.00 0.00  ? 143 ILE B CD1  5  
ATOM   7390  H H    . ILE B 2 4   ? -7.890  -9.548  -9.798  1.00 0.00  ? 143 ILE B H    5  
ATOM   7391  H HA   . ILE B 2 4   ? -5.635  -8.690  -8.392  1.00 0.00  ? 143 ILE B HA   5  
ATOM   7392  H HB   . ILE B 2 4   ? -7.775  -10.643 -7.556  1.00 0.00  ? 143 ILE B HB   5  
ATOM   7393  H HG12 . ILE B 2 4   ? -7.361  -7.667  -7.168  1.00 0.00  ? 143 ILE B HG12 5  
ATOM   7394  H HG13 . ILE B 2 4   ? -8.653  -8.450  -8.079  1.00 0.00  ? 143 ILE B HG13 5  
ATOM   7395  H HG21 . ILE B 2 4   ? -5.680  -9.213  -5.899  1.00 0.00  ? 143 ILE B HG21 5  
ATOM   7396  H HG22 . ILE B 2 4   ? -7.063  -10.078 -5.230  1.00 0.00  ? 143 ILE B HG22 5  
ATOM   7397  H HG23 . ILE B 2 4   ? -5.823  -10.955 -6.124  1.00 0.00  ? 143 ILE B HG23 5  
ATOM   7398  H HD11 . ILE B 2 4   ? -9.000  -9.664  -5.692  1.00 0.00  ? 143 ILE B HD11 5  
ATOM   7399  H HD12 . ILE B 2 4   ? -8.334  -8.127  -5.141  1.00 0.00  ? 143 ILE B HD12 5  
ATOM   7400  H HD13 . ILE B 2 4   ? -9.803  -8.152  -6.117  1.00 0.00  ? 143 ILE B HD13 5  
ATOM   7401  N N    . GLN B 2 5   ? -5.609  -11.959 -8.844  1.00 0.00  ? 144 GLN B N    5  
ATOM   7402  C CA   . GLN B 2 5   ? -4.683  -13.125 -8.866  1.00 0.00  ? 144 GLN B CA   5  
ATOM   7403  C C    . GLN B 2 5   ? -3.394  -12.741 -9.598  1.00 0.00  ? 144 GLN B C    5  
ATOM   7404  O O    . GLN B 2 5   ? -2.305  -13.072 -9.173  1.00 0.00  ? 144 GLN B O    5  
ATOM   7405  C CB   . GLN B 2 5   ? -5.352  -14.295 -9.590  1.00 0.00  ? 144 GLN B CB   5  
ATOM   7406  C CG   . GLN B 2 5   ? -4.929  -15.611 -8.935  1.00 0.00  ? 144 GLN B CG   5  
ATOM   7407  C CD   . GLN B 2 5   ? -3.529  -15.995 -9.415  1.00 0.00  ? 144 GLN B CD   5  
ATOM   7408  O OE1  . GLN B 2 5   ? -2.542  -15.584 -8.837  1.00 0.00  ? 144 GLN B OE1  5  
ATOM   7409  N NE2  . GLN B 2 5   ? -3.398  -16.771 -10.456 1.00 0.00  ? 144 GLN B NE2  5  
ATOM   7410  H H    . GLN B 2 5   ? -6.554  -12.079 -9.074  1.00 0.00  ? 144 GLN B H    5  
ATOM   7411  H HA   . GLN B 2 5   ? -4.447  -13.417 -7.853  1.00 0.00  ? 144 GLN B HA   5  
ATOM   7412  H HB2  . GLN B 2 5   ? -6.426  -14.189 -9.528  1.00 0.00  ? 144 GLN B HB2  5  
ATOM   7413  H HB3  . GLN B 2 5   ? -5.049  -14.298 -10.626 1.00 0.00  ? 144 GLN B HB3  5  
ATOM   7414  H HG2  . GLN B 2 5   ? -4.923  -15.492 -7.861  1.00 0.00  ? 144 GLN B HG2  5  
ATOM   7415  H HG3  . GLN B 2 5   ? -5.626  -16.390 -9.207  1.00 0.00  ? 144 GLN B HG3  5  
ATOM   7416  H HE21 . GLN B 2 5   ? -4.195  -17.102 -10.922 1.00 0.00  ? 144 GLN B HE21 5  
ATOM   7417  H HE22 . GLN B 2 5   ? -2.506  -17.022 -10.772 1.00 0.00  ? 144 GLN B HE22 5  
ATOM   7418  N N    . ALA B 2 6   ? -3.509  -12.043 -10.694 1.00 42.36 ? 145 ALA B N    5  
ATOM   7419  C CA   . ALA B 2 6   ? -2.292  -11.636 -11.451 1.00 39.52 ? 145 ALA B CA   5  
ATOM   7420  C C    . ALA B 2 6   ? -2.255  -10.111 -11.567 1.00 36.36 ? 145 ALA B C    5  
ATOM   7421  O O    . ALA B 2 6   ? -2.126  -9.564  -12.644 1.00 36.34 ? 145 ALA B O    5  
ATOM   7422  C CB   . ALA B 2 6   ? -2.330  -12.254 -12.850 1.00 40.62 ? 145 ALA B CB   5  
ATOM   7423  H H    . ALA B 2 6   ? -4.397  -11.785 -11.019 1.00 0.00  ? 145 ALA B H    5  
ATOM   7424  H HA   . ALA B 2 6   ? -1.411  -11.979 -10.929 1.00 0.00  ? 145 ALA B HA   5  
ATOM   7425  H HB1  . ALA B 2 6   ? -3.349  -12.502 -13.107 1.00 0.00  ? 145 ALA B HB1  5  
ATOM   7426  H HB2  . ALA B 2 6   ? -1.939  -11.547 -13.567 1.00 0.00  ? 145 ALA B HB2  5  
ATOM   7427  H HB3  . ALA B 2 6   ? -1.727  -13.150 -12.864 1.00 0.00  ? 145 ALA B HB3  5  
ATOM   7428  N N    . GLU B 2 7   ? -2.371  -9.421  -10.465 1.00 32.22 ? 146 GLU B N    5  
ATOM   7429  C CA   . GLU B 2 7   ? -2.347  -7.933  -10.510 1.00 28.03 ? 146 GLU B CA   5  
ATOM   7430  C C    . GLU B 2 7   ? -0.899  -7.443  -10.574 1.00 24.38 ? 146 GLU B C    5  
ATOM   7431  O O    . GLU B 2 7   ? 0.009   -8.093  -10.095 1.00 22.48 ? 146 GLU B O    5  
ATOM   7432  C CB   . GLU B 2 7   ? -3.017  -7.377  -9.252  1.00 27.81 ? 146 GLU B CB   5  
ATOM   7433  C CG   . GLU B 2 7   ? -3.786  -6.101  -9.601  1.00 30.44 ? 146 GLU B CG   5  
ATOM   7434  C CD   . GLU B 2 7   ? -4.826  -6.409  -10.679 1.00 31.15 ? 146 GLU B CD   5  
ATOM   7435  O OE1  . GLU B 2 7   ? -5.748  -7.153  -10.391 1.00 30.91 ? 146 GLU B OE1  5  
ATOM   7436  O OE2  . GLU B 2 7   ? -4.683  -5.893  -11.776 1.00 34.56 ? 146 GLU B OE2  5  
ATOM   7437  H H    . GLU B 2 7   ? -2.476  -9.884  -9.609  1.00 0.00  ? 146 GLU B H    5  
ATOM   7438  H HA   . GLU B 2 7   ? -2.881  -7.589  -11.383 1.00 0.00  ? 146 GLU B HA   5  
ATOM   7439  H HB2  . GLU B 2 7   ? -3.700  -8.113  -8.854  1.00 0.00  ? 146 GLU B HB2  5  
ATOM   7440  H HB3  . GLU B 2 7   ? -2.263  -7.150  -8.513  1.00 0.00  ? 146 GLU B HB3  5  
ATOM   7441  H HG2  . GLU B 2 7   ? -4.283  -5.730  -8.716  1.00 0.00  ? 146 GLU B HG2  5  
ATOM   7442  H HG3  . GLU B 2 7   ? -3.098  -5.355  -9.968  1.00 0.00  ? 146 GLU B HG3  5  
ATOM   7443  N N    . GLU B 2 8   ? -0.677  -6.299  -11.161 1.00 21.92 ? 147 GLU B N    5  
ATOM   7444  C CA   . GLU B 2 8   ? 0.711   -5.765  -11.256 1.00 21.70 ? 147 GLU B CA   5  
ATOM   7445  C C    . GLU B 2 8   ? 1.234   -5.453  -9.853  1.00 19.46 ? 147 GLU B C    5  
ATOM   7446  O O    . GLU B 2 8   ? 2.422   -5.320  -9.637  1.00 19.28 ? 147 GLU B O    5  
ATOM   7447  C CB   . GLU B 2 8   ? 0.707   -4.486  -12.096 1.00 26.72 ? 147 GLU B CB   5  
ATOM   7448  C CG   . GLU B 2 8   ? 2.018   -4.383  -12.878 1.00 37.15 ? 147 GLU B CG   5  
ATOM   7449  C CD   . GLU B 2 8   ? 2.560   -2.955  -12.782 1.00 41.71 ? 147 GLU B CD   5  
ATOM   7450  O OE1  . GLU B 2 8   ? 1.886   -2.054  -13.251 1.00 46.00 ? 147 GLU B OE1  5  
ATOM   7451  O OE2  . GLU B 2 8   ? 3.640   -2.788  -12.239 1.00 45.02 ? 147 GLU B OE2  5  
ATOM   7452  H H    . GLU B 2 8   ? -1.423  -5.791  -11.541 1.00 0.00  ? 147 GLU B H    5  
ATOM   7453  H HA   . GLU B 2 8   ? 1.350   -6.501  -11.723 1.00 0.00  ? 147 GLU B HA   5  
ATOM   7454  H HB2  . GLU B 2 8   ? -0.124  -4.511  -12.786 1.00 0.00  ? 147 GLU B HB2  5  
ATOM   7455  H HB3  . GLU B 2 8   ? 0.610   -3.629  -11.446 1.00 0.00  ? 147 GLU B HB3  5  
ATOM   7456  H HG2  . GLU B 2 8   ? 2.740   -5.072  -12.463 1.00 0.00  ? 147 GLU B HG2  5  
ATOM   7457  H HG3  . GLU B 2 8   ? 1.839   -4.629  -13.914 1.00 0.00  ? 147 GLU B HG3  5  
ATOM   7458  N N    . TRP B 2 9   ? 0.354   -5.332  -8.895  1.00 17.10 ? 148 TRP B N    5  
ATOM   7459  C CA   . TRP B 2 9   ? 0.802   -5.027  -7.507  1.00 12.75 ? 148 TRP B CA   5  
ATOM   7460  C C    . TRP B 2 9   ? 0.253   -6.086  -6.547  1.00 12.19 ? 148 TRP B C    5  
ATOM   7461  O O    . TRP B 2 9   ? -0.085  -5.796  -5.416  1.00 11.66 ? 148 TRP B O    5  
ATOM   7462  C CB   . TRP B 2 9   ? 0.297   -3.641  -7.085  1.00 14.42 ? 148 TRP B CB   5  
ATOM   7463  C CG   . TRP B 2 9   ? -1.021  -3.355  -7.737  1.00 13.12 ? 148 TRP B CG   5  
ATOM   7464  C CD1  . TRP B 2 9   ? -1.184  -2.639  -8.875  1.00 13.11 ? 148 TRP B CD1  5  
ATOM   7465  C CD2  . TRP B 2 9   ? -2.355  -3.757  -7.311  1.00 12.81 ? 148 TRP B CD2  5  
ATOM   7466  N NE1  . TRP B 2 9   ? -2.533  -2.577  -9.176  1.00 12.63 ? 148 TRP B NE1  5  
ATOM   7467  C CE2  . TRP B 2 9   ? -3.297  -3.250  -8.243  1.00 13.14 ? 148 TRP B CE2  5  
ATOM   7468  C CE3  . TRP B 2 9   ? -2.836  -4.507  -6.217  1.00 10.52 ? 148 TRP B CE3  5  
ATOM   7469  C CZ2  . TRP B 2 9   ? -4.669  -3.479  -8.094  1.00 13.39 ? 148 TRP B CZ2  5  
ATOM   7470  C CZ3  . TRP B 2 9   ? -4.217  -4.740  -6.063  1.00 12.83 ? 148 TRP B CZ3  5  
ATOM   7471  C CH2  . TRP B 2 9   ? -5.131  -4.226  -7.000  1.00 12.53 ? 148 TRP B CH2  5  
ATOM   7472  H H    . TRP B 2 9   ? -0.600  -5.442  -9.090  1.00 0.00  ? 148 TRP B H    5  
ATOM   7473  H HA   . TRP B 2 9   ? 1.882   -5.040  -7.471  1.00 0.00  ? 148 TRP B HA   5  
ATOM   7474  H HB2  . TRP B 2 9   ? 0.177   -3.615  -6.013  1.00 0.00  ? 148 TRP B HB2  5  
ATOM   7475  H HB3  . TRP B 2 9   ? 1.015   -2.892  -7.385  1.00 0.00  ? 148 TRP B HB3  5  
ATOM   7476  H HD1  . TRP B 2 9   ? -0.391  -2.191  -9.454  1.00 0.00  ? 148 TRP B HD1  5  
ATOM   7477  H HE1  . TRP B 2 9   ? -2.919  -2.117  -9.950  1.00 0.00  ? 148 TRP B HE1  5  
ATOM   7478  H HE3  . TRP B 2 9   ? -2.141  -4.906  -5.494  1.00 0.00  ? 148 TRP B HE3  5  
ATOM   7479  H HZ2  . TRP B 2 9   ? -5.368  -3.082  -8.816  1.00 0.00  ? 148 TRP B HZ2  5  
ATOM   7480  H HZ3  . TRP B 2 9   ? -4.575  -5.315  -5.222  1.00 0.00  ? 148 TRP B HZ3  5  
ATOM   7481  H HH2  . TRP B 2 9   ? -6.188  -4.407  -6.878  1.00 0.00  ? 148 TRP B HH2  5  
ATOM   7482  N N    . TYR B 2 10  ? 0.163   -7.311  -6.989  1.00 11.66 ? 149 TYR B N    5  
ATOM   7483  C CA   . TYR B 2 10  ? -0.361  -8.387  -6.102  1.00 13.63 ? 149 TYR B CA   5  
ATOM   7484  C C    . TYR B 2 10  ? 0.737   -9.426  -5.861  1.00 14.73 ? 149 TYR B C    5  
ATOM   7485  O O    . TYR B 2 10  ? 1.043   -10.231 -6.718  1.00 16.34 ? 149 TYR B O    5  
ATOM   7486  C CB   . TYR B 2 10  ? -1.561  -9.060  -6.770  1.00 12.52 ? 149 TYR B CB   5  
ATOM   7487  C CG   . TYR B 2 10  ? -2.139  -10.099 -5.839  1.00 15.49 ? 149 TYR B CG   5  
ATOM   7488  C CD1  . TYR B 2 10  ? -2.457  -9.757  -4.514  1.00 14.45 ? 149 TYR B CD1  5  
ATOM   7489  C CD2  . TYR B 2 10  ? -2.358  -11.410 -6.297  1.00 19.03 ? 149 TYR B CD2  5  
ATOM   7490  C CE1  . TYR B 2 10  ? -2.995  -10.723 -3.648  1.00 15.99 ? 149 TYR B CE1  5  
ATOM   7491  C CE2  . TYR B 2 10  ? -2.894  -12.376 -5.431  1.00 20.41 ? 149 TYR B CE2  5  
ATOM   7492  C CZ   . TYR B 2 10  ? -3.213  -12.033 -4.105  1.00 21.15 ? 149 TYR B CZ   5  
ATOM   7493  O OH   . TYR B 2 10  ? -3.740  -12.983 -3.255  1.00 23.67 ? 149 TYR B OH   5  
ATOM   7494  H H    . TYR B 2 10  ? 0.444   -7.523  -7.904  1.00 0.00  ? 149 TYR B H    5  
ATOM   7495  H HA   . TYR B 2 10  ? -0.665  -7.960  -5.158  1.00 0.00  ? 149 TYR B HA   5  
ATOM   7496  H HB2  . TYR B 2 10  ? -2.313  -8.316  -6.991  1.00 0.00  ? 149 TYR B HB2  5  
ATOM   7497  H HB3  . TYR B 2 10  ? -1.245  -9.536  -7.687  1.00 0.00  ? 149 TYR B HB3  5  
ATOM   7498  H HD1  . TYR B 2 10  ? -2.290  -8.749  -4.161  1.00 0.00  ? 149 TYR B HD1  5  
ATOM   7499  H HD2  . TYR B 2 10  ? -2.113  -11.673 -7.315  1.00 0.00  ? 149 TYR B HD2  5  
ATOM   7500  H HE1  . TYR B 2 10  ? -3.239  -10.460 -2.630  1.00 0.00  ? 149 TYR B HE1  5  
ATOM   7501  H HE2  . TYR B 2 10  ? -3.063  -13.383 -5.782  1.00 0.00  ? 149 TYR B HE2  5  
ATOM   7502  H HH   . TYR B 2 10  ? -3.010  -13.424 -2.814  1.00 0.00  ? 149 TYR B HH   5  
ATOM   7503  N N    . PHE B 2 11  ? 1.336   -9.411  -4.702  1.00 14.41 ? 150 PHE B N    5  
ATOM   7504  C CA   . PHE B 2 11  ? 2.416   -10.394 -4.407  1.00 13.20 ? 150 PHE B CA   5  
ATOM   7505  C C    . PHE B 2 11  ? 1.813   -11.640 -3.754  1.00 12.95 ? 150 PHE B C    5  
ATOM   7506  O O    . PHE B 2 11  ? 2.204   -12.754 -4.041  1.00 12.44 ? 150 PHE B O    5  
ATOM   7507  C CB   . PHE B 2 11  ? 3.434   -9.762  -3.456  1.00 13.34 ? 150 PHE B CB   5  
ATOM   7508  C CG   . PHE B 2 11  ? 4.818   -9.879  -4.049  1.00 10.91 ? 150 PHE B CG   5  
ATOM   7509  C CD1  . PHE B 2 11  ? 5.031   -9.563  -5.402  1.00 10.09 ? 150 PHE B CD1  5  
ATOM   7510  C CD2  . PHE B 2 11  ? 5.892   -10.306 -3.250  1.00 10.43 ? 150 PHE B CD2  5  
ATOM   7511  C CE1  . PHE B 2 11  ? 6.319   -9.672  -5.954  1.00 7.94  ? 150 PHE B CE1  5  
ATOM   7512  C CE2  . PHE B 2 11  ? 7.179   -10.415 -3.802  1.00 9.38  ? 150 PHE B CE2  5  
ATOM   7513  C CZ   . PHE B 2 11  ? 7.392   -10.098 -5.154  1.00 8.81  ? 150 PHE B CZ   5  
ATOM   7514  H H    . PHE B 2 11  ? 1.077   -8.751  -4.025  1.00 0.00  ? 150 PHE B H    5  
ATOM   7515  H HA   . PHE B 2 11  ? 2.908   -10.673 -5.327  1.00 0.00  ? 150 PHE B HA   5  
ATOM   7516  H HB2  . PHE B 2 11  ? 3.191   -8.720  -3.310  1.00 0.00  ? 150 PHE B HB2  5  
ATOM   7517  H HB3  . PHE B 2 11  ? 3.407   -10.275 -2.506  1.00 0.00  ? 150 PHE B HB3  5  
ATOM   7518  H HD1  . PHE B 2 11  ? 4.206   -9.236  -6.016  1.00 0.00  ? 150 PHE B HD1  5  
ATOM   7519  H HD2  . PHE B 2 11  ? 5.727   -10.549 -2.210  1.00 0.00  ? 150 PHE B HD2  5  
ATOM   7520  H HE1  . PHE B 2 11  ? 6.482   -9.429  -6.993  1.00 0.00  ? 150 PHE B HE1  5  
ATOM   7521  H HE2  . PHE B 2 11  ? 8.004   -10.742 -3.188  1.00 0.00  ? 150 PHE B HE2  5  
ATOM   7522  H HZ   . PHE B 2 11  ? 8.382   -10.182 -5.579  1.00 0.00  ? 150 PHE B HZ   5  
ATOM   7523  N N    . GLY B 2 12  ? 0.864   -11.462 -2.876  1.00 14.57 ? 151 GLY B N    5  
ATOM   7524  C CA   . GLY B 2 12  ? 0.239   -12.639 -2.207  1.00 13.68 ? 151 GLY B CA   5  
ATOM   7525  C C    . GLY B 2 12  ? 0.383   -12.503 -0.690  1.00 15.95 ? 151 GLY B C    5  
ATOM   7526  O O    . GLY B 2 12  ? -0.295  -11.715 -0.061  1.00 16.08 ? 151 GLY B O    5  
ATOM   7527  H H    . GLY B 2 12  ? 0.561   -10.555 -2.658  1.00 0.00  ? 151 GLY B H    5  
ATOM   7528  H HA2  . GLY B 2 12  ? -0.808  -12.688 -2.468  1.00 0.00  ? 151 GLY B HA2  5  
ATOM   7529  H HA3  . GLY B 2 12  ? 0.734   -13.542 -2.531  1.00 0.00  ? 151 GLY B HA3  5  
ATOM   7530  N N    . LYS B 2 13  ? 1.259   -13.267 -0.096  1.00 14.92 ? 152 LYS B N    5  
ATOM   7531  C CA   . LYS B 2 13  ? 1.445   -13.181 1.381   1.00 16.57 ? 152 LYS B CA   5  
ATOM   7532  C C    . LYS B 2 13  ? 2.935   -13.283 1.715   1.00 15.79 ? 152 LYS B C    5  
ATOM   7533  O O    . LYS B 2 13  ? 3.609   -14.211 1.314   1.00 15.62 ? 152 LYS B O    5  
ATOM   7534  C CB   . LYS B 2 13  ? 0.690   -14.329 2.056   1.00 19.39 ? 152 LYS B CB   5  
ATOM   7535  C CG   . LYS B 2 13  ? 0.828   -14.206 3.576   1.00 26.20 ? 152 LYS B CG   5  
ATOM   7536  C CD   . LYS B 2 13  ? 2.027   -15.028 4.049   1.00 32.70 ? 152 LYS B CD   5  
ATOM   7537  C CE   . LYS B 2 13  ? 1.787   -15.503 5.483   1.00 38.73 ? 152 LYS B CE   5  
ATOM   7538  N NZ   . LYS B 2 13  ? 2.391   -16.854 5.668   1.00 43.61 ? 152 LYS B NZ   5  
ATOM   7539  H H    . LYS B 2 13  ? 1.795   -13.897 -0.622  1.00 0.00  ? 152 LYS B H    5  
ATOM   7540  H HA   . LYS B 2 13  ? 1.059   -12.238 1.738   1.00 0.00  ? 152 LYS B HA   5  
ATOM   7541  H HB2  . LYS B 2 13  ? -0.354  -14.284 1.783   1.00 0.00  ? 152 LYS B HB2  5  
ATOM   7542  H HB3  . LYS B 2 13  ? 1.107   -15.272 1.734   1.00 0.00  ? 152 LYS B HB3  5  
ATOM   7543  H HG2  . LYS B 2 13  ? 0.974   -13.169 3.840   1.00 0.00  ? 152 LYS B HG2  5  
ATOM   7544  H HG3  . LYS B 2 13  ? -0.070  -14.575 4.049   1.00 0.00  ? 152 LYS B HG3  5  
ATOM   7545  H HD2  . LYS B 2 13  ? 2.153   -15.885 3.402   1.00 0.00  ? 152 LYS B HD2  5  
ATOM   7546  H HD3  . LYS B 2 13  ? 2.917   -14.419 4.018   1.00 0.00  ? 152 LYS B HD3  5  
ATOM   7547  H HE2  . LYS B 2 13  ? 2.243   -14.808 6.174   1.00 0.00  ? 152 LYS B HE2  5  
ATOM   7548  H HE3  . LYS B 2 13  ? 0.726   -15.554 5.673   1.00 0.00  ? 152 LYS B HE3  5  
ATOM   7549  H HZ1  . LYS B 2 13  ? 2.207   -17.434 4.825   1.00 0.00  ? 152 LYS B HZ1  5  
ATOM   7550  H HZ2  . LYS B 2 13  ? 3.417   -16.759 5.803   1.00 0.00  ? 152 LYS B HZ2  5  
ATOM   7551  H HZ3  . LYS B 2 13  ? 1.971   -17.310 6.502   1.00 0.00  ? 152 LYS B HZ3  5  
ATOM   7552  N N    . ILE B 2 14  ? 3.454   -12.335 2.447   1.00 16.90 ? 153 ILE B N    5  
ATOM   7553  C CA   . ILE B 2 14  ? 4.899   -12.377 2.809   1.00 16.60 ? 153 ILE B CA   5  
ATOM   7554  C C    . ILE B 2 14  ? 5.063   -12.044 4.293   1.00 17.59 ? 153 ILE B C    5  
ATOM   7555  O O    . ILE B 2 14  ? 4.183   -11.482 4.913   1.00 21.20 ? 153 ILE B O    5  
ATOM   7556  C CB   . ILE B 2 14  ? 5.665   -11.354 1.968   1.00 15.36 ? 153 ILE B CB   5  
ATOM   7557  C CG1  . ILE B 2 14  ? 5.049   -9.967  2.172   1.00 14.56 ? 153 ILE B CG1  5  
ATOM   7558  C CG2  . ILE B 2 14  ? 5.578   -11.737 0.490   1.00 15.80 ? 153 ILE B CG2  5  
ATOM   7559  C CD1  . ILE B 2 14  ? 6.045   -8.895  1.725   1.00 13.00 ? 153 ILE B CD1  5  
ATOM   7560  H H    . ILE B 2 14  ? 2.891   -11.596 2.762   1.00 0.00  ? 153 ILE B H    5  
ATOM   7561  H HA   . ILE B 2 14  ? 5.289   -13.366 2.617   1.00 0.00  ? 153 ILE B HA   5  
ATOM   7562  H HB   . ILE B 2 14  ? 6.700   -11.338 2.277   1.00 0.00  ? 153 ILE B HB   5  
ATOM   7563  H HG12 . ILE B 2 14  ? 4.144   -9.886  1.586   1.00 0.00  ? 153 ILE B HG12 5  
ATOM   7564  H HG13 . ILE B 2 14  ? 4.816   -9.825  3.217   1.00 0.00  ? 153 ILE B HG13 5  
ATOM   7565  H HG21 . ILE B 2 14  ? 5.903   -12.760 0.364   1.00 0.00  ? 153 ILE B HG21 5  
ATOM   7566  H HG22 . ILE B 2 14  ? 4.557   -11.640 0.152   1.00 0.00  ? 153 ILE B HG22 5  
ATOM   7567  H HG23 . ILE B 2 14  ? 6.213   -11.083 -0.089  1.00 0.00  ? 153 ILE B HG23 5  
ATOM   7568  H HD11 . ILE B 2 14  ? 6.510   -9.199  0.799   1.00 0.00  ? 153 ILE B HD11 5  
ATOM   7569  H HD12 . ILE B 2 14  ? 5.524   -7.961  1.577   1.00 0.00  ? 153 ILE B HD12 5  
ATOM   7570  H HD13 . ILE B 2 14  ? 6.802   -8.769  2.484   1.00 0.00  ? 153 ILE B HD13 5  
ATOM   7571  N N    . THR B 2 15  ? 6.184   -12.386 4.868   1.00 16.79 ? 154 THR B N    5  
ATOM   7572  C CA   . THR B 2 15  ? 6.402   -12.089 6.311   1.00 16.02 ? 154 THR B CA   5  
ATOM   7573  C C    . THR B 2 15  ? 6.585   -10.580 6.500   1.00 15.06 ? 154 THR B C    5  
ATOM   7574  O O    . THR B 2 15  ? 6.460   -9.809  5.570   1.00 14.17 ? 154 THR B O    5  
ATOM   7575  C CB   . THR B 2 15  ? 7.654   -12.820 6.801   1.00 18.43 ? 154 THR B CB   5  
ATOM   7576  O OG1  . THR B 2 15  ? 8.808   -12.194 6.260   1.00 22.52 ? 154 THR B OG1  5  
ATOM   7577  C CG2  . THR B 2 15  ? 7.603   -14.281 6.349   1.00 19.67 ? 154 THR B CG2  5  
ATOM   7578  H H    . THR B 2 15  ? 6.881   -12.840 4.351   1.00 0.00  ? 154 THR B H    5  
ATOM   7579  H HA   . THR B 2 15  ? 5.546   -12.420 6.881   1.00 0.00  ? 154 THR B HA   5  
ATOM   7580  H HB   . THR B 2 15  ? 7.695   -12.784 7.878   1.00 0.00  ? 154 THR B HB   5  
ATOM   7581  H HG1  . THR B 2 15  ? 9.496   -12.209 6.930   1.00 0.00  ? 154 THR B HG1  5  
ATOM   7582  H HG21 . THR B 2 15  ? 6.713   -14.445 5.760   1.00 0.00  ? 154 THR B HG21 5  
ATOM   7583  H HG22 . THR B 2 15  ? 8.475   -14.504 5.753   1.00 0.00  ? 154 THR B HG22 5  
ATOM   7584  H HG23 . THR B 2 15  ? 7.585   -14.926 7.215   1.00 0.00  ? 154 THR B HG23 5  
ATOM   7585  N N    . ARG B 2 16  ? 6.881   -10.154 7.698   1.00 15.92 ? 155 ARG B N    5  
ATOM   7586  C CA   . ARG B 2 16  ? 7.071   -8.698  7.945   1.00 14.63 ? 155 ARG B CA   5  
ATOM   7587  C C    . ARG B 2 16  ? 8.471   -8.280  7.492   1.00 15.69 ? 155 ARG B C    5  
ATOM   7588  O O    . ARG B 2 16  ? 8.648   -7.273  6.834   1.00 13.45 ? 155 ARG B O    5  
ATOM   7589  C CB   . ARG B 2 16  ? 6.913   -8.410  9.440   1.00 13.07 ? 155 ARG B CB   5  
ATOM   7590  C CG   . ARG B 2 16  ? 6.768   -6.902  9.659   1.00 14.81 ? 155 ARG B CG   5  
ATOM   7591  C CD   . ARG B 2 16  ? 5.930   -6.647  10.913  1.00 13.27 ? 155 ARG B CD   5  
ATOM   7592  N NE   . ARG B 2 16  ? 6.417   -7.514  12.022  1.00 16.05 ? 155 ARG B NE   5  
ATOM   7593  C CZ   . ARG B 2 16  ? 6.062   -7.260  13.252  1.00 8.86  ? 155 ARG B CZ   5  
ATOM   7594  N NH1  . ARG B 2 16  ? 6.372   -6.117  13.799  1.00 12.78 ? 155 ARG B NH1  5  
ATOM   7595  N NH2  . ARG B 2 16  ? 5.394   -8.150  13.935  1.00 8.73  ? 155 ARG B NH2  5  
ATOM   7596  H H    . ARG B 2 16  ? 6.977   -10.794 8.435   1.00 0.00  ? 155 ARG B H    5  
ATOM   7597  H HA   . ARG B 2 16  ? 6.331   -8.139  7.391   1.00 0.00  ? 155 ARG B HA   5  
ATOM   7598  H HB2  . ARG B 2 16  ? 6.033   -8.915  9.812   1.00 0.00  ? 155 ARG B HB2  5  
ATOM   7599  H HB3  . ARG B 2 16  ? 7.784   -8.767  9.969   1.00 0.00  ? 155 ARG B HB3  5  
ATOM   7600  H HG2  . ARG B 2 16  ? 7.746   -6.462  9.782   1.00 0.00  ? 155 ARG B HG2  5  
ATOM   7601  H HG3  . ARG B 2 16  ? 6.278   -6.460  8.805   1.00 0.00  ? 155 ARG B HG3  5  
ATOM   7602  H HD2  . ARG B 2 16  ? 6.021   -5.610  11.200  1.00 0.00  ? 155 ARG B HD2  5  
ATOM   7603  H HD3  . ARG B 2 16  ? 4.894   -6.873  10.706  1.00 0.00  ? 155 ARG B HD3  5  
ATOM   7604  H HE   . ARG B 2 16  ? 7.004   -8.274  11.829  1.00 0.00  ? 155 ARG B HE   5  
ATOM   7605  H HH11 . ARG B 2 16  ? 6.883   -5.435  13.275  1.00 0.00  ? 155 ARG B HH11 5  
ATOM   7606  H HH12 . ARG B 2 16  ? 6.100   -5.922  14.741  1.00 0.00  ? 155 ARG B HH12 5  
ATOM   7607  H HH21 . ARG B 2 16  ? 5.156   -9.027  13.517  1.00 0.00  ? 155 ARG B HH21 5  
ATOM   7608  H HH22 . ARG B 2 16  ? 5.122   -7.956  14.878  1.00 0.00  ? 155 ARG B HH22 5  
ATOM   7609  N N    . ARG B 2 17  ? 9.470   -9.046  7.837   1.00 16.92 ? 156 ARG B N    5  
ATOM   7610  C CA   . ARG B 2 17  ? 10.859  -8.693  7.427   1.00 18.61 ? 156 ARG B CA   5  
ATOM   7611  C C    . ARG B 2 17  ? 10.935  -8.606  5.901   1.00 17.01 ? 156 ARG B C    5  
ATOM   7612  O O    . ARG B 2 17  ? 11.540  -7.707  5.350   1.00 17.04 ? 156 ARG B O    5  
ATOM   7613  C CB   . ARG B 2 17  ? 11.826  -9.769  7.923   1.00 24.11 ? 156 ARG B CB   5  
ATOM   7614  C CG   . ARG B 2 17  ? 13.051  -9.105  8.552   1.00 33.87 ? 156 ARG B CG   5  
ATOM   7615  C CD   . ARG B 2 17  ? 13.913  -8.478  7.453   1.00 41.26 ? 156 ARG B CD   5  
ATOM   7616  N NE   . ARG B 2 17  ? 15.352  -8.611  7.815   1.00 49.98 ? 156 ARG B NE   5  
ATOM   7617  C CZ   . ARG B 2 17  ? 15.856  -7.875  8.768   1.00 51.87 ? 156 ARG B CZ   5  
ATOM   7618  N NH1  . ARG B 2 17  ? 16.333  -6.692  8.495   1.00 52.15 ? 156 ARG B NH1  5  
ATOM   7619  N NH2  . ARG B 2 17  ? 15.883  -8.324  9.993   1.00 53.57 ? 156 ARG B NH2  5  
ATOM   7620  H H    . ARG B 2 17  ? 9.307   -9.854  8.367   1.00 0.00  ? 156 ARG B H    5  
ATOM   7621  H HA   . ARG B 2 17  ? 11.129  -7.739  7.856   1.00 0.00  ? 156 ARG B HA   5  
ATOM   7622  H HB2  . ARG B 2 17  ? 11.331  -10.384 8.662   1.00 0.00  ? 156 ARG B HB2  5  
ATOM   7623  H HB3  . ARG B 2 17  ? 12.138  -10.384 7.094   1.00 0.00  ? 156 ARG B HB3  5  
ATOM   7624  H HG2  . ARG B 2 17  ? 12.731  -8.336  9.241   1.00 0.00  ? 156 ARG B HG2  5  
ATOM   7625  H HG3  . ARG B 2 17  ? 13.631  -9.845  9.082   1.00 0.00  ? 156 ARG B HG3  5  
ATOM   7626  H HD2  . ARG B 2 17  ? 13.729  -8.986  6.518   1.00 0.00  ? 156 ARG B HD2  5  
ATOM   7627  H HD3  . ARG B 2 17  ? 13.662  -7.433  7.351   1.00 0.00  ? 156 ARG B HD3  5  
ATOM   7628  H HE   . ARG B 2 17  ? 15.920  -9.250  7.337   1.00 0.00  ? 156 ARG B HE   5  
ATOM   7629  H HH11 . ARG B 2 17  ? 16.312  -6.349  7.556   1.00 0.00  ? 156 ARG B HH11 5  
ATOM   7630  H HH12 . ARG B 2 17  ? 16.719  -6.129  9.226   1.00 0.00  ? 156 ARG B HH12 5  
ATOM   7631  H HH21 . ARG B 2 17  ? 15.518  -9.231  10.201  1.00 0.00  ? 156 ARG B HH21 5  
ATOM   7632  H HH22 . ARG B 2 17  ? 16.270  -7.760  10.723  1.00 0.00  ? 156 ARG B HH22 5  
ATOM   7633  N N    . GLU B 2 18  ? 10.330  -9.535  5.213   1.00 15.73 ? 157 GLU B N    5  
ATOM   7634  C CA   . GLU B 2 18  ? 10.372  -9.508  3.723   1.00 15.26 ? 157 GLU B CA   5  
ATOM   7635  C C    . GLU B 2 18  ? 9.718   -8.221  3.214   1.00 14.10 ? 157 GLU B C    5  
ATOM   7636  O O    . GLU B 2 18  ? 10.138  -7.649  2.228   1.00 15.48 ? 157 GLU B O    5  
ATOM   7637  C CB   . GLU B 2 18  ? 9.613   -10.717 3.171   1.00 19.30 ? 157 GLU B CB   5  
ATOM   7638  C CG   . GLU B 2 18  ? 10.578  -11.615 2.394   1.00 28.11 ? 157 GLU B CG   5  
ATOM   7639  C CD   . GLU B 2 18  ? 9.802   -12.412 1.344   1.00 29.65 ? 157 GLU B CD   5  
ATOM   7640  O OE1  . GLU B 2 18  ? 8.898   -13.136 1.728   1.00 28.63 ? 157 GLU B OE1  5  
ATOM   7641  O OE2  . GLU B 2 18  ? 10.124  -12.284 0.175   1.00 31.13 ? 157 GLU B OE2  5  
ATOM   7642  H H    . GLU B 2 18  ? 9.850   -10.254 5.676   1.00 0.00  ? 157 GLU B H    5  
ATOM   7643  H HA   . GLU B 2 18  ? 11.399  -9.546  3.391   1.00 0.00  ? 157 GLU B HA   5  
ATOM   7644  H HB2  . GLU B 2 18  ? 9.180   -11.275 3.990   1.00 0.00  ? 157 GLU B HB2  5  
ATOM   7645  H HB3  . GLU B 2 18  ? 8.829   -10.378 2.511   1.00 0.00  ? 157 GLU B HB3  5  
ATOM   7646  H HG2  . GLU B 2 18  ? 11.323  -11.004 1.906   1.00 0.00  ? 157 GLU B HG2  5  
ATOM   7647  H HG3  . GLU B 2 18  ? 11.061  -12.297 3.077   1.00 0.00  ? 157 GLU B HG3  5  
ATOM   7648  N N    . SER B 2 19  ? 8.693   -7.762  3.878   1.00 11.43 ? 158 SER B N    5  
ATOM   7649  C CA   . SER B 2 19  ? 8.013   -6.514  3.430   1.00 9.58  ? 158 SER B CA   5  
ATOM   7650  C C    . SER B 2 19  ? 9.004   -5.349  3.475   1.00 10.15 ? 158 SER B C    5  
ATOM   7651  O O    . SER B 2 19  ? 9.266   -4.705  2.479   1.00 12.31 ? 158 SER B O    5  
ATOM   7652  C CB   . SER B 2 19  ? 6.833   -6.217  4.354   1.00 8.90  ? 158 SER B CB   5  
ATOM   7653  O OG   . SER B 2 19  ? 6.449   -4.857  4.204   1.00 11.55 ? 158 SER B OG   5  
ATOM   7654  H H    . SER B 2 19  ? 8.369   -8.239  4.670   1.00 0.00  ? 158 SER B H    5  
ATOM   7655  H HA   . SER B 2 19  ? 7.656   -6.643  2.419   1.00 0.00  ? 158 SER B HA   5  
ATOM   7656  H HB2  . SER B 2 19  ? 6.001   -6.851  4.095   1.00 0.00  ? 158 SER B HB2  5  
ATOM   7657  H HB3  . SER B 2 19  ? 7.123   -6.408  5.380   1.00 0.00  ? 158 SER B HB3  5  
ATOM   7658  H HG   . SER B 2 19  ? 5.701   -4.693  4.783   1.00 0.00  ? 158 SER B HG   5  
ATOM   7659  N N    . GLU B 2 20  ? 9.556   -5.071  4.625   1.00 11.35 ? 159 GLU B N    5  
ATOM   7660  C CA   . GLU B 2 20  ? 10.528  -3.949  4.732   1.00 12.85 ? 159 GLU B CA   5  
ATOM   7661  C C    . GLU B 2 20  ? 11.770  -4.267  3.898   1.00 15.16 ? 159 GLU B C    5  
ATOM   7662  O O    . GLU B 2 20  ? 12.558  -3.398  3.583   1.00 13.16 ? 159 GLU B O    5  
ATOM   7663  C CB   . GLU B 2 20  ? 10.930  -3.766  6.196   1.00 13.71 ? 159 GLU B CB   5  
ATOM   7664  C CG   . GLU B 2 20  ? 9.955   -2.805  6.879   1.00 16.00 ? 159 GLU B CG   5  
ATOM   7665  C CD   . GLU B 2 20  ? 10.549  -2.330  8.205   1.00 19.40 ? 159 GLU B CD   5  
ATOM   7666  O OE1  . GLU B 2 20  ? 11.730  -2.022  8.226   1.00 21.73 ? 159 GLU B OE1  5  
ATOM   7667  O OE2  . GLU B 2 20  ? 9.815   -2.281  9.178   1.00 26.69 ? 159 GLU B OE2  5  
ATOM   7668  H H    . GLU B 2 20  ? 9.332   -5.601  5.418   1.00 0.00  ? 159 GLU B H    5  
ATOM   7669  H HA   . GLU B 2 20  ? 10.071  -3.040  4.369   1.00 0.00  ? 159 GLU B HA   5  
ATOM   7670  H HB2  . GLU B 2 20  ? 10.904  -4.723  6.698   1.00 0.00  ? 159 GLU B HB2  5  
ATOM   7671  H HB3  . GLU B 2 20  ? 11.928  -3.361  6.248   1.00 0.00  ? 159 GLU B HB3  5  
ATOM   7672  H HG2  . GLU B 2 20  ? 9.780   -1.954  6.236   1.00 0.00  ? 159 GLU B HG2  5  
ATOM   7673  H HG3  . GLU B 2 20  ? 9.021   -3.313  7.067   1.00 0.00  ? 159 GLU B HG3  5  
ATOM   7674  N N    . ARG B 2 21  ? 11.950  -5.508  3.537   1.00 15.73 ? 160 ARG B N    5  
ATOM   7675  C CA   . ARG B 2 21  ? 13.141  -5.882  2.722   1.00 17.77 ? 160 ARG B CA   5  
ATOM   7676  C C    . ARG B 2 21  ? 12.836  -5.665  1.239   1.00 17.96 ? 160 ARG B C    5  
ATOM   7677  O O    . ARG B 2 21  ? 13.728  -5.531  0.426   1.00 17.67 ? 160 ARG B O    5  
ATOM   7678  C CB   . ARG B 2 21  ? 13.478  -7.353  2.960   1.00 21.81 ? 160 ARG B CB   5  
ATOM   7679  C CG   . ARG B 2 21  ? 14.979  -7.569  2.777   1.00 30.59 ? 160 ARG B CG   5  
ATOM   7680  C CD   . ARG B 2 21  ? 15.257  -7.972  1.330   1.00 37.74 ? 160 ARG B CD   5  
ATOM   7681  N NE   . ARG B 2 21  ? 15.427  -9.449  1.251   1.00 43.93 ? 160 ARG B NE   5  
ATOM   7682  C CZ   . ARG B 2 21  ? 15.728  -10.011 0.112   1.00 48.64 ? 160 ARG B CZ   5  
ATOM   7683  N NH1  . ARG B 2 21  ? 16.511  -9.396  -0.732  1.00 51.68 ? 160 ARG B NH1  5  
ATOM   7684  N NH2  . ARG B 2 21  ? 15.246  -11.186 -0.184  1.00 50.79 ? 160 ARG B NH2  5  
ATOM   7685  H H    . ARG B 2 21  ? 11.303  -6.194  3.802   1.00 0.00  ? 160 ARG B H    5  
ATOM   7686  H HA   . ARG B 2 21  ? 13.981  -5.273  3.010   1.00 0.00  ? 160 ARG B HA   5  
ATOM   7687  H HB2  . ARG B 2 21  ? 13.193  -7.632  3.961   1.00 0.00  ? 160 ARG B HB2  5  
ATOM   7688  H HB3  . ARG B 2 21  ? 12.941  -7.959  2.250   1.00 0.00  ? 160 ARG B HB3  5  
ATOM   7689  H HG2  . ARG B 2 21  ? 15.505  -6.654  3.006   1.00 0.00  ? 160 ARG B HG2  5  
ATOM   7690  H HG3  . ARG B 2 21  ? 15.314  -8.354  3.438   1.00 0.00  ? 160 ARG B HG3  5  
ATOM   7691  H HD2  . ARG B 2 21  ? 14.425  -7.671  0.709   1.00 0.00  ? 160 ARG B HD2  5  
ATOM   7692  H HD3  . ARG B 2 21  ? 16.158  -7.485  0.989   1.00 0.00  ? 160 ARG B HD3  5  
ATOM   7693  H HE   . ARG B 2 21  ? 15.312  -10.000 2.053   1.00 0.00  ? 160 ARG B HE   5  
ATOM   7694  H HH11 . ARG B 2 21  ? 16.881  -8.494  -0.505  1.00 0.00  ? 160 ARG B HH11 5  
ATOM   7695  H HH12 . ARG B 2 21  ? 16.742  -9.825  -1.605  1.00 0.00  ? 160 ARG B HH12 5  
ATOM   7696  H HH21 . ARG B 2 21  ? 14.645  -11.657 0.462   1.00 0.00  ? 160 ARG B HH21 5  
ATOM   7697  H HH22 . ARG B 2 21  ? 15.476  -11.616 -1.058  1.00 0.00  ? 160 ARG B HH22 5  
ATOM   7698  N N    . LEU B 2 22  ? 11.582  -5.633  0.881   1.00 16.19 ? 161 LEU B N    5  
ATOM   7699  C CA   . LEU B 2 22  ? 11.221  -5.428  -0.551  1.00 12.63 ? 161 LEU B CA   5  
ATOM   7700  C C    . LEU B 2 22  ? 11.192  -3.931  -0.864  1.00 13.41 ? 161 LEU B C    5  
ATOM   7701  O O    . LEU B 2 22  ? 11.558  -3.506  -1.943  1.00 14.12 ? 161 LEU B O    5  
ATOM   7702  C CB   . LEU B 2 22  ? 9.838   -6.028  -0.815  1.00 10.23 ? 161 LEU B CB   5  
ATOM   7703  C CG   . LEU B 2 22  ? 9.976   -7.518  -1.124  1.00 11.74 ? 161 LEU B CG   5  
ATOM   7704  C CD1  . LEU B 2 22  ? 8.599   -8.103  -1.443  1.00 10.85 ? 161 LEU B CD1  5  
ATOM   7705  C CD2  . LEU B 2 22  ? 10.899  -7.704  -2.331  1.00 15.84 ? 161 LEU B CD2  5  
ATOM   7706  H H    . LEU B 2 22  ? 10.878  -5.746  1.552   1.00 0.00  ? 161 LEU B H    5  
ATOM   7707  H HA   . LEU B 2 22  ? 11.950  -5.915  -1.180  1.00 0.00  ? 161 LEU B HA   5  
ATOM   7708  H HB2  . LEU B 2 22  ? 9.217   -5.897  0.060   1.00 0.00  ? 161 LEU B HB2  5  
ATOM   7709  H HB3  . LEU B 2 22  ? 9.384   -5.527  -1.657  1.00 0.00  ? 161 LEU B HB3  5  
ATOM   7710  H HG   . LEU B 2 22  ? 10.394  -8.026  -0.267  1.00 0.00  ? 161 LEU B HG   5  
ATOM   7711  H HD11 . LEU B 2 22  ? 7.855   -7.634  -0.817  1.00 0.00  ? 161 LEU B HD11 5  
ATOM   7712  H HD12 . LEU B 2 22  ? 8.362   -7.922  -2.481  1.00 0.00  ? 161 LEU B HD12 5  
ATOM   7713  H HD13 . LEU B 2 22  ? 8.609   -9.167  -1.256  1.00 0.00  ? 161 LEU B HD13 5  
ATOM   7714  H HD21 . LEU B 2 22  ? 10.937  -6.787  -2.901  1.00 0.00  ? 161 LEU B HD21 5  
ATOM   7715  H HD22 . LEU B 2 22  ? 11.892  -7.957  -1.989  1.00 0.00  ? 161 LEU B HD22 5  
ATOM   7716  H HD23 . LEU B 2 22  ? 10.522  -8.500  -2.954  1.00 0.00  ? 161 LEU B HD23 5  
ATOM   7717  N N    . LEU B 2 23  ? 10.755  -3.129  0.066   1.00 12.10 ? 162 LEU B N    5  
ATOM   7718  C CA   . LEU B 2 23  ? 10.698  -1.662  -0.183  1.00 13.70 ? 162 LEU B CA   5  
ATOM   7719  C C    . LEU B 2 23  ? 12.027  -1.017  0.217   1.00 15.43 ? 162 LEU B C    5  
ATOM   7720  O O    . LEU B 2 23  ? 12.521  -0.130  -0.450  1.00 15.50 ? 162 LEU B O    5  
ATOM   7721  C CB   . LEU B 2 23  ? 9.564   -1.053  0.646   1.00 13.91 ? 162 LEU B CB   5  
ATOM   7722  C CG   . LEU B 2 23  ? 8.223   -1.599  0.154   1.00 12.97 ? 162 LEU B CG   5  
ATOM   7723  C CD1  . LEU B 2 23  ? 7.231   -1.648  1.317   1.00 9.03  ? 162 LEU B CD1  5  
ATOM   7724  C CD2  . LEU B 2 23  ? 7.673   -0.685  -0.944  1.00 11.59 ? 162 LEU B CD2  5  
ATOM   7725  H H    . LEU B 2 23  ? 10.461  -3.492  0.928   1.00 0.00  ? 162 LEU B H    5  
ATOM   7726  H HA   . LEU B 2 23  ? 10.511  -1.481  -1.231  1.00 0.00  ? 162 LEU B HA   5  
ATOM   7727  H HB2  . LEU B 2 23  ? 9.699   -1.312  1.687   1.00 0.00  ? 162 LEU B HB2  5  
ATOM   7728  H HB3  . LEU B 2 23  ? 9.574   0.022   0.537   1.00 0.00  ? 162 LEU B HB3  5  
ATOM   7729  H HG   . LEU B 2 23  ? 8.364   -2.596  -0.242  1.00 0.00  ? 162 LEU B HG   5  
ATOM   7730  H HD11 . LEU B 2 23  ? 7.762   -1.857  2.234   1.00 0.00  ? 162 LEU B HD11 5  
ATOM   7731  H HD12 . LEU B 2 23  ? 6.727   -0.697  1.401   1.00 0.00  ? 162 LEU B HD12 5  
ATOM   7732  H HD13 . LEU B 2 23  ? 6.503   -2.426  1.137   1.00 0.00  ? 162 LEU B HD13 5  
ATOM   7733  H HD21 . LEU B 2 23  ? 7.737   0.343   -0.622  1.00 0.00  ? 162 LEU B HD21 5  
ATOM   7734  H HD22 . LEU B 2 23  ? 8.254   -0.816  -1.845  1.00 0.00  ? 162 LEU B HD22 5  
ATOM   7735  H HD23 . LEU B 2 23  ? 6.642   -0.939  -1.140  1.00 0.00  ? 162 LEU B HD23 5  
ATOM   7736  N N    . LEU B 2 24  ? 12.607  -1.449  1.303   1.00 17.97 ? 163 LEU B N    5  
ATOM   7737  C CA   . LEU B 2 24  ? 13.897  -0.856  1.744   1.00 23.68 ? 163 LEU B CA   5  
ATOM   7738  C C    . LEU B 2 24  ? 15.062  -1.692  1.211   1.00 29.76 ? 163 LEU B C    5  
ATOM   7739  O O    . LEU B 2 24  ? 15.674  -2.452  1.934   1.00 34.43 ? 163 LEU B O    5  
ATOM   7740  C CB   . LEU B 2 24  ? 13.944  -0.841  3.272   1.00 20.30 ? 163 LEU B CB   5  
ATOM   7741  C CG   . LEU B 2 24  ? 12.657  -0.221  3.817   1.00 19.42 ? 163 LEU B CG   5  
ATOM   7742  C CD1  . LEU B 2 24  ? 12.433  -0.689  5.256   1.00 19.86 ? 163 LEU B CD1  5  
ATOM   7743  C CD2  . LEU B 2 24  ? 12.778  1.304   3.791   1.00 19.28 ? 163 LEU B CD2  5  
ATOM   7744  H H    . LEU B 2 24  ? 12.192  -2.160  1.832   1.00 0.00  ? 163 LEU B H    5  
ATOM   7745  H HA   . LEU B 2 24  ? 13.976  0.154   1.372   1.00 0.00  ? 163 LEU B HA   5  
ATOM   7746  H HB2  . LEU B 2 24  ? 14.040  -1.854  3.639   1.00 0.00  ? 163 LEU B HB2  5  
ATOM   7747  H HB3  . LEU B 2 24  ? 14.788  -0.259  3.599   1.00 0.00  ? 163 LEU B HB3  5  
ATOM   7748  H HG   . LEU B 2 24  ? 11.822  -0.528  3.205   1.00 0.00  ? 163 LEU B HG   5  
ATOM   7749  H HD11 . LEU B 2 24  ? 13.369  -0.659  5.794   1.00 0.00  ? 163 LEU B HD11 5  
ATOM   7750  H HD12 . LEU B 2 24  ? 11.720  -0.038  5.739   1.00 0.00  ? 163 LEU B HD12 5  
ATOM   7751  H HD13 . LEU B 2 24  ? 12.052  -1.699  5.251   1.00 0.00  ? 163 LEU B HD13 5  
ATOM   7752  H HD21 . LEU B 2 24  ? 13.811  1.581   3.630   1.00 0.00  ? 163 LEU B HD21 5  
ATOM   7753  H HD22 . LEU B 2 24  ? 12.171  1.700   2.990   1.00 0.00  ? 163 LEU B HD22 5  
ATOM   7754  H HD23 . LEU B 2 24  ? 12.440  1.709   4.733   1.00 0.00  ? 163 LEU B HD23 5  
ATOM   7755  N N    . ASN B 2 25  ? 15.384  -1.554  -0.048  1.00 33.44 ? 164 ASN B N    5  
ATOM   7756  C CA   . ASN B 2 25  ? 16.518  -2.341  -0.611  1.00 37.75 ? 164 ASN B CA   5  
ATOM   7757  C C    . ASN B 2 25  ? 17.557  -1.386  -1.189  1.00 40.49 ? 164 ASN B C    5  
ATOM   7758  O O    . ASN B 2 25  ? 18.203  -1.674  -2.178  1.00 41.14 ? 164 ASN B O    5  
ATOM   7759  C CB   . ASN B 2 25  ? 16.007  -3.276  -1.708  1.00 39.08 ? 164 ASN B CB   5  
ATOM   7760  C CG   . ASN B 2 25  ? 16.751  -4.610  -1.629  1.00 42.87 ? 164 ASN B CG   5  
ATOM   7761  O OD1  . ASN B 2 25  ? 17.571  -4.913  -2.473  1.00 47.61 ? 164 ASN B OD1  5  
ATOM   7762  N ND2  . ASN B 2 25  ? 16.499  -5.426  -0.642  1.00 46.52 ? 164 ASN B ND2  5  
ATOM   7763  H H    . ASN B 2 25  ? 14.885  -0.932  -0.618  1.00 0.00  ? 164 ASN B H    5  
ATOM   7764  H HA   . ASN B 2 25  ? 16.972  -2.917  0.176   1.00 0.00  ? 164 ASN B HA   5  
ATOM   7765  H HB2  . ASN B 2 25  ? 14.948  -3.444  -1.574  1.00 0.00  ? 164 ASN B HB2  5  
ATOM   7766  H HB3  . ASN B 2 25  ? 16.181  -2.826  -2.675  1.00 0.00  ? 164 ASN B HB3  5  
ATOM   7767  H HD21 . ASN B 2 25  ? 15.836  -5.179  0.041   1.00 0.00  ? 164 ASN B HD21 5  
ATOM   7768  H HD22 . ASN B 2 25  ? 16.973  -6.286  -0.583  1.00 0.00  ? 164 ASN B HD22 5  
ATOM   7769  N N    . ALA B 2 26  ? 17.721  -0.257  -0.562  1.00 41.13 ? 165 ALA B N    5  
ATOM   7770  C CA   . ALA B 2 26  ? 18.719  0.750   -1.036  1.00 40.91 ? 165 ALA B CA   5  
ATOM   7771  C C    . ALA B 2 26  ? 18.734  0.809   -2.568  1.00 39.78 ? 165 ALA B C    5  
ATOM   7772  O O    . ALA B 2 26  ? 19.742  1.116   -3.173  1.00 42.37 ? 165 ALA B O    5  
ATOM   7773  C CB   . ALA B 2 26  ? 20.109  0.361   -0.531  1.00 43.50 ? 165 ALA B CB   5  
ATOM   7774  H H    . ALA B 2 26  ? 17.186  -0.075  0.237   1.00 0.00  ? 165 ALA B H    5  
ATOM   7775  H HA   . ALA B 2 26  ? 18.458  1.722   -0.644  1.00 0.00  ? 165 ALA B HA   5  
ATOM   7776  H HB1  . ALA B 2 26  ? 20.194  -0.716  -0.506  1.00 0.00  ? 165 ALA B HB1  5  
ATOM   7777  H HB2  . ALA B 2 26  ? 20.860  0.766   -1.193  1.00 0.00  ? 165 ALA B HB2  5  
ATOM   7778  H HB3  . ALA B 2 26  ? 20.256  0.757   0.463   1.00 0.00  ? 165 ALA B HB3  5  
ATOM   7779  N N    . GLU B 2 27  ? 17.632  0.511   -3.202  1.00 36.31 ? 166 GLU B N    5  
ATOM   7780  C CA   . GLU B 2 27  ? 17.600  0.546   -4.686  1.00 32.86 ? 166 GLU B CA   5  
ATOM   7781  C C    . GLU B 2 27  ? 16.177  0.836   -5.168  1.00 28.56 ? 166 GLU B C    5  
ATOM   7782  O O    . GLU B 2 27  ? 15.838  0.591   -6.309  1.00 27.16 ? 166 GLU B O    5  
ATOM   7783  C CB   . GLU B 2 27  ? 18.048  -0.812  -5.219  1.00 35.96 ? 166 GLU B CB   5  
ATOM   7784  C CG   . GLU B 2 27  ? 19.562  -0.804  -5.438  1.00 44.79 ? 166 GLU B CG   5  
ATOM   7785  C CD   . GLU B 2 27  ? 19.929  0.307   -6.423  1.00 50.54 ? 166 GLU B CD   5  
ATOM   7786  O OE1  . GLU B 2 27  ? 19.662  0.139   -7.602  1.00 52.17 ? 166 GLU B OE1  5  
ATOM   7787  O OE2  . GLU B 2 27  ? 20.473  1.307   -5.983  1.00 54.06 ? 166 GLU B OE2  5  
ATOM   7788  H H    . GLU B 2 27  ? 16.831  0.259   -2.707  1.00 0.00  ? 166 GLU B H    5  
ATOM   7789  H HA   . GLU B 2 27  ? 18.269  1.313   -5.045  1.00 0.00  ? 166 GLU B HA   5  
ATOM   7790  H HB2  . GLU B 2 27  ? 17.792  -1.579  -4.503  1.00 0.00  ? 166 GLU B HB2  5  
ATOM   7791  H HB3  . GLU B 2 27  ? 17.548  -1.009  -6.149  1.00 0.00  ? 166 GLU B HB3  5  
ATOM   7792  H HG2  . GLU B 2 27  ? 20.060  -0.630  -4.496  1.00 0.00  ? 166 GLU B HG2  5  
ATOM   7793  H HG3  . GLU B 2 27  ? 19.872  -1.756  -5.841  1.00 0.00  ? 166 GLU B HG3  5  
ATOM   7794  N N    . ASN B 2 28  ? 15.339  1.355   -4.313  1.00 24.51 ? 167 ASN B N    5  
ATOM   7795  C CA   . ASN B 2 28  ? 13.942  1.654   -4.736  1.00 21.82 ? 167 ASN B CA   5  
ATOM   7796  C C    . ASN B 2 28  ? 13.722  3.174   -4.732  1.00 19.62 ? 167 ASN B C    5  
ATOM   7797  O O    . ASN B 2 28  ? 14.204  3.861   -3.855  1.00 20.78 ? 167 ASN B O    5  
ATOM   7798  C CB   . ASN B 2 28  ? 12.962  0.995   -3.762  1.00 20.91 ? 167 ASN B CB   5  
ATOM   7799  C CG   . ASN B 2 28  ? 12.821  -0.489  -4.107  1.00 21.84 ? 167 ASN B CG   5  
ATOM   7800  O OD1  . ASN B 2 28  ? 13.584  -1.018  -4.891  1.00 20.75 ? 167 ASN B OD1  5  
ATOM   7801  N ND2  . ASN B 2 28  ? 11.868  -1.187  -3.552  1.00 24.01 ? 167 ASN B ND2  5  
ATOM   7802  H H    . ASN B 2 28  ? 15.627  1.547   -3.396  1.00 0.00  ? 167 ASN B H    5  
ATOM   7803  H HA   . ASN B 2 28  ? 13.779  1.264   -5.728  1.00 0.00  ? 167 ASN B HA   5  
ATOM   7804  H HB2  . ASN B 2 28  ? 13.334  1.097   -2.753  1.00 0.00  ? 167 ASN B HB2  5  
ATOM   7805  H HB3  . ASN B 2 28  ? 11.998  1.475   -3.841  1.00 0.00  ? 167 ASN B HB3  5  
ATOM   7806  H HD21 . ASN B 2 28  ? 11.250  -0.758  -2.917  1.00 0.00  ? 167 ASN B HD21 5  
ATOM   7807  H HD22 . ASN B 2 28  ? 11.770  -2.143  -3.769  1.00 0.00  ? 167 ASN B HD22 5  
ATOM   7808  N N    . PRO B 2 29  ? 12.999  3.658   -5.717  1.00 18.42 ? 168 PRO B N    5  
ATOM   7809  C CA   . PRO B 2 29  ? 12.702  5.095   -5.847  1.00 16.88 ? 168 PRO B CA   5  
ATOM   7810  C C    . PRO B 2 29  ? 11.582  5.498   -4.883  1.00 16.36 ? 168 PRO B C    5  
ATOM   7811  O O    . PRO B 2 29  ? 11.029  4.676   -4.180  1.00 15.23 ? 168 PRO B O    5  
ATOM   7812  C CB   . PRO B 2 29  ? 12.247  5.239   -7.301  1.00 18.00 ? 168 PRO B CB   5  
ATOM   7813  C CG   . PRO B 2 29  ? 11.766  3.838   -7.749  1.00 17.15 ? 168 PRO B CG   5  
ATOM   7814  C CD   . PRO B 2 29  ? 12.411  2.823   -6.787  1.00 16.33 ? 168 PRO B CD   5  
ATOM   7815  H HA   . PRO B 2 29  ? 13.588  5.686   -5.676  1.00 0.00  ? 168 PRO B HA   5  
ATOM   7816  H HB2  . PRO B 2 29  ? 11.437  5.952   -7.365  1.00 0.00  ? 168 PRO B HB2  5  
ATOM   7817  H HB3  . PRO B 2 29  ? 13.072  5.555   -7.920  1.00 0.00  ? 168 PRO B HB3  5  
ATOM   7818  H HG2  . PRO B 2 29  ? 10.687  3.780   -7.685  1.00 0.00  ? 168 PRO B HG2  5  
ATOM   7819  H HG3  . PRO B 2 29  ? 12.090  3.640   -8.759  1.00 0.00  ? 168 PRO B HG3  5  
ATOM   7820  H HD2  . PRO B 2 29  ? 11.660  2.157   -6.384  1.00 0.00  ? 168 PRO B HD2  5  
ATOM   7821  H HD3  . PRO B 2 29  ? 13.184  2.264   -7.290  1.00 0.00  ? 168 PRO B HD3  5  
ATOM   7822  N N    . ARG B 2 30  ? 11.245  6.758   -4.847  1.00 16.48 ? 169 ARG B N    5  
ATOM   7823  C CA   . ARG B 2 30  ? 10.161  7.213   -3.932  1.00 15.86 ? 169 ARG B CA   5  
ATOM   7824  C C    . ARG B 2 30  ? 8.807   7.048   -4.627  1.00 13.88 ? 169 ARG B C    5  
ATOM   7825  O O    . ARG B 2 30  ? 8.443   7.821   -5.490  1.00 15.48 ? 169 ARG B O    5  
ATOM   7826  C CB   . ARG B 2 30  ? 10.376  8.687   -3.580  1.00 15.75 ? 169 ARG B CB   5  
ATOM   7827  C CG   . ARG B 2 30  ? 10.668  8.819   -2.084  1.00 19.73 ? 169 ARG B CG   5  
ATOM   7828  C CD   . ARG B 2 30  ? 10.988  10.278  -1.754  1.00 22.87 ? 169 ARG B CD   5  
ATOM   7829  N NE   . ARG B 2 30  ? 12.123  10.741  -2.601  1.00 21.47 ? 169 ARG B NE   5  
ATOM   7830  C CZ   . ARG B 2 30  ? 11.989  11.804  -3.348  1.00 20.61 ? 169 ARG B CZ   5  
ATOM   7831  N NH1  . ARG B 2 30  ? 11.337  11.729  -4.476  1.00 23.69 ? 169 ARG B NH1  5  
ATOM   7832  N NH2  . ARG B 2 30  ? 12.506  12.939  -2.967  1.00 22.31 ? 169 ARG B NH2  5  
ATOM   7833  H H    . ARG B 2 30  ? 11.703  7.404   -5.424  1.00 0.00  ? 169 ARG B H    5  
ATOM   7834  H HA   . ARG B 2 30  ? 10.177  6.621   -3.030  1.00 0.00  ? 169 ARG B HA   5  
ATOM   7835  H HB2  . ARG B 2 30  ? 11.211  9.073   -4.147  1.00 0.00  ? 169 ARG B HB2  5  
ATOM   7836  H HB3  . ARG B 2 30  ? 9.486   9.249   -3.822  1.00 0.00  ? 169 ARG B HB3  5  
ATOM   7837  H HG2  . ARG B 2 30  ? 9.801   8.503   -1.520  1.00 0.00  ? 169 ARG B HG2  5  
ATOM   7838  H HG3  . ARG B 2 30  ? 11.512  8.199   -1.826  1.00 0.00  ? 169 ARG B HG3  5  
ATOM   7839  H HD2  . ARG B 2 30  ? 10.121  10.890  -1.948  1.00 0.00  ? 169 ARG B HD2  5  
ATOM   7840  H HD3  . ARG B 2 30  ? 11.261  10.360  -0.711  1.00 0.00  ? 169 ARG B HD3  5  
ATOM   7841  H HE   . ARG B 2 30  ? 12.971  10.249  -2.597  1.00 0.00  ? 169 ARG B HE   5  
ATOM   7842  H HH11 . ARG B 2 30  ? 10.941  10.858  -4.768  1.00 0.00  ? 169 ARG B HH11 5  
ATOM   7843  H HH12 . ARG B 2 30  ? 11.234  12.543  -5.049  1.00 0.00  ? 169 ARG B HH12 5  
ATOM   7844  H HH21 . ARG B 2 30  ? 13.006  12.996  -2.102  1.00 0.00  ? 169 ARG B HH21 5  
ATOM   7845  H HH22 . ARG B 2 30  ? 12.403  13.752  -3.539  1.00 0.00  ? 169 ARG B HH22 5  
ATOM   7846  N N    . GLY B 2 31  ? 8.057   6.046   -4.256  1.00 11.61 ? 170 GLY B N    5  
ATOM   7847  C CA   . GLY B 2 31  ? 6.729   5.834   -4.897  1.00 10.78 ? 170 GLY B CA   5  
ATOM   7848  C C    . GLY B 2 31  ? 6.465   4.335   -5.055  1.00 11.90 ? 170 GLY B C    5  
ATOM   7849  O O    . GLY B 2 31  ? 5.361   3.917   -5.344  1.00 11.93 ? 170 GLY B O    5  
ATOM   7850  H H    . GLY B 2 31  ? 8.368   5.433   -3.557  1.00 0.00  ? 170 GLY B H    5  
ATOM   7851  H HA2  . GLY B 2 31  ? 5.958   6.273   -4.279  1.00 0.00  ? 170 GLY B HA2  5  
ATOM   7852  H HA3  . GLY B 2 31  ? 6.719   6.302   -5.870  1.00 0.00  ? 170 GLY B HA3  5  
ATOM   7853  N N    . THR B 2 32  ? 7.470   3.520   -4.872  1.00 11.18 ? 171 THR B N    5  
ATOM   7854  C CA   . THR B 2 32  ? 7.270   2.050   -5.014  1.00 10.98 ? 171 THR B CA   5  
ATOM   7855  C C    . THR B 2 32  ? 6.311   1.558   -3.930  1.00 10.39 ? 171 THR B C    5  
ATOM   7856  O O    . THR B 2 32  ? 6.490   1.829   -2.759  1.00 11.11 ? 171 THR B O    5  
ATOM   7857  C CB   . THR B 2 32  ? 8.616   1.335   -4.868  1.00 12.81 ? 171 THR B CB   5  
ATOM   7858  O OG1  . THR B 2 32  ? 9.507   1.796   -5.875  1.00 15.73 ? 171 THR B OG1  5  
ATOM   7859  C CG2  . THR B 2 32  ? 8.413   -0.173  -5.013  1.00 10.54 ? 171 THR B CG2  5  
ATOM   7860  H H    . THR B 2 32  ? 8.354   3.875   -4.641  1.00 0.00  ? 171 THR B H    5  
ATOM   7861  H HA   . THR B 2 32  ? 6.854   1.837   -5.988  1.00 0.00  ? 171 THR B HA   5  
ATOM   7862  H HB   . THR B 2 32  ? 9.032   1.546   -3.895  1.00 0.00  ? 171 THR B HB   5  
ATOM   7863  H HG1  . THR B 2 32  ? 10.123  1.086   -6.073  1.00 0.00  ? 171 THR B HG1  5  
ATOM   7864  H HG21 . THR B 2 32  ? 7.356   -0.389  -5.082  1.00 0.00  ? 171 THR B HG21 5  
ATOM   7865  H HG22 . THR B 2 32  ? 8.909   -0.519  -5.908  1.00 0.00  ? 171 THR B HG22 5  
ATOM   7866  H HG23 . THR B 2 32  ? 8.827   -0.677  -4.153  1.00 0.00  ? 171 THR B HG23 5  
ATOM   7867  N N    . PHE B 2 33  ? 5.293   0.836   -4.310  1.00 9.86  ? 172 PHE B N    5  
ATOM   7868  C CA   . PHE B 2 33  ? 4.323   0.326   -3.299  1.00 10.31 ? 172 PHE B CA   5  
ATOM   7869  C C    . PHE B 2 33  ? 4.010   -1.144  -3.586  1.00 9.74  ? 172 PHE B C    5  
ATOM   7870  O O    . PHE B 2 33  ? 4.531   -1.729  -4.515  1.00 10.89 ? 172 PHE B O    5  
ATOM   7871  C CB   . PHE B 2 33  ? 3.032   1.146   -3.374  1.00 8.42  ? 172 PHE B CB   5  
ATOM   7872  C CG   . PHE B 2 33  ? 2.345   0.885   -4.693  1.00 10.33 ? 172 PHE B CG   5  
ATOM   7873  C CD1  . PHE B 2 33  ? 2.832   1.483   -5.868  1.00 9.32  ? 172 PHE B CD1  5  
ATOM   7874  C CD2  . PHE B 2 33  ? 1.221   0.043   -4.746  1.00 10.22 ? 172 PHE B CD2  5  
ATOM   7875  C CE1  . PHE B 2 33  ? 2.193   1.240   -7.096  1.00 10.82 ? 172 PHE B CE1  5  
ATOM   7876  C CE2  . PHE B 2 33  ? 0.583   -0.200  -5.973  1.00 9.66  ? 172 PHE B CE2  5  
ATOM   7877  C CZ   . PHE B 2 33  ? 1.069   0.398   -7.149  1.00 11.64 ? 172 PHE B CZ   5  
ATOM   7878  H H    . PHE B 2 33  ? 5.166   0.628   -5.259  1.00 0.00  ? 172 PHE B H    5  
ATOM   7879  H HA   . PHE B 2 33  ? 4.750   0.418   -2.312  1.00 0.00  ? 172 PHE B HA   5  
ATOM   7880  H HB2  . PHE B 2 33  ? 2.377   0.861   -2.564  1.00 0.00  ? 172 PHE B HB2  5  
ATOM   7881  H HB3  . PHE B 2 33  ? 3.268   2.197   -3.294  1.00 0.00  ? 172 PHE B HB3  5  
ATOM   7882  H HD1  . PHE B 2 33  ? 3.695   2.130   -5.827  1.00 0.00  ? 172 PHE B HD1  5  
ATOM   7883  H HD2  . PHE B 2 33  ? 0.849   -0.416  -3.843  1.00 0.00  ? 172 PHE B HD2  5  
ATOM   7884  H HE1  . PHE B 2 33  ? 2.567   1.699   -7.999  1.00 0.00  ? 172 PHE B HE1  5  
ATOM   7885  H HE2  . PHE B 2 33  ? -0.281  -0.846  -6.014  1.00 0.00  ? 172 PHE B HE2  5  
ATOM   7886  H HZ   . PHE B 2 33  ? 0.579   0.211   -8.093  1.00 0.00  ? 172 PHE B HZ   5  
ATOM   7887  N N    . LEU B 2 34  ? 3.163   -1.745  -2.796  1.00 8.06  ? 173 LEU B N    5  
ATOM   7888  C CA   . LEU B 2 34  ? 2.817   -3.176  -3.024  1.00 6.70  ? 173 LEU B CA   5  
ATOM   7889  C C    . LEU B 2 34  ? 1.596   -3.544  -2.179  1.00 8.22  ? 173 LEU B C    5  
ATOM   7890  O O    . LEU B 2 34  ? 1.469   -3.132  -1.042  1.00 8.04  ? 173 LEU B O    5  
ATOM   7891  C CB   . LEU B 2 34  ? 4.000   -4.058  -2.621  1.00 7.47  ? 173 LEU B CB   5  
ATOM   7892  C CG   . LEU B 2 34  ? 4.213   -3.968  -1.110  1.00 8.31  ? 173 LEU B CG   5  
ATOM   7893  C CD1  . LEU B 2 34  ? 3.411   -5.069  -0.414  1.00 7.11  ? 173 LEU B CD1  5  
ATOM   7894  C CD2  . LEU B 2 34  ? 5.700   -4.147  -0.793  1.00 7.67  ? 173 LEU B CD2  5  
ATOM   7895  H H    . LEU B 2 34  ? 2.754   -1.254  -2.054  1.00 0.00  ? 173 LEU B H    5  
ATOM   7896  H HA   . LEU B 2 34  ? 2.591   -3.331  -4.069  1.00 0.00  ? 173 LEU B HA   5  
ATOM   7897  H HB2  . LEU B 2 34  ? 3.796   -5.082  -2.897  1.00 0.00  ? 173 LEU B HB2  5  
ATOM   7898  H HB3  . LEU B 2 34  ? 4.891   -3.719  -3.129  1.00 0.00  ? 173 LEU B HB3  5  
ATOM   7899  H HG   . LEU B 2 34  ? 3.882   -3.002  -0.756  1.00 0.00  ? 173 LEU B HG   5  
ATOM   7900  H HD11 . LEU B 2 34  ? 3.115   -5.812  -1.140  1.00 0.00  ? 173 LEU B HD11 5  
ATOM   7901  H HD12 . LEU B 2 34  ? 4.020   -5.532  0.348   1.00 0.00  ? 173 LEU B HD12 5  
ATOM   7902  H HD13 . LEU B 2 34  ? 2.529   -4.640  0.040   1.00 0.00  ? 173 LEU B HD13 5  
ATOM   7903  H HD21 . LEU B 2 34  ? 6.274   -3.411  -1.338  1.00 0.00  ? 173 LEU B HD21 5  
ATOM   7904  H HD22 . LEU B 2 34  ? 5.861   -4.018  0.266   1.00 0.00  ? 173 LEU B HD22 5  
ATOM   7905  H HD23 . LEU B 2 34  ? 6.014   -5.138  -1.088  1.00 0.00  ? 173 LEU B HD23 5  
ATOM   7906  N N    . VAL B 2 35  ? 0.695   -4.316  -2.722  1.00 9.95  ? 174 VAL B N    5  
ATOM   7907  C CA   . VAL B 2 35  ? -0.517  -4.707  -1.948  1.00 10.61 ? 174 VAL B CA   5  
ATOM   7908  C C    . VAL B 2 35  ? -0.398  -6.169  -1.517  1.00 10.97 ? 174 VAL B C    5  
ATOM   7909  O O    . VAL B 2 35  ? -0.527  -7.075  -2.317  1.00 13.68 ? 174 VAL B O    5  
ATOM   7910  C CB   . VAL B 2 35  ? -1.759  -4.535  -2.822  1.00 8.85  ? 174 VAL B CB   5  
ATOM   7911  C CG1  . VAL B 2 35  ? -3.006  -4.910  -2.019  1.00 7.48  ? 174 VAL B CG1  5  
ATOM   7912  C CG2  . VAL B 2 35  ? -1.865  -3.078  -3.278  1.00 7.46  ? 174 VAL B CG2  5  
ATOM   7913  H H    . VAL B 2 35  ? 0.815   -4.637  -3.641  1.00 0.00  ? 174 VAL B H    5  
ATOM   7914  H HA   . VAL B 2 35  ? -0.602  -4.080  -1.073  1.00 0.00  ? 174 VAL B HA   5  
ATOM   7915  H HB   . VAL B 2 35  ? -1.682  -5.179  -3.686  1.00 0.00  ? 174 VAL B HB   5  
ATOM   7916  H HG11 . VAL B 2 35  ? -2.712  -5.423  -1.117  1.00 0.00  ? 174 VAL B HG11 5  
ATOM   7917  H HG12 . VAL B 2 35  ? -3.551  -4.013  -1.762  1.00 0.00  ? 174 VAL B HG12 5  
ATOM   7918  H HG13 . VAL B 2 35  ? -3.636  -5.556  -2.613  1.00 0.00  ? 174 VAL B HG13 5  
ATOM   7919  H HG21 . VAL B 2 35  ? -1.496  -2.430  -2.496  1.00 0.00  ? 174 VAL B HG21 5  
ATOM   7920  H HG22 . VAL B 2 35  ? -1.275  -2.936  -4.170  1.00 0.00  ? 174 VAL B HG22 5  
ATOM   7921  H HG23 . VAL B 2 35  ? -2.897  -2.839  -3.485  1.00 0.00  ? 174 VAL B HG23 5  
ATOM   7922  N N    . ARG B 2 36  ? -0.156  -6.408  -0.257  1.00 12.04 ? 175 ARG B N    5  
ATOM   7923  C CA   . ARG B 2 36  ? -0.035  -7.814  0.223   1.00 13.07 ? 175 ARG B CA   5  
ATOM   7924  C C    . ARG B 2 36  ? -1.333  -8.228  0.918   1.00 15.49 ? 175 ARG B C    5  
ATOM   7925  O O    . ARG B 2 36  ? -2.253  -7.446  1.052   1.00 11.34 ? 175 ARG B O    5  
ATOM   7926  C CB   . ARG B 2 36  ? 1.130   -7.918  1.211   1.00 10.24 ? 175 ARG B CB   5  
ATOM   7927  C CG   . ARG B 2 36  ? 0.842   -7.049  2.437   1.00 10.97 ? 175 ARG B CG   5  
ATOM   7928  C CD   . ARG B 2 36  ? 2.149   -6.447  2.954   1.00 8.81  ? 175 ARG B CD   5  
ATOM   7929  N NE   . ARG B 2 36  ? 2.837   -7.435  3.832   1.00 7.82  ? 175 ARG B NE   5  
ATOM   7930  C CZ   . ARG B 2 36  ? 2.301   -7.782  4.970   1.00 8.03  ? 175 ARG B CZ   5  
ATOM   7931  N NH1  . ARG B 2 36  ? 1.603   -6.917  5.654   1.00 7.60  ? 175 ARG B NH1  5  
ATOM   7932  N NH2  . ARG B 2 36  ? 2.464   -8.995  5.426   1.00 11.06 ? 175 ARG B NH2  5  
ATOM   7933  H H    . ARG B 2 36  ? -0.058  -5.664  0.373   1.00 0.00  ? 175 ARG B H    5  
ATOM   7934  H HA   . ARG B 2 36  ? 0.148   -8.466  -0.618  1.00 0.00  ? 175 ARG B HA   5  
ATOM   7935  H HB2  . ARG B 2 36  ? 1.248   -8.948  1.518   1.00 0.00  ? 175 ARG B HB2  5  
ATOM   7936  H HB3  . ARG B 2 36  ? 2.037   -7.577  0.736   1.00 0.00  ? 175 ARG B HB3  5  
ATOM   7937  H HG2  . ARG B 2 36  ? 0.161   -6.257  2.163   1.00 0.00  ? 175 ARG B HG2  5  
ATOM   7938  H HG3  . ARG B 2 36  ? 0.396   -7.656  3.211   1.00 0.00  ? 175 ARG B HG3  5  
ATOM   7939  H HD2  . ARG B 2 36  ? 2.787   -6.203  2.118   1.00 0.00  ? 175 ARG B HD2  5  
ATOM   7940  H HD3  . ARG B 2 36  ? 1.934   -5.552  3.517   1.00 0.00  ? 175 ARG B HD3  5  
ATOM   7941  H HE   . ARG B 2 36  ? 3.693   -7.825  3.555   1.00 0.00  ? 175 ARG B HE   5  
ATOM   7942  H HH11 . ARG B 2 36  ? 1.477   -5.988  5.305   1.00 0.00  ? 175 ARG B HH11 5  
ATOM   7943  H HH12 . ARG B 2 36  ? 1.192   -7.183  6.526   1.00 0.00  ? 175 ARG B HH12 5  
ATOM   7944  H HH21 . ARG B 2 36  ? 3.000   -9.657  4.903   1.00 0.00  ? 175 ARG B HH21 5  
ATOM   7945  H HH22 . ARG B 2 36  ? 2.054   -9.260  6.298   1.00 0.00  ? 175 ARG B HH22 5  
ATOM   7946  N N    . GLU B 2 37  ? -1.415  -9.452  1.359   1.00 20.91 ? 176 GLU B N    5  
ATOM   7947  C CA   . GLU B 2 37  ? -2.654  -9.916  2.043   1.00 26.31 ? 176 GLU B CA   5  
ATOM   7948  C C    . GLU B 2 37  ? -2.665  -9.401  3.483   1.00 29.76 ? 176 GLU B C    5  
ATOM   7949  O O    . GLU B 2 37  ? -1.699  -8.836  3.957   1.00 30.61 ? 176 GLU B O    5  
ATOM   7950  C CB   . GLU B 2 37  ? -2.690  -11.446 2.049   1.00 25.39 ? 176 GLU B CB   5  
ATOM   7951  C CG   . GLU B 2 37  ? -4.116  -11.924 2.325   1.00 29.84 ? 176 GLU B CG   5  
ATOM   7952  C CD   . GLU B 2 37  ? -4.492  -13.017 1.324   1.00 32.50 ? 176 GLU B CD   5  
ATOM   7953  O OE1  . GLU B 2 37  ? -4.244  -12.824 0.145   1.00 36.79 ? 176 GLU B OE1  5  
ATOM   7954  O OE2  . GLU B 2 37  ? -5.019  -14.030 1.753   1.00 34.32 ? 176 GLU B OE2  5  
ATOM   7955  H H    . GLU B 2 37  ? -0.661  -10.067 1.240   1.00 0.00  ? 176 GLU B H    5  
ATOM   7956  H HA   . GLU B 2 37  ? -3.518  -9.538  1.519   1.00 0.00  ? 176 GLU B HA   5  
ATOM   7957  H HB2  . GLU B 2 37  ? -2.365  -11.817 1.089   1.00 0.00  ? 176 GLU B HB2  5  
ATOM   7958  H HB3  . GLU B 2 37  ? -2.033  -11.818 2.821   1.00 0.00  ? 176 GLU B HB3  5  
ATOM   7959  H HG2  . GLU B 2 37  ? -4.177  -12.317 3.330   1.00 0.00  ? 176 GLU B HG2  5  
ATOM   7960  H HG3  . GLU B 2 37  ? -4.801  -11.094 2.221   1.00 0.00  ? 176 GLU B HG3  5  
ATOM   7961  N N    . SER B 2 38  ? -3.750  -9.594  4.182   1.00 36.14 ? 177 SER B N    5  
ATOM   7962  C CA   . SER B 2 38  ? -3.825  -9.119  5.593   1.00 41.98 ? 177 SER B CA   5  
ATOM   7963  C C    . SER B 2 38  ? -2.544  -9.498  6.327   1.00 43.00 ? 177 SER B C    5  
ATOM   7964  O O    . SER B 2 38  ? -1.640  -8.700  6.477   1.00 43.66 ? 177 SER B O    5  
ATOM   7965  C CB   . SER B 2 38  ? -5.021  -9.771  6.287   1.00 45.78 ? 177 SER B CB   5  
ATOM   7966  O OG   . SER B 2 38  ? -5.438  -10.904 5.538   1.00 51.84 ? 177 SER B OG   5  
ATOM   7967  H H    . SER B 2 38  ? -4.516  -10.052 3.780   1.00 0.00  ? 177 SER B H    5  
ATOM   7968  H HA   . SER B 2 38  ? -3.939  -8.054  5.609   1.00 0.00  ? 177 SER B HA   5  
ATOM   7969  H HB2  . SER B 2 38  ? -4.737  -10.085 7.278   1.00 0.00  ? 177 SER B HB2  5  
ATOM   7970  H HB3  . SER B 2 38  ? -5.829  -9.055  6.357   1.00 0.00  ? 177 SER B HB3  5  
ATOM   7971  H HG   . SER B 2 38  ? -5.367  -11.677 6.104   1.00 0.00  ? 177 SER B HG   5  
ATOM   7972  N N    . GLU B 2 39  ? -2.476  -10.716 6.782   1.00 23.97 ? 178 GLU B N    5  
ATOM   7973  C CA   . GLU B 2 39  ? -1.272  -11.206 7.521   1.00 25.52 ? 178 GLU B CA   5  
ATOM   7974  C C    . GLU B 2 39  ? -1.372  -10.804 8.995   1.00 30.02 ? 178 GLU B C    5  
ATOM   7975  O O    . GLU B 2 39  ? -1.127  -11.599 9.880   1.00 31.55 ? 178 GLU B O    5  
ATOM   7976  C CB   . GLU B 2 39  ? 0.002   -10.617 6.909   1.00 23.29 ? 178 GLU B CB   5  
ATOM   7977  C CG   . GLU B 2 39  ? 1.044   -11.723 6.741   1.00 29.79 ? 178 GLU B CG   5  
ATOM   7978  C CD   . GLU B 2 39  ? 1.926   -11.790 7.990   1.00 33.17 ? 178 GLU B CD   5  
ATOM   7979  O OE1  . GLU B 2 39  ? 2.742   -10.899 8.162   1.00 39.84 ? 178 GLU B OE1  5  
ATOM   7980  O OE2  . GLU B 2 39  ? 1.770   -12.729 8.752   1.00 21.15 ? 178 GLU B OE2  5  
ATOM   7981  H H    . GLU B 2 39  ? -3.232  -11.315 6.636   1.00 0.00  ? 178 GLU B H    5  
ATOM   7982  H HA   . GLU B 2 39  ? -1.233  -12.285 7.453   1.00 0.00  ? 178 GLU B HA   5  
ATOM   7983  H HB2  . GLU B 2 39  ? -0.227  -10.189 5.944   1.00 0.00  ? 178 GLU B HB2  5  
ATOM   7984  H HB3  . GLU B 2 39  ? 0.395   -9.851  7.560   1.00 0.00  ? 178 GLU B HB3  5  
ATOM   7985  H HG2  . GLU B 2 39  ? 0.544   -12.671 6.602   1.00 0.00  ? 178 GLU B HG2  5  
ATOM   7986  H HG3  . GLU B 2 39  ? 1.659   -11.511 5.880   1.00 0.00  ? 178 GLU B HG3  5  
ATOM   7987  N N    . THR B 2 40  ? -1.731  -9.579  9.269   1.00 26.98 ? 179 THR B N    5  
ATOM   7988  C CA   . THR B 2 40  ? -1.846  -9.136  10.684  1.00 31.67 ? 179 THR B CA   5  
ATOM   7989  C C    . THR B 2 40  ? -3.287  -8.701  10.966  1.00 34.54 ? 179 THR B C    5  
ATOM   7990  O O    . THR B 2 40  ? -3.692  -8.560  12.102  1.00 34.85 ? 179 THR B O    5  
ATOM   7991  C CB   . THR B 2 40  ? -0.900  -7.958  10.925  1.00 26.17 ? 179 THR B CB   5  
ATOM   7992  O OG1  . THR B 2 40  ? -0.823  -7.167  9.748   1.00 28.58 ? 179 THR B OG1  5  
ATOM   7993  C CG2  . THR B 2 40  ? 0.491   -8.483  11.283  1.00 35.55 ? 179 THR B CG2  5  
ATOM   7994  H H    . THR B 2 40  ? -1.925  -8.952  8.545   1.00 0.00  ? 179 THR B H    5  
ATOM   7995  H HA   . THR B 2 40  ? -1.581  -9.952  11.340  1.00 0.00  ? 179 THR B HA   5  
ATOM   7996  H HB   . THR B 2 40  ? -1.274  -7.357  11.739  1.00 0.00  ? 179 THR B HB   5  
ATOM   7997  H HG1  . THR B 2 40  ? -0.594  -6.272  10.006  1.00 0.00  ? 179 THR B HG1  5  
ATOM   7998  H HG21 . THR B 2 40  ? 0.536   -9.544  11.091  1.00 0.00  ? 179 THR B HG21 5  
ATOM   7999  H HG22 . THR B 2 40  ? 1.232   -7.977  10.682  1.00 0.00  ? 179 THR B HG22 5  
ATOM   8000  H HG23 . THR B 2 40  ? 0.688   -8.297  12.328  1.00 0.00  ? 179 THR B HG23 5  
ATOM   8001  N N    . THR B 2 41  ? -4.064  -8.488  9.937   1.00 27.03 ? 180 THR B N    5  
ATOM   8002  C CA   . THR B 2 41  ? -5.477  -8.063  10.145  1.00 25.08 ? 180 THR B CA   5  
ATOM   8003  C C    . THR B 2 41  ? -6.398  -9.275  9.979   1.00 30.09 ? 180 THR B C    5  
ATOM   8004  O O    . THR B 2 41  ? -5.959  -10.408 10.006  1.00 30.04 ? 180 THR B O    5  
ATOM   8005  C CB   . THR B 2 41  ? -5.843  -6.996  9.111   1.00 29.37 ? 180 THR B CB   5  
ATOM   8006  O OG1  . THR B 2 41  ? -4.680  -6.260  8.762   1.00 38.10 ? 180 THR B OG1  5  
ATOM   8007  C CG2  . THR B 2 41  ? -6.889  -6.048  9.701   1.00 40.88 ? 180 THR B CG2  5  
ATOM   8008  H H    . THR B 2 41  ? -3.719  -8.607  9.028   1.00 0.00  ? 180 THR B H    5  
ATOM   8009  H HA   . THR B 2 41  ? -5.591  -7.657  11.139  1.00 0.00  ? 180 THR B HA   5  
ATOM   8010  H HB   . THR B 2 41  ? -6.249  -7.469  8.230   1.00 0.00  ? 180 THR B HB   5  
ATOM   8011  H HG1  . THR B 2 41  ? -4.938  -5.570  8.146   1.00 0.00  ? 180 THR B HG1  5  
ATOM   8012  H HG21 . THR B 2 41  ? -7.120  -6.351  10.712  1.00 0.00  ? 180 THR B HG21 5  
ATOM   8013  H HG22 . THR B 2 41  ? -6.499  -5.041  9.708   1.00 0.00  ? 180 THR B HG22 5  
ATOM   8014  H HG23 . THR B 2 41  ? -7.786  -6.082  9.100   1.00 0.00  ? 180 THR B HG23 5  
ATOM   8015  N N    . LYS B 2 42  ? -7.672  -9.048  9.810   1.00 32.42 ? 181 LYS B N    5  
ATOM   8016  C CA   . LYS B 2 42  ? -8.614  -10.191 9.646   1.00 38.97 ? 181 LYS B CA   5  
ATOM   8017  C C    . LYS B 2 42  ? -9.416  -10.016 8.354   1.00 35.28 ? 181 LYS B C    5  
ATOM   8018  O O    . LYS B 2 42  ? -10.133 -9.049  8.181   1.00 34.92 ? 181 LYS B O    5  
ATOM   8019  C CB   . LYS B 2 42  ? -9.573  -10.237 10.838  1.00 51.02 ? 181 LYS B CB   5  
ATOM   8020  C CG   . LYS B 2 42  ? -8.935  -11.039 11.974  1.00 72.35 ? 181 LYS B CG   5  
ATOM   8021  C CD   . LYS B 2 42  ? -8.933  -12.526 11.611  1.00 84.05 ? 181 LYS B CD   5  
ATOM   8022  C CE   . LYS B 2 42  ? -10.373 -13.005 11.423  1.00 88.20 ? 181 LYS B CE   5  
ATOM   8023  N NZ   . LYS B 2 42  ? -10.404 -14.495 11.422  1.00 87.98 ? 181 LYS B NZ   5  
ATOM   8024  H H    . LYS B 2 42  ? -8.009  -8.128  9.792   1.00 0.00  ? 181 LYS B H    5  
ATOM   8025  H HA   . LYS B 2 42  ? -8.055  -11.113 9.598   1.00 0.00  ? 181 LYS B HA   5  
ATOM   8026  H HB2  . LYS B 2 42  ? -9.775  -9.231  11.176  1.00 0.00  ? 181 LYS B HB2  5  
ATOM   8027  H HB3  . LYS B 2 42  ? -10.496 -10.710 10.540  1.00 0.00  ? 181 LYS B HB3  5  
ATOM   8028  H HG2  . LYS B 2 42  ? -7.919  -10.703 12.124  1.00 0.00  ? 181 LYS B HG2  5  
ATOM   8029  H HG3  . LYS B 2 42  ? -9.501  -10.892 12.881  1.00 0.00  ? 181 LYS B HG3  5  
ATOM   8030  H HD2  . LYS B 2 42  ? -8.380  -12.672 10.694  1.00 0.00  ? 181 LYS B HD2  5  
ATOM   8031  H HD3  . LYS B 2 42  ? -8.470  -13.090 12.406  1.00 0.00  ? 181 LYS B HD3  5  
ATOM   8032  H HE2  . LYS B 2 42  ? -10.987 -12.633 12.230  1.00 0.00  ? 181 LYS B HE2  5  
ATOM   8033  H HE3  . LYS B 2 42  ? -10.755 -12.638 10.481  1.00 0.00  ? 181 LYS B HE3  5  
ATOM   8034  H HZ1  . LYS B 2 42  ? -9.546  -14.860 11.883  1.00 0.00  ? 181 LYS B HZ1  5  
ATOM   8035  H HZ2  . LYS B 2 42  ? -11.244 -14.825 11.940  1.00 0.00  ? 181 LYS B HZ2  5  
ATOM   8036  H HZ3  . LYS B 2 42  ? -10.442 -14.841 10.442  1.00 0.00  ? 181 LYS B HZ3  5  
ATOM   8037  N N    . GLY B 2 43  ? -9.304  -10.947 7.446   1.00 38.03 ? 182 GLY B N    5  
ATOM   8038  C CA   . GLY B 2 43  ? -10.062 -10.840 6.167   1.00 30.70 ? 182 GLY B CA   5  
ATOM   8039  C C    . GLY B 2 43  ? -9.853  -9.454  5.556   1.00 29.58 ? 182 GLY B C    5  
ATOM   8040  O O    . GLY B 2 43  ? -10.793 -8.795  5.155   1.00 31.67 ? 182 GLY B O    5  
ATOM   8041  H H    . GLY B 2 43  ? -8.723  -11.719 7.608   1.00 0.00  ? 182 GLY B H    5  
ATOM   8042  H HA2  . GLY B 2 43  ? -9.709  -11.595 5.478   1.00 0.00  ? 182 GLY B HA2  5  
ATOM   8043  H HA3  . GLY B 2 43  ? -11.113 -10.990 6.359   1.00 0.00  ? 182 GLY B HA3  5  
ATOM   8044  N N    . ALA B 2 44  ? -8.631  -9.005  5.478   1.00 35.86 ? 183 ALA B N    5  
ATOM   8045  C CA   . ALA B 2 44  ? -8.369  -7.661  4.889   1.00 32.70 ? 183 ALA B CA   5  
ATOM   8046  C C    . ALA B 2 44  ? -6.986  -7.652  4.233   1.00 28.65 ? 183 ALA B C    5  
ATOM   8047  O O    . ALA B 2 44  ? -6.273  -8.636  4.252   1.00 29.39 ? 183 ALA B O    5  
ATOM   8048  C CB   . ALA B 2 44  ? -8.418  -6.601  5.992   1.00 31.44 ? 183 ALA B CB   5  
ATOM   8049  H H    . ALA B 2 44  ? -7.885  -9.550  5.805   1.00 0.00  ? 183 ALA B H    5  
ATOM   8050  H HA   . ALA B 2 44  ? -9.121  -7.442  4.146   1.00 0.00  ? 183 ALA B HA   5  
ATOM   8051  H HB1  . ALA B 2 44  ? -9.267  -6.786  6.632   1.00 0.00  ? 183 ALA B HB1  5  
ATOM   8052  H HB2  . ALA B 2 44  ? -7.511  -6.645  6.575   1.00 0.00  ? 183 ALA B HB2  5  
ATOM   8053  H HB3  . ALA B 2 44  ? -8.512  -5.621  5.545   1.00 0.00  ? 183 ALA B HB3  5  
ATOM   8054  N N    . TYR B 2 45  ? -6.603  -6.549  3.650   1.00 24.43 ? 184 TYR B N    5  
ATOM   8055  C CA   . TYR B 2 45  ? -5.268  -6.480  2.991   1.00 19.69 ? 184 TYR B CA   5  
ATOM   8056  C C    . TYR B 2 45  ? -4.492  -5.278  3.534   1.00 15.67 ? 184 TYR B C    5  
ATOM   8057  O O    . TYR B 2 45  ? -5.018  -4.468  4.273   1.00 11.54 ? 184 TYR B O    5  
ATOM   8058  C CB   . TYR B 2 45  ? -5.453  -6.328  1.480   1.00 20.89 ? 184 TYR B CB   5  
ATOM   8059  C CG   . TYR B 2 45  ? -6.345  -7.435  0.970   1.00 21.46 ? 184 TYR B CG   5  
ATOM   8060  C CD1  . TYR B 2 45  ? -6.100  -8.765  1.349   1.00 23.38 ? 184 TYR B CD1  5  
ATOM   8061  C CD2  . TYR B 2 45  ? -7.420  -7.133  0.118   1.00 21.81 ? 184 TYR B CD2  5  
ATOM   8062  C CE1  . TYR B 2 45  ? -6.930  -9.795  0.875   1.00 24.77 ? 184 TYR B CE1  5  
ATOM   8063  C CE2  . TYR B 2 45  ? -8.251  -8.163  -0.356  1.00 21.77 ? 184 TYR B CE2  5  
ATOM   8064  C CZ   . TYR B 2 45  ? -8.006  -9.494  0.023   1.00 25.72 ? 184 TYR B CZ   5  
ATOM   8065  O OH   . TYR B 2 45  ? -8.821  -10.505 -0.442  1.00 27.17 ? 184 TYR B OH   5  
ATOM   8066  H H    . TYR B 2 45  ? -7.193  -5.767  3.643   1.00 0.00  ? 184 TYR B H    5  
ATOM   8067  H HA   . TYR B 2 45  ? -4.718  -7.387  3.197   1.00 0.00  ? 184 TYR B HA   5  
ATOM   8068  H HB2  . TYR B 2 45  ? -5.907  -5.372  1.267   1.00 0.00  ? 184 TYR B HB2  5  
ATOM   8069  H HB3  . TYR B 2 45  ? -4.492  -6.389  0.992   1.00 0.00  ? 184 TYR B HB3  5  
ATOM   8070  H HD1  . TYR B 2 45  ? -5.273  -8.997  2.004   1.00 0.00  ? 184 TYR B HD1  5  
ATOM   8071  H HD2  . TYR B 2 45  ? -7.609  -6.110  -0.173  1.00 0.00  ? 184 TYR B HD2  5  
ATOM   8072  H HE1  . TYR B 2 45  ? -6.741  -10.817 1.166   1.00 0.00  ? 184 TYR B HE1  5  
ATOM   8073  H HE2  . TYR B 2 45  ? -9.078  -7.932  -1.011  1.00 0.00  ? 184 TYR B HE2  5  
ATOM   8074  H HH   . TYR B 2 45  ? -9.719  -10.167 -0.485  1.00 0.00  ? 184 TYR B HH   5  
ATOM   8075  N N    . CYS B 2 46  ? -3.243  -5.155  3.176   1.00 12.49 ? 185 CYS B N    5  
ATOM   8076  C CA   . CYS B 2 46  ? -2.438  -4.005  3.675   1.00 13.07 ? 185 CYS B CA   5  
ATOM   8077  C C    . CYS B 2 46  ? -1.555  -3.468  2.546   1.00 11.90 ? 185 CYS B C    5  
ATOM   8078  O O    . CYS B 2 46  ? -0.781  -4.192  1.952   1.00 11.52 ? 185 CYS B O    5  
ATOM   8079  C CB   . CYS B 2 46  ? -1.555  -4.468  4.836   1.00 13.05 ? 185 CYS B CB   5  
ATOM   8080  S SG   . CYS B 2 46  ? -2.492  -4.371  6.381   1.00 27.90 ? 185 CYS B SG   5  
ATOM   8081  H H    . CYS B 2 46  ? -2.836  -5.818  2.580   1.00 0.00  ? 185 CYS B H    5  
ATOM   8082  H HA   . CYS B 2 46  ? -3.099  -3.224  4.015   1.00 0.00  ? 185 CYS B HA   5  
ATOM   8083  H HB2  . CYS B 2 46  ? -1.243  -5.488  4.668   1.00 0.00  ? 185 CYS B HB2  5  
ATOM   8084  H HB3  . CYS B 2 46  ? -0.685  -3.832  4.902   1.00 0.00  ? 185 CYS B HB3  5  
ATOM   8085  H HG   . CYS B 2 46  ? -3.127  -3.654  6.299   1.00 0.00  ? 185 CYS B HG   5  
ATOM   8086  N N    . LEU B 2 47  ? -1.663  -2.202  2.249   1.00 10.41 ? 186 LEU B N    5  
ATOM   8087  C CA   . LEU B 2 47  ? -0.829  -1.617  1.162   1.00 10.82 ? 186 LEU B CA   5  
ATOM   8088  C C    . LEU B 2 47  ? 0.471   -1.072  1.759   1.00 10.91 ? 186 LEU B C    5  
ATOM   8089  O O    . LEU B 2 47  ? 0.545   -0.769  2.933   1.00 11.30 ? 186 LEU B O    5  
ATOM   8090  C CB   . LEU B 2 47  ? -1.602  -0.480  0.485   1.00 8.57  ? 186 LEU B CB   5  
ATOM   8091  C CG   . LEU B 2 47  ? -0.675  0.292   -0.456  1.00 8.23  ? 186 LEU B CG   5  
ATOM   8092  C CD1  . LEU B 2 47  ? -0.233  -0.618  -1.604  1.00 10.17 ? 186 LEU B CD1  5  
ATOM   8093  C CD2  . LEU B 2 47  ? -1.423  1.500   -1.025  1.00 8.76  ? 186 LEU B CD2  5  
ATOM   8094  H H    . LEU B 2 47  ? -2.292  -1.635  2.742   1.00 0.00  ? 186 LEU B H    5  
ATOM   8095  H HA   . LEU B 2 47  ? -0.599  -2.380  0.434   1.00 0.00  ? 186 LEU B HA   5  
ATOM   8096  H HB2  . LEU B 2 47  ? -2.426  -0.893  -0.079  1.00 0.00  ? 186 LEU B HB2  5  
ATOM   8097  H HB3  . LEU B 2 47  ? -1.985  0.191   1.240   1.00 0.00  ? 186 LEU B HB3  5  
ATOM   8098  H HG   . LEU B 2 47  ? 0.194   0.630   0.091   1.00 0.00  ? 186 LEU B HG   5  
ATOM   8099  H HD11 . LEU B 2 47  ? -0.242  -1.646  -1.272  1.00 0.00  ? 186 LEU B HD11 5  
ATOM   8100  H HD12 . LEU B 2 47  ? -0.910  -0.502  -2.437  1.00 0.00  ? 186 LEU B HD12 5  
ATOM   8101  H HD13 . LEU B 2 47  ? 0.766   -0.349  -1.913  1.00 0.00  ? 186 LEU B HD13 5  
ATOM   8102  H HD21 . LEU B 2 47  ? -2.381  1.182   -1.409  1.00 0.00  ? 186 LEU B HD21 5  
ATOM   8103  H HD22 . LEU B 2 47  ? -1.572  2.232   -0.245  1.00 0.00  ? 186 LEU B HD22 5  
ATOM   8104  H HD23 . LEU B 2 47  ? -0.842  1.939   -1.825  1.00 0.00  ? 186 LEU B HD23 5  
ATOM   8105  N N    . SER B 2 48  ? 1.497   -0.948  0.962   1.00 10.50 ? 187 SER B N    5  
ATOM   8106  C CA   . SER B 2 48  ? 2.790   -0.424  1.488   1.00 9.18  ? 187 SER B CA   5  
ATOM   8107  C C    . SER B 2 48  ? 3.410   0.527   0.463   1.00 8.50  ? 187 SER B C    5  
ATOM   8108  O O    . SER B 2 48  ? 3.316   0.314   -0.729  1.00 9.53  ? 187 SER B O    5  
ATOM   8109  C CB   . SER B 2 48  ? 3.745   -1.590  1.746   1.00 7.49  ? 187 SER B CB   5  
ATOM   8110  O OG   . SER B 2 48  ? 3.021   -2.673  2.316   1.00 5.18  ? 187 SER B OG   5  
ATOM   8111  H H    . SER B 2 48  ? 1.418   -1.200  0.019   1.00 0.00  ? 187 SER B H    5  
ATOM   8112  H HA   . SER B 2 48  ? 2.614   0.108   2.412   1.00 0.00  ? 187 SER B HA   5  
ATOM   8113  H HB2  . SER B 2 48  ? 4.186   -1.909  0.817   1.00 0.00  ? 187 SER B HB2  5  
ATOM   8114  H HB3  . SER B 2 48  ? 4.528   -1.270  2.422   1.00 0.00  ? 187 SER B HB3  5  
ATOM   8115  H HG   . SER B 2 48  ? 2.545   -3.117  1.610   1.00 0.00  ? 187 SER B HG   5  
ATOM   8116  N N    . VAL B 2 49  ? 4.043   1.575   0.914   1.00 11.78 ? 188 VAL B N    5  
ATOM   8117  C CA   . VAL B 2 49  ? 4.666   2.535   -0.040  1.00 12.79 ? 188 VAL B CA   5  
ATOM   8118  C C    . VAL B 2 49  ? 6.071   2.900   0.446   1.00 14.65 ? 188 VAL B C    5  
ATOM   8119  O O    . VAL B 2 49  ? 6.403   2.730   1.602   1.00 14.43 ? 188 VAL B O    5  
ATOM   8120  C CB   . VAL B 2 49  ? 3.811   3.801   -0.123  1.00 12.22 ? 188 VAL B CB   5  
ATOM   8121  C CG1  . VAL B 2 49  ? 4.178   4.582   -1.385  1.00 11.34 ? 188 VAL B CG1  5  
ATOM   8122  C CG2  . VAL B 2 49  ? 2.332   3.413   -0.177  1.00 12.23 ? 188 VAL B CG2  5  
ATOM   8123  H H    . VAL B 2 49  ? 4.107   1.730   1.880   1.00 0.00  ? 188 VAL B H    5  
ATOM   8124  H HA   . VAL B 2 49  ? 4.730   2.080   -1.016  1.00 0.00  ? 188 VAL B HA   5  
ATOM   8125  H HB   . VAL B 2 49  ? 3.993   4.416   0.747   1.00 0.00  ? 188 VAL B HB   5  
ATOM   8126  H HG11 . VAL B 2 49  ? 4.654   3.920   -2.094  1.00 0.00  ? 188 VAL B HG11 5  
ATOM   8127  H HG12 . VAL B 2 49  ? 3.283   4.997   -1.825  1.00 0.00  ? 188 VAL B HG12 5  
ATOM   8128  H HG13 . VAL B 2 49  ? 4.856   5.383   -1.129  1.00 0.00  ? 188 VAL B HG13 5  
ATOM   8129  H HG21 . VAL B 2 49  ? 2.242   2.379   -0.478  1.00 0.00  ? 188 VAL B HG21 5  
ATOM   8130  H HG22 . VAL B 2 49  ? 1.889   3.544   0.799   1.00 0.00  ? 188 VAL B HG22 5  
ATOM   8131  H HG23 . VAL B 2 49  ? 1.821   4.041   -0.891  1.00 0.00  ? 188 VAL B HG23 5  
ATOM   8132  N N    . SER B 2 50  ? 6.899   3.397   -0.432  1.00 14.39 ? 189 SER B N    5  
ATOM   8133  C CA   . SER B 2 50  ? 8.283   3.771   -0.025  1.00 13.97 ? 189 SER B CA   5  
ATOM   8134  C C    . SER B 2 50  ? 8.391   5.293   0.090   1.00 14.32 ? 189 SER B C    5  
ATOM   8135  O O    . SER B 2 50  ? 7.690   6.027   -0.576  1.00 13.16 ? 189 SER B O    5  
ATOM   8136  C CB   . SER B 2 50  ? 9.274   3.268   -1.074  1.00 12.52 ? 189 SER B CB   5  
ATOM   8137  O OG   . SER B 2 50  ? 8.749   3.516   -2.373  1.00 13.11 ? 189 SER B OG   5  
ATOM   8138  H H    . SER B 2 50  ? 6.611   3.525   -1.359  1.00 0.00  ? 189 SER B H    5  
ATOM   8139  H HA   . SER B 2 50  ? 8.511   3.320   0.930   1.00 0.00  ? 189 SER B HA   5  
ATOM   8140  H HB2  . SER B 2 50  ? 10.211  3.788   -0.967  1.00 0.00  ? 189 SER B HB2  5  
ATOM   8141  H HB3  . SER B 2 50  ? 9.435   2.208   -0.937  1.00 0.00  ? 189 SER B HB3  5  
ATOM   8142  H HG   . SER B 2 50  ? 9.395   3.215   -3.016  1.00 0.00  ? 189 SER B HG   5  
ATOM   8143  N N    . ASP B 2 51  ? 9.268   5.771   0.931   1.00 17.22 ? 190 ASP B N    5  
ATOM   8144  C CA   . ASP B 2 51  ? 9.424   7.245   1.088   1.00 20.71 ? 190 ASP B CA   5  
ATOM   8145  C C    . ASP B 2 51  ? 10.893  7.577   1.356   1.00 19.82 ? 190 ASP B C    5  
ATOM   8146  O O    . ASP B 2 51  ? 11.672  6.726   1.739   1.00 20.14 ? 190 ASP B O    5  
ATOM   8147  C CB   . ASP B 2 51  ? 8.569   7.726   2.261   1.00 25.05 ? 190 ASP B CB   5  
ATOM   8148  C CG   . ASP B 2 51  ? 8.142   9.175   2.023   1.00 26.93 ? 190 ASP B CG   5  
ATOM   8149  O OD1  . ASP B 2 51  ? 7.997   9.548   0.870   1.00 31.13 ? 190 ASP B OD1  5  
ATOM   8150  O OD2  . ASP B 2 51  ? 7.969   9.890   2.996   1.00 30.74 ? 190 ASP B OD2  5  
ATOM   8151  H H    . ASP B 2 51  ? 9.824   5.161   1.458   1.00 0.00  ? 190 ASP B H    5  
ATOM   8152  H HA   . ASP B 2 51  ? 9.104   7.740   0.182   1.00 0.00  ? 190 ASP B HA   5  
ATOM   8153  H HB2  . ASP B 2 51  ? 7.691   7.101   2.348   1.00 0.00  ? 190 ASP B HB2  5  
ATOM   8154  H HB3  . ASP B 2 51  ? 9.143   7.668   3.174   1.00 0.00  ? 190 ASP B HB3  5  
ATOM   8155  N N    . PHE B 2 52  ? 11.280  8.808   1.160   1.00 21.67 ? 191 PHE B N    5  
ATOM   8156  C CA   . PHE B 2 52  ? 12.699  9.192   1.405   1.00 24.27 ? 191 PHE B CA   5  
ATOM   8157  C C    . PHE B 2 52  ? 12.760  10.644  1.885   1.00 28.02 ? 191 PHE B C    5  
ATOM   8158  O O    . PHE B 2 52  ? 12.088  11.510  1.360   1.00 25.66 ? 191 PHE B O    5  
ATOM   8159  C CB   . PHE B 2 52  ? 13.497  9.046   0.106   1.00 23.13 ? 191 PHE B CB   5  
ATOM   8160  C CG   . PHE B 2 52  ? 14.881  9.622   0.295   1.00 21.13 ? 191 PHE B CG   5  
ATOM   8161  C CD1  . PHE B 2 52  ? 15.920  8.812   0.782   1.00 20.50 ? 191 PHE B CD1  5  
ATOM   8162  C CD2  . PHE B 2 52  ? 15.129  10.969  -0.021  1.00 18.20 ? 191 PHE B CD2  5  
ATOM   8163  C CE1  . PHE B 2 52  ? 17.207  9.348   0.956   1.00 19.46 ? 191 PHE B CE1  5  
ATOM   8164  C CE2  . PHE B 2 52  ? 16.417  11.505  0.153   1.00 16.51 ? 191 PHE B CE2  5  
ATOM   8165  C CZ   . PHE B 2 52  ? 17.456  10.695  0.641   1.00 17.79 ? 191 PHE B CZ   5  
ATOM   8166  H H    . PHE B 2 52  ? 10.637  9.480   0.851   1.00 0.00  ? 191 PHE B H    5  
ATOM   8167  H HA   . PHE B 2 52  ? 13.120  8.546   2.161   1.00 0.00  ? 191 PHE B HA   5  
ATOM   8168  H HB2  . PHE B 2 52  ? 13.576  8.000   -0.151  1.00 0.00  ? 191 PHE B HB2  5  
ATOM   8169  H HB3  . PHE B 2 52  ? 12.992  9.576   -0.688  1.00 0.00  ? 191 PHE B HB3  5  
ATOM   8170  H HD1  . PHE B 2 52  ? 15.729  7.777   1.025   1.00 0.00  ? 191 PHE B HD1  5  
ATOM   8171  H HD2  . PHE B 2 52  ? 14.331  11.591  -0.396  1.00 0.00  ? 191 PHE B HD2  5  
ATOM   8172  H HE1  . PHE B 2 52  ? 18.006  8.725   1.331   1.00 0.00  ? 191 PHE B HE1  5  
ATOM   8173  H HE2  . PHE B 2 52  ? 16.607  12.540  -0.090  1.00 0.00  ? 191 PHE B HE2  5  
ATOM   8174  H HZ   . PHE B 2 52  ? 18.445  11.107  0.774   1.00 0.00  ? 191 PHE B HZ   5  
ATOM   8175  N N    . ASP B 2 53  ? 13.560  10.917  2.879   1.00 32.66 ? 192 ASP B N    5  
ATOM   8176  C CA   . ASP B 2 53  ? 13.663  12.313  3.392   1.00 38.82 ? 192 ASP B CA   5  
ATOM   8177  C C    . ASP B 2 53  ? 15.129  12.750  3.392   1.00 41.14 ? 192 ASP B C    5  
ATOM   8178  O O    . ASP B 2 53  ? 16.031  11.936  3.370   1.00 38.49 ? 192 ASP B O    5  
ATOM   8179  C CB   . ASP B 2 53  ? 13.113  12.373  4.819   1.00 42.78 ? 192 ASP B CB   5  
ATOM   8180  C CG   . ASP B 2 53  ? 11.650  11.928  4.820   1.00 45.03 ? 192 ASP B CG   5  
ATOM   8181  O OD1  . ASP B 2 53  ? 11.407  10.757  4.578   1.00 46.40 ? 192 ASP B OD1  5  
ATOM   8182  O OD2  . ASP B 2 53  ? 10.797  12.765  5.064   1.00 49.15 ? 192 ASP B OD2  5  
ATOM   8183  H H    . ASP B 2 53  ? 14.093  10.204  3.288   1.00 0.00  ? 192 ASP B H    5  
ATOM   8184  H HA   . ASP B 2 53  ? 13.091  12.972  2.757   1.00 0.00  ? 192 ASP B HA   5  
ATOM   8185  H HB2  . ASP B 2 53  ? 13.691  11.717  5.454   1.00 0.00  ? 192 ASP B HB2  5  
ATOM   8186  H HB3  . ASP B 2 53  ? 13.181  13.385  5.188   1.00 0.00  ? 192 ASP B HB3  5  
ATOM   8187  N N    . ASN B 2 54  ? 15.376  14.032  3.414   1.00 45.91 ? 193 ASN B N    5  
ATOM   8188  C CA   . ASN B 2 54  ? 16.782  14.521  3.414   1.00 50.53 ? 193 ASN B CA   5  
ATOM   8189  C C    . ASN B 2 54  ? 17.272  14.669  4.856   1.00 51.37 ? 193 ASN B C    5  
ATOM   8190  O O    . ASN B 2 54  ? 17.745  15.714  5.256   1.00 52.38 ? 193 ASN B O    5  
ATOM   8191  C CB   . ASN B 2 54  ? 16.849  15.879  2.711   1.00 54.84 ? 193 ASN B CB   5  
ATOM   8192  C CG   . ASN B 2 54  ? 16.819  15.670  1.195   1.00 60.46 ? 193 ASN B CG   5  
ATOM   8193  O OD1  . ASN B 2 54  ? 15.765  15.500  0.615   1.00 63.78 ? 193 ASN B OD1  5  
ATOM   8194  N ND2  . ASN B 2 54  ? 17.940  15.677  0.526   1.00 62.09 ? 193 ASN B ND2  5  
ATOM   8195  H H    . ASN B 2 54  ? 14.637  14.671  3.431   1.00 0.00  ? 193 ASN B H    5  
ATOM   8196  H HA   . ASN B 2 54  ? 17.405  13.814  2.893   1.00 0.00  ? 193 ASN B HA   5  
ATOM   8197  H HB2  . ASN B 2 54  ? 16.004  16.481  3.010   1.00 0.00  ? 193 ASN B HB2  5  
ATOM   8198  H HB3  . ASN B 2 54  ? 17.765  16.380  2.985   1.00 0.00  ? 193 ASN B HB3  5  
ATOM   8199  H HD21 . ASN B 2 54  ? 18.793  15.814  0.997   1.00 0.00  ? 193 ASN B HD21 5  
ATOM   8200  H HD22 . ASN B 2 54  ? 17.929  15.543  -0.449  1.00 0.00  ? 193 ASN B HD22 5  
ATOM   8201  N N    . ALA B 2 55  ? 17.164  13.631  5.639   1.00 51.03 ? 194 ALA B N    5  
ATOM   8202  C CA   . ALA B 2 55  ? 17.625  13.715  7.054   1.00 49.87 ? 194 ALA B CA   5  
ATOM   8203  C C    . ALA B 2 55  ? 17.989  12.316  7.556   1.00 48.78 ? 194 ALA B C    5  
ATOM   8204  O O    . ALA B 2 55  ? 19.110  12.058  7.947   1.00 50.16 ? 194 ALA B O    5  
ATOM   8205  C CB   . ALA B 2 55  ? 16.506  14.293  7.922   1.00 50.70 ? 194 ALA B CB   5  
ATOM   8206  H H    . ALA B 2 55  ? 16.779  12.797  5.297   1.00 0.00  ? 194 ALA B H    5  
ATOM   8207  H HA   . ALA B 2 55  ? 18.493  14.355  7.112   1.00 0.00  ? 194 ALA B HA   5  
ATOM   8208  H HB1  . ALA B 2 55  ? 15.828  14.862  7.304   1.00 0.00  ? 194 ALA B HB1  5  
ATOM   8209  H HB2  . ALA B 2 55  ? 15.967  13.487  8.398   1.00 0.00  ? 194 ALA B HB2  5  
ATOM   8210  H HB3  . ALA B 2 55  ? 16.931  14.936  8.678   1.00 0.00  ? 194 ALA B HB3  5  
ATOM   8211  N N    . LYS B 2 56  ? 17.050  11.410  7.547   1.00 45.35 ? 195 LYS B N    5  
ATOM   8212  C CA   . LYS B 2 56  ? 17.343  10.029  8.024   1.00 41.76 ? 195 LYS B CA   5  
ATOM   8213  C C    . LYS B 2 56  ? 17.633  9.125   6.824   1.00 38.59 ? 195 LYS B C    5  
ATOM   8214  O O    . LYS B 2 56  ? 18.763  8.763   6.566   1.00 39.85 ? 195 LYS B O    5  
ATOM   8215  C CB   . LYS B 2 56  ? 16.135  9.487   8.790   1.00 42.95 ? 195 LYS B CB   5  
ATOM   8216  C CG   . LYS B 2 56  ? 16.160  10.015  10.225  1.00 45.27 ? 195 LYS B CG   5  
ATOM   8217  C CD   . LYS B 2 56  ? 14.883  9.585   10.950  1.00 47.56 ? 195 LYS B CD   5  
ATOM   8218  C CE   . LYS B 2 56  ? 14.703  10.430  12.212  1.00 50.16 ? 195 LYS B CE   5  
ATOM   8219  N NZ   . LYS B 2 56  ? 15.194  9.667   13.394  1.00 50.69 ? 195 LYS B NZ   5  
ATOM   8220  H H    . LYS B 2 56  ? 16.152  11.638  7.228   1.00 0.00  ? 195 LYS B H    5  
ATOM   8221  H HA   . LYS B 2 56  ? 18.203  10.048  8.677   1.00 0.00  ? 195 LYS B HA   5  
ATOM   8222  H HB2  . LYS B 2 56  ? 15.227  9.810   8.302   1.00 0.00  ? 195 LYS B HB2  5  
ATOM   8223  H HB3  . LYS B 2 56  ? 16.172  8.408   8.804   1.00 0.00  ? 195 LYS B HB3  5  
ATOM   8224  H HG2  . LYS B 2 56  ? 17.021  9.614   10.741  1.00 0.00  ? 195 LYS B HG2  5  
ATOM   8225  H HG3  . LYS B 2 56  ? 16.218  11.093  10.211  1.00 0.00  ? 195 LYS B HG3  5  
ATOM   8226  H HD2  . LYS B 2 56  ? 14.034  9.726   10.296  1.00 0.00  ? 195 LYS B HD2  5  
ATOM   8227  H HD3  . LYS B 2 56  ? 14.958  8.544   11.224  1.00 0.00  ? 195 LYS B HD3  5  
ATOM   8228  H HE2  . LYS B 2 56  ? 15.266  11.346  12.116  1.00 0.00  ? 195 LYS B HE2  5  
ATOM   8229  H HE3  . LYS B 2 56  ? 13.657  10.662  12.343  1.00 0.00  ? 195 LYS B HE3  5  
ATOM   8230  H HZ1  . LYS B 2 56  ? 16.188  9.403   13.249  1.00 0.00  ? 195 LYS B HZ1  5  
ATOM   8231  H HZ2  . LYS B 2 56  ? 15.115  10.257  14.245  1.00 0.00  ? 195 LYS B HZ2  5  
ATOM   8232  H HZ3  . LYS B 2 56  ? 14.620  8.807   13.514  1.00 0.00  ? 195 LYS B HZ3  5  
ATOM   8233  N N    . GLY B 2 57  ? 16.620  8.760   6.086   1.00 34.40 ? 196 GLY B N    5  
ATOM   8234  C CA   . GLY B 2 57  ? 16.839  7.881   4.903   1.00 29.38 ? 196 GLY B CA   5  
ATOM   8235  C C    . GLY B 2 57  ? 15.490  7.507   4.286   1.00 25.82 ? 196 GLY B C    5  
ATOM   8236  O O    . GLY B 2 57  ? 14.532  8.251   4.368   1.00 25.14 ? 196 GLY B O    5  
ATOM   8237  H H    . GLY B 2 57  ? 15.716  9.064   6.311   1.00 0.00  ? 196 GLY B H    5  
ATOM   8238  H HA2  . GLY B 2 57  ? 17.438  8.404   4.172   1.00 0.00  ? 196 GLY B HA2  5  
ATOM   8239  H HA3  . GLY B 2 57  ? 17.351  6.982   5.213   1.00 0.00  ? 196 GLY B HA3  5  
ATOM   8240  N N    . LEU B 2 58  ? 15.407  6.361   3.670   1.00 25.09 ? 197 LEU B N    5  
ATOM   8241  C CA   . LEU B 2 58  ? 14.120  5.941   3.047   1.00 24.92 ? 197 LEU B CA   5  
ATOM   8242  C C    . LEU B 2 58  ? 13.344  5.055   4.023   1.00 23.75 ? 197 LEU B C    5  
ATOM   8243  O O    . LEU B 2 58  ? 13.826  4.033   4.468   1.00 23.93 ? 197 LEU B O    5  
ATOM   8244  C CB   . LEU B 2 58  ? 14.405  5.157   1.765   1.00 25.84 ? 197 LEU B CB   5  
ATOM   8245  C CG   . LEU B 2 58  ? 15.442  4.070   2.048   1.00 30.07 ? 197 LEU B CG   5  
ATOM   8246  C CD1  . LEU B 2 58  ? 14.901  2.714   1.592   1.00 29.71 ? 197 LEU B CD1  5  
ATOM   8247  C CD2  . LEU B 2 58  ? 16.731  4.386   1.286   1.00 30.59 ? 197 LEU B CD2  5  
ATOM   8248  H H    . LEU B 2 58  ? 16.192  5.777   3.615   1.00 0.00  ? 197 LEU B H    5  
ATOM   8249  H HA   . LEU B 2 58  ? 13.533  6.815   2.811   1.00 0.00  ? 197 LEU B HA   5  
ATOM   8250  H HB2  . LEU B 2 58  ? 13.491  4.701   1.411   1.00 0.00  ? 197 LEU B HB2  5  
ATOM   8251  H HB3  . LEU B 2 58  ? 14.787  5.828   1.010   1.00 0.00  ? 197 LEU B HB3  5  
ATOM   8252  H HG   . LEU B 2 58  ? 15.647  4.036   3.108   1.00 0.00  ? 197 LEU B HG   5  
ATOM   8253  H HD11 . LEU B 2 58  ? 13.897  2.584   1.966   1.00 0.00  ? 197 LEU B HD11 5  
ATOM   8254  H HD12 . LEU B 2 58  ? 14.892  2.675   0.513   1.00 0.00  ? 197 LEU B HD12 5  
ATOM   8255  H HD13 . LEU B 2 58  ? 15.533  1.926   1.975   1.00 0.00  ? 197 LEU B HD13 5  
ATOM   8256  H HD21 . LEU B 2 58  ? 16.672  5.384   0.878   1.00 0.00  ? 197 LEU B HD21 5  
ATOM   8257  H HD22 . LEU B 2 58  ? 17.573  4.322   1.959   1.00 0.00  ? 197 LEU B HD22 5  
ATOM   8258  H HD23 . LEU B 2 58  ? 16.858  3.675   0.482   1.00 0.00  ? 197 LEU B HD23 5  
ATOM   8259  N N    . ASN B 2 59  ? 12.142  5.439   4.359   1.00 21.78 ? 198 ASN B N    5  
ATOM   8260  C CA   . ASN B 2 59  ? 11.334  4.618   5.304   1.00 19.17 ? 198 ASN B CA   5  
ATOM   8261  C C    . ASN B 2 59  ? 10.169  3.974   4.550   1.00 16.90 ? 198 ASN B C    5  
ATOM   8262  O O    . ASN B 2 59  ? 9.931   4.261   3.395   1.00 15.60 ? 198 ASN B O    5  
ATOM   8263  C CB   . ASN B 2 59  ? 10.789  5.511   6.420   1.00 18.45 ? 198 ASN B CB   5  
ATOM   8264  C CG   . ASN B 2 59  ? 11.906  6.419   6.939   1.00 20.04 ? 198 ASN B CG   5  
ATOM   8265  O OD1  . ASN B 2 59  ? 12.444  6.191   8.005   1.00 23.65 ? 198 ASN B OD1  5  
ATOM   8266  N ND2  . ASN B 2 59  ? 12.279  7.447   6.228   1.00 21.55 ? 198 ASN B ND2  5  
ATOM   8267  H H    . ASN B 2 59  ? 11.770  6.266   3.988   1.00 0.00  ? 198 ASN B H    5  
ATOM   8268  H HA   . ASN B 2 59  ? 11.957  3.846   5.733   1.00 0.00  ? 198 ASN B HA   5  
ATOM   8269  H HB2  . ASN B 2 59  ? 9.982   6.118   6.033   1.00 0.00  ? 198 ASN B HB2  5  
ATOM   8270  H HB3  . ASN B 2 59  ? 10.422  4.896   7.228   1.00 0.00  ? 198 ASN B HB3  5  
ATOM   8271  H HD21 . ASN B 2 59  ? 11.842  7.631   5.365   1.00 0.00  ? 198 ASN B HD21 5  
ATOM   8272  H HD22 . ASN B 2 59  ? 12.996  8.035   6.555   1.00 0.00  ? 198 ASN B HD22 5  
ATOM   8273  N N    . VAL B 2 60  ? 9.441   3.105   5.195   1.00 14.62 ? 199 VAL B N    5  
ATOM   8274  C CA   . VAL B 2 60  ? 8.292   2.444   4.512   1.00 11.82 ? 199 VAL B CA   5  
ATOM   8275  C C    . VAL B 2 60  ? 6.997   2.778   5.252   1.00 10.68 ? 199 VAL B C    5  
ATOM   8276  O O    . VAL B 2 60  ? 6.817   2.425   6.400   1.00 13.24 ? 199 VAL B O    5  
ATOM   8277  C CB   . VAL B 2 60  ? 8.502   0.929   4.513   1.00 9.61  ? 199 VAL B CB   5  
ATOM   8278  C CG1  . VAL B 2 60  ? 7.596   0.287   3.461   1.00 11.94 ? 199 VAL B CG1  5  
ATOM   8279  C CG2  . VAL B 2 60  ? 9.963   0.618   4.183   1.00 10.00 ? 199 VAL B CG2  5  
ATOM   8280  H H    . VAL B 2 60  ? 9.648   2.885   6.127   1.00 0.00  ? 199 VAL B H    5  
ATOM   8281  H HA   . VAL B 2 60  ? 8.227   2.798   3.494   1.00 0.00  ? 199 VAL B HA   5  
ATOM   8282  H HB   . VAL B 2 60  ? 8.258   0.533   5.487   1.00 0.00  ? 199 VAL B HB   5  
ATOM   8283  H HG11 . VAL B 2 60  ? 6.687   0.862   3.370   1.00 0.00  ? 199 VAL B HG11 5  
ATOM   8284  H HG12 . VAL B 2 60  ? 8.107   0.268   2.509   1.00 0.00  ? 199 VAL B HG12 5  
ATOM   8285  H HG13 . VAL B 2 60  ? 7.356   -0.722  3.761   1.00 0.00  ? 199 VAL B HG13 5  
ATOM   8286  H HG21 . VAL B 2 60  ? 10.609  1.205   4.821   1.00 0.00  ? 199 VAL B HG21 5  
ATOM   8287  H HG22 . VAL B 2 60  ? 10.153  -0.432  4.347   1.00 0.00  ? 199 VAL B HG22 5  
ATOM   8288  H HG23 . VAL B 2 60  ? 10.159  0.863   3.150   1.00 0.00  ? 199 VAL B HG23 5  
ATOM   8289  N N    . LYS B 2 61  ? 6.089   3.456   4.604   1.00 11.30 ? 200 LYS B N    5  
ATOM   8290  C CA   . LYS B 2 61  ? 4.807   3.809   5.269   1.00 11.14 ? 200 LYS B CA   5  
ATOM   8291  C C    . LYS B 2 61  ? 3.779   2.707   5.007   1.00 8.78  ? 200 LYS B C    5  
ATOM   8292  O O    . LYS B 2 61  ? 3.333   2.513   3.894   1.00 9.63  ? 200 LYS B O    5  
ATOM   8293  C CB   . LYS B 2 61  ? 4.292   5.134   4.706   1.00 11.27 ? 200 LYS B CB   5  
ATOM   8294  C CG   . LYS B 2 61  ? 5.241   6.263   5.112   1.00 16.97 ? 200 LYS B CG   5  
ATOM   8295  C CD   . LYS B 2 61  ? 4.940   6.693   6.549   1.00 21.04 ? 200 LYS B CD   5  
ATOM   8296  C CE   . LYS B 2 61  ? 6.086   7.557   7.075   1.00 28.12 ? 200 LYS B CE   5  
ATOM   8297  N NZ   . LYS B 2 61  ? 5.531   8.702   7.851   1.00 32.40 ? 200 LYS B NZ   5  
ATOM   8298  H H    . LYS B 2 61  ? 6.250   3.731   3.677   1.00 0.00  ? 200 LYS B H    5  
ATOM   8299  H HA   . LYS B 2 61  ? 4.967   3.907   6.333   1.00 0.00  ? 200 LYS B HA   5  
ATOM   8300  H HB2  . LYS B 2 61  ? 4.244   5.072   3.628   1.00 0.00  ? 200 LYS B HB2  5  
ATOM   8301  H HB3  . LYS B 2 61  ? 3.309   5.334   5.100   1.00 0.00  ? 200 LYS B HB3  5  
ATOM   8302  H HG2  . LYS B 2 61  ? 6.262   5.917   5.045   1.00 0.00  ? 200 LYS B HG2  5  
ATOM   8303  H HG3  . LYS B 2 61  ? 5.102   7.104   4.450   1.00 0.00  ? 200 LYS B HG3  5  
ATOM   8304  H HD2  . LYS B 2 61  ? 4.020   7.261   6.570   1.00 0.00  ? 200 LYS B HD2  5  
ATOM   8305  H HD3  . LYS B 2 61  ? 4.836   5.817   7.172   1.00 0.00  ? 200 LYS B HD3  5  
ATOM   8306  H HE2  . LYS B 2 61  ? 6.722   6.962   7.715   1.00 0.00  ? 200 LYS B HE2  5  
ATOM   8307  H HE3  . LYS B 2 61  ? 6.665   7.932   6.243   1.00 0.00  ? 200 LYS B HE3  5  
ATOM   8308  H HZ1  . LYS B 2 61  ? 4.790   8.358   8.494   1.00 0.00  ? 200 LYS B HZ1  5  
ATOM   8309  H HZ2  . LYS B 2 61  ? 6.292   9.147   8.404   1.00 0.00  ? 200 LYS B HZ2  5  
ATOM   8310  H HZ3  . LYS B 2 61  ? 5.123   9.399   7.197   1.00 0.00  ? 200 LYS B HZ3  5  
ATOM   8311  N N    . HIS B 2 62  ? 3.402   1.980   6.023   1.00 7.82  ? 201 HIS B N    5  
ATOM   8312  C CA   . HIS B 2 62  ? 2.408   0.888   5.829   1.00 7.41  ? 201 HIS B CA   5  
ATOM   8313  C C    . HIS B 2 62  ? 0.992   1.448   5.989   1.00 9.79  ? 201 HIS B C    5  
ATOM   8314  O O    . HIS B 2 62  ? 0.618   1.929   7.040   1.00 10.36 ? 201 HIS B O    5  
ATOM   8315  C CB   . HIS B 2 62  ? 2.644   -0.206  6.871   1.00 6.15  ? 201 HIS B CB   5  
ATOM   8316  C CG   . HIS B 2 62  ? 3.878   -0.987  6.505   1.00 5.80  ? 201 HIS B CG   5  
ATOM   8317  N ND1  . HIS B 2 62  ? 4.001   -1.647  5.293   1.00 7.97  ? 201 HIS B ND1  5  
ATOM   8318  C CD2  . HIS B 2 62  ? 5.050   -1.220  7.180   1.00 7.69  ? 201 HIS B CD2  5  
ATOM   8319  C CE1  . HIS B 2 62  ? 5.209   -2.241  5.276   1.00 7.75  ? 201 HIS B CE1  5  
ATOM   8320  N NE2  . HIS B 2 62  ? 5.890   -2.011  6.403   1.00 6.51  ? 201 HIS B NE2  5  
ATOM   8321  H H    . HIS B 2 62  ? 3.776   2.150   6.913   1.00 0.00  ? 201 HIS B H    5  
ATOM   8322  H HA   . HIS B 2 62  ? 2.519   0.473   4.839   1.00 0.00  ? 201 HIS B HA   5  
ATOM   8323  H HB2  . HIS B 2 62  ? 2.779   0.244   7.844   1.00 0.00  ? 201 HIS B HB2  5  
ATOM   8324  H HB3  . HIS B 2 62  ? 1.794   -0.870  6.895   1.00 0.00  ? 201 HIS B HB3  5  
ATOM   8325  H HD1  . HIS B 2 62  ? 3.331   -1.678  4.579   1.00 0.00  ? 201 HIS B HD1  5  
ATOM   8326  H HD2  . HIS B 2 62  ? 5.285   -0.845  8.166   1.00 0.00  ? 201 HIS B HD2  5  
ATOM   8327  H HE1  . HIS B 2 62  ? 5.583   -2.829  4.452   1.00 0.00  ? 201 HIS B HE1  5  
ATOM   8328  N N    . TYR B 2 63  ? 0.203   1.388   4.951   1.00 10.61 ? 202 TYR B N    5  
ATOM   8329  C CA   . TYR B 2 63  ? -1.187  1.913   5.038   1.00 10.61 ? 202 TYR B CA   5  
ATOM   8330  C C    . TYR B 2 63  ? -2.174  0.743   5.010   1.00 10.67 ? 202 TYR B C    5  
ATOM   8331  O O    . TYR B 2 63  ? -2.578  0.286   3.960   1.00 11.97 ? 202 TYR B O    5  
ATOM   8332  C CB   . TYR B 2 63  ? -1.453  2.832   3.846   1.00 10.02 ? 202 TYR B CB   5  
ATOM   8333  C CG   . TYR B 2 63  ? -0.796  4.171   4.086   1.00 10.20 ? 202 TYR B CG   5  
ATOM   8334  C CD1  . TYR B 2 63  ? -1.327  5.052   5.042   1.00 10.92 ? 202 TYR B CD1  5  
ATOM   8335  C CD2  . TYR B 2 63  ? 0.347   4.533   3.354   1.00 9.08  ? 202 TYR B CD2  5  
ATOM   8336  C CE1  . TYR B 2 63  ? -0.715  6.298   5.266   1.00 11.72 ? 202 TYR B CE1  5  
ATOM   8337  C CE2  . TYR B 2 63  ? 0.958   5.779   3.577   1.00 11.32 ? 202 TYR B CE2  5  
ATOM   8338  C CZ   . TYR B 2 63  ? 0.428   6.660   4.534   1.00 12.88 ? 202 TYR B CZ   5  
ATOM   8339  O OH   . TYR B 2 63  ? 1.029   7.883   4.753   1.00 13.22 ? 202 TYR B OH   5  
ATOM   8340  H H    . TYR B 2 63  ? 0.524   0.998   4.113   1.00 0.00  ? 202 TYR B H    5  
ATOM   8341  H HA   . TYR B 2 63  ? -1.308  2.467   5.957   1.00 0.00  ? 202 TYR B HA   5  
ATOM   8342  H HB2  . TYR B 2 63  ? -1.047  2.385   2.950   1.00 0.00  ? 202 TYR B HB2  5  
ATOM   8343  H HB3  . TYR B 2 63  ? -2.516  2.969   3.729   1.00 0.00  ? 202 TYR B HB3  5  
ATOM   8344  H HD1  . TYR B 2 63  ? -2.206  4.773   5.605   1.00 0.00  ? 202 TYR B HD1  5  
ATOM   8345  H HD2  . TYR B 2 63  ? 0.755   3.856   2.619   1.00 0.00  ? 202 TYR B HD2  5  
ATOM   8346  H HE1  . TYR B 2 63  ? -1.124  6.975   6.001   1.00 0.00  ? 202 TYR B HE1  5  
ATOM   8347  H HE2  . TYR B 2 63  ? 1.836   6.058   3.014   1.00 0.00  ? 202 TYR B HE2  5  
ATOM   8348  H HH   . TYR B 2 63  ? 1.592   7.802   5.527   1.00 0.00  ? 202 TYR B HH   5  
ATOM   8349  N N    . LYS B 2 64  ? -2.563  0.254   6.155   1.00 11.16 ? 203 LYS B N    5  
ATOM   8350  C CA   . LYS B 2 64  ? -3.521  -0.886  6.191   1.00 13.85 ? 203 LYS B CA   5  
ATOM   8351  C C    . LYS B 2 64  ? -4.775  -0.528  5.391   1.00 13.44 ? 203 LYS B C    5  
ATOM   8352  O O    . LYS B 2 64  ? -5.392  0.495   5.611   1.00 12.80 ? 203 LYS B O    5  
ATOM   8353  C CB   . LYS B 2 64  ? -3.910  -1.180  7.642   1.00 19.04 ? 203 LYS B CB   5  
ATOM   8354  C CG   . LYS B 2 64  ? -4.304  0.123   8.340   1.00 23.92 ? 203 LYS B CG   5  
ATOM   8355  C CD   . LYS B 2 64  ? -5.316  -0.176  9.448   1.00 29.39 ? 203 LYS B CD   5  
ATOM   8356  C CE   . LYS B 2 64  ? -4.628  -0.949  10.574  1.00 31.37 ? 203 LYS B CE   5  
ATOM   8357  N NZ   . LYS B 2 64  ? -5.404  -2.185  10.875  1.00 36.57 ? 203 LYS B NZ   5  
ATOM   8358  H H    . LYS B 2 64  ? -2.224  0.636   6.992   1.00 0.00  ? 203 LYS B H    5  
ATOM   8359  H HA   . LYS B 2 64  ? -3.056  -1.761  5.760   1.00 0.00  ? 203 LYS B HA   5  
ATOM   8360  H HB2  . LYS B 2 64  ? -4.746  -1.865  7.659   1.00 0.00  ? 203 LYS B HB2  5  
ATOM   8361  H HB3  . LYS B 2 64  ? -3.071  -1.623  8.157   1.00 0.00  ? 203 LYS B HB3  5  
ATOM   8362  H HG2  . LYS B 2 64  ? -3.425  0.581   8.769   1.00 0.00  ? 203 LYS B HG2  5  
ATOM   8363  H HG3  . LYS B 2 64  ? -4.747  0.797   7.622   1.00 0.00  ? 203 LYS B HG3  5  
ATOM   8364  H HD2  . LYS B 2 64  ? -5.711  0.753   9.835   1.00 0.00  ? 203 LYS B HD2  5  
ATOM   8365  H HD3  . LYS B 2 64  ? -6.123  -0.771  9.047   1.00 0.00  ? 203 LYS B HD3  5  
ATOM   8366  H HE2  . LYS B 2 64  ? -3.628  -1.217  10.268  1.00 0.00  ? 203 LYS B HE2  5  
ATOM   8367  H HE3  . LYS B 2 64  ? -4.579  -0.330  11.457  1.00 0.00  ? 203 LYS B HE3  5  
ATOM   8368  H HZ1  . LYS B 2 64  ? -6.390  -1.930  11.091  1.00 0.00  ? 203 LYS B HZ1  5  
ATOM   8369  H HZ2  . LYS B 2 64  ? -5.381  -2.818  10.051  1.00 0.00  ? 203 LYS B HZ2  5  
ATOM   8370  H HZ3  . LYS B 2 64  ? -4.983  -2.668  11.693  1.00 0.00  ? 203 LYS B HZ3  5  
ATOM   8371  N N    . ILE B 2 65  ? -5.159  -1.366  4.467   1.00 14.05 ? 204 ILE B N    5  
ATOM   8372  C CA   . ILE B 2 65  ? -6.375  -1.077  3.655   1.00 13.51 ? 204 ILE B CA   5  
ATOM   8373  C C    . ILE B 2 65  ? -7.598  -1.670  4.357   1.00 14.04 ? 204 ILE B C    5  
ATOM   8374  O O    . ILE B 2 65  ? -7.689  -2.864  4.562   1.00 15.82 ? 204 ILE B O    5  
ATOM   8375  C CB   . ILE B 2 65  ? -6.221  -1.705  2.267   1.00 12.30 ? 204 ILE B CB   5  
ATOM   8376  C CG1  . ILE B 2 65  ? -5.147  -0.948  1.483   1.00 11.29 ? 204 ILE B CG1  5  
ATOM   8377  C CG2  . ILE B 2 65  ? -7.551  -1.624  1.514   1.00 14.21 ? 204 ILE B CG2  5  
ATOM   8378  C CD1  . ILE B 2 65  ? -4.912  -1.642  0.140   1.00 13.89 ? 204 ILE B CD1  5  
ATOM   8379  H H    . ILE B 2 65  ? -4.650  -2.188  4.308   1.00 0.00  ? 204 ILE B H    5  
ATOM   8380  H HA   . ILE B 2 65  ? -6.500  -0.009  3.556   1.00 0.00  ? 204 ILE B HA   5  
ATOM   8381  H HB   . ILE B 2 65  ? -5.929  -2.740  2.372   1.00 0.00  ? 204 ILE B HB   5  
ATOM   8382  H HG12 . ILE B 2 65  ? -5.475  0.067   1.312   1.00 0.00  ? 204 ILE B HG12 5  
ATOM   8383  H HG13 . ILE B 2 65  ? -4.227  -0.939  2.048   1.00 0.00  ? 204 ILE B HG13 5  
ATOM   8384  H HG21 . ILE B 2 65  ? -8.337  -2.044  2.124   1.00 0.00  ? 204 ILE B HG21 5  
ATOM   8385  H HG22 . ILE B 2 65  ? -7.778  -0.591  1.295   1.00 0.00  ? 204 ILE B HG22 5  
ATOM   8386  H HG23 . ILE B 2 65  ? -7.476  -2.179  0.591   1.00 0.00  ? 204 ILE B HG23 5  
ATOM   8387  H HD11 . ILE B 2 65  ? -5.858  -1.794  -0.357  1.00 0.00  ? 204 ILE B HD11 5  
ATOM   8388  H HD12 . ILE B 2 65  ? -4.275  -1.025  -0.477  1.00 0.00  ? 204 ILE B HD12 5  
ATOM   8389  H HD13 . ILE B 2 65  ? -4.435  -2.596  0.307   1.00 0.00  ? 204 ILE B HD13 5  
ATOM   8390  N N    . ARG B 2 66  ? -8.535  -0.845  4.734   1.00 15.56 ? 205 ARG B N    5  
ATOM   8391  C CA   . ARG B 2 66  ? -9.744  -1.364  5.430   1.00 13.76 ? 205 ARG B CA   5  
ATOM   8392  C C    . ARG B 2 66  ? -10.714 -1.962  4.415   1.00 13.72 ? 205 ARG B C    5  
ATOM   8393  O O    . ARG B 2 66  ? -10.611 -1.733  3.226   1.00 13.25 ? 205 ARG B O    5  
ATOM   8394  C CB   . ARG B 2 66  ? -10.434 -0.225  6.179   1.00 15.23 ? 205 ARG B CB   5  
ATOM   8395  C CG   . ARG B 2 66  ? -9.456  0.383   7.179   1.00 20.69 ? 205 ARG B CG   5  
ATOM   8396  C CD   . ARG B 2 66  ? -10.180 0.665   8.497   1.00 28.70 ? 205 ARG B CD   5  
ATOM   8397  N NE   . ARG B 2 66  ? -9.840  2.037   8.969   1.00 38.45 ? 205 ARG B NE   5  
ATOM   8398  C CZ   . ARG B 2 66  ? -10.278 2.456   10.125  1.00 41.91 ? 205 ARG B CZ   5  
ATOM   8399  N NH1  . ARG B 2 66  ? -11.376 1.959   10.626  1.00 44.96 ? 205 ARG B NH1  5  
ATOM   8400  N NH2  . ARG B 2 66  ? -9.618  3.370   10.782  1.00 41.78 ? 205 ARG B NH2  5  
ATOM   8401  H H    . ARG B 2 66  ? -8.441  0.115   4.565   1.00 0.00  ? 205 ARG B H    5  
ATOM   8402  H HA   . ARG B 2 66  ? -9.450  -2.127  6.135   1.00 0.00  ? 205 ARG B HA   5  
ATOM   8403  H HB2  . ARG B 2 66  ? -10.749 0.530   5.474   1.00 0.00  ? 205 ARG B HB2  5  
ATOM   8404  H HB3  . ARG B 2 66  ? -11.295 -0.608  6.706   1.00 0.00  ? 205 ARG B HB3  5  
ATOM   8405  H HG2  . ARG B 2 66  ? -8.646  -0.312  7.352   1.00 0.00  ? 205 ARG B HG2  5  
ATOM   8406  H HG3  . ARG B 2 66  ? -9.062  1.304   6.780   1.00 0.00  ? 205 ARG B HG3  5  
ATOM   8407  H HD2  . ARG B 2 66  ? -11.247 0.593   8.344   1.00 0.00  ? 205 ARG B HD2  5  
ATOM   8408  H HD3  . ARG B 2 66  ? -9.873  -0.058  9.238   1.00 0.00  ? 205 ARG B HD3  5  
ATOM   8409  H HE   . ARG B 2 66  ? -9.288  2.624   8.412   1.00 0.00  ? 205 ARG B HE   5  
ATOM   8410  H HH11 . ARG B 2 66  ? -11.882 1.258   10.123  1.00 0.00  ? 205 ARG B HH11 5  
ATOM   8411  H HH12 . ARG B 2 66  ? -11.711 2.280   11.512  1.00 0.00  ? 205 ARG B HH12 5  
ATOM   8412  H HH21 . ARG B 2 66  ? -8.776  3.752   10.399  1.00 0.00  ? 205 ARG B HH21 5  
ATOM   8413  H HH22 . ARG B 2 66  ? -9.953  3.691   11.667  1.00 0.00  ? 205 ARG B HH22 5  
ATOM   8414  N N    . LYS B 2 67  ? -11.657 -2.728  4.885   1.00 14.89 ? 206 LYS B N    5  
ATOM   8415  C CA   . LYS B 2 67  ? -12.645 -3.355  3.962   1.00 18.13 ? 206 LYS B CA   5  
ATOM   8416  C C    . LYS B 2 67  ? -14.020 -3.397  4.637   1.00 17.74 ? 206 LYS B C    5  
ATOM   8417  O O    . LYS B 2 67  ? -14.187 -3.977  5.692   1.00 18.39 ? 206 LYS B O    5  
ATOM   8418  C CB   . LYS B 2 67  ? -12.193 -4.780  3.632   1.00 21.97 ? 206 LYS B CB   5  
ATOM   8419  C CG   . LYS B 2 67  ? -13.317 -5.525  2.907   1.00 27.97 ? 206 LYS B CG   5  
ATOM   8420  C CD   . LYS B 2 67  ? -12.733 -6.333  1.747   1.00 32.27 ? 206 LYS B CD   5  
ATOM   8421  C CE   . LYS B 2 67  ? -13.156 -7.798  1.881   1.00 33.99 ? 206 LYS B CE   5  
ATOM   8422  N NZ   . LYS B 2 67  ? -13.127 -8.447  0.540   1.00 35.74 ? 206 LYS B NZ   5  
ATOM   8423  H H    . LYS B 2 67  ? -11.713 -2.891  5.849   1.00 0.00  ? 206 LYS B H    5  
ATOM   8424  H HA   . LYS B 2 67  ? -12.707 -2.776  3.053   1.00 0.00  ? 206 LYS B HA   5  
ATOM   8425  H HB2  . LYS B 2 67  ? -11.319 -4.740  2.998   1.00 0.00  ? 206 LYS B HB2  5  
ATOM   8426  H HB3  . LYS B 2 67  ? -11.950 -5.301  4.546   1.00 0.00  ? 206 LYS B HB3  5  
ATOM   8427  H HG2  . LYS B 2 67  ? -13.810 -6.192  3.599   1.00 0.00  ? 206 LYS B HG2  5  
ATOM   8428  H HG3  . LYS B 2 67  ? -14.032 -4.813  2.523   1.00 0.00  ? 206 LYS B HG3  5  
ATOM   8429  H HD2  . LYS B 2 67  ? -13.101 -5.936  0.811   1.00 0.00  ? 206 LYS B HD2  5  
ATOM   8430  H HD3  . LYS B 2 67  ? -11.656 -6.268  1.768   1.00 0.00  ? 206 LYS B HD3  5  
ATOM   8431  H HE2  . LYS B 2 67  ? -12.475 -8.310  2.544   1.00 0.00  ? 206 LYS B HE2  5  
ATOM   8432  H HE3  . LYS B 2 67  ? -14.157 -7.848  2.284   1.00 0.00  ? 206 LYS B HE3  5  
ATOM   8433  H HZ1  . LYS B 2 67  ? -13.214 -7.720  -0.199  1.00 0.00  ? 206 LYS B HZ1  5  
ATOM   8434  H HZ2  . LYS B 2 67  ? -12.230 -8.958  0.421   1.00 0.00  ? 206 LYS B HZ2  5  
ATOM   8435  H HZ3  . LYS B 2 67  ? -13.918 -9.118  0.462   1.00 0.00  ? 206 LYS B HZ3  5  
ATOM   8436  N N    . LEU B 2 68  ? -15.006 -2.794  4.032   1.00 17.31 ? 207 LEU B N    5  
ATOM   8437  C CA   . LEU B 2 68  ? -16.369 -2.808  4.634   1.00 19.33 ? 207 LEU B CA   5  
ATOM   8438  C C    . LEU B 2 68  ? -16.994 -4.189  4.431   1.00 21.64 ? 207 LEU B C    5  
ATOM   8439  O O    . LEU B 2 68  ? -16.971 -4.735  3.346   1.00 21.80 ? 207 LEU B O    5  
ATOM   8440  C CB   . LEU B 2 68  ? -17.237 -1.750  3.951   1.00 19.68 ? 207 LEU B CB   5  
ATOM   8441  C CG   . LEU B 2 68  ? -16.695 -0.356  4.270   1.00 19.58 ? 207 LEU B CG   5  
ATOM   8442  C CD1  . LEU B 2 68  ? -17.374 0.676   3.368   1.00 16.81 ? 207 LEU B CD1  5  
ATOM   8443  C CD2  . LEU B 2 68  ? -16.987 -0.020  5.735   1.00 16.39 ? 207 LEU B CD2  5  
ATOM   8444  H H    . LEU B 2 68  ? -14.853 -2.337  3.180   1.00 0.00  ? 207 LEU B H    5  
ATOM   8445  H HA   . LEU B 2 68  ? -16.300 -2.593  5.689   1.00 0.00  ? 207 LEU B HA   5  
ATOM   8446  H HB2  . LEU B 2 68  ? -17.220 -1.907  2.881   1.00 0.00  ? 207 LEU B HB2  5  
ATOM   8447  H HB3  . LEU B 2 68  ? -18.252 -1.831  4.310   1.00 0.00  ? 207 LEU B HB3  5  
ATOM   8448  H HG   . LEU B 2 68  ? -15.628 -0.337  4.100   1.00 0.00  ? 207 LEU B HG   5  
ATOM   8449  H HD11 . LEU B 2 68  ? -18.104 0.183   2.743   1.00 0.00  ? 207 LEU B HD11 5  
ATOM   8450  H HD12 . LEU B 2 68  ? -17.865 1.420   3.978   1.00 0.00  ? 207 LEU B HD12 5  
ATOM   8451  H HD13 . LEU B 2 68  ? -16.631 1.154   2.746   1.00 0.00  ? 207 LEU B HD13 5  
ATOM   8452  H HD21 . LEU B 2 68  ? -16.614 -0.812  6.367   1.00 0.00  ? 207 LEU B HD21 5  
ATOM   8453  H HD22 . LEU B 2 68  ? -16.498 0.908   5.996   1.00 0.00  ? 207 LEU B HD22 5  
ATOM   8454  H HD23 . LEU B 2 68  ? -18.052 0.082   5.875   1.00 0.00  ? 207 LEU B HD23 5  
ATOM   8455  N N    . ASP B 2 69  ? -17.550 -4.760  5.464   1.00 24.31 ? 208 ASP B N    5  
ATOM   8456  C CA   . ASP B 2 69  ? -18.172 -6.107  5.321   1.00 27.33 ? 208 ASP B CA   5  
ATOM   8457  C C    . ASP B 2 69  ? -19.050 -6.128  4.069   1.00 28.23 ? 208 ASP B C    5  
ATOM   8458  O O    . ASP B 2 69  ? -19.125 -7.118  3.368   1.00 28.17 ? 208 ASP B O    5  
ATOM   8459  C CB   . ASP B 2 69  ? -19.030 -6.409  6.552   1.00 32.44 ? 208 ASP B CB   5  
ATOM   8460  C CG   . ASP B 2 69  ? -19.254 -7.918  6.661   1.00 36.84 ? 208 ASP B CG   5  
ATOM   8461  O OD1  . ASP B 2 69  ? -18.297 -8.654  6.485   1.00 41.58 ? 208 ASP B OD1  5  
ATOM   8462  O OD2  . ASP B 2 69  ? -20.380 -8.313  6.918   1.00 40.11 ? 208 ASP B OD2  5  
ATOM   8463  H H    . ASP B 2 69  ? -17.558 -4.305  6.331   1.00 0.00  ? 208 ASP B H    5  
ATOM   8464  H HA   . ASP B 2 69  ? -17.398 -6.851  5.229   1.00 0.00  ? 208 ASP B HA   5  
ATOM   8465  H HB2  . ASP B 2 69  ? -18.523 -6.054  7.439   1.00 0.00  ? 208 ASP B HB2  5  
ATOM   8466  H HB3  . ASP B 2 69  ? -19.983 -5.910  6.458   1.00 0.00  ? 208 ASP B HB3  5  
ATOM   8467  N N    . SER B 2 70  ? -19.713 -5.043  3.785   1.00 30.57 ? 209 SER B N    5  
ATOM   8468  C CA   . SER B 2 70  ? -20.583 -4.990  2.587   1.00 30.81 ? 209 SER B CA   5  
ATOM   8469  C C    . SER B 2 70  ? -19.787 -5.426  1.356   1.00 31.86 ? 209 SER B C    5  
ATOM   8470  O O    . SER B 2 70  ? -20.215 -6.272  0.595   1.00 34.96 ? 209 SER B O    5  
ATOM   8471  C CB   . SER B 2 70  ? -21.067 -3.558  2.405   1.00 29.35 ? 209 SER B CB   5  
ATOM   8472  O OG   . SER B 2 70  ? -20.155 -2.852  1.574   1.00 27.77 ? 209 SER B OG   5  
ATOM   8473  H H    . SER B 2 70  ? -19.640 -4.258  4.362   1.00 0.00  ? 209 SER B H    5  
ATOM   8474  H HA   . SER B 2 70  ? -21.431 -5.642  2.725   1.00 0.00  ? 209 SER B HA   5  
ATOM   8475  H HB2  . SER B 2 70  ? -22.034 -3.563  1.949   1.00 0.00  ? 209 SER B HB2  5  
ATOM   8476  H HB3  . SER B 2 70  ? -21.132 -3.082  3.372   1.00 0.00  ? 209 SER B HB3  5  
ATOM   8477  H HG   . SER B 2 70  ? -20.510 -2.845  0.683   1.00 0.00  ? 209 SER B HG   5  
ATOM   8478  N N    . GLY B 2 71  ? -18.631 -4.855  1.154   1.00 31.91 ? 210 GLY B N    5  
ATOM   8479  C CA   . GLY B 2 71  ? -17.807 -5.236  -0.028  1.00 30.37 ? 210 GLY B CA   5  
ATOM   8480  C C    . GLY B 2 71  ? -17.089 -3.998  -0.571  1.00 29.39 ? 210 GLY B C    5  
ATOM   8481  O O    . GLY B 2 71  ? -17.181 -3.679  -1.740  1.00 32.51 ? 210 GLY B O    5  
ATOM   8482  H H    . GLY B 2 71  ? -18.305 -4.175  1.780   1.00 0.00  ? 210 GLY B H    5  
ATOM   8483  H HA2  . GLY B 2 71  ? -17.078 -5.976  0.267   1.00 0.00  ? 210 GLY B HA2  5  
ATOM   8484  H HA3  . GLY B 2 71  ? -18.446 -5.643  -0.797  1.00 0.00  ? 210 GLY B HA3  5  
ATOM   8485  N N    . GLY B 2 72  ? -16.375 -3.299  0.267   1.00 27.09 ? 211 GLY B N    5  
ATOM   8486  C CA   . GLY B 2 72  ? -15.653 -2.082  -0.204  1.00 22.75 ? 211 GLY B CA   5  
ATOM   8487  C C    . GLY B 2 72  ? -14.335 -1.940  0.558   1.00 20.54 ? 211 GLY B C    5  
ATOM   8488  O O    . GLY B 2 72  ? -13.945 -2.808  1.313   1.00 21.66 ? 211 GLY B O    5  
ATOM   8489  H H    . GLY B 2 72  ? -16.314 -3.572  1.206   1.00 0.00  ? 211 GLY B H    5  
ATOM   8490  H HA2  . GLY B 2 72  ? -15.452 -2.172  -1.261  1.00 0.00  ? 211 GLY B HA2  5  
ATOM   8491  H HA3  . GLY B 2 72  ? -16.264 -1.211  -0.025  1.00 0.00  ? 211 GLY B HA3  5  
ATOM   8492  N N    . PHE B 2 73  ? -13.646 -0.848  0.366   1.00 18.17 ? 212 PHE B N    5  
ATOM   8493  C CA   . PHE B 2 73  ? -12.352 -0.645  1.079   1.00 17.54 ? 212 PHE B CA   5  
ATOM   8494  C C    . PHE B 2 73  ? -12.132 0.852   1.294   1.00 15.84 ? 212 PHE B C    5  
ATOM   8495  O O    . PHE B 2 73  ? -12.724 1.675   0.625   1.00 18.26 ? 212 PHE B O    5  
ATOM   8496  C CB   . PHE B 2 73  ? -11.202 -1.211  0.239   1.00 16.88 ? 212 PHE B CB   5  
ATOM   8497  C CG   . PHE B 2 73  ? -11.664 -2.441  -0.505  1.00 18.16 ? 212 PHE B CG   5  
ATOM   8498  C CD1  . PHE B 2 73  ? -12.497 -2.312  -1.629  1.00 18.64 ? 212 PHE B CD1  5  
ATOM   8499  C CD2  . PHE B 2 73  ? -11.260 -3.716  -0.073  1.00 18.25 ? 212 PHE B CD2  5  
ATOM   8500  C CE1  . PHE B 2 73  ? -12.925 -3.457  -2.322  1.00 19.59 ? 212 PHE B CE1  5  
ATOM   8501  C CE2  . PHE B 2 73  ? -11.689 -4.860  -0.766  1.00 18.17 ? 212 PHE B CE2  5  
ATOM   8502  C CZ   . PHE B 2 73  ? -12.522 -4.730  -1.890  1.00 18.19 ? 212 PHE B CZ   5  
ATOM   8503  H H    . PHE B 2 73  ? -13.979 -0.159  -0.247  1.00 0.00  ? 212 PHE B H    5  
ATOM   8504  H HA   . PHE B 2 73  ? -12.383 -1.147  2.035   1.00 0.00  ? 212 PHE B HA   5  
ATOM   8505  H HB2  . PHE B 2 73  ? -10.877 -0.464  -0.471  1.00 0.00  ? 212 PHE B HB2  5  
ATOM   8506  H HB3  . PHE B 2 73  ? -10.379 -1.471  0.887   1.00 0.00  ? 212 PHE B HB3  5  
ATOM   8507  H HD1  . PHE B 2 73  ? -12.808 -1.331  -1.961  1.00 0.00  ? 212 PHE B HD1  5  
ATOM   8508  H HD2  . PHE B 2 73  ? -10.621 -3.815  0.791   1.00 0.00  ? 212 PHE B HD2  5  
ATOM   8509  H HE1  . PHE B 2 73  ? -13.565 -3.357  -3.186  1.00 0.00  ? 212 PHE B HE1  5  
ATOM   8510  H HE2  . PHE B 2 73  ? -11.379 -5.841  -0.435  1.00 0.00  ? 212 PHE B HE2  5  
ATOM   8511  H HZ   . PHE B 2 73  ? -12.851 -5.611  -2.423  1.00 0.00  ? 212 PHE B HZ   5  
ATOM   8512  N N    . TYR B 2 74  ? -11.285 1.217   2.217   1.00 14.56 ? 213 TYR B N    5  
ATOM   8513  C CA   . TYR B 2 74  ? -11.038 2.667   2.455   1.00 12.35 ? 213 TYR B CA   5  
ATOM   8514  C C    . TYR B 2 74  ? -9.983  2.840   3.552   1.00 12.92 ? 213 TYR B C    5  
ATOM   8515  O O    . TYR B 2 74  ? -10.161 2.407   4.672   1.00 12.14 ? 213 TYR B O    5  
ATOM   8516  C CB   . TYR B 2 74  ? -12.350 3.349   2.870   1.00 12.55 ? 213 TYR B CB   5  
ATOM   8517  C CG   . TYR B 2 74  ? -12.665 3.042   4.318   1.00 14.01 ? 213 TYR B CG   5  
ATOM   8518  C CD1  . TYR B 2 74  ? -12.676 1.712   4.771   1.00 13.49 ? 213 TYR B CD1  5  
ATOM   8519  C CD2  . TYR B 2 74  ? -12.944 4.089   5.212   1.00 13.18 ? 213 TYR B CD2  5  
ATOM   8520  C CE1  . TYR B 2 74  ? -12.967 1.430   6.117   1.00 13.06 ? 213 TYR B CE1  5  
ATOM   8521  C CE2  . TYR B 2 74  ? -13.233 3.809   6.557   1.00 14.46 ? 213 TYR B CE2  5  
ATOM   8522  C CZ   . TYR B 2 74  ? -13.245 2.479   7.010   1.00 15.80 ? 213 TYR B CZ   5  
ATOM   8523  O OH   . TYR B 2 74  ? -13.528 2.202   8.332   1.00 18.90 ? 213 TYR B OH   5  
ATOM   8524  H H    . TYR B 2 74  ? -10.810 0.540   2.746   1.00 0.00  ? 213 TYR B H    5  
ATOM   8525  H HA   . TYR B 2 74  ? -10.677 3.118   1.542   1.00 0.00  ? 213 TYR B HA   5  
ATOM   8526  H HB2  . TYR B 2 74  ? -12.251 4.418   2.746   1.00 0.00  ? 213 TYR B HB2  5  
ATOM   8527  H HB3  . TYR B 2 74  ? -13.154 2.990   2.245   1.00 0.00  ? 213 TYR B HB3  5  
ATOM   8528  H HD1  . TYR B 2 74  ? -12.464 0.905   4.084   1.00 0.00  ? 213 TYR B HD1  5  
ATOM   8529  H HD2  . TYR B 2 74  ? -12.936 5.112   4.864   1.00 0.00  ? 213 TYR B HD2  5  
ATOM   8530  H HE1  . TYR B 2 74  ? -12.974 0.409   6.464   1.00 0.00  ? 213 TYR B HE1  5  
ATOM   8531  H HE2  . TYR B 2 74  ? -13.446 4.615   7.243   1.00 0.00  ? 213 TYR B HE2  5  
ATOM   8532  H HH   . TYR B 2 74  ? -13.188 1.327   8.532   1.00 0.00  ? 213 TYR B HH   5  
ATOM   8533  N N    . ILE B 2 75  ? -8.890  3.476   3.238   1.00 13.74 ? 214 ILE B N    5  
ATOM   8534  C CA   . ILE B 2 75  ? -7.829  3.682   4.261   1.00 13.80 ? 214 ILE B CA   5  
ATOM   8535  C C    . ILE B 2 75  ? -8.089  4.996   5.008   1.00 14.16 ? 214 ILE B C    5  
ATOM   8536  O O    . ILE B 2 75  ? -7.388  5.339   5.941   1.00 12.50 ? 214 ILE B O    5  
ATOM   8537  C CB   . ILE B 2 75  ? -6.464  3.727   3.568   1.00 10.15 ? 214 ILE B CB   5  
ATOM   8538  C CG1  . ILE B 2 75  ? -6.067  2.308   3.159   1.00 9.57  ? 214 ILE B CG1  5  
ATOM   8539  C CG2  . ILE B 2 75  ? -5.406  4.290   4.523   1.00 8.37  ? 214 ILE B CG2  5  
ATOM   8540  C CD1  . ILE B 2 75  ? -5.169  2.363   1.922   1.00 7.18  ? 214 ILE B CD1  5  
ATOM   8541  H H    . ILE B 2 75  ? -8.767  3.822   2.329   1.00 0.00  ? 214 ILE B H    5  
ATOM   8542  H HA   . ILE B 2 75  ? -7.847  2.862   4.964   1.00 0.00  ? 214 ILE B HA   5  
ATOM   8543  H HB   . ILE B 2 75  ? -6.526  4.353   2.688   1.00 0.00  ? 214 ILE B HB   5  
ATOM   8544  H HG12 . ILE B 2 75  ? -5.534  1.836   3.972   1.00 0.00  ? 214 ILE B HG12 5  
ATOM   8545  H HG13 . ILE B 2 75  ? -6.956  1.737   2.933   1.00 0.00  ? 214 ILE B HG13 5  
ATOM   8546  H HG21 . ILE B 2 75  ? -5.583  3.912   5.519   1.00 0.00  ? 214 ILE B HG21 5  
ATOM   8547  H HG22 . ILE B 2 75  ? -4.424  3.987   4.192   1.00 0.00  ? 214 ILE B HG22 5  
ATOM   8548  H HG23 . ILE B 2 75  ? -5.467  5.368   4.531   1.00 0.00  ? 214 ILE B HG23 5  
ATOM   8549  H HD11 . ILE B 2 75  ? -4.799  3.367   1.791   1.00 0.00  ? 214 ILE B HD11 5  
ATOM   8550  H HD12 . ILE B 2 75  ? -4.337  1.686   2.051   1.00 0.00  ? 214 ILE B HD12 5  
ATOM   8551  H HD13 . ILE B 2 75  ? -5.737  2.071   1.051   1.00 0.00  ? 214 ILE B HD13 5  
ATOM   8552  N N    . THR B 2 76  ? -9.094  5.731   4.612   1.00 15.77 ? 215 THR B N    5  
ATOM   8553  C CA   . THR B 2 76  ? -9.395  7.014   5.307   1.00 18.20 ? 215 THR B CA   5  
ATOM   8554  C C    . THR B 2 76  ? -10.907 7.244   5.313   1.00 17.81 ? 215 THR B C    5  
ATOM   8555  O O    . THR B 2 76  ? -11.624 6.736   4.474   1.00 15.56 ? 215 THR B O    5  
ATOM   8556  C CB   . THR B 2 76  ? -8.707  8.169   4.575   1.00 20.21 ? 215 THR B CB   5  
ATOM   8557  O OG1  . THR B 2 76  ? -8.882  9.368   5.316   1.00 26.81 ? 215 THR B OG1  5  
ATOM   8558  C CG2  . THR B 2 76  ? -9.321  8.333   3.183   1.00 22.31 ? 215 THR B CG2  5  
ATOM   8559  H H    . THR B 2 76  ? -9.651  5.440   3.863   1.00 0.00  ? 215 THR B H    5  
ATOM   8560  H HA   . THR B 2 76  ? -9.036  6.966   6.324   1.00 0.00  ? 215 THR B HA   5  
ATOM   8561  H HB   . THR B 2 76  ? -7.654  7.957   4.476   1.00 0.00  ? 215 THR B HB   5  
ATOM   8562  H HG1  . THR B 2 76  ? -8.600  9.203   6.218   1.00 0.00  ? 215 THR B HG1  5  
ATOM   8563  H HG21 . THR B 2 76  ? -10.174 7.677   3.088   1.00 0.00  ? 215 THR B HG21 5  
ATOM   8564  H HG22 . THR B 2 76  ? -9.636  9.357   3.047   1.00 0.00  ? 215 THR B HG22 5  
ATOM   8565  H HG23 . THR B 2 76  ? -8.587  8.079   2.433   1.00 0.00  ? 215 THR B HG23 5  
ATOM   8566  N N    . SER B 2 77  ? -11.397 8.004   6.252   1.00 18.97 ? 216 SER B N    5  
ATOM   8567  C CA   . SER B 2 77  ? -12.863 8.265   6.312   1.00 18.71 ? 216 SER B CA   5  
ATOM   8568  C C    . SER B 2 77  ? -13.210 9.437   5.393   1.00 18.69 ? 216 SER B C    5  
ATOM   8569  O O    . SER B 2 77  ? -13.597 10.497  5.841   1.00 20.53 ? 216 SER B O    5  
ATOM   8570  C CB   . SER B 2 77  ? -13.262 8.606   7.748   1.00 20.19 ? 216 SER B CB   5  
ATOM   8571  O OG   . SER B 2 77  ? -14.255 7.690   8.190   1.00 22.41 ? 216 SER B OG   5  
ATOM   8572  H H    . SER B 2 77  ? -10.801 8.404   6.919   1.00 0.00  ? 216 SER B H    5  
ATOM   8573  H HA   . SER B 2 77  ? -13.398 7.383   5.990   1.00 0.00  ? 216 SER B HA   5  
ATOM   8574  H HB2  . SER B 2 77  ? -12.401 8.532   8.390   1.00 0.00  ? 216 SER B HB2  5  
ATOM   8575  H HB3  . SER B 2 77  ? -13.649 9.617   7.782   1.00 0.00  ? 216 SER B HB3  5  
ATOM   8576  H HG   . SER B 2 77  ? -13.857 7.112   8.845   1.00 0.00  ? 216 SER B HG   5  
ATOM   8577  N N    . ARG B 2 78  ? -13.074 9.253   4.108   1.00 0.00  ? 217 ARG B N    5  
ATOM   8578  C CA   . ARG B 2 78  ? -13.394 10.356  3.159   1.00 0.00  ? 217 ARG B CA   5  
ATOM   8579  C C    . ARG B 2 78  ? -13.999 9.773   1.880   1.00 0.00  ? 217 ARG B C    5  
ATOM   8580  O O    . ARG B 2 78  ? -14.924 10.321  1.314   1.00 0.00  ? 217 ARG B O    5  
ATOM   8581  C CB   . ARG B 2 78  ? -12.113 11.121  2.816   1.00 0.00  ? 217 ARG B CB   5  
ATOM   8582  C CG   . ARG B 2 78  ? -11.873 12.211  3.864   1.00 0.00  ? 217 ARG B CG   5  
ATOM   8583  C CD   . ARG B 2 78  ? -11.559 13.534  3.163   1.00 0.00  ? 217 ARG B CD   5  
ATOM   8584  N NE   . ARG B 2 78  ? -12.747 14.430  3.238   1.00 0.00  ? 217 ARG B NE   5  
ATOM   8585  C CZ   . ARG B 2 78  ? -12.621 15.644  3.701   1.00 0.00  ? 217 ARG B CZ   5  
ATOM   8586  N NH1  . ARG B 2 78  ? -12.076 16.571  2.962   1.00 0.00  ? 217 ARG B NH1  5  
ATOM   8587  N NH2  . ARG B 2 78  ? -13.041 15.931  4.903   1.00 0.00  ? 217 ARG B NH2  5  
ATOM   8588  H H    . ARG B 2 78  ? -12.760 8.390   3.768   1.00 0.00  ? 217 ARG B H    5  
ATOM   8589  H HA   . ARG B 2 78  ? -14.103 11.030  3.618   1.00 0.00  ? 217 ARG B HA   5  
ATOM   8590  H HB2  . ARG B 2 78  ? -11.276 10.437  2.810   1.00 0.00  ? 217 ARG B HB2  5  
ATOM   8591  H HB3  . ARG B 2 78  ? -12.215 11.576  1.843   1.00 0.00  ? 217 ARG B HB3  5  
ATOM   8592  H HG2  . ARG B 2 78  ? -12.759 12.326  4.472   1.00 0.00  ? 217 ARG B HG2  5  
ATOM   8593  H HG3  . ARG B 2 78  ? -11.040 11.931  4.490   1.00 0.00  ? 217 ARG B HG3  5  
ATOM   8594  H HD2  . ARG B 2 78  ? -10.720 14.009  3.649   1.00 0.00  ? 217 ARG B HD2  5  
ATOM   8595  H HD3  . ARG B 2 78  ? -11.316 13.345  2.128   1.00 0.00  ? 217 ARG B HD3  5  
ATOM   8596  H HE   . ARG B 2 78  ? -13.624 14.109  2.940   1.00 0.00  ? 217 ARG B HE   5  
ATOM   8597  H HH11 . ARG B 2 78  ? -11.755 16.352  2.041   1.00 0.00  ? 217 ARG B HH11 5  
ATOM   8598  H HH12 . ARG B 2 78  ? -11.980 17.501  3.317   1.00 0.00  ? 217 ARG B HH12 5  
ATOM   8599  H HH21 . ARG B 2 78  ? -13.459 15.220  5.469   1.00 0.00  ? 217 ARG B HH21 5  
ATOM   8600  H HH22 . ARG B 2 78  ? -12.944 16.861  5.258   1.00 0.00  ? 217 ARG B HH22 5  
ATOM   8601  N N    . THR B 2 79  ? -13.486 8.665   1.416   1.00 23.45 ? 218 THR B N    5  
ATOM   8602  C CA   . THR B 2 79  ? -14.035 8.053   0.174   1.00 23.59 ? 218 THR B CA   5  
ATOM   8603  C C    . THR B 2 79  ? -13.940 6.528   0.265   1.00 19.84 ? 218 THR B C    5  
ATOM   8604  O O    . THR B 2 79  ? -12.962 5.984   0.739   1.00 20.24 ? 218 THR B O    5  
ATOM   8605  C CB   . THR B 2 79  ? -13.230 8.542   -1.033  1.00 26.45 ? 218 THR B CB   5  
ATOM   8606  O OG1  . THR B 2 79  ? -13.450 9.934   -1.214  1.00 30.31 ? 218 THR B OG1  5  
ATOM   8607  C CG2  . THR B 2 79  ? -13.673 7.785   -2.286  1.00 27.38 ? 218 THR B CG2  5  
ATOM   8608  H H    . THR B 2 79  ? -12.738 8.237   1.885   1.00 0.00  ? 218 THR B H    5  
ATOM   8609  H HA   . THR B 2 79  ? -15.069 8.342   0.056   1.00 0.00  ? 218 THR B HA   5  
ATOM   8610  H HB   . THR B 2 79  ? -12.179 8.362   -0.862  1.00 0.00  ? 218 THR B HB   5  
ATOM   8611  H HG1  . THR B 2 79  ? -13.360 10.362  -0.359  1.00 0.00  ? 218 THR B HG1  5  
ATOM   8612  H HG21 . THR B 2 79  ? -14.747 7.674   -2.278  1.00 0.00  ? 218 THR B HG21 5  
ATOM   8613  H HG22 . THR B 2 79  ? -13.375 8.339   -3.165  1.00 0.00  ? 218 THR B HG22 5  
ATOM   8614  H HG23 . THR B 2 79  ? -13.210 6.810   -2.301  1.00 0.00  ? 218 THR B HG23 5  
ATOM   8615  N N    . GLN B 2 80  ? -14.950 5.833   -0.185  1.00 18.30 ? 219 GLN B N    5  
ATOM   8616  C CA   . GLN B 2 80  ? -14.921 4.344   -0.125  1.00 20.11 ? 219 GLN B CA   5  
ATOM   8617  C C    . GLN B 2 80  ? -14.971 3.779   -1.546  1.00 19.45 ? 219 GLN B C    5  
ATOM   8618  O O    . GLN B 2 80  ? -15.834 4.121   -2.331  1.00 20.30 ? 219 GLN B O    5  
ATOM   8619  C CB   . GLN B 2 80  ? -16.130 3.837   0.665   1.00 20.56 ? 219 GLN B CB   5  
ATOM   8620  C CG   . GLN B 2 80  ? -16.432 4.799   1.817   1.00 23.60 ? 219 GLN B CG   5  
ATOM   8621  C CD   . GLN B 2 80  ? -17.659 5.643   1.466   1.00 19.08 ? 219 GLN B CD   5  
ATOM   8622  O OE1  . GLN B 2 80  ? -17.876 5.975   0.318   1.00 17.99 ? 219 GLN B OE1  5  
ATOM   8623  N NE2  . GLN B 2 80  ? -18.479 6.005   2.415   1.00 17.08 ? 219 GLN B NE2  5  
ATOM   8624  H H    . GLN B 2 80  ? -15.729 6.292   -0.563  1.00 0.00  ? 219 GLN B H    5  
ATOM   8625  H HA   . GLN B 2 80  ? -14.011 4.019   0.359   1.00 0.00  ? 219 GLN B HA   5  
ATOM   8626  H HB2  . GLN B 2 80  ? -16.988 3.777   0.012   1.00 0.00  ? 219 GLN B HB2  5  
ATOM   8627  H HB3  . GLN B 2 80  ? -15.913 2.858   1.065   1.00 0.00  ? 219 GLN B HB3  5  
ATOM   8628  H HG2  . GLN B 2 80  ? -16.626 4.234   2.717   1.00 0.00  ? 219 GLN B HG2  5  
ATOM   8629  H HG3  . GLN B 2 80  ? -15.584 5.449   1.975   1.00 0.00  ? 219 GLN B HG3  5  
ATOM   8630  H HE21 . GLN B 2 80  ? -18.303 5.736   3.346   1.00 0.00  ? 219 GLN B HE21 5  
ATOM   8631  H HE22 . GLN B 2 80  ? -19.271 6.548   2.199   1.00 0.00  ? 219 GLN B HE22 5  
ATOM   8632  N N    . PHE B 2 81  ? -14.050 2.918   -1.886  1.00 18.96 ? 220 PHE B N    5  
ATOM   8633  C CA   . PHE B 2 81  ? -14.046 2.335   -3.257  1.00 17.73 ? 220 PHE B CA   5  
ATOM   8634  C C    . PHE B 2 81  ? -14.637 0.926   -3.216  1.00 17.76 ? 220 PHE B C    5  
ATOM   8635  O O    . PHE B 2 81  ? -14.747 0.317   -2.172  1.00 19.11 ? 220 PHE B O    5  
ATOM   8636  C CB   . PHE B 2 81  ? -12.609 2.272   -3.778  1.00 14.17 ? 220 PHE B CB   5  
ATOM   8637  C CG   . PHE B 2 81  ? -12.076 3.674   -3.949  1.00 14.07 ? 220 PHE B CG   5  
ATOM   8638  C CD1  . PHE B 2 81  ? -12.626 4.520   -4.926  1.00 12.87 ? 220 PHE B CD1  5  
ATOM   8639  C CD2  . PHE B 2 81  ? -11.030 4.133   -3.129  1.00 14.01 ? 220 PHE B CD2  5  
ATOM   8640  C CE1  . PHE B 2 81  ? -12.131 5.826   -5.084  1.00 13.31 ? 220 PHE B CE1  5  
ATOM   8641  C CE2  . PHE B 2 81  ? -10.535 5.439   -3.288  1.00 11.11 ? 220 PHE B CE2  5  
ATOM   8642  C CZ   . PHE B 2 81  ? -11.085 6.285   -4.265  1.00 13.09 ? 220 PHE B CZ   5  
ATOM   8643  H H    . PHE B 2 81  ? -13.362 2.657   -1.239  1.00 0.00  ? 220 PHE B H    5  
ATOM   8644  H HA   . PHE B 2 81  ? -14.639 2.954   -3.914  1.00 0.00  ? 220 PHE B HA   5  
ATOM   8645  H HB2  . PHE B 2 81  ? -11.993 1.734   -3.072  1.00 0.00  ? 220 PHE B HB2  5  
ATOM   8646  H HB3  . PHE B 2 81  ? -12.594 1.763   -4.730  1.00 0.00  ? 220 PHE B HB3  5  
ATOM   8647  H HD1  . PHE B 2 81  ? -13.429 4.167   -5.556  1.00 0.00  ? 220 PHE B HD1  5  
ATOM   8648  H HD2  . PHE B 2 81  ? -10.608 3.483   -2.378  1.00 0.00  ? 220 PHE B HD2  5  
ATOM   8649  H HE1  . PHE B 2 81  ? -12.553 6.476   -5.836  1.00 0.00  ? 220 PHE B HE1  5  
ATOM   8650  H HE2  . PHE B 2 81  ? -9.731  5.791   -2.658  1.00 0.00  ? 220 PHE B HE2  5  
ATOM   8651  H HZ   . PHE B 2 81  ? -10.705 7.288   -4.387  1.00 0.00  ? 220 PHE B HZ   5  
ATOM   8652  N N    . ASN B 2 82  ? -15.020 0.403   -4.348  1.00 20.00 ? 221 ASN B N    5  
ATOM   8653  C CA   . ASN B 2 82  ? -15.606 -0.966  -4.377  1.00 21.48 ? 221 ASN B CA   5  
ATOM   8654  C C    . ASN B 2 82  ? -14.619 -1.929  -5.041  1.00 22.18 ? 221 ASN B C    5  
ATOM   8655  O O    . ASN B 2 82  ? -14.987 -2.998  -5.488  1.00 24.56 ? 221 ASN B O    5  
ATOM   8656  C CB   . ASN B 2 82  ? -16.913 -0.946  -5.172  1.00 26.12 ? 221 ASN B CB   5  
ATOM   8657  C CG   . ASN B 2 82  ? -18.092 -0.762  -4.215  1.00 28.62 ? 221 ASN B CG   5  
ATOM   8658  O OD1  . ASN B 2 82  ? -18.390 -1.636  -3.424  1.00 32.09 ? 221 ASN B OD1  5  
ATOM   8659  N ND2  . ASN B 2 82  ? -18.781 0.346   -4.253  1.00 31.44 ? 221 ASN B ND2  5  
ATOM   8660  H H    . ASN B 2 82  ? -14.924 0.913   -5.179  1.00 0.00  ? 221 ASN B H    5  
ATOM   8661  H HA   . ASN B 2 82  ? -15.804 -1.294  -3.366  1.00 0.00  ? 221 ASN B HA   5  
ATOM   8662  H HB2  . ASN B 2 82  ? -16.891 -0.129  -5.878  1.00 0.00  ? 221 ASN B HB2  5  
ATOM   8663  H HB3  . ASN B 2 82  ? -17.025 -1.878  -5.704  1.00 0.00  ? 221 ASN B HB3  5  
ATOM   8664  H HD21 . ASN B 2 82  ? -18.540 1.052   -4.893  1.00 0.00  ? 221 ASN B HD21 5  
ATOM   8665  H HD22 . ASN B 2 82  ? -19.542 0.471   -3.640  1.00 0.00  ? 221 ASN B HD22 5  
ATOM   8666  N N    . SER B 2 83  ? -13.368 -1.562  -5.111  1.00 20.04 ? 222 SER B N    5  
ATOM   8667  C CA   . SER B 2 83  ? -12.364 -2.460  -5.748  1.00 17.84 ? 222 SER B CA   5  
ATOM   8668  C C    . SER B 2 83  ? -10.968 -2.119  -5.223  1.00 17.08 ? 222 SER B C    5  
ATOM   8669  O O    . SER B 2 83  ? -10.617 -0.965  -5.068  1.00 17.94 ? 222 SER B O    5  
ATOM   8670  C CB   . SER B 2 83  ? -12.399 -2.270  -7.265  1.00 15.42 ? 222 SER B CB   5  
ATOM   8671  O OG   . SER B 2 83  ? -12.783 -0.934  -7.561  1.00 19.15 ? 222 SER B OG   5  
ATOM   8672  H H    . SER B 2 83  ? -13.089 -0.696  -4.745  1.00 0.00  ? 222 SER B H    5  
ATOM   8673  H HA   . SER B 2 83  ? -12.597 -3.488  -5.508  1.00 0.00  ? 222 SER B HA   5  
ATOM   8674  H HB2  . SER B 2 83  ? -11.422 -2.458  -7.676  1.00 0.00  ? 222 SER B HB2  5  
ATOM   8675  H HB3  . SER B 2 83  ? -13.108 -2.964  -7.696  1.00 0.00  ? 222 SER B HB3  5  
ATOM   8676  H HG   . SER B 2 83  ? -13.725 -0.930  -7.745  1.00 0.00  ? 222 SER B HG   5  
ATOM   8677  N N    . LEU B 2 84  ? -10.166 -3.112  -4.949  1.00 17.11 ? 223 LEU B N    5  
ATOM   8678  C CA   . LEU B 2 84  ? -8.794  -2.842  -4.437  1.00 16.96 ? 223 LEU B CA   5  
ATOM   8679  C C    . LEU B 2 84  ? -8.043  -1.959  -5.435  1.00 17.05 ? 223 LEU B C    5  
ATOM   8680  O O    . LEU B 2 84  ? -7.446  -0.964  -5.072  1.00 18.74 ? 223 LEU B O    5  
ATOM   8681  C CB   . LEU B 2 84  ? -8.043  -4.163  -4.262  1.00 15.68 ? 223 LEU B CB   5  
ATOM   8682  C CG   . LEU B 2 84  ? -8.275  -4.702  -2.850  1.00 18.50 ? 223 LEU B CG   5  
ATOM   8683  C CD1  . LEU B 2 84  ? -7.814  -6.157  -2.776  1.00 17.89 ? 223 LEU B CD1  5  
ATOM   8684  C CD2  . LEU B 2 84  ? -7.478  -3.863  -1.849  1.00 17.50 ? 223 LEU B CD2  5  
ATOM   8685  H H    . LEU B 2 84  ? -10.467 -4.035  -5.082  1.00 0.00  ? 223 LEU B H    5  
ATOM   8686  H HA   . LEU B 2 84  ? -8.858  -2.336  -3.485  1.00 0.00  ? 223 LEU B HA   5  
ATOM   8687  H HB2  . LEU B 2 84  ? -8.404  -4.880  -4.986  1.00 0.00  ? 223 LEU B HB2  5  
ATOM   8688  H HB3  . LEU B 2 84  ? -6.987  -4.000  -4.413  1.00 0.00  ? 223 LEU B HB3  5  
ATOM   8689  H HG   . LEU B 2 84  ? -9.328  -4.645  -2.613  1.00 0.00  ? 223 LEU B HG   5  
ATOM   8690  H HD11 . LEU B 2 84  ? -7.451  -6.470  -3.744  1.00 0.00  ? 223 LEU B HD11 5  
ATOM   8691  H HD12 . LEU B 2 84  ? -7.021  -6.248  -2.049  1.00 0.00  ? 223 LEU B HD12 5  
ATOM   8692  H HD13 . LEU B 2 84  ? -8.644  -6.784  -2.483  1.00 0.00  ? 223 LEU B HD13 5  
ATOM   8693  H HD21 . LEU B 2 84  ? -6.463  -3.749  -2.202  1.00 0.00  ? 223 LEU B HD21 5  
ATOM   8694  H HD22 . LEU B 2 84  ? -7.935  -2.889  -1.748  1.00 0.00  ? 223 LEU B HD22 5  
ATOM   8695  H HD23 . LEU B 2 84  ? -7.471  -4.359  -0.889  1.00 0.00  ? 223 LEU B HD23 5  
ATOM   8696  N N    . GLN B 2 85  ? -8.065  -2.314  -6.690  1.00 17.04 ? 224 GLN B N    5  
ATOM   8697  C CA   . GLN B 2 85  ? -7.350  -1.496  -7.708  1.00 17.80 ? 224 GLN B CA   5  
ATOM   8698  C C    . GLN B 2 85  ? -7.925  -0.079  -7.717  1.00 17.42 ? 224 GLN B C    5  
ATOM   8699  O O    . GLN B 2 85  ? -7.253  0.870   -8.067  1.00 17.16 ? 224 GLN B O    5  
ATOM   8700  C CB   . GLN B 2 85  ? -7.527  -2.128  -9.089  1.00 21.63 ? 224 GLN B CB   5  
ATOM   8701  C CG   . GLN B 2 85  ? -8.989  -2.013  -9.524  1.00 27.99 ? 224 GLN B CG   5  
ATOM   8702  C CD   . GLN B 2 85  ? -9.176  -2.697  -10.879 1.00 31.34 ? 224 GLN B CD   5  
ATOM   8703  O OE1  . GLN B 2 85  ? -9.672  -2.097  -11.812 1.00 31.30 ? 224 GLN B OE1  5  
ATOM   8704  N NE2  . GLN B 2 85  ? -8.797  -3.937  -11.027 1.00 33.99 ? 224 GLN B NE2  5  
ATOM   8705  H H    . GLN B 2 85  ? -8.551  -3.120  -6.962  1.00 0.00  ? 224 GLN B H    5  
ATOM   8706  H HA   . GLN B 2 85  ? -6.300  -1.453  -7.462  1.00 0.00  ? 224 GLN B HA   5  
ATOM   8707  H HB2  . GLN B 2 85  ? -6.897  -1.616  -9.803  1.00 0.00  ? 224 GLN B HB2  5  
ATOM   8708  H HB3  . GLN B 2 85  ? -7.249  -3.170  -9.046  1.00 0.00  ? 224 GLN B HB3  5  
ATOM   8709  H HG2  . GLN B 2 85  ? -9.621  -2.489  -8.788  1.00 0.00  ? 224 GLN B HG2  5  
ATOM   8710  H HG3  . GLN B 2 85  ? -9.258  -0.970  -9.608  1.00 0.00  ? 224 GLN B HG3  5  
ATOM   8711  H HE21 . GLN B 2 85  ? -8.396  -4.422  -10.271 1.00 0.00  ? 224 GLN B HE21 5  
ATOM   8712  H HE22 . GLN B 2 85  ? -8.913  -4.385  -11.896 1.00 0.00  ? 224 GLN B HE22 5  
ATOM   8713  N N    . GLN B 2 86  ? -9.162  0.075   -7.331  1.00 17.93 ? 225 GLN B N    5  
ATOM   8714  C CA   . GLN B 2 86  ? -9.771  1.435   -7.316  1.00 17.77 ? 225 GLN B CA   5  
ATOM   8715  C C    . GLN B 2 86  ? -9.056  2.292   -6.271  1.00 14.93 ? 225 GLN B C    5  
ATOM   8716  O O    . GLN B 2 86  ? -8.541  3.352   -6.569  1.00 15.44 ? 225 GLN B O    5  
ATOM   8717  C CB   . GLN B 2 86  ? -11.254 1.328   -6.959  1.00 23.54 ? 225 GLN B CB   5  
ATOM   8718  C CG   . GLN B 2 86  ? -12.097 1.498   -8.225  1.00 32.83 ? 225 GLN B CG   5  
ATOM   8719  C CD   . GLN B 2 86  ? -13.572 1.619   -7.843  1.00 37.70 ? 225 GLN B CD   5  
ATOM   8720  O OE1  . GLN B 2 86  ? -13.897 2.065   -6.761  1.00 41.31 ? 225 GLN B OE1  5  
ATOM   8721  N NE2  . GLN B 2 86  ? -14.487 1.235   -8.690  1.00 38.92 ? 225 GLN B NE2  5  
ATOM   8722  H H    . GLN B 2 86  ? -9.688  -0.701  -7.049  1.00 0.00  ? 225 GLN B H    5  
ATOM   8723  H HA   . GLN B 2 86  ? -9.665  1.889   -8.289  1.00 0.00  ? 225 GLN B HA   5  
ATOM   8724  H HB2  . GLN B 2 86  ? -11.449 0.359   -6.522  1.00 0.00  ? 225 GLN B HB2  5  
ATOM   8725  H HB3  . GLN B 2 86  ? -11.511 2.101   -6.251  1.00 0.00  ? 225 GLN B HB3  5  
ATOM   8726  H HG2  . GLN B 2 86  ? -11.785 2.391   -8.746  1.00 0.00  ? 225 GLN B HG2  5  
ATOM   8727  H HG3  . GLN B 2 86  ? -11.962 0.639   -8.865  1.00 0.00  ? 225 GLN B HG3  5  
ATOM   8728  H HE21 . GLN B 2 86  ? -14.225 0.875   -9.564  1.00 0.00  ? 225 GLN B HE21 5  
ATOM   8729  H HE22 . GLN B 2 86  ? -15.436 1.308   -8.455  1.00 0.00  ? 225 GLN B HE22 5  
ATOM   8730  N N    . LEU B 2 87  ? -9.014  1.838   -5.048  1.00 13.83 ? 226 LEU B N    5  
ATOM   8731  C CA   . LEU B 2 87  ? -8.326  2.623   -3.986  1.00 13.09 ? 226 LEU B CA   5  
ATOM   8732  C C    . LEU B 2 87  ? -6.851  2.791   -4.359  1.00 11.87 ? 226 LEU B C    5  
ATOM   8733  O O    . LEU B 2 87  ? -6.208  3.749   -3.978  1.00 12.13 ? 226 LEU B O    5  
ATOM   8734  C CB   . LEU B 2 87  ? -8.438  1.878   -2.651  1.00 12.56 ? 226 LEU B CB   5  
ATOM   8735  C CG   . LEU B 2 87  ? -7.608  2.597   -1.585  1.00 13.63 ? 226 LEU B CG   5  
ATOM   8736  C CD1  . LEU B 2 87  ? -8.158  2.260   -0.199  1.00 13.34 ? 226 LEU B CD1  5  
ATOM   8737  C CD2  . LEU B 2 87  ? -6.151  2.138   -1.678  1.00 14.36 ? 226 LEU B CD2  5  
ATOM   8738  H H    . LEU B 2 87  ? -9.433  0.979   -4.830  1.00 0.00  ? 226 LEU B H    5  
ATOM   8739  H HA   . LEU B 2 87  ? -8.789  3.595   -3.897  1.00 0.00  ? 226 LEU B HA   5  
ATOM   8740  H HB2  . LEU B 2 87  ? -9.473  1.849   -2.343  1.00 0.00  ? 226 LEU B HB2  5  
ATOM   8741  H HB3  . LEU B 2 87  ? -8.070  0.871   -2.771  1.00 0.00  ? 226 LEU B HB3  5  
ATOM   8742  H HG   . LEU B 2 87  ? -7.662  3.665   -1.743  1.00 0.00  ? 226 LEU B HG   5  
ATOM   8743  H HD11 . LEU B 2 87  ? -8.185  1.188   -0.073  1.00 0.00  ? 226 LEU B HD11 5  
ATOM   8744  H HD12 . LEU B 2 87  ? -7.521  2.696   0.557   1.00 0.00  ? 226 LEU B HD12 5  
ATOM   8745  H HD13 . LEU B 2 87  ? -9.157  2.658   -0.101  1.00 0.00  ? 226 LEU B HD13 5  
ATOM   8746  H HD21 . LEU B 2 87  ? -6.029  1.501   -2.542  1.00 0.00  ? 226 LEU B HD21 5  
ATOM   8747  H HD22 . LEU B 2 87  ? -5.507  2.999   -1.772  1.00 0.00  ? 226 LEU B HD22 5  
ATOM   8748  H HD23 . LEU B 2 87  ? -5.890  1.588   -0.786  1.00 0.00  ? 226 LEU B HD23 5  
ATOM   8749  N N    . VAL B 2 88  ? -6.311  1.864   -5.105  1.00 11.28 ? 227 VAL B N    5  
ATOM   8750  C CA   . VAL B 2 88  ? -4.878  1.969   -5.504  1.00 13.23 ? 227 VAL B CA   5  
ATOM   8751  C C    . VAL B 2 88  ? -4.739  2.982   -6.642  1.00 13.64 ? 227 VAL B C    5  
ATOM   8752  O O    . VAL B 2 88  ? -3.694  3.570   -6.837  1.00 15.96 ? 227 VAL B O    5  
ATOM   8753  C CB   . VAL B 2 88  ? -4.381  0.601   -5.975  1.00 9.89  ? 227 VAL B CB   5  
ATOM   8754  C CG1  . VAL B 2 88  ? -2.942  0.726   -6.479  1.00 9.85  ? 227 VAL B CG1  5  
ATOM   8755  C CG2  . VAL B 2 88  ? -4.428  -0.387  -4.807  1.00 9.58  ? 227 VAL B CG2  5  
ATOM   8756  H H    . VAL B 2 88  ? -6.847  1.099   -5.403  1.00 0.00  ? 227 VAL B H    5  
ATOM   8757  H HA   . VAL B 2 88  ? -4.291  2.293   -4.658  1.00 0.00  ? 227 VAL B HA   5  
ATOM   8758  H HB   . VAL B 2 88  ? -5.013  0.245   -6.776  1.00 0.00  ? 227 VAL B HB   5  
ATOM   8759  H HG11 . VAL B 2 88  ? -2.312  1.092   -5.682  1.00 0.00  ? 227 VAL B HG11 5  
ATOM   8760  H HG12 . VAL B 2 88  ? -2.589  -0.242  -6.801  1.00 0.00  ? 227 VAL B HG12 5  
ATOM   8761  H HG13 . VAL B 2 88  ? -2.910  1.415   -7.309  1.00 0.00  ? 227 VAL B HG13 5  
ATOM   8762  H HG21 . VAL B 2 88  ? -5.436  -0.440  -4.422  1.00 0.00  ? 227 VAL B HG21 5  
ATOM   8763  H HG22 . VAL B 2 88  ? -4.121  -1.364  -5.150  1.00 0.00  ? 227 VAL B HG22 5  
ATOM   8764  H HG23 . VAL B 2 88  ? -3.761  -0.053  -4.027  1.00 0.00  ? 227 VAL B HG23 5  
ATOM   8765  N N    . ALA B 2 89  ? -5.784  3.191   -7.393  1.00 16.21 ? 228 ALA B N    5  
ATOM   8766  C CA   . ALA B 2 89  ? -5.711  4.167   -8.516  1.00 16.05 ? 228 ALA B CA   5  
ATOM   8767  C C    . ALA B 2 89  ? -5.776  5.587   -7.956  1.00 16.38 ? 228 ALA B C    5  
ATOM   8768  O O    . ALA B 2 89  ? -4.976  6.437   -8.295  1.00 17.42 ? 228 ALA B O    5  
ATOM   8769  C CB   . ALA B 2 89  ? -6.887  3.937   -9.468  1.00 17.50 ? 228 ALA B CB   5  
ATOM   8770  H H    . ALA B 2 89  ? -6.617  2.708   -7.218  1.00 0.00  ? 228 ALA B H    5  
ATOM   8771  H HA   . ALA B 2 89  ? -4.782  4.032   -9.051  1.00 0.00  ? 228 ALA B HA   5  
ATOM   8772  H HB1  . ALA B 2 89  ? -7.815  4.043   -8.926  1.00 0.00  ? 228 ALA B HB1  5  
ATOM   8773  H HB2  . ALA B 2 89  ? -6.851  4.665   -10.266 1.00 0.00  ? 228 ALA B HB2  5  
ATOM   8774  H HB3  . ALA B 2 89  ? -6.824  2.943   -9.884  1.00 0.00  ? 228 ALA B HB3  5  
ATOM   8775  N N    . TYR B 2 90  ? -6.720  5.852   -7.094  1.00 17.24 ? 229 TYR B N    5  
ATOM   8776  C CA   . TYR B 2 90  ? -6.830  7.216   -6.508  1.00 15.90 ? 229 TYR B CA   5  
ATOM   8777  C C    . TYR B 2 90  ? -5.538  7.546   -5.758  1.00 15.53 ? 229 TYR B C    5  
ATOM   8778  O O    . TYR B 2 90  ? -4.981  8.616   -5.903  1.00 15.40 ? 229 TYR B O    5  
ATOM   8779  C CB   . TYR B 2 90  ? -8.011  7.260   -5.535  1.00 17.41 ? 229 TYR B CB   5  
ATOM   8780  C CG   . TYR B 2 90  ? -8.421  8.695   -5.303  1.00 19.62 ? 229 TYR B CG   5  
ATOM   8781  C CD1  . TYR B 2 90  ? -9.196  9.368   -6.262  1.00 20.00 ? 229 TYR B CD1  5  
ATOM   8782  C CD2  . TYR B 2 90  ? -8.030  9.356   -4.127  1.00 19.06 ? 229 TYR B CD2  5  
ATOM   8783  C CE1  . TYR B 2 90  ? -9.579  10.703  -6.045  1.00 22.03 ? 229 TYR B CE1  5  
ATOM   8784  C CE2  . TYR B 2 90  ? -8.413  10.689  -3.909  1.00 20.67 ? 229 TYR B CE2  5  
ATOM   8785  C CZ   . TYR B 2 90  ? -9.188  11.364  -4.868  1.00 22.97 ? 229 TYR B CZ   5  
ATOM   8786  O OH   . TYR B 2 90  ? -9.564  12.674  -4.655  1.00 24.81 ? 229 TYR B OH   5  
ATOM   8787  H H    . TYR B 2 90  ? -7.353  5.152   -6.830  1.00 0.00  ? 229 TYR B H    5  
ATOM   8788  H HA   . TYR B 2 90  ? -6.985  7.938   -7.297  1.00 0.00  ? 229 TYR B HA   5  
ATOM   8789  H HB2  . TYR B 2 90  ? -8.842  6.711   -5.953  1.00 0.00  ? 229 TYR B HB2  5  
ATOM   8790  H HB3  . TYR B 2 90  ? -7.721  6.814   -4.596  1.00 0.00  ? 229 TYR B HB3  5  
ATOM   8791  H HD1  . TYR B 2 90  ? -9.498  8.861   -7.167  1.00 0.00  ? 229 TYR B HD1  5  
ATOM   8792  H HD2  . TYR B 2 90  ? -7.435  8.837   -3.389  1.00 0.00  ? 229 TYR B HD2  5  
ATOM   8793  H HE1  . TYR B 2 90  ? -10.175 11.221  -6.782  1.00 0.00  ? 229 TYR B HE1  5  
ATOM   8794  H HE2  . TYR B 2 90  ? -8.111  11.197  -3.005  1.00 0.00  ? 229 TYR B HE2  5  
ATOM   8795  H HH   . TYR B 2 90  ? -8.826  13.238  -4.899  1.00 0.00  ? 229 TYR B HH   5  
ATOM   8796  N N    . TYR B 2 91  ? -5.054  6.631   -4.962  1.00 15.18 ? 230 TYR B N    5  
ATOM   8797  C CA   . TYR B 2 91  ? -3.795  6.890   -4.209  1.00 16.33 ? 230 TYR B CA   5  
ATOM   8798  C C    . TYR B 2 91  ? -2.600  6.806   -5.163  1.00 16.83 ? 230 TYR B C    5  
ATOM   8799  O O    . TYR B 2 91  ? -1.492  7.165   -4.819  1.00 16.71 ? 230 TYR B O    5  
ATOM   8800  C CB   . TYR B 2 91  ? -3.639  5.841   -3.104  1.00 14.52 ? 230 TYR B CB   5  
ATOM   8801  C CG   . TYR B 2 91  ? -4.444  6.251   -1.891  1.00 16.10 ? 230 TYR B CG   5  
ATOM   8802  C CD1  . TYR B 2 91  ? -5.620  7.006   -2.044  1.00 15.88 ? 230 TYR B CD1  5  
ATOM   8803  C CD2  . TYR B 2 91  ? -4.017  5.872   -0.607  1.00 17.17 ? 230 TYR B CD2  5  
ATOM   8804  C CE1  . TYR B 2 91  ? -6.366  7.383   -0.913  1.00 17.12 ? 230 TYR B CE1  5  
ATOM   8805  C CE2  . TYR B 2 91  ? -4.762  6.248   0.523   1.00 17.84 ? 230 TYR B CE2  5  
ATOM   8806  C CZ   . TYR B 2 91  ? -5.937  7.003   0.370   1.00 17.32 ? 230 TYR B CZ   5  
ATOM   8807  O OH   . TYR B 2 91  ? -6.669  7.373   1.480   1.00 19.89 ? 230 TYR B OH   5  
ATOM   8808  H H    . TYR B 2 91  ? -5.517  5.772   -4.864  1.00 0.00  ? 230 TYR B H    5  
ATOM   8809  H HA   . TYR B 2 91  ? -3.835  7.875   -3.767  1.00 0.00  ? 230 TYR B HA   5  
ATOM   8810  H HB2  . TYR B 2 91  ? -3.992  4.886   -3.463  1.00 0.00  ? 230 TYR B HB2  5  
ATOM   8811  H HB3  . TYR B 2 91  ? -2.597  5.759   -2.830  1.00 0.00  ? 230 TYR B HB3  5  
ATOM   8812  H HD1  . TYR B 2 91  ? -5.950  7.299   -3.029  1.00 0.00  ? 230 TYR B HD1  5  
ATOM   8813  H HD2  . TYR B 2 91  ? -3.114  5.291   -0.489  1.00 0.00  ? 230 TYR B HD2  5  
ATOM   8814  H HE1  . TYR B 2 91  ? -7.268  7.963   -1.030  1.00 0.00  ? 230 TYR B HE1  5  
ATOM   8815  H HE2  . TYR B 2 91  ? -4.432  5.957   1.509   1.00 0.00  ? 230 TYR B HE2  5  
ATOM   8816  H HH   . TYR B 2 91  ? -7.445  6.810   1.524   1.00 0.00  ? 230 TYR B HH   5  
ATOM   8817  N N    . SER B 2 92  ? -2.816  6.332   -6.361  1.00 17.92 ? 231 SER B N    5  
ATOM   8818  C CA   . SER B 2 92  ? -1.693  6.226   -7.333  1.00 22.15 ? 231 SER B CA   5  
ATOM   8819  C C    . SER B 2 92  ? -1.596  7.518   -8.150  1.00 22.66 ? 231 SER B C    5  
ATOM   8820  O O    . SER B 2 92  ? -0.639  7.738   -8.865  1.00 24.35 ? 231 SER B O    5  
ATOM   8821  C CB   . SER B 2 92  ? -1.946  5.047   -8.274  1.00 21.66 ? 231 SER B CB   5  
ATOM   8822  O OG   . SER B 2 92  ? -1.368  3.872   -7.720  1.00 28.41 ? 231 SER B OG   5  
ATOM   8823  H H    . SER B 2 92  ? -3.715  6.044   -6.622  1.00 0.00  ? 231 SER B H    5  
ATOM   8824  H HA   . SER B 2 92  ? -0.769  6.067   -6.798  1.00 0.00  ? 231 SER B HA   5  
ATOM   8825  H HB2  . SER B 2 92  ? -3.006  4.899   -8.392  1.00 0.00  ? 231 SER B HB2  5  
ATOM   8826  H HB3  . SER B 2 92  ? -1.505  5.257   -9.238  1.00 0.00  ? 231 SER B HB3  5  
ATOM   8827  H HG   . SER B 2 92  ? -1.163  3.274   -8.442  1.00 0.00  ? 231 SER B HG   5  
ATOM   8828  N N    . LYS B 2 93  ? -2.576  8.375   -8.049  1.00 24.70 ? 232 LYS B N    5  
ATOM   8829  C CA   . LYS B 2 93  ? -2.531  9.650   -8.822  1.00 27.78 ? 232 LYS B CA   5  
ATOM   8830  C C    . LYS B 2 93  ? -2.299  10.819  -7.864  1.00 29.48 ? 232 LYS B C    5  
ATOM   8831  O O    . LYS B 2 93  ? -1.495  11.694  -8.119  1.00 31.78 ? 232 LYS B O    5  
ATOM   8832  C CB   . LYS B 2 93  ? -3.858  9.849   -9.558  1.00 28.95 ? 232 LYS B CB   5  
ATOM   8833  C CG   . LYS B 2 93  ? -3.634  9.697   -11.064 1.00 35.04 ? 232 LYS B CG   5  
ATOM   8834  C CD   . LYS B 2 93  ? -3.175  11.034  -11.650 1.00 42.20 ? 232 LYS B CD   5  
ATOM   8835  C CE   . LYS B 2 93  ? -4.299  11.632  -12.498 1.00 46.43 ? 232 LYS B CE   5  
ATOM   8836  N NZ   . LYS B 2 93  ? -3.862  12.949  -13.044 1.00 50.42 ? 232 LYS B NZ   5  
ATOM   8837  H H    . LYS B 2 93  ? -3.341  8.183   -7.467  1.00 0.00  ? 232 LYS B H    5  
ATOM   8838  H HA   . LYS B 2 93  ? -1.725  9.607   -9.540  1.00 0.00  ? 232 LYS B HA   5  
ATOM   8839  H HB2  . LYS B 2 93  ? -4.570  9.109   -9.222  1.00 0.00  ? 232 LYS B HB2  5  
ATOM   8840  H HB3  . LYS B 2 93  ? -4.239  10.837  -9.351  1.00 0.00  ? 232 LYS B HB3  5  
ATOM   8841  H HG2  . LYS B 2 93  ? -2.877  8.946   -11.241 1.00 0.00  ? 232 LYS B HG2  5  
ATOM   8842  H HG3  . LYS B 2 93  ? -4.557  9.397   -11.537 1.00 0.00  ? 232 LYS B HG3  5  
ATOM   8843  H HD2  . LYS B 2 93  ? -2.928  11.713  -10.847 1.00 0.00  ? 232 LYS B HD2  5  
ATOM   8844  H HD3  . LYS B 2 93  ? -2.304  10.877  -12.269 1.00 0.00  ? 232 LYS B HD3  5  
ATOM   8845  H HE2  . LYS B 2 93  ? -4.530  10.963  -13.313 1.00 0.00  ? 232 LYS B HE2  5  
ATOM   8846  H HE3  . LYS B 2 93  ? -5.177  11.771  -11.885 1.00 0.00  ? 232 LYS B HE3  5  
ATOM   8847  H HZ1  . LYS B 2 93  ? -3.400  13.499  -12.292 1.00 0.00  ? 232 LYS B HZ1  5  
ATOM   8848  H HZ2  . LYS B 2 93  ? -3.193  12.795  -13.825 1.00 0.00  ? 232 LYS B HZ2  5  
ATOM   8849  H HZ3  . LYS B 2 93  ? -4.690  13.468  -13.397 1.00 0.00  ? 232 LYS B HZ3  5  
ATOM   8850  N N    . HIS B 2 94  ? -2.996  10.841  -6.761  1.00 31.24 ? 233 HIS B N    5  
ATOM   8851  C CA   . HIS B 2 94  ? -2.815  11.954  -5.786  1.00 31.51 ? 233 HIS B CA   5  
ATOM   8852  C C    . HIS B 2 94  ? -2.470  11.373  -4.413  1.00 28.20 ? 233 HIS B C    5  
ATOM   8853  O O    . HIS B 2 94  ? -3.047  10.396  -3.979  1.00 29.72 ? 233 HIS B O    5  
ATOM   8854  C CB   . HIS B 2 94  ? -4.110  12.763  -5.687  1.00 33.74 ? 233 HIS B CB   5  
ATOM   8855  C CG   . HIS B 2 94  ? -4.353  13.483  -6.984  1.00 39.30 ? 233 HIS B CG   5  
ATOM   8856  N ND1  . HIS B 2 94  ? -3.727  14.681  -7.293  1.00 40.06 ? 233 HIS B ND1  5  
ATOM   8857  C CD2  . HIS B 2 94  ? -5.150  13.188  -8.063  1.00 39.81 ? 233 HIS B CD2  5  
ATOM   8858  C CE1  . HIS B 2 94  ? -4.155  15.060  -8.511  1.00 41.81 ? 233 HIS B CE1  5  
ATOM   8859  N NE2  . HIS B 2 94  ? -5.024  14.185  -9.025  1.00 42.50 ? 233 HIS B NE2  5  
ATOM   8860  H H    . HIS B 2 94  ? -3.639  10.127  -6.574  1.00 0.00  ? 233 HIS B H    5  
ATOM   8861  H HA   . HIS B 2 94  ? -2.013  12.597  -6.117  1.00 0.00  ? 233 HIS B HA   5  
ATOM   8862  H HB2  . HIS B 2 94  ? -4.936  12.096  -5.486  1.00 0.00  ? 233 HIS B HB2  5  
ATOM   8863  H HB3  . HIS B 2 94  ? -4.025  13.482  -4.887  1.00 0.00  ? 233 HIS B HB3  5  
ATOM   8864  H HD1  . HIS B 2 94  ? -3.090  15.164  -6.726  1.00 0.00  ? 233 HIS B HD1  5  
ATOM   8865  H HD2  . HIS B 2 94  ? -5.779  12.314  -8.151  1.00 0.00  ? 233 HIS B HD2  5  
ATOM   8866  H HE1  . HIS B 2 94  ? -3.837  15.963  -9.011  1.00 0.00  ? 233 HIS B HE1  5  
ATOM   8867  N N    . ALA B 2 95  ? -1.534  11.967  -3.725  1.00 24.22 ? 234 ALA B N    5  
ATOM   8868  C CA   . ALA B 2 95  ? -1.155  11.447  -2.381  1.00 22.83 ? 234 ALA B CA   5  
ATOM   8869  C C    . ALA B 2 95  ? -2.298  11.700  -1.397  1.00 24.43 ? 234 ALA B C    5  
ATOM   8870  O O    . ALA B 2 95  ? -2.381  11.078  -0.357  1.00 23.70 ? 234 ALA B O    5  
ATOM   8871  C CB   . ALA B 2 95  ? 0.106   12.163  -1.894  1.00 19.43 ? 234 ALA B CB   5  
ATOM   8872  H H    . ALA B 2 95  ? -1.079  12.754  -4.091  1.00 0.00  ? 234 ALA B H    5  
ATOM   8873  H HA   . ALA B 2 95  ? -0.965  10.386  -2.447  1.00 0.00  ? 234 ALA B HA   5  
ATOM   8874  H HB1  . ALA B 2 95  ? 0.552   12.705  -2.714  1.00 0.00  ? 234 ALA B HB1  5  
ATOM   8875  H HB2  . ALA B 2 95  ? -0.154  12.853  -1.105  1.00 0.00  ? 234 ALA B HB2  5  
ATOM   8876  H HB3  . ALA B 2 95  ? 0.810   11.434  -1.519  1.00 0.00  ? 234 ALA B HB3  5  
ATOM   8877  N N    . ASP B 2 96  ? -3.180  12.610  -1.723  1.00 27.21 ? 235 ASP B N    5  
ATOM   8878  C CA   . ASP B 2 96  ? -4.326  12.916  -0.817  1.00 29.29 ? 235 ASP B CA   5  
ATOM   8879  C C    . ASP B 2 96  ? -3.845  12.958  0.636   1.00 28.86 ? 235 ASP B C    5  
ATOM   8880  O O    . ASP B 2 96  ? -4.535  12.532  1.541   1.00 29.80 ? 235 ASP B O    5  
ATOM   8881  C CB   . ASP B 2 96  ? -5.406  11.840  -0.972  1.00 35.17 ? 235 ASP B CB   5  
ATOM   8882  C CG   . ASP B 2 96  ? -4.916  10.523  -0.368  1.00 40.61 ? 235 ASP B CG   5  
ATOM   8883  O OD1  . ASP B 2 96  ? -5.092  10.340  0.825   1.00 45.11 ? 235 ASP B OD1  5  
ATOM   8884  O OD2  . ASP B 2 96  ? -4.374  9.719   -1.109  1.00 46.14 ? 235 ASP B OD2  5  
ATOM   8885  H H    . ASP B 2 96  ? -3.087  13.095  -2.569  1.00 0.00  ? 235 ASP B H    5  
ATOM   8886  H HA   . ASP B 2 96  ? -4.742  13.878  -1.081  1.00 0.00  ? 235 ASP B HA   5  
ATOM   8887  H HB2  . ASP B 2 96  ? -6.305  12.157  -0.463  1.00 0.00  ? 235 ASP B HB2  5  
ATOM   8888  H HB3  . ASP B 2 96  ? -5.620  11.694  -2.021  1.00 0.00  ? 235 ASP B HB3  5  
ATOM   8889  N N    . GLY B 2 97  ? -2.666  13.468  0.866   1.00 27.14 ? 236 GLY B N    5  
ATOM   8890  C CA   . GLY B 2 97  ? -2.143  13.536  2.260   1.00 25.64 ? 236 GLY B CA   5  
ATOM   8891  C C    . GLY B 2 97  ? -1.387  12.248  2.586   1.00 24.14 ? 236 GLY B C    5  
ATOM   8892  O O    . GLY B 2 97  ? -1.413  11.767  3.701   1.00 24.47 ? 236 GLY B O    5  
ATOM   8893  H H    . GLY B 2 97  ? -2.125  13.805  0.121   1.00 0.00  ? 236 GLY B H    5  
ATOM   8894  H HA2  . GLY B 2 97  ? -1.474  14.381  2.351   1.00 0.00  ? 236 GLY B HA2  5  
ATOM   8895  H HA3  . GLY B 2 97  ? -2.965  13.651  2.948   1.00 0.00  ? 236 GLY B HA3  5  
ATOM   8896  N N    . LEU B 2 98  ? -0.714  11.683  1.621   1.00 20.92 ? 237 LEU B N    5  
ATOM   8897  C CA   . LEU B 2 98  ? 0.042   10.425  1.879   1.00 19.13 ? 237 LEU B CA   5  
ATOM   8898  C C    . LEU B 2 98  ? 1.543   10.723  1.878   1.00 18.42 ? 237 LEU B C    5  
ATOM   8899  O O    . LEU B 2 98  ? 1.962   11.854  1.726   1.00 19.85 ? 237 LEU B O    5  
ATOM   8900  C CB   . LEU B 2 98  ? -0.278  9.407   0.782   1.00 19.72 ? 237 LEU B CB   5  
ATOM   8901  C CG   . LEU B 2 98  ? -1.410  8.492   1.251   1.00 21.67 ? 237 LEU B CG   5  
ATOM   8902  C CD1  . LEU B 2 98  ? -2.339  8.187   0.074   1.00 17.09 ? 237 LEU B CD1  5  
ATOM   8903  C CD2  . LEU B 2 98  ? -0.819  7.184   1.786   1.00 22.76 ? 237 LEU B CD2  5  
ATOM   8904  H H    . LEU B 2 98  ? -0.705  12.086  0.728   1.00 0.00  ? 237 LEU B H    5  
ATOM   8905  H HA   . LEU B 2 98  ? -0.245  10.023  2.839   1.00 0.00  ? 237 LEU B HA   5  
ATOM   8906  H HB2  . LEU B 2 98  ? -0.582  9.927   -0.115  1.00 0.00  ? 237 LEU B HB2  5  
ATOM   8907  H HB3  . LEU B 2 98  ? 0.600   8.814   0.575   1.00 0.00  ? 237 LEU B HB3  5  
ATOM   8908  H HG   . LEU B 2 98  ? -1.970  8.983   2.033   1.00 0.00  ? 237 LEU B HG   5  
ATOM   8909  H HD11 . LEU B 2 98  ? -2.230  8.954   -0.678  1.00 0.00  ? 237 LEU B HD11 5  
ATOM   8910  H HD12 . LEU B 2 98  ? -2.079  7.228   -0.350  1.00 0.00  ? 237 LEU B HD12 5  
ATOM   8911  H HD13 . LEU B 2 98  ? -3.362  8.164   0.420   1.00 0.00  ? 237 LEU B HD13 5  
ATOM   8912  H HD21 . LEU B 2 98  ? 0.259   7.251   1.790   1.00 0.00  ? 237 LEU B HD21 5  
ATOM   8913  H HD22 . LEU B 2 98  ? -1.174  7.014   2.792   1.00 0.00  ? 237 LEU B HD22 5  
ATOM   8914  H HD23 . LEU B 2 98  ? -1.126  6.365   1.152   1.00 0.00  ? 237 LEU B HD23 5  
ATOM   8915  N N    . CYS B 2 99  ? 2.356   9.717   2.047   1.00 18.29 ? 238 CYS B N    5  
ATOM   8916  C CA   . CYS B 2 99  ? 3.828   9.941   2.057   1.00 17.21 ? 238 CYS B CA   5  
ATOM   8917  C C    . CYS B 2 99  ? 4.320   10.162  0.625   1.00 18.80 ? 238 CYS B C    5  
ATOM   8918  O O    . CYS B 2 99  ? 5.304   10.837  0.395   1.00 19.09 ? 238 CYS B O    5  
ATOM   8919  C CB   . CYS B 2 99  ? 4.524   8.716   2.653   1.00 17.49 ? 238 CYS B CB   5  
ATOM   8920  S SG   . CYS B 2 99  ? 3.959   7.225   1.796   1.00 18.25 ? 238 CYS B SG   5  
ATOM   8921  H H    . CYS B 2 99  ? 1.997   8.813   2.168   1.00 0.00  ? 238 CYS B H    5  
ATOM   8922  H HA   . CYS B 2 99  ? 4.056   10.811  2.654   1.00 0.00  ? 238 CYS B HA   5  
ATOM   8923  H HB2  . CYS B 2 99  ? 5.592   8.816   2.534   1.00 0.00  ? 238 CYS B HB2  5  
ATOM   8924  H HB3  . CYS B 2 99  ? 4.283   8.642   3.702   1.00 0.00  ? 238 CYS B HB3  5  
ATOM   8925  H HG   . CYS B 2 99  ? 4.731   6.709   1.557   1.00 0.00  ? 238 CYS B HG   5  
ATOM   8926  N N    . HIS B 2 100 ? 3.644   9.600   -0.339  1.00 17.96 ? 239 HIS B N    5  
ATOM   8927  C CA   . HIS B 2 100 ? 4.074   9.779   -1.754  1.00 18.41 ? 239 HIS B CA   5  
ATOM   8928  C C    . HIS B 2 100 ? 3.101   9.050   -2.682  1.00 18.79 ? 239 HIS B C    5  
ATOM   8929  O O    . HIS B 2 100 ? 2.659   7.955   -2.397  1.00 19.28 ? 239 HIS B O    5  
ATOM   8930  C CB   . HIS B 2 100 ? 5.480   9.200   -1.934  1.00 18.77 ? 239 HIS B CB   5  
ATOM   8931  C CG   . HIS B 2 100 ? 6.198   9.955   -3.019  1.00 18.40 ? 239 HIS B CG   5  
ATOM   8932  N ND1  . HIS B 2 100 ? 5.771   9.938   -4.337  1.00 18.53 ? 239 HIS B ND1  5  
ATOM   8933  C CD2  . HIS B 2 100 ? 7.315   10.753  -2.996  1.00 19.51 ? 239 HIS B CD2  5  
ATOM   8934  C CE1  . HIS B 2 100 ? 6.619   10.704  -5.047  1.00 19.04 ? 239 HIS B CE1  5  
ATOM   8935  N NE2  . HIS B 2 100 ? 7.579   11.225  -4.278  1.00 20.02 ? 239 HIS B NE2  5  
ATOM   8936  H H    . HIS B 2 100 ? 2.853   9.059   -0.133  1.00 0.00  ? 239 HIS B H    5  
ATOM   8937  H HA   . HIS B 2 100 ? 4.085   10.831  -1.998  1.00 0.00  ? 239 HIS B HA   5  
ATOM   8938  H HB2  . HIS B 2 100 ? 6.027   9.291   -1.008  1.00 0.00  ? 239 HIS B HB2  5  
ATOM   8939  H HB3  . HIS B 2 100 ? 5.407   8.158   -2.209  1.00 0.00  ? 239 HIS B HB3  5  
ATOM   8940  H HD1  . HIS B 2 100 ? 4.993   9.456   -4.689  1.00 0.00  ? 239 HIS B HD1  5  
ATOM   8941  H HD2  . HIS B 2 100 ? 7.899   10.979  -2.116  1.00 0.00  ? 239 HIS B HD2  5  
ATOM   8942  H HE1  . HIS B 2 100 ? 6.534   10.877  -6.110  1.00 0.00  ? 239 HIS B HE1  5  
ATOM   8943  N N    . ARG B 2 101 ? 2.761   9.648   -3.792  1.00 19.17 ? 240 ARG B N    5  
ATOM   8944  C CA   . ARG B 2 101 ? 1.817   8.987   -4.736  1.00 20.76 ? 240 ARG B CA   5  
ATOM   8945  C C    . ARG B 2 101 ? 2.468   7.726   -5.309  1.00 18.50 ? 240 ARG B C    5  
ATOM   8946  O O    . ARG B 2 101 ? 3.664   7.670   -5.516  1.00 17.06 ? 240 ARG B O    5  
ATOM   8947  C CB   . ARG B 2 101 ? 1.473   9.949   -5.874  1.00 25.30 ? 240 ARG B CB   5  
ATOM   8948  C CG   . ARG B 2 101 ? 0.663   9.207   -6.937  1.00 30.23 ? 240 ARG B CG   5  
ATOM   8949  C CD   . ARG B 2 101 ? 1.526   9.016   -8.182  1.00 37.22 ? 240 ARG B CD   5  
ATOM   8950  N NE   . ARG B 2 101 ? 1.038   9.911   -9.270  1.00 43.41 ? 240 ARG B NE   5  
ATOM   8951  C CZ   . ARG B 2 101 ? 1.400   9.694   -10.504 1.00 45.15 ? 240 ARG B CZ   5  
ATOM   8952  N NH1  . ARG B 2 101 ? 2.531   10.172  -10.947 1.00 46.50 ? 240 ARG B NH1  5  
ATOM   8953  N NH2  . ARG B 2 101 ? 0.632   8.997   -11.296 1.00 46.15 ? 240 ARG B NH2  5  
ATOM   8954  H H    . ARG B 2 101 ? 3.129   10.532  -4.005  1.00 0.00  ? 240 ARG B H    5  
ATOM   8955  H HA   . ARG B 2 101 ? 0.915   8.715   -4.213  1.00 0.00  ? 240 ARG B HA   5  
ATOM   8956  H HB2  . ARG B 2 101 ? 0.891   10.771  -5.484  1.00 0.00  ? 240 ARG B HB2  5  
ATOM   8957  H HB3  . ARG B 2 101 ? 2.382   10.326  -6.314  1.00 0.00  ? 240 ARG B HB3  5  
ATOM   8958  H HG2  . ARG B 2 101 ? 0.364   8.241   -6.554  1.00 0.00  ? 240 ARG B HG2  5  
ATOM   8959  H HG3  . ARG B 2 101 ? -0.213  9.782   -7.193  1.00 0.00  ? 240 ARG B HG3  5  
ATOM   8960  H HD2  . ARG B 2 101 ? 2.552   9.258   -7.947  1.00 0.00  ? 240 ARG B HD2  5  
ATOM   8961  H HD3  . ARG B 2 101 ? 1.463   7.989   -8.505  1.00 0.00  ? 240 ARG B HD3  5  
ATOM   8962  H HE   . ARG B 2 101 ? 0.445   10.662  -9.057  1.00 0.00  ? 240 ARG B HE   5  
ATOM   8963  H HH11 . ARG B 2 101 ? 3.119   10.706  -10.339 1.00 0.00  ? 240 ARG B HH11 5  
ATOM   8964  H HH12 . ARG B 2 101 ? 2.807   10.006  -11.892 1.00 0.00  ? 240 ARG B HH12 5  
ATOM   8965  H HH21 . ARG B 2 101 ? -0.234  8.629   -10.957 1.00 0.00  ? 240 ARG B HH21 5  
ATOM   8966  H HH22 . ARG B 2 101 ? 0.909   8.830   -12.243 1.00 0.00  ? 240 ARG B HH22 5  
ATOM   8967  N N    . LEU B 2 102 ? 1.687   6.712   -5.566  1.00 16.42 ? 241 LEU B N    5  
ATOM   8968  C CA   . LEU B 2 102 ? 2.259   5.453   -6.122  1.00 16.95 ? 241 LEU B CA   5  
ATOM   8969  C C    . LEU B 2 102 ? 2.852   5.723   -7.506  1.00 18.53 ? 241 LEU B C    5  
ATOM   8970  O O    . LEU B 2 102 ? 2.142   5.989   -8.455  1.00 19.32 ? 241 LEU B O    5  
ATOM   8971  C CB   . LEU B 2 102 ? 1.152   4.405   -6.241  1.00 12.02 ? 241 LEU B CB   5  
ATOM   8972  C CG   . LEU B 2 102 ? 0.399   4.297   -4.913  1.00 10.93 ? 241 LEU B CG   5  
ATOM   8973  C CD1  . LEU B 2 102 ? -0.543  3.094   -4.957  1.00 7.07  ? 241 LEU B CD1  5  
ATOM   8974  C CD2  . LEU B 2 102 ? 1.401   4.115   -3.769  1.00 9.30  ? 241 LEU B CD2  5  
ATOM   8975  H H    . LEU B 2 102 ? 0.725   6.778   -5.390  1.00 0.00  ? 241 LEU B H    5  
ATOM   8976  H HA   . LEU B 2 102 ? 3.032   5.085   -5.464  1.00 0.00  ? 241 LEU B HA   5  
ATOM   8977  H HB2  . LEU B 2 102 ? 0.467   4.697   -7.023  1.00 0.00  ? 241 LEU B HB2  5  
ATOM   8978  H HB3  . LEU B 2 102 ? 1.587   3.450   -6.484  1.00 0.00  ? 241 LEU B HB3  5  
ATOM   8979  H HG   . LEU B 2 102 ? -0.175  5.198   -4.751  1.00 0.00  ? 241 LEU B HG   5  
ATOM   8980  H HD11 . LEU B 2 102 ? 0.010   2.214   -5.250  1.00 0.00  ? 241 LEU B HD11 5  
ATOM   8981  H HD12 . LEU B 2 102 ? -0.974  2.938   -3.979  1.00 0.00  ? 241 LEU B HD12 5  
ATOM   8982  H HD13 . LEU B 2 102 ? -1.331  3.279   -5.672  1.00 0.00  ? 241 LEU B HD13 5  
ATOM   8983  H HD21 . LEU B 2 102 ? 2.343   3.768   -4.168  1.00 0.00  ? 241 LEU B HD21 5  
ATOM   8984  H HD22 . LEU B 2 102 ? 1.550   5.059   -3.266  1.00 0.00  ? 241 LEU B HD22 5  
ATOM   8985  H HD23 . LEU B 2 102 ? 1.018   3.389   -3.067  1.00 0.00  ? 241 LEU B HD23 5  
ATOM   8986  N N    . THR B 2 103 ? 4.149   5.655   -7.630  1.00 20.81 ? 242 THR B N    5  
ATOM   8987  C CA   . THR B 2 103 ? 4.784   5.908   -8.954  1.00 20.89 ? 242 THR B CA   5  
ATOM   8988  C C    . THR B 2 103 ? 5.245   4.583   -9.567  1.00 21.74 ? 242 THR B C    5  
ATOM   8989  O O    . THR B 2 103 ? 5.357   4.452   -10.770 1.00 24.76 ? 242 THR B O    5  
ATOM   8990  C CB   . THR B 2 103 ? 5.992   6.830   -8.773  1.00 20.18 ? 242 THR B CB   5  
ATOM   8991  O OG1  . THR B 2 103 ? 6.977   6.170   -7.988  1.00 22.88 ? 242 THR B OG1  5  
ATOM   8992  C CG2  . THR B 2 103 ? 5.555   8.116   -8.070  1.00 19.22 ? 242 THR B CG2  5  
ATOM   8993  H H    . THR B 2 103 ? 4.705   5.436   -6.853  1.00 0.00  ? 242 THR B H    5  
ATOM   8994  H HA   . THR B 2 103 ? 4.069   6.379   -9.612  1.00 0.00  ? 242 THR B HA   5  
ATOM   8995  H HB   . THR B 2 103 ? 6.407   7.076   -9.738  1.00 0.00  ? 242 THR B HB   5  
ATOM   8996  H HG1  . THR B 2 103 ? 7.680   5.883   -8.575  1.00 0.00  ? 242 THR B HG1  5  
ATOM   8997  H HG21 . THR B 2 103 ? 4.676   7.918   -7.473  1.00 0.00  ? 242 THR B HG21 5  
ATOM   8998  H HG22 . THR B 2 103 ? 6.351   8.466   -7.431  1.00 0.00  ? 242 THR B HG22 5  
ATOM   8999  H HG23 . THR B 2 103 ? 5.327   8.871   -8.807  1.00 0.00  ? 242 THR B HG23 5  
ATOM   9000  N N    . THR B 2 104 ? 5.516   3.601   -8.752  1.00 20.71 ? 243 THR B N    5  
ATOM   9001  C CA   . THR B 2 104 ? 5.970   2.289   -9.296  1.00 18.86 ? 243 THR B CA   5  
ATOM   9002  C C    . THR B 2 104 ? 5.522   1.164   -8.362  1.00 18.56 ? 243 THR B C    5  
ATOM   9003  O O    . THR B 2 104 ? 5.106   1.399   -7.246  1.00 18.28 ? 243 THR B O    5  
ATOM   9004  C CB   . THR B 2 104 ? 7.498   2.285   -9.400  1.00 20.42 ? 243 THR B CB   5  
ATOM   9005  O OG1  . THR B 2 104 ? 7.954   3.598   -9.694  1.00 20.70 ? 243 THR B OG1  5  
ATOM   9006  C CG2  . THR B 2 104 ? 7.932   1.330   -10.515 1.00 16.38 ? 243 THR B CG2  5  
ATOM   9007  H H    . THR B 2 104 ? 5.422   3.725   -7.785  1.00 0.00  ? 243 THR B H    5  
ATOM   9008  H HA   . THR B 2 104 ? 5.542   2.137   -10.275 1.00 0.00  ? 243 THR B HA   5  
ATOM   9009  H HB   . THR B 2 104 ? 7.922   1.956   -8.465  1.00 0.00  ? 243 THR B HB   5  
ATOM   9010  H HG1  . THR B 2 104 ? 8.914   3.593   -9.659  1.00 0.00  ? 243 THR B HG1  5  
ATOM   9011  H HG21 . THR B 2 104 ? 7.380   1.553   -11.415 1.00 0.00  ? 243 THR B HG21 5  
ATOM   9012  H HG22 . THR B 2 104 ? 8.989   1.452   -10.701 1.00 0.00  ? 243 THR B HG22 5  
ATOM   9013  H HG23 . THR B 2 104 ? 7.734   0.313   -10.213 1.00 0.00  ? 243 THR B HG23 5  
ATOM   9014  N N    . VAL B 2 105 ? 5.604   -0.060  -8.809  1.00 16.29 ? 244 VAL B N    5  
ATOM   9015  C CA   . VAL B 2 105 ? 5.183   -1.199  -7.946  1.00 16.81 ? 244 VAL B CA   5  
ATOM   9016  C C    . VAL B 2 105 ? 6.416   -1.998  -7.521  1.00 16.74 ? 244 VAL B C    5  
ATOM   9017  O O    . VAL B 2 105 ? 7.503   -1.797  -8.026  1.00 17.40 ? 244 VAL B O    5  
ATOM   9018  C CB   . VAL B 2 105 ? 4.232   -2.107  -8.729  1.00 17.29 ? 244 VAL B CB   5  
ATOM   9019  C CG1  . VAL B 2 105 ? 3.491   -3.029  -7.757  1.00 17.99 ? 244 VAL B CG1  5  
ATOM   9020  C CG2  . VAL B 2 105 ? 3.218   -1.250  -9.488  1.00 17.19 ? 244 VAL B CG2  5  
ATOM   9021  H H    . VAL B 2 105 ? 5.944   -0.229  -9.713  1.00 0.00  ? 244 VAL B H    5  
ATOM   9022  H HA   . VAL B 2 105 ? 4.679   -0.820  -7.070  1.00 0.00  ? 244 VAL B HA   5  
ATOM   9023  H HB   . VAL B 2 105 ? 4.799   -2.704  -9.429  1.00 0.00  ? 244 VAL B HB   5  
ATOM   9024  H HG11 . VAL B 2 105 ? 3.168   -2.461  -6.898  1.00 0.00  ? 244 VAL B HG11 5  
ATOM   9025  H HG12 . VAL B 2 105 ? 2.632   -3.456  -8.251  1.00 0.00  ? 244 VAL B HG12 5  
ATOM   9026  H HG13 . VAL B 2 105 ? 4.153   -3.821  -7.438  1.00 0.00  ? 244 VAL B HG13 5  
ATOM   9027  H HG21 . VAL B 2 105 ? 3.742   -0.533  -10.103 1.00 0.00  ? 244 VAL B HG21 5  
ATOM   9028  H HG22 . VAL B 2 105 ? 2.608   -1.883  -10.115 1.00 0.00  ? 244 VAL B HG22 5  
ATOM   9029  H HG23 . VAL B 2 105 ? 2.588   -0.728  -8.783  1.00 0.00  ? 244 VAL B HG23 5  
ATOM   9030  N N    . CYS B 2 106 ? 6.258   -2.904  -6.595  1.00 15.40 ? 245 CYS B N    5  
ATOM   9031  C CA   . CYS B 2 106 ? 7.422   -3.714  -6.139  1.00 16.70 ? 245 CYS B CA   5  
ATOM   9032  C C    . CYS B 2 106 ? 7.671   -4.856  -7.133  1.00 16.64 ? 245 CYS B C    5  
ATOM   9033  O O    . CYS B 2 106 ? 6.748   -5.340  -7.758  1.00 17.47 ? 245 CYS B O    5  
ATOM   9034  C CB   . CYS B 2 106 ? 7.128   -4.298  -4.756  1.00 15.93 ? 245 CYS B CB   5  
ATOM   9035  S SG   . CYS B 2 106 ? 7.772   -3.187  -3.481  1.00 18.24 ? 245 CYS B SG   5  
ATOM   9036  H H    . CYS B 2 106 ? 5.373   -3.052  -6.200  1.00 0.00  ? 245 CYS B H    5  
ATOM   9037  H HA   . CYS B 2 106 ? 8.299   -3.087  -6.086  1.00 0.00  ? 245 CYS B HA   5  
ATOM   9038  H HB2  . CYS B 2 106 ? 6.060   -4.408  -4.631  1.00 0.00  ? 245 CYS B HB2  5  
ATOM   9039  H HB3  . CYS B 2 106 ? 7.602   -5.264  -4.664  1.00 0.00  ? 245 CYS B HB3  5  
ATOM   9040  H HG   . CYS B 2 106 ? 7.867   -3.689  -2.669  1.00 0.00  ? 245 CYS B HG   5  
ATOM   9041  N N    . PRO B 2 107 ? 8.916   -5.251  -7.250  1.00 18.63 ? 246 PRO B N    5  
ATOM   9042  C CA   . PRO B 2 107 ? 9.319   -6.336  -8.163  1.00 19.52 ? 246 PRO B CA   5  
ATOM   9043  C C    . PRO B 2 107 ? 8.981   -7.700  -7.553  1.00 19.33 ? 246 PRO B C    5  
ATOM   9044  O O    . PRO B 2 107 ? 7.901   -7.829  -7.002  1.00 19.97 ? 246 PRO B O    5  
ATOM   9045  C CB   . PRO B 2 107 ? 10.834  -6.154  -8.291  1.00 18.97 ? 246 PRO B CB   5  
ATOM   9046  C CG   . PRO B 2 107 ? 11.287  -5.367  -7.038  1.00 18.88 ? 246 PRO B CG   5  
ATOM   9047  C CD   . PRO B 2 107 ? 10.035  -4.657  -6.488  1.00 17.74 ? 246 PRO B CD   5  
ATOM   9048  O OXT  . PRO B 2 107 ? 9.810   -8.590  -7.648  1.00 0.00  ? 246 PRO B OXT  5  
ATOM   9049  H HA   . PRO B 2 107 ? 8.850   -6.220  -9.126  1.00 0.00  ? 246 PRO B HA   5  
ATOM   9050  H HB2  . PRO B 2 107 ? 11.320  -7.120  -8.324  1.00 0.00  ? 246 PRO B HB2  5  
ATOM   9051  H HB3  . PRO B 2 107 ? 11.066  -5.589  -9.179  1.00 0.00  ? 246 PRO B HB3  5  
ATOM   9052  H HG2  . PRO B 2 107 ? 11.686  -6.048  -6.299  1.00 0.00  ? 246 PRO B HG2  5  
ATOM   9053  H HG3  . PRO B 2 107 ? 12.031  -4.635  -7.309  1.00 0.00  ? 246 PRO B HG3  5  
ATOM   9054  H HD2  . PRO B 2 107 ? 9.924   -4.855  -5.430  1.00 0.00  ? 246 PRO B HD2  5  
ATOM   9055  H HD3  . PRO B 2 107 ? 10.089  -3.596  -6.672  1.00 0.00  ? 246 PRO B HD3  5  
HETATM 9056  C C    . ACE A 1 1   ? 2.035   1.112   11.514  1.00 14.10 ? 100 ACE A C    6  
HETATM 9057  O O    . ACE A 1 1   ? 2.812   1.226   10.587  1.00 14.64 ? 100 ACE A O    6  
HETATM 9058  C CH3  . ACE A 1 1   ? 2.491   0.566   12.869  1.00 14.17 ? 100 ACE A CH3  6  
HETATM 9059  H H1   . ACE A 1 1   ? 1.651   0.537   13.547  1.00 0.00  ? 100 ACE A H1   6  
HETATM 9060  H H2   . ACE A 1 1   ? 2.884   -0.433  12.741  1.00 0.00  ? 100 ACE A H2   6  
HETATM 9061  H H3   . ACE A 1 1   ? 3.261   1.205   13.275  1.00 0.00  ? 100 ACE A H3   6  
HETATM 9062  N N    . PTR A 1 2   ? 0.781   1.453   11.393  1.00 14.28 ? 101 PTR A N    6  
HETATM 9063  C CA   . PTR A 1 2   ? 0.279   1.991   10.098  1.00 13.54 ? 101 PTR A CA   6  
HETATM 9064  C C    . PTR A 1 2   ? 0.067   3.502   10.222  1.00 14.12 ? 101 PTR A C    6  
HETATM 9065  O O    . PTR A 1 2   ? -0.064  4.033   11.306  1.00 13.97 ? 101 PTR A O    6  
HETATM 9066  C CB   . PTR A 1 2   ? -1.050  1.318   9.746   1.00 13.83 ? 101 PTR A CB   6  
HETATM 9067  C CG   . PTR A 1 2   ? -0.821  -0.156  9.509   1.00 12.91 ? 101 PTR A CG   6  
HETATM 9068  C CD1  . PTR A 1 2   ? -0.465  -0.614  8.230   1.00 12.17 ? 101 PTR A CD1  6  
HETATM 9069  C CD2  . PTR A 1 2   ? -0.963  -1.068  10.568  1.00 12.70 ? 101 PTR A CD2  6  
HETATM 9070  C CE1  . PTR A 1 2   ? -0.251  -1.985  8.009   1.00 12.08 ? 101 PTR A CE1  6  
HETATM 9071  C CE2  . PTR A 1 2   ? -0.749  -2.439  10.348  1.00 11.44 ? 101 PTR A CE2  6  
HETATM 9072  C CZ   . PTR A 1 2   ? -0.393  -2.898  9.068   1.00 13.78 ? 101 PTR A CZ   6  
HETATM 9073  O OH   . PTR A 1 2   ? -0.173  -4.293  8.844   1.00 14.51 ? 101 PTR A OH   6  
HETATM 9074  P P    . PTR A 1 2   ? 1.270   -4.945  9.135   1.00 17.94 ? 101 PTR A P    6  
HETATM 9075  O O1P  . PTR A 1 2   ? 1.048   -6.385  8.872   1.00 18.17 ? 101 PTR A O1P  6  
HETATM 9076  O O2P  . PTR A 1 2   ? 1.515   -4.599  10.553  1.00 15.88 ? 101 PTR A O2P  6  
HETATM 9077  O O3P  . PTR A 1 2   ? 2.151   -4.260  8.163   1.00 18.41 ? 101 PTR A O3P  6  
HETATM 9078  H H    . PTR A 1 2   ? 0.171   1.353   12.152  1.00 0.00  ? 101 PTR A H    6  
HETATM 9079  H HA   . PTR A 1 2   ? 1.001   1.792   9.320   1.00 0.00  ? 101 PTR A HA   6  
HETATM 9080  H HB2  . PTR A 1 2   ? -1.746  1.448   10.560  1.00 0.00  ? 101 PTR A HB2  6  
HETATM 9081  H HB3  . PTR A 1 2   ? -1.455  1.767   8.851   1.00 0.00  ? 101 PTR A HB3  6  
HETATM 9082  H HD1  . PTR A 1 2   ? -0.356  0.087   7.415   1.00 0.00  ? 101 PTR A HD1  6  
HETATM 9083  H HD2  . PTR A 1 2   ? -1.238  -0.715  11.552  1.00 0.00  ? 101 PTR A HD2  6  
HETATM 9084  H HE1  . PTR A 1 2   ? 0.023   -2.337  7.026   1.00 0.00  ? 101 PTR A HE1  6  
HETATM 9085  H HE2  . PTR A 1 2   ? -0.859  -3.141  11.162  1.00 0.00  ? 101 PTR A HE2  6  
ATOM   9086  N N    . GLU A 1 3   ? 0.032   4.198   9.119   1.00 15.01 ? 102 GLU A N    6  
ATOM   9087  C CA   . GLU A 1 3   ? -0.170  5.672   9.173   1.00 18.67 ? 102 GLU A CA   6  
ATOM   9088  C C    . GLU A 1 3   ? -1.626  6.001   8.836   1.00 23.30 ? 102 GLU A C    6  
ATOM   9089  O O    . GLU A 1 3   ? -2.448  5.122   8.668   1.00 23.42 ? 102 GLU A O    6  
ATOM   9090  C CB   . GLU A 1 3   ? 0.753   6.353   8.160   1.00 18.41 ? 102 GLU A CB   6  
ATOM   9091  C CG   . GLU A 1 3   ? 2.207   5.996   8.474   1.00 20.30 ? 102 GLU A CG   6  
ATOM   9092  C CD   . GLU A 1 3   ? 2.505   6.308   9.942   1.00 19.75 ? 102 GLU A CD   6  
ATOM   9093  O OE1  . GLU A 1 3   ? 2.601   7.478   10.270  1.00 19.69 ? 102 GLU A OE1  6  
ATOM   9094  O OE2  . GLU A 1 3   ? 2.631   5.369   10.712  1.00 21.81 ? 102 GLU A OE2  6  
ATOM   9095  H H    . GLU A 1 3   ? 0.140   3.750   8.253   1.00 0.00  ? 102 GLU A H    6  
ATOM   9096  H HA   . GLU A 1 3   ? 0.059   6.031   10.166  1.00 0.00  ? 102 GLU A HA   6  
ATOM   9097  H HB2  . GLU A 1 3   ? 0.505   6.015   7.164   1.00 0.00  ? 102 GLU A HB2  6  
ATOM   9098  H HB3  . GLU A 1 3   ? 0.626   7.423   8.220   1.00 0.00  ? 102 GLU A HB3  6  
ATOM   9099  H HG2  . GLU A 1 3   ? 2.367   4.943   8.288   1.00 0.00  ? 102 GLU A HG2  6  
ATOM   9100  H HG3  . GLU A 1 3   ? 2.864   6.577   7.845   1.00 0.00  ? 102 GLU A HG3  6  
ATOM   9101  N N    . GLU A 1 4   ? -1.952  7.262   8.736   1.00 29.30 ? 103 GLU A N    6  
ATOM   9102  C CA   . GLU A 1 4   ? -3.354  7.645   8.409   1.00 35.63 ? 103 GLU A CA   6  
ATOM   9103  C C    . GLU A 1 4   ? -3.347  8.742   7.342   1.00 37.94 ? 103 GLU A C    6  
ATOM   9104  O O    . GLU A 1 4   ? -2.430  9.537   7.261   1.00 40.44 ? 103 GLU A O    6  
ATOM   9105  C CB   . GLU A 1 4   ? -4.048  8.167   9.670   1.00 38.84 ? 103 GLU A CB   6  
ATOM   9106  C CG   . GLU A 1 4   ? -4.464  6.987   10.550  1.00 44.99 ? 103 GLU A CG   6  
ATOM   9107  C CD   . GLU A 1 4   ? -5.447  7.469   11.618  1.00 50.48 ? 103 GLU A CD   6  
ATOM   9108  O OE1  . GLU A 1 4   ? -5.143  8.450   12.276  1.00 53.57 ? 103 GLU A OE1  6  
ATOM   9109  O OE2  . GLU A 1 4   ? -6.487  6.848   11.761  1.00 53.04 ? 103 GLU A OE2  6  
ATOM   9110  H H    . GLU A 1 4   ? -1.274  7.954   8.876   1.00 0.00  ? 103 GLU A H    6  
ATOM   9111  H HA   . GLU A 1 4   ? -3.886  6.783   8.036   1.00 0.00  ? 103 GLU A HA   6  
ATOM   9112  H HB2  . GLU A 1 4   ? -3.368  8.803   10.217  1.00 0.00  ? 103 GLU A HB2  6  
ATOM   9113  H HB3  . GLU A 1 4   ? -4.925  8.731   9.391   1.00 0.00  ? 103 GLU A HB3  6  
ATOM   9114  H HG2  . GLU A 1 4   ? -4.936  6.230   9.939   1.00 0.00  ? 103 GLU A HG2  6  
ATOM   9115  H HG3  . GLU A 1 4   ? -3.590  6.570   11.029  1.00 0.00  ? 103 GLU A HG3  6  
ATOM   9116  N N    . ILE A 1 5   ? -4.360  8.793   6.522   1.00 39.26 ? 104 ILE A N    6  
ATOM   9117  C CA   . ILE A 1 5   ? -4.411  9.838   5.463   1.00 40.91 ? 104 ILE A CA   6  
ATOM   9118  C C    . ILE A 1 5   ? -5.014  11.120  6.043   1.00 42.72 ? 104 ILE A C    6  
ATOM   9119  O O    . ILE A 1 5   ? -6.207  11.340  5.979   1.00 43.33 ? 104 ILE A O    6  
ATOM   9120  C CB   . ILE A 1 5   ? -5.277  9.347   4.301   1.00 40.30 ? 104 ILE A CB   6  
ATOM   9121  C CG1  . ILE A 1 5   ? -4.567  8.193   3.589   1.00 39.28 ? 104 ILE A CG1  6  
ATOM   9122  C CG2  . ILE A 1 5   ? -5.504  10.491  3.311   1.00 41.44 ? 104 ILE A CG2  6  
ATOM   9123  C CD1  . ILE A 1 5   ? -5.008  6.865   4.207   1.00 37.66 ? 104 ILE A CD1  6  
ATOM   9124  H H    . ILE A 1 5   ? -5.090  8.143   6.606   1.00 0.00  ? 104 ILE A H    6  
ATOM   9125  H HA   . ILE A 1 5   ? -3.411  10.040  5.108   1.00 0.00  ? 104 ILE A HA   6  
ATOM   9126  H HB   . ILE A 1 5   ? -6.230  9.006   4.681   1.00 0.00  ? 104 ILE A HB   6  
ATOM   9127  H HG12 . ILE A 1 5   ? -4.824  8.205   2.540   1.00 0.00  ? 104 ILE A HG12 6  
ATOM   9128  H HG13 . ILE A 1 5   ? -3.499  8.302   3.701   1.00 0.00  ? 104 ILE A HG13 6  
ATOM   9129  H HG21 . ILE A 1 5   ? -4.596  11.068  3.214   1.00 0.00  ? 104 ILE A HG21 6  
ATOM   9130  H HG22 . ILE A 1 5   ? -5.777  10.085  2.348   1.00 0.00  ? 104 ILE A HG22 6  
ATOM   9131  H HG23 . ILE A 1 5   ? -6.298  11.127  3.671   1.00 0.00  ? 104 ILE A HG23 6  
ATOM   9132  H HD11 . ILE A 1 5   ? -5.992  6.977   4.637   1.00 0.00  ? 104 ILE A HD11 6  
ATOM   9133  H HD12 . ILE A 1 5   ? -5.034  6.103   3.441   1.00 0.00  ? 104 ILE A HD12 6  
ATOM   9134  H HD13 . ILE A 1 5   ? -4.308  6.576   4.978   1.00 0.00  ? 104 ILE A HD13 6  
ATOM   9135  N N    . GLU A 1 6   ? -4.198  11.967  6.609   1.00 0.00  ? 105 GLU A N    6  
ATOM   9136  C CA   . GLU A 1 6   ? -4.725  13.232  7.192   1.00 0.00  ? 105 GLU A CA   6  
ATOM   9137  C C    . GLU A 1 6   ? -4.306  14.412  6.314   1.00 0.00  ? 105 GLU A C    6  
ATOM   9138  O O    . GLU A 1 6   ? -3.114  14.598  6.136   1.00 0.00  ? 105 GLU A O    6  
ATOM   9139  C CB   . GLU A 1 6   ? -4.160  13.418  8.602   1.00 0.00  ? 105 GLU A CB   6  
ATOM   9140  C CG   . GLU A 1 6   ? -4.676  12.301  9.511   1.00 0.00  ? 105 GLU A CG   6  
ATOM   9141  C CD   . GLU A 1 6   ? -4.788  12.821  10.946  1.00 0.00  ? 105 GLU A CD   6  
ATOM   9142  O OE1  . GLU A 1 6   ? -5.673  13.622  11.196  1.00 0.00  ? 105 GLU A OE1  6  
ATOM   9143  O OE2  . GLU A 1 6   ? -3.988  12.408  11.768  1.00 0.00  ? 105 GLU A OE2  6  
ATOM   9144  O OXT  . GLU A 1 6   ? -5.185  15.110  5.835   1.00 0.00  ? 105 GLU A OXT  6  
ATOM   9145  H H    . GLU A 1 6   ? -3.239  11.770  6.651   1.00 0.00  ? 105 GLU A H    6  
ATOM   9146  H HA   . GLU A 1 6   ? -5.804  13.184  7.241   1.00 0.00  ? 105 GLU A HA   6  
ATOM   9147  H HB2  . GLU A 1 6   ? -3.081  13.383  8.564   1.00 0.00  ? 105 GLU A HB2  6  
ATOM   9148  H HB3  . GLU A 1 6   ? -4.477  14.373  8.994   1.00 0.00  ? 105 GLU A HB3  6  
ATOM   9149  H HG2  . GLU A 1 6   ? -5.647  11.976  9.168   1.00 0.00  ? 105 GLU A HG2  6  
ATOM   9150  H HG3  . GLU A 1 6   ? -3.988  11.468  9.485   1.00 0.00  ? 105 GLU A HG3  6  
ATOM   9151  N N    . MET B 2 1   ? -9.347  -3.563  -13.339 1.00 0.00  ? 140 MET B N    6  
ATOM   9152  C CA   . MET B 2 1   ? -10.143 -4.770  -13.705 1.00 0.00  ? 140 MET B CA   6  
ATOM   9153  C C    . MET B 2 1   ? -10.609 -5.478  -12.431 1.00 0.00  ? 140 MET B C    6  
ATOM   9154  O O    . MET B 2 1   ? -10.108 -5.229  -11.352 1.00 0.00  ? 140 MET B O    6  
ATOM   9155  C CB   . MET B 2 1   ? -9.276  -5.723  -14.530 1.00 0.00  ? 140 MET B CB   6  
ATOM   9156  C CG   . MET B 2 1   ? -8.486  -4.925  -15.569 1.00 0.00  ? 140 MET B CG   6  
ATOM   9157  S SD   . MET B 2 1   ? -9.634  -4.158  -16.740 1.00 0.00  ? 140 MET B SD   6  
ATOM   9158  C CE   . MET B 2 1   ? -9.007  -2.467  -16.597 1.00 0.00  ? 140 MET B CE   6  
ATOM   9159  H H1   . MET B 2 1   ? -9.758  -3.119  -12.495 1.00 0.00  ? 140 MET B H1   6  
ATOM   9160  H H2   . MET B 2 1   ? -8.364  -3.845  -13.141 1.00 0.00  ? 140 MET B H2   6  
ATOM   9161  H H3   . MET B 2 1   ? -9.361  -2.887  -14.128 1.00 0.00  ? 140 MET B H3   6  
ATOM   9162  H HA   . MET B 2 1   ? -11.003 -4.471  -14.286 1.00 0.00  ? 140 MET B HA   6  
ATOM   9163  H HB2  . MET B 2 1   ? -8.589  -6.242  -13.876 1.00 0.00  ? 140 MET B HB2  6  
ATOM   9164  H HB3  . MET B 2 1   ? -9.907  -6.440  -15.033 1.00 0.00  ? 140 MET B HB3  6  
ATOM   9165  H HG2  . MET B 2 1   ? -7.911  -4.158  -15.074 1.00 0.00  ? 140 MET B HG2  6  
ATOM   9166  H HG3  . MET B 2 1   ? -7.820  -5.588  -16.101 1.00 0.00  ? 140 MET B HG3  6  
ATOM   9167  H HE1  . MET B 2 1   ? -8.236  -2.430  -15.844 1.00 0.00  ? 140 MET B HE1  6  
ATOM   9168  H HE2  . MET B 2 1   ? -8.594  -2.155  -17.548 1.00 0.00  ? 140 MET B HE2  6  
ATOM   9169  H HE3  . MET B 2 1   ? -9.815  -1.807  -16.316 1.00 0.00  ? 140 MET B HE3  6  
ATOM   9170  N N    . ASP B 2 2   ? -11.564 -6.358  -12.547 1.00 0.00  ? 141 ASP B N    6  
ATOM   9171  C CA   . ASP B 2 2   ? -12.062 -7.081  -11.342 1.00 0.00  ? 141 ASP B CA   6  
ATOM   9172  C C    . ASP B 2 2   ? -11.265 -8.374  -11.157 1.00 0.00  ? 141 ASP B C    6  
ATOM   9173  O O    . ASP B 2 2   ? -11.819 -9.454  -11.099 1.00 0.00  ? 141 ASP B O    6  
ATOM   9174  C CB   . ASP B 2 2   ? -13.543 -7.417  -11.524 1.00 0.00  ? 141 ASP B CB   6  
ATOM   9175  C CG   . ASP B 2 2   ? -14.356 -6.123  -11.588 1.00 0.00  ? 141 ASP B CG   6  
ATOM   9176  O OD1  . ASP B 2 2   ? -14.109 -5.335  -12.486 1.00 0.00  ? 141 ASP B OD1  6  
ATOM   9177  O OD2  . ASP B 2 2   ? -15.213 -5.942  -10.738 1.00 0.00  ? 141 ASP B OD2  6  
ATOM   9178  H H    . ASP B 2 2   ? -11.956 -6.545  -13.426 1.00 0.00  ? 141 ASP B H    6  
ATOM   9179  H HA   . ASP B 2 2   ? -11.939 -6.455  -10.470 1.00 0.00  ? 141 ASP B HA   6  
ATOM   9180  H HB2  . ASP B 2 2   ? -13.676 -7.972  -12.442 1.00 0.00  ? 141 ASP B HB2  6  
ATOM   9181  H HB3  . ASP B 2 2   ? -13.882 -8.013  -10.691 1.00 0.00  ? 141 ASP B HB3  6  
ATOM   9182  N N    . SER B 2 3   ? -9.967  -8.274  -11.064 1.00 0.00  ? 142 SER B N    6  
ATOM   9183  C CA   . SER B 2 3   ? -9.137  -9.498  -10.883 1.00 0.00  ? 142 SER B CA   6  
ATOM   9184  C C    . SER B 2 3   ? -8.096  -9.250  -9.789  1.00 0.00  ? 142 SER B C    6  
ATOM   9185  O O    . SER B 2 3   ? -6.990  -8.823  -10.056 1.00 0.00  ? 142 SER B O    6  
ATOM   9186  C CB   . SER B 2 3   ? -8.428  -9.832  -12.195 1.00 0.00  ? 142 SER B CB   6  
ATOM   9187  O OG   . SER B 2 3   ? -9.214  -10.761 -12.930 1.00 0.00  ? 142 SER B OG   6  
ATOM   9188  H H    . SER B 2 3   ? -9.538  -7.394  -11.113 1.00 0.00  ? 142 SER B H    6  
ATOM   9189  H HA   . SER B 2 3   ? -9.771  -10.324 -10.596 1.00 0.00  ? 142 SER B HA   6  
ATOM   9190  H HB2  . SER B 2 3   ? -8.302  -8.935  -12.778 1.00 0.00  ? 142 SER B HB2  6  
ATOM   9191  H HB3  . SER B 2 3   ? -7.456  -10.259 -11.981 1.00 0.00  ? 142 SER B HB3  6  
ATOM   9192  H HG   . SER B 2 3   ? -9.877  -10.267 -13.419 1.00 0.00  ? 142 SER B HG   6  
ATOM   9193  N N    . ILE B 2 4   ? -8.441  -9.516  -8.559  1.00 0.00  ? 143 ILE B N    6  
ATOM   9194  C CA   . ILE B 2 4   ? -7.473  -9.295  -7.448  1.00 0.00  ? 143 ILE B CA   6  
ATOM   9195  C C    . ILE B 2 4   ? -6.389  -10.375 -7.485  1.00 0.00  ? 143 ILE B C    6  
ATOM   9196  O O    . ILE B 2 4   ? -5.392  -10.290 -6.794  1.00 0.00  ? 143 ILE B O    6  
ATOM   9197  C CB   . ILE B 2 4   ? -8.212  -9.362  -6.110  1.00 0.00  ? 143 ILE B CB   6  
ATOM   9198  C CG1  . ILE B 2 4   ? -7.215  -9.160  -4.967  1.00 0.00  ? 143 ILE B CG1  6  
ATOM   9199  C CG2  . ILE B 2 4   ? -8.882  -10.729 -5.965  1.00 0.00  ? 143 ILE B CG2  6  
ATOM   9200  C CD1  . ILE B 2 4   ? -7.963  -9.141  -3.633  1.00 0.00  ? 143 ILE B CD1  6  
ATOM   9201  H H    . ILE B 2 4   ? -9.338  -9.860  -8.366  1.00 0.00  ? 143 ILE B H    6  
ATOM   9202  H HA   . ILE B 2 4   ? -7.016  -8.323  -7.557  1.00 0.00  ? 143 ILE B HA   6  
ATOM   9203  H HB   . ILE B 2 4   ? -8.964  -8.587  -6.075  1.00 0.00  ? 143 ILE B HB   6  
ATOM   9204  H HG12 . ILE B 2 4   ? -6.498  -9.969  -4.968  1.00 0.00  ? 143 ILE B HG12 6  
ATOM   9205  H HG13 . ILE B 2 4   ? -6.698  -8.222  -5.102  1.00 0.00  ? 143 ILE B HG13 6  
ATOM   9206  H HG21 . ILE B 2 4   ? -9.099  -11.130 -6.944  1.00 0.00  ? 143 ILE B HG21 6  
ATOM   9207  H HG22 . ILE B 2 4   ? -8.220  -11.401 -5.440  1.00 0.00  ? 143 ILE B HG22 6  
ATOM   9208  H HG23 . ILE B 2 4   ? -9.801  -10.622 -5.408  1.00 0.00  ? 143 ILE B HG23 6  
ATOM   9209  H HD11 . ILE B 2 4   ? -8.925  -9.617  -3.753  1.00 0.00  ? 143 ILE B HD11 6  
ATOM   9210  H HD12 . ILE B 2 4   ? -7.388  -9.674  -2.890  1.00 0.00  ? 143 ILE B HD12 6  
ATOM   9211  H HD13 . ILE B 2 4   ? -8.104  -8.119  -3.314  1.00 0.00  ? 143 ILE B HD13 6  
ATOM   9212  N N    . GLN B 2 5   ? -6.572  -11.393 -8.282  1.00 0.00  ? 144 GLN B N    6  
ATOM   9213  C CA   . GLN B 2 5   ? -5.548  -12.472 -8.354  1.00 0.00  ? 144 GLN B CA   6  
ATOM   9214  C C    . GLN B 2 5   ? -4.732  -12.321 -9.640  1.00 0.00  ? 144 GLN B C    6  
ATOM   9215  O O    . GLN B 2 5   ? -4.033  -13.225 -10.052 1.00 0.00  ? 144 GLN B O    6  
ATOM   9216  C CB   . GLN B 2 5   ? -6.243  -13.835 -8.350  1.00 0.00  ? 144 GLN B CB   6  
ATOM   9217  C CG   . GLN B 2 5   ? -5.288  -14.895 -7.798  1.00 0.00  ? 144 GLN B CG   6  
ATOM   9218  C CD   . GLN B 2 5   ? -4.744  -15.743 -8.949  1.00 0.00  ? 144 GLN B CD   6  
ATOM   9219  O OE1  . GLN B 2 5   ? -5.501  -16.303 -9.718  1.00 0.00  ? 144 GLN B OE1  6  
ATOM   9220  N NE2  . GLN B 2 5   ? -3.454  -15.862 -9.102  1.00 0.00  ? 144 GLN B NE2  6  
ATOM   9221  H H    . GLN B 2 5   ? -7.382  -11.447 -8.831  1.00 0.00  ? 144 GLN B H    6  
ATOM   9222  H HA   . GLN B 2 5   ? -4.891  -12.403 -7.502  1.00 0.00  ? 144 GLN B HA   6  
ATOM   9223  H HB2  . GLN B 2 5   ? -7.126  -13.787 -7.729  1.00 0.00  ? 144 GLN B HB2  6  
ATOM   9224  H HB3  . GLN B 2 5   ? -6.527  -14.099 -9.358  1.00 0.00  ? 144 GLN B HB3  6  
ATOM   9225  H HG2  . GLN B 2 5   ? -4.468  -14.409 -7.289  1.00 0.00  ? 144 GLN B HG2  6  
ATOM   9226  H HG3  . GLN B 2 5   ? -5.817  -15.531 -7.105  1.00 0.00  ? 144 GLN B HG3  6  
ATOM   9227  H HE21 . GLN B 2 5   ? -2.843  -15.412 -8.482  1.00 0.00  ? 144 GLN B HE21 6  
ATOM   9228  H HE22 . GLN B 2 5   ? -3.095  -16.404 -9.836  1.00 0.00  ? 144 GLN B HE22 6  
ATOM   9229  N N    . ALA B 2 6   ? -4.816  -11.187 -10.281 1.00 42.36 ? 145 ALA B N    6  
ATOM   9230  C CA   . ALA B 2 6   ? -4.044  -10.987 -11.539 1.00 39.52 ? 145 ALA B CA   6  
ATOM   9231  C C    . ALA B 2 6   ? -3.389  -9.601  -11.539 1.00 36.36 ? 145 ALA B C    6  
ATOM   9232  O O    . ALA B 2 6   ? -2.771  -9.201  -12.505 1.00 36.34 ? 145 ALA B O    6  
ATOM   9233  C CB   . ALA B 2 6   ? -4.987  -11.101 -12.739 1.00 40.62 ? 145 ALA B CB   6  
ATOM   9234  H H    . ALA B 2 6   ? -5.388  -10.470 -9.935  1.00 0.00  ? 145 ALA B H    6  
ATOM   9235  H HA   . ALA B 2 6   ? -3.277  -11.744 -11.614 1.00 0.00  ? 145 ALA B HA   6  
ATOM   9236  H HB1  . ALA B 2 6   ? -5.631  -11.958 -12.608 1.00 0.00  ? 145 ALA B HB1  6  
ATOM   9237  H HB2  . ALA B 2 6   ? -5.588  -10.207 -12.810 1.00 0.00  ? 145 ALA B HB2  6  
ATOM   9238  H HB3  . ALA B 2 6   ? -4.407  -11.220 -13.642 1.00 0.00  ? 145 ALA B HB3  6  
ATOM   9239  N N    . GLU B 2 7   ? -3.517  -8.864  -10.469 1.00 32.22 ? 146 GLU B N    6  
ATOM   9240  C CA   . GLU B 2 7   ? -2.897  -7.508  -10.426 1.00 28.03 ? 146 GLU B CA   6  
ATOM   9241  C C    . GLU B 2 7   ? -1.393  -7.636  -10.189 1.00 24.38 ? 146 GLU B C    6  
ATOM   9242  O O    . GLU B 2 7   ? -0.939  -8.468  -9.426  1.00 22.48 ? 146 GLU B O    6  
ATOM   9243  C CB   . GLU B 2 7   ? -3.515  -6.685  -9.296  1.00 27.81 ? 146 GLU B CB   6  
ATOM   9244  C CG   . GLU B 2 7   ? -3.423  -7.461  -7.982  1.00 30.44 ? 146 GLU B CG   6  
ATOM   9245  C CD   . GLU B 2 7   ? -4.767  -7.399  -7.250  1.00 31.15 ? 146 GLU B CD   6  
ATOM   9246  O OE1  . GLU B 2 7   ? -5.646  -6.700  -7.725  1.00 30.91 ? 146 GLU B OE1  6  
ATOM   9247  O OE2  . GLU B 2 7   ? -4.892  -8.049  -6.226  1.00 34.56 ? 146 GLU B OE2  6  
ATOM   9248  H H    . GLU B 2 7   ? -4.020  -9.198  -9.697  1.00 0.00  ? 146 GLU B H    6  
ATOM   9249  H HA   . GLU B 2 7   ? -3.068  -7.008  -11.368 1.00 0.00  ? 146 GLU B HA   6  
ATOM   9250  H HB2  . GLU B 2 7   ? -2.976  -5.755  -9.202  1.00 0.00  ? 146 GLU B HB2  6  
ATOM   9251  H HB3  . GLU B 2 7   ? -4.547  -6.481  -9.525  1.00 0.00  ? 146 GLU B HB3  6  
ATOM   9252  H HG2  . GLU B 2 7   ? -3.174  -8.491  -8.189  1.00 0.00  ? 146 GLU B HG2  6  
ATOM   9253  H HG3  . GLU B 2 7   ? -2.657  -7.025  -7.360  1.00 0.00  ? 146 GLU B HG3  6  
ATOM   9254  N N    . GLU B 2 8   ? -0.618  -6.813  -10.835 1.00 21.92 ? 147 GLU B N    6  
ATOM   9255  C CA   . GLU B 2 8   ? 0.858   -6.881  -10.653 1.00 21.70 ? 147 GLU B CA   6  
ATOM   9256  C C    . GLU B 2 8   ? 1.240   -6.321  -9.281  1.00 19.46 ? 147 GLU B C    6  
ATOM   9257  O O    . GLU B 2 8   ? 2.390   -6.359  -8.890  1.00 19.28 ? 147 GLU B O    6  
ATOM   9258  C CB   . GLU B 2 8   ? 1.544   -6.057  -11.745 1.00 26.72 ? 147 GLU B CB   6  
ATOM   9259  C CG   . GLU B 2 8   ? 3.052   -6.029  -11.488 1.00 37.15 ? 147 GLU B CG   6  
ATOM   9260  C CD   . GLU B 2 8   ? 3.782   -5.613  -12.766 1.00 41.71 ? 147 GLU B CD   6  
ATOM   9261  O OE1  . GLU B 2 8   ? 3.781   -6.392  -13.705 1.00 45.02 ? 147 GLU B OE1  6  
ATOM   9262  O OE2  . GLU B 2 8   ? 4.331   -4.524  -12.783 1.00 46.00 ? 147 GLU B OE2  6  
ATOM   9263  H H    . GLU B 2 8   ? -1.008  -6.149  -11.442 1.00 0.00  ? 147 GLU B H    6  
ATOM   9264  H HA   . GLU B 2 8   ? 1.180   -7.909  -10.724 1.00 0.00  ? 147 GLU B HA   6  
ATOM   9265  H HB2  . GLU B 2 8   ? 1.351   -6.506  -12.710 1.00 0.00  ? 147 GLU B HB2  6  
ATOM   9266  H HB3  . GLU B 2 8   ? 1.160   -5.050  -11.732 1.00 0.00  ? 147 GLU B HB3  6  
ATOM   9267  H HG2  . GLU B 2 8   ? 3.269   -5.320  -10.701 1.00 0.00  ? 147 GLU B HG2  6  
ATOM   9268  H HG3  . GLU B 2 8   ? 3.386   -7.012  -11.188 1.00 0.00  ? 147 GLU B HG3  6  
ATOM   9269  N N    . TRP B 2 9   ? 0.296   -5.804  -8.542  1.00 17.10 ? 148 TRP B N    6  
ATOM   9270  C CA   . TRP B 2 9   ? 0.637   -5.252  -7.201  1.00 12.75 ? 148 TRP B CA   6  
ATOM   9271  C C    . TRP B 2 9   ? 0.104   -6.180  -6.106  1.00 12.19 ? 148 TRP B C    6  
ATOM   9272  O O    . TRP B 2 9   ? -0.014  -5.796  -4.959  1.00 11.66 ? 148 TRP B O    6  
ATOM   9273  C CB   . TRP B 2 9   ? 0.034   -3.853  -7.037  1.00 14.42 ? 148 TRP B CB   6  
ATOM   9274  C CG   . TRP B 2 9   ? -1.356  -3.822  -7.588  1.00 13.12 ? 148 TRP B CG   6  
ATOM   9275  C CD1  . TRP B 2 9   ? -1.682  -3.468  -8.853  1.00 13.11 ? 148 TRP B CD1  6  
ATOM   9276  C CD2  . TRP B 2 9   ? -2.610  -4.137  -6.914  1.00 12.81 ? 148 TRP B CD2  6  
ATOM   9277  N NE1  . TRP B 2 9   ? -3.056  -3.546  -9.001  1.00 12.63 ? 148 TRP B NE1  6  
ATOM   9278  C CE2  . TRP B 2 9   ? -3.673  -3.956  -7.835  1.00 13.14 ? 148 TRP B CE2  6  
ATOM   9279  C CE3  . TRP B 2 9   ? -2.924  -4.561  -5.606  1.00 10.52 ? 148 TRP B CE3  6  
ATOM   9280  C CZ2  . TRP B 2 9   ? -5.004  -4.187  -7.471  1.00 13.39 ? 148 TRP B CZ2  6  
ATOM   9281  C CZ3  . TRP B 2 9   ? -4.264  -4.794  -5.235  1.00 12.83 ? 148 TRP B CZ3  6  
ATOM   9282  C CH2  . TRP B 2 9   ? -5.301  -4.607  -6.166  1.00 12.53 ? 148 TRP B CH2  6  
ATOM   9283  H H    . TRP B 2 9   ? -0.631  -5.779  -8.866  1.00 0.00  ? 148 TRP B H    6  
ATOM   9284  H HA   . TRP B 2 9   ? 1.712   -5.186  -7.113  1.00 0.00  ? 148 TRP B HA   6  
ATOM   9285  H HB2  . TRP B 2 9   ? 0.009   -3.595  -5.989  1.00 0.00  ? 148 TRP B HB2  6  
ATOM   9286  H HB3  . TRP B 2 9   ? 0.645   -3.137  -7.566  1.00 0.00  ? 148 TRP B HB3  6  
ATOM   9287  H HD1  . TRP B 2 9   ? -0.984  -3.171  -9.623  1.00 0.00  ? 148 TRP B HD1  6  
ATOM   9288  H HE1  . TRP B 2 9   ? -3.548  -3.343  -9.823  1.00 0.00  ? 148 TRP B HE1  6  
ATOM   9289  H HE3  . TRP B 2 9   ? -2.135  -4.708  -4.885  1.00 0.00  ? 148 TRP B HE3  6  
ATOM   9290  H HZ2  . TRP B 2 9   ? -5.797  -4.042  -8.188  1.00 0.00  ? 148 TRP B HZ2  6  
ATOM   9291  H HZ3  . TRP B 2 9   ? -4.494  -5.118  -4.231  1.00 0.00  ? 148 TRP B HZ3  6  
ATOM   9292  H HH2  . TRP B 2 9   ? -6.325  -4.787  -5.877  1.00 0.00  ? 148 TRP B HH2  6  
ATOM   9293  N N    . TYR B 2 10  ? -0.209  -7.403  -6.445  1.00 11.66 ? 149 TYR B N    6  
ATOM   9294  C CA   . TYR B 2 10  ? -0.721  -8.350  -5.414  1.00 13.63 ? 149 TYR B CA   6  
ATOM   9295  C C    . TYR B 2 10  ? 0.173   -9.590  -5.374  1.00 14.73 ? 149 TYR B C    6  
ATOM   9296  O O    . TYR B 2 10  ? 0.111   -10.441 -6.239  1.00 16.34 ? 149 TYR B O    6  
ATOM   9297  C CB   . TYR B 2 10  ? -2.150  -8.770  -5.760  1.00 12.52 ? 149 TYR B CB   6  
ATOM   9298  C CG   . TYR B 2 10  ? -2.615  -9.825  -4.784  1.00 15.49 ? 149 TYR B CG   6  
ATOM   9299  C CD1  . TYR B 2 10  ? -3.049  -9.452  -3.500  1.00 19.03 ? 149 TYR B CD1  6  
ATOM   9300  C CD2  . TYR B 2 10  ? -2.611  -11.179 -5.158  1.00 14.45 ? 149 TYR B CD2  6  
ATOM   9301  C CE1  . TYR B 2 10  ? -3.479  -10.434 -2.592  1.00 20.41 ? 149 TYR B CE1  6  
ATOM   9302  C CE2  . TYR B 2 10  ? -3.042  -12.161 -4.249  1.00 15.99 ? 149 TYR B CE2  6  
ATOM   9303  C CZ   . TYR B 2 10  ? -3.476  -11.787 -2.966  1.00 21.15 ? 149 TYR B CZ   6  
ATOM   9304  O OH   . TYR B 2 10  ? -3.899  -12.752 -2.073  1.00 23.67 ? 149 TYR B OH   6  
ATOM   9305  H H    . TYR B 2 10  ? -0.101  -7.699  -7.375  1.00 0.00  ? 149 TYR B H    6  
ATOM   9306  H HA   . TYR B 2 10  ? -0.712  -7.869  -4.446  1.00 0.00  ? 149 TYR B HA   6  
ATOM   9307  H HB2  . TYR B 2 10  ? -2.803  -7.912  -5.700  1.00 0.00  ? 149 TYR B HB2  6  
ATOM   9308  H HB3  . TYR B 2 10  ? -2.174  -9.174  -6.760  1.00 0.00  ? 149 TYR B HB3  6  
ATOM   9309  H HD1  . TYR B 2 10  ? -3.051  -8.411  -3.212  1.00 0.00  ? 149 TYR B HD1  6  
ATOM   9310  H HD2  . TYR B 2 10  ? -2.278  -11.465 -6.145  1.00 0.00  ? 149 TYR B HD2  6  
ATOM   9311  H HE1  . TYR B 2 10  ? -3.813  -10.147 -1.605  1.00 0.00  ? 149 TYR B HE1  6  
ATOM   9312  H HE2  . TYR B 2 10  ? -3.039  -13.202 -4.537  1.00 0.00  ? 149 TYR B HE2  6  
ATOM   9313  H HH   . TYR B 2 10  ? -3.147  -13.311 -1.863  1.00 0.00  ? 149 TYR B HH   6  
ATOM   9314  N N    . PHE B 2 11  ? 1.007   -9.700  -4.375  1.00 14.41 ? 150 PHE B N    6  
ATOM   9315  C CA   . PHE B 2 11  ? 1.904   -10.887 -4.283  1.00 13.20 ? 150 PHE B CA   6  
ATOM   9316  C C    . PHE B 2 11  ? 1.253   -11.949 -3.395  1.00 12.95 ? 150 PHE B C    6  
ATOM   9317  O O    . PHE B 2 11  ? 1.316   -13.129 -3.676  1.00 12.44 ? 150 PHE B O    6  
ATOM   9318  C CB   . PHE B 2 11  ? 3.246   -10.468 -3.679  1.00 13.34 ? 150 PHE B CB   6  
ATOM   9319  C CG   . PHE B 2 11  ? 3.668   -9.136  -4.256  1.00 10.91 ? 150 PHE B CG   6  
ATOM   9320  C CD1  . PHE B 2 11  ? 3.332   -8.802  -5.580  1.00 10.09 ? 150 PHE B CD1  6  
ATOM   9321  C CD2  . PHE B 2 11  ? 4.397   -8.230  -3.467  1.00 10.43 ? 150 PHE B CD2  6  
ATOM   9322  C CE1  . PHE B 2 11  ? 3.727   -7.564  -6.114  1.00 7.94  ? 150 PHE B CE1  6  
ATOM   9323  C CE2  . PHE B 2 11  ? 4.791   -6.992  -4.002  1.00 9.38  ? 150 PHE B CE2  6  
ATOM   9324  C CZ   . PHE B 2 11  ? 4.455   -6.659  -5.325  1.00 8.81  ? 150 PHE B CZ   6  
ATOM   9325  H H    . PHE B 2 11  ? 1.042   -9.004  -3.687  1.00 0.00  ? 150 PHE B H    6  
ATOM   9326  H HA   . PHE B 2 11  ? 2.064   -11.294 -5.271  1.00 0.00  ? 150 PHE B HA   6  
ATOM   9327  H HB2  . PHE B 2 11  ? 3.146   -10.381 -2.607  1.00 0.00  ? 150 PHE B HB2  6  
ATOM   9328  H HB3  . PHE B 2 11  ? 3.993   -11.211 -3.913  1.00 0.00  ? 150 PHE B HB3  6  
ATOM   9329  H HD1  . PHE B 2 11  ? 2.772   -9.498  -6.186  1.00 0.00  ? 150 PHE B HD1  6  
ATOM   9330  H HD2  . PHE B 2 11  ? 4.655   -8.486  -2.450  1.00 0.00  ? 150 PHE B HD2  6  
ATOM   9331  H HE1  . PHE B 2 11  ? 3.469   -7.307  -7.131  1.00 0.00  ? 150 PHE B HE1  6  
ATOM   9332  H HE2  . PHE B 2 11  ? 5.352   -6.296  -3.396  1.00 0.00  ? 150 PHE B HE2  6  
ATOM   9333  H HZ   . PHE B 2 11  ? 4.759   -5.707  -5.736  1.00 0.00  ? 150 PHE B HZ   6  
ATOM   9334  N N    . GLY B 2 12  ? 0.626   -11.541 -2.326  1.00 14.57 ? 151 GLY B N    6  
ATOM   9335  C CA   . GLY B 2 12  ? -0.028  -12.529 -1.423  1.00 13.68 ? 151 GLY B CA   6  
ATOM   9336  C C    . GLY B 2 12  ? 0.439   -12.301 0.015   1.00 15.95 ? 151 GLY B C    6  
ATOM   9337  O O    . GLY B 2 12  ? 0.568   -11.180 0.466   1.00 16.08 ? 151 GLY B O    6  
ATOM   9338  H H    . GLY B 2 12  ? 0.584   -10.583 -2.117  1.00 0.00  ? 151 GLY B H    6  
ATOM   9339  H HA2  . GLY B 2 12  ? -1.101  -12.410 -1.479  1.00 0.00  ? 151 GLY B HA2  6  
ATOM   9340  H HA3  . GLY B 2 12  ? 0.238   -13.529 -1.731  1.00 0.00  ? 151 GLY B HA3  6  
ATOM   9341  N N    . LYS B 2 13  ? 0.690   -13.356 0.741   1.00 14.92 ? 152 LYS B N    6  
ATOM   9342  C CA   . LYS B 2 13  ? 1.145   -13.201 2.151   1.00 16.57 ? 152 LYS B CA   6  
ATOM   9343  C C    . LYS B 2 13  ? 2.673   -13.262 2.204   1.00 15.79 ? 152 LYS B C    6  
ATOM   9344  O O    . LYS B 2 13  ? 3.288   -14.175 1.690   1.00 15.62 ? 152 LYS B O    6  
ATOM   9345  C CB   . LYS B 2 13  ? 0.561   -14.331 3.001   1.00 19.39 ? 152 LYS B CB   6  
ATOM   9346  C CG   . LYS B 2 13  ? 1.183   -14.296 4.398   1.00 26.20 ? 152 LYS B CG   6  
ATOM   9347  C CD   . LYS B 2 13  ? 2.022   -15.557 4.615   1.00 32.70 ? 152 LYS B CD   6  
ATOM   9348  C CE   . LYS B 2 13  ? 3.187   -15.242 5.555   1.00 38.73 ? 152 LYS B CE   6  
ATOM   9349  N NZ   . LYS B 2 13  ? 4.476   -15.454 4.836   1.00 43.61 ? 152 LYS B NZ   6  
ATOM   9350  H H    . LYS B 2 13  ? 0.578   -14.251 0.358   1.00 0.00  ? 152 LYS B H    6  
ATOM   9351  H HA   . LYS B 2 13  ? 0.809   -12.250 2.535   1.00 0.00  ? 152 LYS B HA   6  
ATOM   9352  H HB2  . LYS B 2 13  ? -0.510  -14.204 3.080   1.00 0.00  ? 152 LYS B HB2  6  
ATOM   9353  H HB3  . LYS B 2 13  ? 0.778   -15.281 2.536   1.00 0.00  ? 152 LYS B HB3  6  
ATOM   9354  H HG2  . LYS B 2 13  ? 1.814   -13.424 4.489   1.00 0.00  ? 152 LYS B HG2  6  
ATOM   9355  H HG3  . LYS B 2 13  ? 0.402   -14.255 5.140   1.00 0.00  ? 152 LYS B HG3  6  
ATOM   9356  H HD2  . LYS B 2 13  ? 1.404   -16.329 5.053   1.00 0.00  ? 152 LYS B HD2  6  
ATOM   9357  H HD3  . LYS B 2 13  ? 2.408   -15.900 3.667   1.00 0.00  ? 152 LYS B HD3  6  
ATOM   9358  H HE2  . LYS B 2 13  ? 3.121   -14.213 5.877   1.00 0.00  ? 152 LYS B HE2  6  
ATOM   9359  H HE3  . LYS B 2 13  ? 3.142   -15.893 6.415   1.00 0.00  ? 152 LYS B HE3  6  
ATOM   9360  H HZ1  . LYS B 2 13  ? 4.325   -16.105 4.039   1.00 0.00  ? 152 LYS B HZ1  6  
ATOM   9361  H HZ2  . LYS B 2 13  ? 4.826   -14.545 4.476   1.00 0.00  ? 152 LYS B HZ2  6  
ATOM   9362  H HZ3  . LYS B 2 13  ? 5.173   -15.862 5.491   1.00 0.00  ? 152 LYS B HZ3  6  
ATOM   9363  N N    . ILE B 2 14  ? 3.292   -12.295 2.825   1.00 16.90 ? 153 ILE B N    6  
ATOM   9364  C CA   . ILE B 2 14  ? 4.779   -12.297 2.915   1.00 16.60 ? 153 ILE B CA   6  
ATOM   9365  C C    . ILE B 2 14  ? 5.203   -11.882 4.325   1.00 17.59 ? 153 ILE B C    6  
ATOM   9366  O O    . ILE B 2 14  ? 4.622   -11.000 4.925   1.00 21.20 ? 153 ILE B O    6  
ATOM   9367  C CB   . ILE B 2 14  ? 5.353   -11.310 1.897   1.00 15.36 ? 153 ILE B CB   6  
ATOM   9368  C CG1  . ILE B 2 14  ? 4.529   -10.020 1.916   1.00 14.56 ? 153 ILE B CG1  6  
ATOM   9369  C CG2  . ILE B 2 14  ? 5.300   -11.928 0.499   1.00 15.80 ? 153 ILE B CG2  6  
ATOM   9370  C CD1  . ILE B 2 14  ? 5.091   -9.040  0.884   1.00 13.00 ? 153 ILE B CD1  6  
ATOM   9371  H H    . ILE B 2 14  ? 2.778   -11.567 3.234   1.00 0.00  ? 153 ILE B H    6  
ATOM   9372  H HA   . ILE B 2 14  ? 5.150   -13.288 2.704   1.00 0.00  ? 153 ILE B HA   6  
ATOM   9373  H HB   . ILE B 2 14  ? 6.380   -11.087 2.152   1.00 0.00  ? 153 ILE B HB   6  
ATOM   9374  H HG12 . ILE B 2 14  ? 3.501   -10.248 1.676   1.00 0.00  ? 153 ILE B HG12 6  
ATOM   9375  H HG13 . ILE B 2 14  ? 4.580   -9.575  2.898   1.00 0.00  ? 153 ILE B HG13 6  
ATOM   9376  H HG21 . ILE B 2 14  ? 5.214   -13.001 0.583   1.00 0.00  ? 153 ILE B HG21 6  
ATOM   9377  H HG22 . ILE B 2 14  ? 4.444   -11.539 -0.034  1.00 0.00  ? 153 ILE B HG22 6  
ATOM   9378  H HG23 . ILE B 2 14  ? 6.202   -11.680 -0.040  1.00 0.00  ? 153 ILE B HG23 6  
ATOM   9379  H HD11 . ILE B 2 14  ? 6.017   -9.428  0.486   1.00 0.00  ? 153 ILE B HD11 6  
ATOM   9380  H HD12 . ILE B 2 14  ? 4.379   -8.916  0.082   1.00 0.00  ? 153 ILE B HD12 6  
ATOM   9381  H HD13 . ILE B 2 14  ? 5.272   -8.086  1.356   1.00 0.00  ? 153 ILE B HD13 6  
ATOM   9382  N N    . THR B 2 15  ? 6.212   -12.513 4.861   1.00 16.79 ? 154 THR B N    6  
ATOM   9383  C CA   . THR B 2 15  ? 6.671   -12.156 6.233   1.00 16.02 ? 154 THR B CA   6  
ATOM   9384  C C    . THR B 2 15  ? 6.881   -10.643 6.324   1.00 15.06 ? 154 THR B C    6  
ATOM   9385  O O    . THR B 2 15  ? 7.045   -9.968  5.326   1.00 14.17 ? 154 THR B O    6  
ATOM   9386  C CB   . THR B 2 15  ? 7.988   -12.874 6.534   1.00 18.43 ? 154 THR B CB   6  
ATOM   9387  O OG1  . THR B 2 15  ? 9.028   -12.299 5.753   1.00 22.52 ? 154 THR B OG1  6  
ATOM   9388  C CG2  . THR B 2 15  ? 7.853   -14.359 6.193   1.00 19.67 ? 154 THR B CG2  6  
ATOM   9389  H H    . THR B 2 15  ? 6.667   -13.223 4.361   1.00 0.00  ? 154 THR B H    6  
ATOM   9390  H HA   . THR B 2 15  ? 5.924   -12.458 6.953   1.00 0.00  ? 154 THR B HA   6  
ATOM   9391  H HB   . THR B 2 15  ? 8.224   -12.770 7.582   1.00 0.00  ? 154 THR B HB   6  
ATOM   9392  H HG1  . THR B 2 15  ? 8.740   -12.290 4.837   1.00 0.00  ? 154 THR B HG1  6  
ATOM   9393  H HG21 . THR B 2 15  ? 6.902   -14.533 5.712   1.00 0.00  ? 154 THR B HG21 6  
ATOM   9394  H HG22 . THR B 2 15  ? 8.652   -14.650 5.527   1.00 0.00  ? 154 THR B HG22 6  
ATOM   9395  H HG23 . THR B 2 15  ? 7.909   -14.943 7.100   1.00 0.00  ? 154 THR B HG23 6  
ATOM   9396  N N    . ARG B 2 16  ? 6.880   -10.105 7.512   1.00 15.92 ? 155 ARG B N    6  
ATOM   9397  C CA   . ARG B 2 16  ? 7.081   -8.636  7.666   1.00 14.63 ? 155 ARG B CA   6  
ATOM   9398  C C    . ARG B 2 16  ? 8.535   -8.286  7.343   1.00 15.69 ? 155 ARG B C    6  
ATOM   9399  O O    . ARG B 2 16  ? 8.813   -7.325  6.653   1.00 13.45 ? 155 ARG B O    6  
ATOM   9400  C CB   . ARG B 2 16  ? 6.764   -8.224  9.104   1.00 13.07 ? 155 ARG B CB   6  
ATOM   9401  C CG   . ARG B 2 16  ? 7.147   -6.757  9.311   1.00 14.81 ? 155 ARG B CG   6  
ATOM   9402  C CD   . ARG B 2 16  ? 6.995   -6.393  10.789  1.00 13.27 ? 155 ARG B CD   6  
ATOM   9403  N NE   . ARG B 2 16  ? 7.786   -7.345  11.619  1.00 16.05 ? 155 ARG B NE   6  
ATOM   9404  C CZ   . ARG B 2 16  ? 8.936   -6.978  12.115  1.00 8.86  ? 155 ARG B CZ   6  
ATOM   9405  N NH1  . ARG B 2 16  ? 8.977   -6.237  13.188  1.00 8.73  ? 155 ARG B NH1  6  
ATOM   9406  N NH2  . ARG B 2 16  ? 10.044  -7.353  11.538  1.00 12.78 ? 155 ARG B NH2  6  
ATOM   9407  H H    . ARG B 2 16  ? 6.747   -10.666 8.305   1.00 0.00  ? 155 ARG B H    6  
ATOM   9408  H HA   . ARG B 2 16  ? 6.425   -8.111  6.987   1.00 0.00  ? 155 ARG B HA   6  
ATOM   9409  H HB2  . ARG B 2 16  ? 5.707   -8.351  9.291   1.00 0.00  ? 155 ARG B HB2  6  
ATOM   9410  H HB3  . ARG B 2 16  ? 7.327   -8.841  9.789   1.00 0.00  ? 155 ARG B HB3  6  
ATOM   9411  H HG2  . ARG B 2 16  ? 8.172   -6.607  9.006   1.00 0.00  ? 155 ARG B HG2  6  
ATOM   9412  H HG3  . ARG B 2 16  ? 6.498   -6.129  8.719   1.00 0.00  ? 155 ARG B HG3  6  
ATOM   9413  H HD2  . ARG B 2 16  ? 7.356   -5.388  10.951  1.00 0.00  ? 155 ARG B HD2  6  
ATOM   9414  H HD3  . ARG B 2 16  ? 5.953   -6.451  11.069  1.00 0.00  ? 155 ARG B HD3  6  
ATOM   9415  H HE   . ARG B 2 16  ? 7.442   -8.246  11.792  1.00 0.00  ? 155 ARG B HE   6  
ATOM   9416  H HH11 . ARG B 2 16  ? 8.127   -5.950  13.630  1.00 0.00  ? 155 ARG B HH11 6  
ATOM   9417  H HH12 . ARG B 2 16  ? 9.858   -5.957  13.569  1.00 0.00  ? 155 ARG B HH12 6  
ATOM   9418  H HH21 . ARG B 2 16  ? 10.013  -7.920  10.715  1.00 0.00  ? 155 ARG B HH21 6  
ATOM   9419  H HH22 . ARG B 2 16  ? 10.925  -7.072  11.918  1.00 0.00  ? 155 ARG B HH22 6  
ATOM   9420  N N    . ARG B 2 17  ? 9.465   -9.057  7.835   1.00 16.92 ? 156 ARG B N    6  
ATOM   9421  C CA   . ARG B 2 17  ? 10.898  -8.767  7.555   1.00 18.61 ? 156 ARG B CA   6  
ATOM   9422  C C    . ARG B 2 17  ? 11.100  -8.608  6.047   1.00 17.01 ? 156 ARG B C    6  
ATOM   9423  O O    . ARG B 2 17  ? 11.763  -7.698  5.591   1.00 17.04 ? 156 ARG B O    6  
ATOM   9424  C CB   . ARG B 2 17  ? 11.763  -9.922  8.066   1.00 24.11 ? 156 ARG B CB   6  
ATOM   9425  C CG   . ARG B 2 17  ? 13.211  -9.451  8.214   1.00 33.87 ? 156 ARG B CG   6  
ATOM   9426  C CD   . ARG B 2 17  ? 14.159  -10.612 7.909   1.00 41.26 ? 156 ARG B CD   6  
ATOM   9427  N NE   . ARG B 2 17  ? 15.534  -10.084 7.684   1.00 49.98 ? 156 ARG B NE   6  
ATOM   9428  C CZ   . ARG B 2 17  ? 16.160  -9.462  8.644   1.00 51.87 ? 156 ARG B CZ   6  
ATOM   9429  N NH1  . ARG B 2 17  ? 15.991  -9.837  9.883   1.00 53.57 ? 156 ARG B NH1  6  
ATOM   9430  N NH2  . ARG B 2 17  ? 16.955  -8.466  8.367   1.00 52.15 ? 156 ARG B NH2  6  
ATOM   9431  H H    . ARG B 2 17  ? 9.220   -9.829  8.389   1.00 0.00  ? 156 ARG B H    6  
ATOM   9432  H HA   . ARG B 2 17  ? 11.186  -7.854  8.055   1.00 0.00  ? 156 ARG B HA   6  
ATOM   9433  H HB2  . ARG B 2 17  ? 11.390  -10.252 9.025   1.00 0.00  ? 156 ARG B HB2  6  
ATOM   9434  H HB3  . ARG B 2 17  ? 11.723  -10.740 7.363   1.00 0.00  ? 156 ARG B HB3  6  
ATOM   9435  H HG2  . ARG B 2 17  ? 13.398  -8.641  7.524   1.00 0.00  ? 156 ARG B HG2  6  
ATOM   9436  H HG3  . ARG B 2 17  ? 13.377  -9.109  9.225   1.00 0.00  ? 156 ARG B HG3  6  
ATOM   9437  H HD2  . ARG B 2 17  ? 14.168  -11.298 8.742   1.00 0.00  ? 156 ARG B HD2  6  
ATOM   9438  H HD3  . ARG B 2 17  ? 13.822  -11.128 7.021   1.00 0.00  ? 156 ARG B HD3  6  
ATOM   9439  H HE   . ARG B 2 17  ? 15.968  -10.204 6.813   1.00 0.00  ? 156 ARG B HE   6  
ATOM   9440  H HH11 . ARG B 2 17  ? 15.382  -10.601 10.095  1.00 0.00  ? 156 ARG B HH11 6  
ATOM   9441  H HH12 . ARG B 2 17  ? 16.469  -9.360  10.620  1.00 0.00  ? 156 ARG B HH12 6  
ATOM   9442  H HH21 . ARG B 2 17  ? 17.085  -8.177  7.419   1.00 0.00  ? 156 ARG B HH21 6  
ATOM   9443  H HH22 . ARG B 2 17  ? 17.434  -7.988  9.104   1.00 0.00  ? 156 ARG B HH22 6  
ATOM   9444  N N    . GLU B 2 18  ? 10.531  -9.487  5.268   1.00 15.73 ? 157 GLU B N    6  
ATOM   9445  C CA   . GLU B 2 18  ? 10.687  -9.385  3.790   1.00 15.26 ? 157 GLU B CA   6  
ATOM   9446  C C    . GLU B 2 18  ? 9.915   -8.167  3.278   1.00 14.10 ? 157 GLU B C    6  
ATOM   9447  O O    . GLU B 2 18  ? 10.291  -7.546  2.305   1.00 15.48 ? 157 GLU B O    6  
ATOM   9448  C CB   . GLU B 2 18  ? 10.137  -10.652 3.131   1.00 19.30 ? 157 GLU B CB   6  
ATOM   9449  C CG   . GLU B 2 18  ? 10.519  -10.667 1.650   1.00 28.11 ? 157 GLU B CG   6  
ATOM   9450  C CD   . GLU B 2 18  ? 10.709  -12.112 1.185   1.00 29.65 ? 157 GLU B CD   6  
ATOM   9451  O OE1  . GLU B 2 18  ? 9.959   -12.962 1.638   1.00 28.63 ? 157 GLU B OE1  6  
ATOM   9452  O OE2  . GLU B 2 18  ? 11.601  -12.345 0.386   1.00 31.13 ? 157 GLU B OE2  6  
ATOM   9453  H H    . GLU B 2 18  ? 9.998   -10.213 5.655   1.00 0.00  ? 157 GLU B H    6  
ATOM   9454  H HA   . GLU B 2 18  ? 11.733  -9.277  3.545   1.00 0.00  ? 157 GLU B HA   6  
ATOM   9455  H HB2  . GLU B 2 18  ? 10.553  -11.521 3.619   1.00 0.00  ? 157 GLU B HB2  6  
ATOM   9456  H HB3  . GLU B 2 18  ? 9.061   -10.669 3.223   1.00 0.00  ? 157 GLU B HB3  6  
ATOM   9457  H HG2  . GLU B 2 18  ? 9.733   -10.203 1.071   1.00 0.00  ? 157 GLU B HG2  6  
ATOM   9458  H HG3  . GLU B 2 18  ? 11.441  -10.122 1.509   1.00 0.00  ? 157 GLU B HG3  6  
ATOM   9459  N N    . SER B 2 19  ? 8.836   -7.823  3.927   1.00 11.43 ? 158 SER B N    6  
ATOM   9460  C CA   . SER B 2 19  ? 8.039   -6.647  3.479   1.00 9.58  ? 158 SER B CA   6  
ATOM   9461  C C    . SER B 2 19  ? 8.944   -5.415  3.405   1.00 10.15 ? 158 SER B C    6  
ATOM   9462  O O    . SER B 2 19  ? 9.087   -4.799  2.367   1.00 12.31 ? 158 SER B O    6  
ATOM   9463  C CB   . SER B 2 19  ? 6.908   -6.389  4.474   1.00 8.90  ? 158 SER B CB   6  
ATOM   9464  O OG   . SER B 2 19  ? 6.286   -7.623  4.808   1.00 11.55 ? 158 SER B OG   6  
ATOM   9465  H H    . SER B 2 19  ? 8.550   -8.338  4.710   1.00 0.00  ? 158 SER B H    6  
ATOM   9466  H HA   . SER B 2 19  ? 7.622   -6.845  2.502   1.00 0.00  ? 158 SER B HA   6  
ATOM   9467  H HB2  . SER B 2 19  ? 7.306   -5.939  5.368   1.00 0.00  ? 158 SER B HB2  6  
ATOM   9468  H HB3  . SER B 2 19  ? 6.184   -5.719  4.029   1.00 0.00  ? 158 SER B HB3  6  
ATOM   9469  H HG   . SER B 2 19  ? 5.555   -7.437  5.401   1.00 0.00  ? 158 SER B HG   6  
ATOM   9470  N N    . GLU B 2 20  ? 9.556   -5.049  4.498   1.00 11.35 ? 159 GLU B N    6  
ATOM   9471  C CA   . GLU B 2 20  ? 10.449  -3.858  4.490   1.00 12.85 ? 159 GLU B CA   6  
ATOM   9472  C C    . GLU B 2 20  ? 11.656  -4.132  3.591   1.00 15.16 ? 159 GLU B C    6  
ATOM   9473  O O    . GLU B 2 20  ? 12.154  -3.251  2.919   1.00 13.16 ? 159 GLU B O    6  
ATOM   9474  C CB   . GLU B 2 20  ? 10.928  -3.573  5.915   1.00 13.71 ? 159 GLU B CB   6  
ATOM   9475  C CG   . GLU B 2 20  ? 9.948   -2.622  6.603   1.00 16.00 ? 159 GLU B CG   6  
ATOM   9476  C CD   . GLU B 2 20  ? 10.638  -1.949  7.791   1.00 19.40 ? 159 GLU B CD   6  
ATOM   9477  O OE1  . GLU B 2 20  ? 11.799  -1.602  7.657   1.00 21.73 ? 159 GLU B OE1  6  
ATOM   9478  O OE2  . GLU B 2 20  ? 9.994   -1.794  8.816   1.00 26.69 ? 159 GLU B OE2  6  
ATOM   9479  H H    . GLU B 2 20  ? 9.428   -5.558  5.326   1.00 0.00  ? 159 GLU B H    6  
ATOM   9480  H HA   . GLU B 2 20  ? 9.906   -3.002  4.115   1.00 0.00  ? 159 GLU B HA   6  
ATOM   9481  H HB2  . GLU B 2 20  ? 10.981  -4.499  6.468   1.00 0.00  ? 159 GLU B HB2  6  
ATOM   9482  H HB3  . GLU B 2 20  ? 11.905  -3.118  5.881   1.00 0.00  ? 159 GLU B HB3  6  
ATOM   9483  H HG2  . GLU B 2 20  ? 9.623   -1.868  5.900   1.00 0.00  ? 159 GLU B HG2  6  
ATOM   9484  H HG3  . GLU B 2 20  ? 9.092   -3.178  6.955   1.00 0.00  ? 159 GLU B HG3  6  
ATOM   9485  N N    . ARG B 2 21  ? 12.131  -5.347  3.574   1.00 15.73 ? 160 ARG B N    6  
ATOM   9486  C CA   . ARG B 2 21  ? 13.305  -5.678  2.719   1.00 17.77 ? 160 ARG B CA   6  
ATOM   9487  C C    . ARG B 2 21  ? 12.963  -5.413  1.252   1.00 17.96 ? 160 ARG B C    6  
ATOM   9488  O O    . ARG B 2 21  ? 13.833  -5.236  0.424   1.00 17.67 ? 160 ARG B O    6  
ATOM   9489  C CB   . ARG B 2 21  ? 13.663  -7.152  2.898   1.00 21.81 ? 160 ARG B CB   6  
ATOM   9490  C CG   . ARG B 2 21  ? 15.123  -7.378  2.505   1.00 30.59 ? 160 ARG B CG   6  
ATOM   9491  C CD   . ARG B 2 21  ? 15.191  -7.841  1.050   1.00 37.74 ? 160 ARG B CD   6  
ATOM   9492  N NE   . ARG B 2 21  ? 15.489  -9.301  1.007   1.00 43.93 ? 160 ARG B NE   6  
ATOM   9493  C CZ   . ARG B 2 21  ? 16.077  -9.816  -0.038  1.00 48.64 ? 160 ARG B CZ   6  
ATOM   9494  N NH1  . ARG B 2 21  ? 15.534  -9.694  -1.218  1.00 50.79 ? 160 ARG B NH1  6  
ATOM   9495  N NH2  . ARG B 2 21  ? 17.207  -10.453 0.099   1.00 51.68 ? 160 ARG B NH2  6  
ATOM   9496  H H    . ARG B 2 21  ? 11.715  -6.042  4.125   1.00 0.00  ? 160 ARG B H    6  
ATOM   9497  H HA   . ARG B 2 21  ? 14.145  -5.070  3.007   1.00 0.00  ? 160 ARG B HA   6  
ATOM   9498  H HB2  . ARG B 2 21  ? 13.517  -7.436  3.928   1.00 0.00  ? 160 ARG B HB2  6  
ATOM   9499  H HB3  . ARG B 2 21  ? 13.027  -7.748  2.266   1.00 0.00  ? 160 ARG B HB3  6  
ATOM   9500  H HG2  . ARG B 2 21  ? 15.674  -6.455  2.616   1.00 0.00  ? 160 ARG B HG2  6  
ATOM   9501  H HG3  . ARG B 2 21  ? 15.555  -8.135  3.142   1.00 0.00  ? 160 ARG B HG3  6  
ATOM   9502  H HD2  . ARG B 2 21  ? 14.242  -7.653  0.570   1.00 0.00  ? 160 ARG B HD2  6  
ATOM   9503  H HD3  . ARG B 2 21  ? 15.969  -7.299  0.535   1.00 0.00  ? 160 ARG B HD3  6  
ATOM   9504  H HE   . ARG B 2 21  ? 15.242  -9.874  1.763   1.00 0.00  ? 160 ARG B HE   6  
ATOM   9505  H HH11 . ARG B 2 21  ? 14.667  -9.206  -1.322  1.00 0.00  ? 160 ARG B HH11 6  
ATOM   9506  H HH12 . ARG B 2 21  ? 15.985  -10.089 -2.019  1.00 0.00  ? 160 ARG B HH12 6  
ATOM   9507  H HH21 . ARG B 2 21  ? 17.623  -10.546 1.003   1.00 0.00  ? 160 ARG B HH21 6  
ATOM   9508  H HH22 . ARG B 2 21  ? 17.658  -10.847 -0.702  1.00 0.00  ? 160 ARG B HH22 6  
ATOM   9509  N N    . LEU B 2 22  ? 11.700  -5.390  0.924   1.00 16.19 ? 161 LEU B N    6  
ATOM   9510  C CA   . LEU B 2 22  ? 11.302  -5.144  -0.491  1.00 12.63 ? 161 LEU B CA   6  
ATOM   9511  C C    . LEU B 2 22  ? 11.118  -3.641  -0.725  1.00 13.41 ? 161 LEU B C    6  
ATOM   9512  O O    . LEU B 2 22  ? 11.545  -3.105  -1.728  1.00 14.12 ? 161 LEU B O    6  
ATOM   9513  C CB   . LEU B 2 22  ? 9.986   -5.869  -0.781  1.00 10.23 ? 161 LEU B CB   6  
ATOM   9514  C CG   . LEU B 2 22  ? 10.276  -7.327  -1.136  1.00 11.74 ? 161 LEU B CG   6  
ATOM   9515  C CD1  . LEU B 2 22  ? 8.966   -8.042  -1.470  1.00 10.85 ? 161 LEU B CD1  6  
ATOM   9516  C CD2  . LEU B 2 22  ? 11.207  -7.379  -2.350  1.00 15.84 ? 161 LEU B CD2  6  
ATOM   9517  H H    . LEU B 2 22  ? 11.013  -5.540  1.607   1.00 0.00  ? 161 LEU B H    6  
ATOM   9518  H HA   . LEU B 2 22  ? 12.070  -5.519  -1.151  1.00 0.00  ? 161 LEU B HA   6  
ATOM   9519  H HB2  . LEU B 2 22  ? 9.354   -5.829  0.094   1.00 0.00  ? 161 LEU B HB2  6  
ATOM   9520  H HB3  . LEU B 2 22  ? 9.487   -5.391  -1.609  1.00 0.00  ? 161 LEU B HB3  6  
ATOM   9521  H HG   . LEU B 2 22  ? 10.749  -7.816  -0.296  1.00 0.00  ? 161 LEU B HG   6  
ATOM   9522  H HD11 . LEU B 2 22  ? 8.133   -7.428  -1.164  1.00 0.00  ? 161 LEU B HD11 6  
ATOM   9523  H HD12 . LEU B 2 22  ? 8.912   -8.218  -2.534  1.00 0.00  ? 161 LEU B HD12 6  
ATOM   9524  H HD13 . LEU B 2 22  ? 8.928   -8.987  -0.947  1.00 0.00  ? 161 LEU B HD13 6  
ATOM   9525  H HD21 . LEU B 2 22  ? 11.188  -6.426  -2.858  1.00 0.00  ? 161 LEU B HD21 6  
ATOM   9526  H HD22 . LEU B 2 22  ? 12.214  -7.593  -2.022  1.00 0.00  ? 161 LEU B HD22 6  
ATOM   9527  H HD23 . LEU B 2 22  ? 10.875  -8.154  -3.025  1.00 0.00  ? 161 LEU B HD23 6  
ATOM   9528  N N    . LEU B 2 23  ? 10.482  -2.960  0.188   1.00 12.10 ? 162 LEU B N    6  
ATOM   9529  C CA   . LEU B 2 23  ? 10.269  -1.496  0.010   1.00 13.70 ? 162 LEU B CA   6  
ATOM   9530  C C    . LEU B 2 23  ? 11.496  -0.725  0.504   1.00 15.43 ? 162 LEU B C    6  
ATOM   9531  O O    . LEU B 2 23  ? 11.531  0.489   0.468   1.00 15.50 ? 162 LEU B O    6  
ATOM   9532  C CB   . LEU B 2 23  ? 9.041   -1.059  0.812   1.00 13.91 ? 162 LEU B CB   6  
ATOM   9533  C CG   . LEU B 2 23  ? 7.790   -1.722  0.234   1.00 12.97 ? 162 LEU B CG   6  
ATOM   9534  C CD1  . LEU B 2 23  ? 6.737   -1.870  1.334   1.00 9.03  ? 162 LEU B CD1  6  
ATOM   9535  C CD2  . LEU B 2 23  ? 7.228   -0.852  -0.893  1.00 11.59 ? 162 LEU B CD2  6  
ATOM   9536  H H    . LEU B 2 23  ? 10.140  -3.412  0.989   1.00 0.00  ? 162 LEU B H    6  
ATOM   9537  H HA   . LEU B 2 23  ? 10.108  -1.281  -1.036  1.00 0.00  ? 162 LEU B HA   6  
ATOM   9538  H HB2  . LEU B 2 23  ? 9.162   -1.355  1.845   1.00 0.00  ? 162 LEU B HB2  6  
ATOM   9539  H HB3  . LEU B 2 23  ? 8.937   0.014   0.755   1.00 0.00  ? 162 LEU B HB3  6  
ATOM   9540  H HG   . LEU B 2 23  ? 8.046   -2.697  -0.153  1.00 0.00  ? 162 LEU B HG   6  
ATOM   9541  H HD11 . LEU B 2 23  ? 6.903   -1.122  2.095   1.00 0.00  ? 162 LEU B HD11 6  
ATOM   9542  H HD12 . LEU B 2 23  ? 5.752   -1.741  0.910   1.00 0.00  ? 162 LEU B HD12 6  
ATOM   9543  H HD13 . LEU B 2 23  ? 6.813   -2.854  1.774   1.00 0.00  ? 162 LEU B HD13 6  
ATOM   9544  H HD21 . LEU B 2 23  ? 7.882   -0.009  -1.058  1.00 0.00  ? 162 LEU B HD21 6  
ATOM   9545  H HD22 . LEU B 2 23  ? 7.160   -1.438  -1.798  1.00 0.00  ? 162 LEU B HD22 6  
ATOM   9546  H HD23 . LEU B 2 23  ? 6.245   -0.498  -0.619  1.00 0.00  ? 162 LEU B HD23 6  
ATOM   9547  N N    . LEU B 2 24  ? 12.504  -1.414  0.969   1.00 17.97 ? 163 LEU B N    6  
ATOM   9548  C CA   . LEU B 2 24  ? 13.719  -0.712  1.462   1.00 23.68 ? 163 LEU B CA   6  
ATOM   9549  C C    . LEU B 2 24  ? 14.867  -0.902  0.467   1.00 29.76 ? 163 LEU B C    6  
ATOM   9550  O O    . LEU B 2 24  ? 15.923  -0.319  0.609   1.00 34.43 ? 163 LEU B O    6  
ATOM   9551  C CB   . LEU B 2 24  ? 14.119  -1.295  2.818   1.00 20.30 ? 163 LEU B CB   6  
ATOM   9552  C CG   . LEU B 2 24  ? 13.145  -0.813  3.895   1.00 19.42 ? 163 LEU B CG   6  
ATOM   9553  C CD1  . LEU B 2 24  ? 13.637  -1.268  5.269   1.00 19.86 ? 163 LEU B CD1  6  
ATOM   9554  C CD2  . LEU B 2 24  ? 13.063  0.716   3.865   1.00 19.28 ? 163 LEU B CD2  6  
ATOM   9555  H H    . LEU B 2 24  ? 12.462  -2.391  0.994   1.00 0.00  ? 163 LEU B H    6  
ATOM   9556  H HA   . LEU B 2 24  ? 13.507  0.341   1.572   1.00 0.00  ? 163 LEU B HA   6  
ATOM   9557  H HB2  . LEU B 2 24  ? 14.093  -2.374  2.767   1.00 0.00  ? 163 LEU B HB2  6  
ATOM   9558  H HB3  . LEU B 2 24  ? 15.116  -0.972  3.066   1.00 0.00  ? 163 LEU B HB3  6  
ATOM   9559  H HG   . LEU B 2 24  ? 12.166  -1.232  3.707   1.00 0.00  ? 163 LEU B HG   6  
ATOM   9560  H HD11 . LEU B 2 24  ? 14.659  -0.947  5.409   1.00 0.00  ? 163 LEU B HD11 6  
ATOM   9561  H HD12 . LEU B 2 24  ? 13.015  -0.834  6.037   1.00 0.00  ? 163 LEU B HD12 6  
ATOM   9562  H HD13 . LEU B 2 24  ? 13.587  -2.346  5.331   1.00 0.00  ? 163 LEU B HD13 6  
ATOM   9563  H HD21 . LEU B 2 24  ? 14.027  1.123   3.596   1.00 0.00  ? 163 LEU B HD21 6  
ATOM   9564  H HD22 . LEU B 2 24  ? 12.327  1.023   3.137   1.00 0.00  ? 163 LEU B HD22 6  
ATOM   9565  H HD23 . LEU B 2 24  ? 12.778  1.080   4.840   1.00 0.00  ? 163 LEU B HD23 6  
ATOM   9566  N N    . ASN B 2 25  ? 14.672  -1.713  -0.539  1.00 33.44 ? 164 ASN B N    6  
ATOM   9567  C CA   . ASN B 2 25  ? 15.754  -1.935  -1.538  1.00 37.75 ? 164 ASN B CA   6  
ATOM   9568  C C    . ASN B 2 25  ? 16.359  -0.590  -1.941  1.00 40.49 ? 164 ASN B C    6  
ATOM   9569  O O    . ASN B 2 25  ? 15.717  0.232   -2.562  1.00 41.14 ? 164 ASN B O    6  
ATOM   9570  C CB   . ASN B 2 25  ? 15.173  -2.623  -2.775  1.00 39.08 ? 164 ASN B CB   6  
ATOM   9571  C CG   . ASN B 2 25  ? 15.869  -3.969  -2.984  1.00 42.87 ? 164 ASN B CG   6  
ATOM   9572  O OD1  . ASN B 2 25  ? 17.016  -4.135  -2.619  1.00 47.61 ? 164 ASN B OD1  6  
ATOM   9573  N ND2  . ASN B 2 25  ? 15.222  -4.944  -3.561  1.00 46.52 ? 164 ASN B ND2  6  
ATOM   9574  H H    . ASN B 2 25  ? 13.816  -2.175  -0.638  1.00 0.00  ? 164 ASN B H    6  
ATOM   9575  H HA   . ASN B 2 25  ? 16.520  -2.560  -1.106  1.00 0.00  ? 164 ASN B HA   6  
ATOM   9576  H HB2  . ASN B 2 25  ? 14.113  -2.784  -2.633  1.00 0.00  ? 164 ASN B HB2  6  
ATOM   9577  H HB3  . ASN B 2 25  ? 15.330  -2.000  -3.642  1.00 0.00  ? 164 ASN B HB3  6  
ATOM   9578  H HD21 . ASN B 2 25  ? 14.292  -4.808  -3.855  1.00 0.00  ? 164 ASN B HD21 6  
ATOM   9579  H HD22 . ASN B 2 25  ? 15.663  -5.812  -3.698  1.00 0.00  ? 164 ASN B HD22 6  
ATOM   9580  N N    . ALA B 2 26  ? 17.591  -0.360  -1.589  1.00 41.13 ? 165 ALA B N    6  
ATOM   9581  C CA   . ALA B 2 26  ? 18.243  0.931   -1.946  1.00 40.91 ? 165 ALA B CA   6  
ATOM   9582  C C    . ALA B 2 26  ? 18.048  1.215   -3.439  1.00 39.78 ? 165 ALA B C    6  
ATOM   9583  O O    . ALA B 2 26  ? 18.123  2.344   -3.880  1.00 42.37 ? 165 ALA B O    6  
ATOM   9584  C CB   . ALA B 2 26  ? 19.739  0.848   -1.637  1.00 43.50 ? 165 ALA B CB   6  
ATOM   9585  H H    . ALA B 2 26  ? 18.088  -1.038  -1.086  1.00 0.00  ? 165 ALA B H    6  
ATOM   9586  H HA   . ALA B 2 26  ? 17.801  1.729   -1.368  1.00 0.00  ? 165 ALA B HA   6  
ATOM   9587  H HB1  . ALA B 2 26  ? 19.934  -0.028  -1.036  1.00 0.00  ? 165 ALA B HB1  6  
ATOM   9588  H HB2  . ALA B 2 26  ? 20.295  0.781   -2.561  1.00 0.00  ? 165 ALA B HB2  6  
ATOM   9589  H HB3  . ALA B 2 26  ? 20.044  1.731   -1.096  1.00 0.00  ? 165 ALA B HB3  6  
ATOM   9590  N N    . GLU B 2 27  ? 17.804  0.199   -4.223  1.00 36.31 ? 166 GLU B N    6  
ATOM   9591  C CA   . GLU B 2 27  ? 17.611  0.415   -5.685  1.00 32.86 ? 166 GLU B CA   6  
ATOM   9592  C C    . GLU B 2 27  ? 16.130  0.659   -5.984  1.00 28.56 ? 166 GLU B C    6  
ATOM   9593  O O    . GLU B 2 27  ? 15.635  0.305   -7.035  1.00 27.16 ? 166 GLU B O    6  
ATOM   9594  C CB   . GLU B 2 27  ? 18.082  -0.825  -6.445  1.00 35.96 ? 166 GLU B CB   6  
ATOM   9595  C CG   . GLU B 2 27  ? 19.611  -0.877  -6.444  1.00 44.79 ? 166 GLU B CG   6  
ATOM   9596  C CD   . GLU B 2 27  ? 20.081  -2.071  -7.278  1.00 50.54 ? 166 GLU B CD   6  
ATOM   9597  O OE1  . GLU B 2 27  ? 19.237  -2.736  -7.853  1.00 52.17 ? 166 GLU B OE1  6  
ATOM   9598  O OE2  . GLU B 2 27  ? 21.279  -2.298  -7.327  1.00 54.06 ? 166 GLU B OE2  6  
ATOM   9599  H H    . GLU B 2 27  ? 17.753  -0.706  -3.852  1.00 0.00  ? 166 GLU B H    6  
ATOM   9600  H HA   . GLU B 2 27  ? 18.189  1.271   -6.001  1.00 0.00  ? 166 GLU B HA   6  
ATOM   9601  H HB2  . GLU B 2 27  ? 17.690  -1.710  -5.964  1.00 0.00  ? 166 GLU B HB2  6  
ATOM   9602  H HB3  . GLU B 2 27  ? 17.726  -0.780  -7.462  1.00 0.00  ? 166 GLU B HB3  6  
ATOM   9603  H HG2  . GLU B 2 27  ? 20.002  0.036   -6.868  1.00 0.00  ? 166 GLU B HG2  6  
ATOM   9604  H HG3  . GLU B 2 27  ? 19.967  -0.986  -5.431  1.00 0.00  ? 166 GLU B HG3  6  
ATOM   9605  N N    . ASN B 2 28  ? 15.418  1.260   -5.072  1.00 24.51 ? 167 ASN B N    6  
ATOM   9606  C CA   . ASN B 2 28  ? 13.970  1.524   -5.316  1.00 21.82 ? 167 ASN B CA   6  
ATOM   9607  C C    . ASN B 2 28  ? 13.733  3.038   -5.399  1.00 19.62 ? 167 ASN B C    6  
ATOM   9608  O O    . ASN B 2 28  ? 14.306  3.790   -4.636  1.00 20.78 ? 167 ASN B O    6  
ATOM   9609  C CB   . ASN B 2 28  ? 13.144  0.943   -4.166  1.00 20.91 ? 167 ASN B CB   6  
ATOM   9610  C CG   . ASN B 2 28  ? 12.384  -0.292  -4.654  1.00 21.84 ? 167 ASN B CG   6  
ATOM   9611  O OD1  . ASN B 2 28  ? 12.405  -0.609  -5.827  1.00 20.75 ? 167 ASN B OD1  6  
ATOM   9612  N ND2  . ASN B 2 28  ? 11.709  -1.007  -3.798  1.00 24.01 ? 167 ASN B ND2  6  
ATOM   9613  H H    . ASN B 2 28  ? 15.833  1.540   -4.231  1.00 0.00  ? 167 ASN B H    6  
ATOM   9614  H HA   . ASN B 2 28  ? 13.676  1.056   -6.243  1.00 0.00  ? 167 ASN B HA   6  
ATOM   9615  H HB2  . ASN B 2 28  ? 13.800  0.664   -3.356  1.00 0.00  ? 167 ASN B HB2  6  
ATOM   9616  H HB3  . ASN B 2 28  ? 12.439  1.683   -3.821  1.00 0.00  ? 167 ASN B HB3  6  
ATOM   9617  H HD21 . ASN B 2 28  ? 11.692  -0.750  -2.848  1.00 0.00  ? 167 ASN B HD21 6  
ATOM   9618  H HD22 . ASN B 2 28  ? 11.216  -1.804  -4.102  1.00 0.00  ? 167 ASN B HD22 6  
ATOM   9619  N N    . PRO B 2 29  ? 12.893  3.445   -6.323  1.00 18.42 ? 168 PRO B N    6  
ATOM   9620  C CA   . PRO B 2 29  ? 12.566  4.867   -6.521  1.00 16.88 ? 168 PRO B CA   6  
ATOM   9621  C C    . PRO B 2 29  ? 11.550  5.332   -5.473  1.00 16.36 ? 168 PRO B C    6  
ATOM   9622  O O    . PRO B 2 29  ? 10.668  4.595   -5.080  1.00 15.23 ? 168 PRO B O    6  
ATOM   9623  C CB   . PRO B 2 29  ? 11.953  4.905   -7.923  1.00 18.00 ? 168 PRO B CB   6  
ATOM   9624  C CG   . PRO B 2 29  ? 11.443  3.474   -8.214  1.00 17.15 ? 168 PRO B CG   6  
ATOM   9625  C CD   . PRO B 2 29  ? 12.195  2.533   -7.255  1.00 16.33 ? 168 PRO B CD   6  
ATOM   9626  H HA   . PRO B 2 29  ? 13.456  5.475   -6.489  1.00 0.00  ? 168 PRO B HA   6  
ATOM   9627  H HB2  . PRO B 2 29  ? 11.132  5.608   -7.950  1.00 0.00  ? 168 PRO B HB2  6  
ATOM   9628  H HB3  . PRO B 2 29  ? 12.702  5.178   -8.650  1.00 0.00  ? 168 PRO B HB3  6  
ATOM   9629  H HG2  . PRO B 2 29  ? 10.378  3.417   -8.034  1.00 0.00  ? 168 PRO B HG2  6  
ATOM   9630  H HG3  . PRO B 2 29  ? 11.662  3.202   -9.235  1.00 0.00  ? 168 PRO B HG3  6  
ATOM   9631  H HD2  . PRO B 2 29  ? 11.497  1.902   -6.721  1.00 0.00  ? 168 PRO B HD2  6  
ATOM   9632  H HD3  . PRO B 2 29  ? 12.912  1.934   -7.795  1.00 0.00  ? 168 PRO B HD3  6  
ATOM   9633  N N    . ARG B 2 30  ? 11.664  6.550   -5.019  1.00 16.48 ? 169 ARG B N    6  
ATOM   9634  C CA   . ARG B 2 30  ? 10.703  7.059   -3.999  1.00 15.86 ? 169 ARG B CA   6  
ATOM   9635  C C    . ARG B 2 30  ? 9.285   7.010   -4.571  1.00 13.88 ? 169 ARG B C    6  
ATOM   9636  O O    . ARG B 2 30  ? 8.931   7.778   -5.445  1.00 15.48 ? 169 ARG B O    6  
ATOM   9637  C CB   . ARG B 2 30  ? 11.058  8.502   -3.636  1.00 15.75 ? 169 ARG B CB   6  
ATOM   9638  C CG   . ARG B 2 30  ? 10.780  8.738   -2.151  1.00 19.73 ? 169 ARG B CG   6  
ATOM   9639  C CD   . ARG B 2 30  ? 10.581  10.234  -1.899  1.00 22.87 ? 169 ARG B CD   6  
ATOM   9640  N NE   . ARG B 2 30  ? 11.678  11.000  -2.555  1.00 21.47 ? 169 ARG B NE   6  
ATOM   9641  C CZ   . ARG B 2 30  ? 11.646  12.304  -2.570  1.00 20.61 ? 169 ARG B CZ   6  
ATOM   9642  N NH1  . ARG B 2 30  ? 11.780  12.972  -1.457  1.00 22.31 ? 169 ARG B NH1  6  
ATOM   9643  N NH2  . ARG B 2 30  ? 11.478  12.941  -3.696  1.00 23.69 ? 169 ARG B NH2  6  
ATOM   9644  H H    . ARG B 2 30  ? 12.381  7.132   -5.350  1.00 0.00  ? 169 ARG B H    6  
ATOM   9645  H HA   . ARG B 2 30  ? 10.756  6.441   -3.115  1.00 0.00  ? 169 ARG B HA   6  
ATOM   9646  H HB2  . ARG B 2 30  ? 12.105  8.677   -3.840  1.00 0.00  ? 169 ARG B HB2  6  
ATOM   9647  H HB3  . ARG B 2 30  ? 10.459  9.179   -4.226  1.00 0.00  ? 169 ARG B HB3  6  
ATOM   9648  H HG2  . ARG B 2 30  ? 9.887   8.202   -1.863  1.00 0.00  ? 169 ARG B HG2  6  
ATOM   9649  H HG3  . ARG B 2 30  ? 11.616  8.385   -1.568  1.00 0.00  ? 169 ARG B HG3  6  
ATOM   9650  H HD2  . ARG B 2 30  ? 9.631   10.545  -2.308  1.00 0.00  ? 169 ARG B HD2  6  
ATOM   9651  H HD3  . ARG B 2 30  ? 10.595  10.425  -0.836  1.00 0.00  ? 169 ARG B HD3  6  
ATOM   9652  H HE   . ARG B 2 30  ? 12.424  10.523  -2.977  1.00 0.00  ? 169 ARG B HE   6  
ATOM   9653  H HH11 . ARG B 2 30  ? 11.909  12.484  -0.593  1.00 0.00  ? 169 ARG B HH11 6  
ATOM   9654  H HH12 . ARG B 2 30  ? 11.756  13.972  -1.467  1.00 0.00  ? 169 ARG B HH12 6  
ATOM   9655  H HH21 . ARG B 2 30  ? 11.375  12.429  -4.549  1.00 0.00  ? 169 ARG B HH21 6  
ATOM   9656  H HH22 . ARG B 2 30  ? 11.454  13.940  -3.707  1.00 0.00  ? 169 ARG B HH22 6  
ATOM   9657  N N    . GLY B 2 31  ? 8.469   6.114   -4.088  1.00 11.61 ? 170 GLY B N    6  
ATOM   9658  C CA   . GLY B 2 31  ? 7.075   6.019   -4.607  1.00 10.78 ? 170 GLY B CA   6  
ATOM   9659  C C    . GLY B 2 31  ? 6.708   4.552   -4.848  1.00 11.90 ? 170 GLY B C    6  
ATOM   9660  O O    . GLY B 2 31  ? 5.585   4.233   -5.187  1.00 11.93 ? 170 GLY B O    6  
ATOM   9661  H H    . GLY B 2 31  ? 8.773   5.504   -3.383  1.00 0.00  ? 170 GLY B H    6  
ATOM   9662  H HA2  . GLY B 2 31  ? 6.394   6.446   -3.884  1.00 0.00  ? 170 GLY B HA2  6  
ATOM   9663  H HA3  . GLY B 2 31  ? 7.000   6.563   -5.536  1.00 0.00  ? 170 GLY B HA3  6  
ATOM   9664  N N    . THR B 2 32  ? 7.643   3.654   -4.681  1.00 11.18 ? 171 THR B N    6  
ATOM   9665  C CA   . THR B 2 32  ? 7.337   2.212   -4.903  1.00 10.98 ? 171 THR B CA   6  
ATOM   9666  C C    . THR B 2 32  ? 6.375   1.724   -3.817  1.00 10.39 ? 171 THR B C    6  
ATOM   9667  O O    . THR B 2 32  ? 6.468   2.114   -2.671  1.00 11.11 ? 171 THR B O    6  
ATOM   9668  C CB   . THR B 2 32  ? 8.633   1.401   -4.839  1.00 12.81 ? 171 THR B CB   6  
ATOM   9669  O OG1  . THR B 2 32  ? 9.477   1.776   -5.918  1.00 15.73 ? 171 THR B OG1  6  
ATOM   9670  C CG2  . THR B 2 32  ? 8.308   -0.091  -4.935  1.00 10.54 ? 171 THR B CG2  6  
ATOM   9671  H H    . THR B 2 32  ? 8.543   3.926   -4.407  1.00 0.00  ? 171 THR B H    6  
ATOM   9672  H HA   . THR B 2 32  ? 6.880   2.087   -5.874  1.00 0.00  ? 171 THR B HA   6  
ATOM   9673  H HB   . THR B 2 32  ? 9.135   1.596   -3.904  1.00 0.00  ? 171 THR B HB   6  
ATOM   9674  H HG1  . THR B 2 32  ? 9.039   1.530   -6.737  1.00 0.00  ? 171 THR B HG1  6  
ATOM   9675  H HG21 . THR B 2 32  ? 7.654   -0.262  -5.777  1.00 0.00  ? 171 THR B HG21 6  
ATOM   9676  H HG22 . THR B 2 32  ? 9.222   -0.650  -5.070  1.00 0.00  ? 171 THR B HG22 6  
ATOM   9677  H HG23 . THR B 2 32  ? 7.820   -0.412  -4.027  1.00 0.00  ? 171 THR B HG23 6  
ATOM   9678  N N    . PHE B 2 33  ? 5.449   0.874   -4.168  1.00 9.86  ? 172 PHE B N    6  
ATOM   9679  C CA   . PHE B 2 33  ? 4.482   0.366   -3.154  1.00 10.31 ? 172 PHE B CA   6  
ATOM   9680  C C    . PHE B 2 33  ? 4.170   -1.106  -3.434  1.00 9.74  ? 172 PHE B C    6  
ATOM   9681  O O    . PHE B 2 33  ? 4.647   -1.681  -4.392  1.00 10.89 ? 172 PHE B O    6  
ATOM   9682  C CB   . PHE B 2 33  ? 3.190   1.182   -3.229  1.00 8.42  ? 172 PHE B CB   6  
ATOM   9683  C CG   . PHE B 2 33  ? 2.639   1.120   -4.633  1.00 10.33 ? 172 PHE B CG   6  
ATOM   9684  C CD1  . PHE B 2 33  ? 3.027   2.079   -5.583  1.00 10.22 ? 172 PHE B CD1  6  
ATOM   9685  C CD2  . PHE B 2 33  ? 1.739   0.101   -4.990  1.00 9.32  ? 172 PHE B CD2  6  
ATOM   9686  C CE1  . PHE B 2 33  ? 2.515   2.020   -6.891  1.00 9.66  ? 172 PHE B CE1  6  
ATOM   9687  C CE2  . PHE B 2 33  ? 1.227   0.043   -6.298  1.00 10.82 ? 172 PHE B CE2  6  
ATOM   9688  C CZ   . PHE B 2 33  ? 1.615   1.002   -7.248  1.00 11.64 ? 172 PHE B CZ   6  
ATOM   9689  H H    . PHE B 2 33  ? 5.387   0.572   -5.099  1.00 0.00  ? 172 PHE B H    6  
ATOM   9690  H HA   . PHE B 2 33  ? 4.911   0.463   -2.168  1.00 0.00  ? 172 PHE B HA   6  
ATOM   9691  H HB2  . PHE B 2 33  ? 2.466   0.775   -2.539  1.00 0.00  ? 172 PHE B HB2  6  
ATOM   9692  H HB3  . PHE B 2 33  ? 3.397   2.210   -2.970  1.00 0.00  ? 172 PHE B HB3  6  
ATOM   9693  H HD1  . PHE B 2 33  ? 3.718   2.862   -5.309  1.00 0.00  ? 172 PHE B HD1  6  
ATOM   9694  H HD2  . PHE B 2 33  ? 1.441   -0.636  -4.261  1.00 0.00  ? 172 PHE B HD2  6  
ATOM   9695  H HE1  . PHE B 2 33  ? 2.814   2.758   -7.620  1.00 0.00  ? 172 PHE B HE1  6  
ATOM   9696  H HE2  . PHE B 2 33  ? 0.535   -0.740  -6.572  1.00 0.00  ? 172 PHE B HE2  6  
ATOM   9697  H HZ   . PHE B 2 33  ? 1.222   0.958   -8.252  1.00 0.00  ? 172 PHE B HZ   6  
ATOM   9698  N N    . LEU B 2 34  ? 3.369   -1.718  -2.604  1.00 8.06  ? 173 LEU B N    6  
ATOM   9699  C CA   . LEU B 2 34  ? 3.023   -3.151  -2.821  1.00 6.70  ? 173 LEU B CA   6  
ATOM   9700  C C    . LEU B 2 34  ? 1.885   -3.549  -1.878  1.00 8.22  ? 173 LEU B C    6  
ATOM   9701  O O    . LEU B 2 34  ? 1.929   -3.285  -0.694  1.00 8.04  ? 173 LEU B O    6  
ATOM   9702  C CB   . LEU B 2 34  ? 4.249   -4.023  -2.537  1.00 7.47  ? 173 LEU B CB   6  
ATOM   9703  C CG   . LEU B 2 34  ? 4.563   -3.996  -1.039  1.00 8.31  ? 173 LEU B CG   6  
ATOM   9704  C CD1  . LEU B 2 34  ? 3.943   -5.222  -0.365  1.00 7.11  ? 173 LEU B CD1  6  
ATOM   9705  C CD2  . LEU B 2 34  ? 6.080   -4.019  -0.837  1.00 7.67  ? 173 LEU B CD2  6  
ATOM   9706  H H    . LEU B 2 34  ? 2.994   -1.234  -1.839  1.00 0.00  ? 173 LEU B H    6  
ATOM   9707  H HA   . LEU B 2 34  ? 2.709   -3.295  -3.845  1.00 0.00  ? 173 LEU B HA   6  
ATOM   9708  H HB2  . LEU B 2 34  ? 4.046   -5.039  -2.844  1.00 0.00  ? 173 LEU B HB2  6  
ATOM   9709  H HB3  . LEU B 2 34  ? 5.097   -3.643  -3.087  1.00 0.00  ? 173 LEU B HB3  6  
ATOM   9710  H HG   . LEU B 2 34  ? 4.153   -3.098  -0.601  1.00 0.00  ? 173 LEU B HG   6  
ATOM   9711  H HD11 . LEU B 2 34  ? 4.321   -6.119  -0.832  1.00 0.00  ? 173 LEU B HD11 6  
ATOM   9712  H HD12 . LEU B 2 34  ? 4.202   -5.225  0.683   1.00 0.00  ? 173 LEU B HD12 6  
ATOM   9713  H HD13 . LEU B 2 34  ? 2.870   -5.185  -0.470  1.00 0.00  ? 173 LEU B HD13 6  
ATOM   9714  H HD21 . LEU B 2 34  ? 6.529   -3.203  -1.384  1.00 0.00  ? 173 LEU B HD21 6  
ATOM   9715  H HD22 . LEU B 2 34  ? 6.305   -3.916  0.213   1.00 0.00  ? 173 LEU B HD22 6  
ATOM   9716  H HD23 . LEU B 2 34  ? 6.477   -4.956  -1.199  1.00 0.00  ? 173 LEU B HD23 6  
ATOM   9717  N N    . VAL B 2 35  ? 0.867   -4.183  -2.392  1.00 9.95  ? 174 VAL B N    6  
ATOM   9718  C CA   . VAL B 2 35  ? -0.268  -4.595  -1.519  1.00 10.61 ? 174 VAL B CA   6  
ATOM   9719  C C    . VAL B 2 35  ? -0.156  -6.088  -1.207  1.00 10.97 ? 174 VAL B C    6  
ATOM   9720  O O    . VAL B 2 35  ? 0.143   -6.891  -2.067  1.00 13.68 ? 174 VAL B O    6  
ATOM   9721  C CB   . VAL B 2 35  ? -1.589  -4.322  -2.239  1.00 8.85  ? 174 VAL B CB   6  
ATOM   9722  C CG1  . VAL B 2 35  ? -2.752  -4.518  -1.264  1.00 7.48  ? 174 VAL B CG1  6  
ATOM   9723  C CG2  . VAL B 2 35  ? -1.598  -2.881  -2.757  1.00 7.46  ? 174 VAL B CG2  6  
ATOM   9724  H H    . VAL B 2 35  ? 0.850   -4.389  -3.349  1.00 0.00  ? 174 VAL B H    6  
ATOM   9725  H HA   . VAL B 2 35  ? -0.237  -4.031  -0.599  1.00 0.00  ? 174 VAL B HA   6  
ATOM   9726  H HB   . VAL B 2 35  ? -1.696  -5.006  -3.068  1.00 0.00  ? 174 VAL B HB   6  
ATOM   9727  H HG11 . VAL B 2 35  ? -2.376  -4.904  -0.328  1.00 0.00  ? 174 VAL B HG11 6  
ATOM   9728  H HG12 . VAL B 2 35  ? -3.242  -3.571  -1.092  1.00 0.00  ? 174 VAL B HG12 6  
ATOM   9729  H HG13 . VAL B 2 35  ? -3.459  -5.218  -1.683  1.00 0.00  ? 174 VAL B HG13 6  
ATOM   9730  H HG21 . VAL B 2 35  ? -0.660  -2.671  -3.251  1.00 0.00  ? 174 VAL B HG21 6  
ATOM   9731  H HG22 . VAL B 2 35  ? -2.410  -2.755  -3.457  1.00 0.00  ? 174 VAL B HG22 6  
ATOM   9732  H HG23 . VAL B 2 35  ? -1.727  -2.202  -1.928  1.00 0.00  ? 174 VAL B HG23 6  
ATOM   9733  N N    . ARG B 2 36  ? -0.392  -6.467  0.020   1.00 12.04 ? 175 ARG B N    6  
ATOM   9734  C CA   . ARG B 2 36  ? -0.299  -7.907  0.387   1.00 13.07 ? 175 ARG B CA   6  
ATOM   9735  C C    . ARG B 2 36  ? -1.281  -8.211  1.519   1.00 15.49 ? 175 ARG B C    6  
ATOM   9736  O O    . ARG B 2 36  ? -1.777  -7.319  2.180   1.00 11.34 ? 175 ARG B O    6  
ATOM   9737  C CB   . ARG B 2 36  ? 1.125   -8.225  0.847   1.00 10.24 ? 175 ARG B CB   6  
ATOM   9738  C CG   . ARG B 2 36  ? 1.609   -7.133  1.803   1.00 10.97 ? 175 ARG B CG   6  
ATOM   9739  C CD   . ARG B 2 36  ? 2.028   -7.766  3.131   1.00 8.81  ? 175 ARG B CD   6  
ATOM   9740  N NE   . ARG B 2 36  ? 3.039   -6.898  3.798   1.00 7.82  ? 175 ARG B NE   6  
ATOM   9741  C CZ   . ARG B 2 36  ? 2.824   -6.457  5.007   1.00 8.03  ? 175 ARG B CZ   6  
ATOM   9742  N NH1  . ARG B 2 36  ? 2.259   -7.230  5.894   1.00 11.06 ? 175 ARG B NH1  6  
ATOM   9743  N NH2  . ARG B 2 36  ? 3.173   -5.241  5.329   1.00 7.60  ? 175 ARG B NH2  6  
ATOM   9744  H H    . ARG B 2 36  ? -0.631  -5.801  0.700   1.00 0.00  ? 175 ARG B H    6  
ATOM   9745  H HA   . ARG B 2 36  ? -0.542  -8.514  -0.473  1.00 0.00  ? 175 ARG B HA   6  
ATOM   9746  H HB2  . ARG B 2 36  ? 1.135   -9.179  1.355   1.00 0.00  ? 175 ARG B HB2  6  
ATOM   9747  H HB3  . ARG B 2 36  ? 1.780   -8.267  -0.009  1.00 0.00  ? 175 ARG B HB3  6  
ATOM   9748  H HG2  . ARG B 2 36  ? 2.453   -6.620  1.364   1.00 0.00  ? 175 ARG B HG2  6  
ATOM   9749  H HG3  . ARG B 2 36  ? 0.810   -6.429  1.978   1.00 0.00  ? 175 ARG B HG3  6  
ATOM   9750  H HD2  . ARG B 2 36  ? 1.164   -7.868  3.770   1.00 0.00  ? 175 ARG B HD2  6  
ATOM   9751  H HD3  . ARG B 2 36  ? 2.456   -8.740  2.946   1.00 0.00  ? 175 ARG B HD3  6  
ATOM   9752  H HE   . ARG B 2 36  ? 3.866   -6.659  3.329   1.00 0.00  ? 175 ARG B HE   6  
ATOM   9753  H HH11 . ARG B 2 36  ? 1.992   -8.162  5.647   1.00 0.00  ? 175 ARG B HH11 6  
ATOM   9754  H HH12 . ARG B 2 36  ? 2.095   -6.892  6.820   1.00 0.00  ? 175 ARG B HH12 6  
ATOM   9755  H HH21 . ARG B 2 36  ? 3.606   -4.647  4.649   1.00 0.00  ? 175 ARG B HH21 6  
ATOM   9756  H HH22 . ARG B 2 36  ? 3.008   -4.902  6.256   1.00 0.00  ? 175 ARG B HH22 6  
ATOM   9757  N N    . GLU B 2 37  ? -1.567  -9.462  1.749   1.00 20.91 ? 176 GLU B N    6  
ATOM   9758  C CA   . GLU B 2 37  ? -2.518  -9.822  2.839   1.00 26.31 ? 176 GLU B CA   6  
ATOM   9759  C C    . GLU B 2 37  ? -1.928  -9.405  4.188   1.00 29.76 ? 176 GLU B C    6  
ATOM   9760  O O    . GLU B 2 37  ? -0.853  -9.828  4.563   1.00 30.61 ? 176 GLU B O    6  
ATOM   9761  C CB   . GLU B 2 37  ? -2.757  -11.332 2.831   1.00 25.39 ? 176 GLU B CB   6  
ATOM   9762  C CG   . GLU B 2 37  ? -3.480  -11.729 1.542   1.00 29.84 ? 176 GLU B CG   6  
ATOM   9763  C CD   . GLU B 2 37  ? -3.680  -13.245 1.513   1.00 32.50 ? 176 GLU B CD   6  
ATOM   9764  O OE1  . GLU B 2 37  ? -2.927  -13.934 2.180   1.00 36.79 ? 176 GLU B OE1  6  
ATOM   9765  O OE2  . GLU B 2 37  ? -4.583  -13.690 0.824   1.00 34.32 ? 176 GLU B OE2  6  
ATOM   9766  H H    . GLU B 2 37  ? -1.157  -10.167 1.205   1.00 0.00  ? 176 GLU B H    6  
ATOM   9767  H HA   . GLU B 2 37  ? -3.455  -9.308  2.683   1.00 0.00  ? 176 GLU B HA   6  
ATOM   9768  H HB2  . GLU B 2 37  ? -1.808  -11.847 2.884   1.00 0.00  ? 176 GLU B HB2  6  
ATOM   9769  H HB3  . GLU B 2 37  ? -3.364  -11.606 3.680   1.00 0.00  ? 176 GLU B HB3  6  
ATOM   9770  H HG2  . GLU B 2 37  ? -4.442  -11.236 1.505   1.00 0.00  ? 176 GLU B HG2  6  
ATOM   9771  H HG3  . GLU B 2 37  ? -2.889  -11.429 0.690   1.00 0.00  ? 176 GLU B HG3  6  
ATOM   9772  N N    . SER B 2 38  ? -2.623  -8.579  4.920   1.00 36.14 ? 177 SER B N    6  
ATOM   9773  C CA   . SER B 2 38  ? -2.102  -8.136  6.244   1.00 41.98 ? 177 SER B CA   6  
ATOM   9774  C C    . SER B 2 38  ? -1.995  -9.342  7.179   1.00 43.00 ? 177 SER B C    6  
ATOM   9775  O O    . SER B 2 38  ? -2.984  -9.945  7.546   1.00 43.66 ? 177 SER B O    6  
ATOM   9776  C CB   . SER B 2 38  ? -3.056  -7.106  6.848   1.00 45.78 ? 177 SER B CB   6  
ATOM   9777  O OG   . SER B 2 38  ? -2.735  -5.816  6.343   1.00 51.84 ? 177 SER B OG   6  
ATOM   9778  H H    . SER B 2 38  ? -3.488  -8.249  4.599   1.00 0.00  ? 177 SER B H    6  
ATOM   9779  H HA   . SER B 2 38  ? -1.126  -7.692  6.116   1.00 0.00  ? 177 SER B HA   6  
ATOM   9780  H HB2  . SER B 2 38  ? -4.070  -7.350  6.580   1.00 0.00  ? 177 SER B HB2  6  
ATOM   9781  H HB3  . SER B 2 38  ? -2.958  -7.116  7.927   1.00 0.00  ? 177 SER B HB3  6  
ATOM   9782  H HG   . SER B 2 38  ? -1.782  -5.711  6.380   1.00 0.00  ? 177 SER B HG   6  
ATOM   9783  N N    . GLU B 2 39  ? -0.802  -9.699  7.568   1.00 23.97 ? 178 GLU B N    6  
ATOM   9784  C CA   . GLU B 2 39  ? -0.634  -10.865 8.480   1.00 25.52 ? 178 GLU B CA   6  
ATOM   9785  C C    . GLU B 2 39  ? -1.284  -10.554 9.829   1.00 30.02 ? 178 GLU B C    6  
ATOM   9786  O O    . GLU B 2 39  ? -1.865  -11.413 10.463  1.00 31.55 ? 178 GLU B O    6  
ATOM   9787  C CB   . GLU B 2 39  ? 0.856   -11.143 8.685   1.00 23.29 ? 178 GLU B CB   6  
ATOM   9788  C CG   . GLU B 2 39  ? 1.430   -11.804 7.430   1.00 29.79 ? 178 GLU B CG   6  
ATOM   9789  C CD   . GLU B 2 39  ? 1.590   -13.306 7.671   1.00 33.17 ? 178 GLU B CD   6  
ATOM   9790  O OE1  . GLU B 2 39  ? 0.634   -14.027 7.441   1.00 21.15 ? 178 GLU B OE1  6  
ATOM   9791  O OE2  . GLU B 2 39  ? 2.667   -13.708 8.081   1.00 39.84 ? 178 GLU B OE2  6  
ATOM   9792  H H    . GLU B 2 39  ? -0.016  -9.200  7.261   1.00 0.00  ? 178 GLU B H    6  
ATOM   9793  H HA   . GLU B 2 39  ? -1.106  -11.734 8.045   1.00 0.00  ? 178 GLU B HA   6  
ATOM   9794  H HB2  . GLU B 2 39  ? 1.374   -10.212 8.872   1.00 0.00  ? 178 GLU B HB2  6  
ATOM   9795  H HB3  . GLU B 2 39  ? 0.987   -11.803 9.529   1.00 0.00  ? 178 GLU B HB3  6  
ATOM   9796  H HG2  . GLU B 2 39  ? 0.759   -11.640 6.599   1.00 0.00  ? 178 GLU B HG2  6  
ATOM   9797  H HG3  . GLU B 2 39  ? 2.394   -11.372 7.205   1.00 0.00  ? 178 GLU B HG3  6  
ATOM   9798  N N    . THR B 2 40  ? -1.190  -9.330  10.273  1.00 26.98 ? 179 THR B N    6  
ATOM   9799  C CA   . THR B 2 40  ? -1.802  -8.962  11.580  1.00 31.67 ? 179 THR B CA   6  
ATOM   9800  C C    . THR B 2 40  ? -3.306  -8.744  11.397  1.00 34.54 ? 179 THR B C    6  
ATOM   9801  O O    . THR B 2 40  ? -4.089  -8.959  12.301  1.00 34.85 ? 179 THR B O    6  
ATOM   9802  C CB   . THR B 2 40  ? -1.157  -7.675  12.096  1.00 26.17 ? 179 THR B CB   6  
ATOM   9803  O OG1  . THR B 2 40  ? -1.759  -6.558  11.458  1.00 28.58 ? 179 THR B OG1  6  
ATOM   9804  C CG2  . THR B 2 40  ? 0.341   -7.694  11.789  1.00 35.55 ? 179 THR B CG2  6  
ATOM   9805  H H    . THR B 2 40  ? -0.718  -8.653  9.747   1.00 0.00  ? 179 THR B H    6  
ATOM   9806  H HA   . THR B 2 40  ? -1.638  -9.758  12.292  1.00 0.00  ? 179 THR B HA   6  
ATOM   9807  H HB   . THR B 2 40  ? -1.300  -7.603  13.162  1.00 0.00  ? 179 THR B HB   6  
ATOM   9808  H HG1  . THR B 2 40  ? -1.328  -6.433  10.609  1.00 0.00  ? 179 THR B HG1  6  
ATOM   9809  H HG21 . THR B 2 40  ? 0.742   -8.672  12.014  1.00 0.00  ? 179 THR B HG21 6  
ATOM   9810  H HG22 . THR B 2 40  ? 0.498   -7.473  10.744  1.00 0.00  ? 179 THR B HG22 6  
ATOM   9811  H HG23 . THR B 2 40  ? 0.842   -6.952  12.393  1.00 0.00  ? 179 THR B HG23 6  
ATOM   9812  N N    . THR B 2 41  ? -3.715  -8.317  10.233  1.00 27.03 ? 180 THR B N    6  
ATOM   9813  C CA   . THR B 2 41  ? -5.167  -8.085  9.992   1.00 25.08 ? 180 THR B CA   6  
ATOM   9814  C C    . THR B 2 41  ? -5.788  -9.343  9.380   1.00 30.09 ? 180 THR B C    6  
ATOM   9815  O O    . THR B 2 41  ? -5.103  -10.168 8.808   1.00 30.04 ? 180 THR B O    6  
ATOM   9816  C CB   . THR B 2 41  ? -5.343  -6.908  9.032   1.00 29.37 ? 180 THR B CB   6  
ATOM   9817  O OG1  . THR B 2 41  ? -4.274  -5.989  9.213   1.00 38.10 ? 180 THR B OG1  6  
ATOM   9818  C CG2  . THR B 2 41  ? -6.673  -6.207  9.315   1.00 40.88 ? 180 THR B CG2  6  
ATOM   9819  H H    . THR B 2 41  ? -3.067  -8.150  9.517   1.00 0.00  ? 180 THR B H    6  
ATOM   9820  H HA   . THR B 2 41  ? -5.656  -7.863  10.930  1.00 0.00  ? 180 THR B HA   6  
ATOM   9821  H HB   . THR B 2 41  ? -5.339  -7.268  8.014   1.00 0.00  ? 180 THR B HB   6  
ATOM   9822  H HG1  . THR B 2 41  ? -4.295  -5.684  10.123  1.00 0.00  ? 180 THR B HG1  6  
ATOM   9823  H HG21 . THR B 2 41  ? -7.413  -6.942  9.595   1.00 0.00  ? 180 THR B HG21 6  
ATOM   9824  H HG22 . THR B 2 41  ? -6.543  -5.502  10.122  1.00 0.00  ? 180 THR B HG22 6  
ATOM   9825  H HG23 . THR B 2 41  ? -7.001  -5.685  8.429   1.00 0.00  ? 180 THR B HG23 6  
ATOM   9826  N N    . LYS B 2 42  ? -7.079  -9.495  9.493   1.00 32.42 ? 181 LYS B N    6  
ATOM   9827  C CA   . LYS B 2 42  ? -7.740  -10.700 8.916   1.00 38.97 ? 181 LYS B CA   6  
ATOM   9828  C C    . LYS B 2 42  ? -8.863  -10.266 7.972   1.00 35.28 ? 181 LYS B C    6  
ATOM   9829  O O    . LYS B 2 42  ? -9.774  -9.562  8.359   1.00 34.92 ? 181 LYS B O    6  
ATOM   9830  C CB   . LYS B 2 42  ? -8.326  -11.550 10.046  1.00 51.02 ? 181 LYS B CB   6  
ATOM   9831  C CG   . LYS B 2 42  ? -7.190  -12.163 10.867  1.00 72.35 ? 181 LYS B CG   6  
ATOM   9832  C CD   . LYS B 2 42  ? -7.549  -12.110 12.353  1.00 84.05 ? 181 LYS B CD   6  
ATOM   9833  C CE   . LYS B 2 42  ? -7.098  -10.773 12.941  1.00 88.20 ? 181 LYS B CE   6  
ATOM   9834  N NZ   . LYS B 2 42  ? -7.343  -10.768 14.411  1.00 87.98 ? 181 LYS B NZ   6  
ATOM   9835  H H    . LYS B 2 42  ? -7.613  -8.819  9.958   1.00 0.00  ? 181 LYS B H    6  
ATOM   9836  H HA   . LYS B 2 42  ? -7.013  -11.281 8.368   1.00 0.00  ? 181 LYS B HA   6  
ATOM   9837  H HB2  . LYS B 2 42  ? -8.938  -10.929 10.683  1.00 0.00  ? 181 LYS B HB2  6  
ATOM   9838  H HB3  . LYS B 2 42  ? -8.929  -12.340 9.625   1.00 0.00  ? 181 LYS B HB3  6  
ATOM   9839  H HG2  . LYS B 2 42  ? -7.042  -13.190 10.566  1.00 0.00  ? 181 LYS B HG2  6  
ATOM   9840  H HG3  . LYS B 2 42  ? -6.282  -11.604 10.698  1.00 0.00  ? 181 LYS B HG3  6  
ATOM   9841  H HD2  . LYS B 2 42  ? -8.618  -12.213 12.468  1.00 0.00  ? 181 LYS B HD2  6  
ATOM   9842  H HD3  . LYS B 2 42  ? -7.051  -12.916 12.872  1.00 0.00  ? 181 LYS B HD3  6  
ATOM   9843  H HE2  . LYS B 2 42  ? -6.044  -10.633 12.751  1.00 0.00  ? 181 LYS B HE2  6  
ATOM   9844  H HE3  . LYS B 2 42  ? -7.656  -9.971  12.480  1.00 0.00  ? 181 LYS B HE3  6  
ATOM   9845  H HZ1  . LYS B 2 42  ? -7.180  -11.720 14.794  1.00 0.00  ? 181 LYS B HZ1  6  
ATOM   9846  H HZ2  . LYS B 2 42  ? -6.694  -10.094 14.868  1.00 0.00  ? 181 LYS B HZ2  6  
ATOM   9847  H HZ3  . LYS B 2 42  ? -8.325  -10.484 14.598  1.00 0.00  ? 181 LYS B HZ3  6  
ATOM   9848  N N    . GLY B 2 43  ? -8.805  -10.681 6.736   1.00 38.03 ? 182 GLY B N    6  
ATOM   9849  C CA   . GLY B 2 43  ? -9.870  -10.294 5.769   1.00 30.70 ? 182 GLY B CA   6  
ATOM   9850  C C    . GLY B 2 43  ? -9.566  -8.907  5.199   1.00 29.58 ? 182 GLY B C    6  
ATOM   9851  O O    . GLY B 2 43  ? -10.434 -8.238  4.673   1.00 31.67 ? 182 GLY B O    6  
ATOM   9852  H H    . GLY B 2 43  ? -8.062  -11.250 6.445   1.00 0.00  ? 182 GLY B H    6  
ATOM   9853  H HA2  . GLY B 2 43  ? -9.905  -11.015 4.965   1.00 0.00  ? 182 GLY B HA2  6  
ATOM   9854  H HA3  . GLY B 2 43  ? -10.824 -10.271 6.274   1.00 0.00  ? 182 GLY B HA3  6  
ATOM   9855  N N    . ALA B 2 44  ? -8.341  -8.469  5.298   1.00 35.86 ? 183 ALA B N    6  
ATOM   9856  C CA   . ALA B 2 44  ? -7.985  -7.126  4.760   1.00 32.70 ? 183 ALA B CA   6  
ATOM   9857  C C    . ALA B 2 44  ? -6.524  -7.127  4.308   1.00 28.65 ? 183 ALA B C    6  
ATOM   9858  O O    . ALA B 2 44  ? -5.680  -7.765  4.905   1.00 29.39 ? 183 ALA B O    6  
ATOM   9859  C CB   . ALA B 2 44  ? -8.180  -6.072  5.852   1.00 31.44 ? 183 ALA B CB   6  
ATOM   9860  H H    . ALA B 2 44  ? -7.655  -9.024  5.725   1.00 0.00  ? 183 ALA B H    6  
ATOM   9861  H HA   . ALA B 2 44  ? -8.622  -6.895  3.919   1.00 0.00  ? 183 ALA B HA   6  
ATOM   9862  H HB1  . ALA B 2 44  ? -7.614  -6.352  6.728   1.00 0.00  ? 183 ALA B HB1  6  
ATOM   9863  H HB2  . ALA B 2 44  ? -7.837  -5.114  5.493   1.00 0.00  ? 183 ALA B HB2  6  
ATOM   9864  H HB3  . ALA B 2 44  ? -9.228  -6.006  6.107   1.00 0.00  ? 183 ALA B HB3  6  
ATOM   9865  N N    . TYR B 2 45  ? -6.219  -6.417  3.256   1.00 24.43 ? 184 TYR B N    6  
ATOM   9866  C CA   . TYR B 2 45  ? -4.813  -6.378  2.767   1.00 19.69 ? 184 TYR B CA   6  
ATOM   9867  C C    . TYR B 2 45  ? -4.125  -5.118  3.297   1.00 15.67 ? 184 TYR B C    6  
ATOM   9868  O O    . TYR B 2 45  ? -4.633  -4.446  4.173   1.00 11.54 ? 184 TYR B O    6  
ATOM   9869  C CB   . TYR B 2 45  ? -4.808  -6.359  1.236   1.00 20.89 ? 184 TYR B CB   6  
ATOM   9870  C CG   . TYR B 2 45  ? -5.722  -7.444  0.718   1.00 21.46 ? 184 TYR B CG   6  
ATOM   9871  C CD1  . TYR B 2 45  ? -7.111  -7.236  0.686   1.00 23.38 ? 184 TYR B CD1  6  
ATOM   9872  C CD2  . TYR B 2 45  ? -5.184  -8.661  0.268   1.00 21.81 ? 184 TYR B CD2  6  
ATOM   9873  C CE1  . TYR B 2 45  ? -7.962  -8.245  0.205   1.00 24.77 ? 184 TYR B CE1  6  
ATOM   9874  C CE2  . TYR B 2 45  ? -6.035  -9.670  -0.213  1.00 21.77 ? 184 TYR B CE2  6  
ATOM   9875  C CZ   . TYR B 2 45  ? -7.424  -9.462  -0.245  1.00 25.72 ? 184 TYR B CZ   6  
ATOM   9876  O OH   . TYR B 2 45  ? -8.260  -10.453 -0.717  1.00 27.17 ? 184 TYR B OH   6  
ATOM   9877  H H    . TYR B 2 45  ? -6.916  -5.910  2.790   1.00 0.00  ? 184 TYR B H    6  
ATOM   9878  H HA   . TYR B 2 45  ? -4.285  -7.251  3.118   1.00 0.00  ? 184 TYR B HA   6  
ATOM   9879  H HB2  . TYR B 2 45  ? -5.154  -5.398  0.887   1.00 0.00  ? 184 TYR B HB2  6  
ATOM   9880  H HB3  . TYR B 2 45  ? -3.804  -6.533  0.878   1.00 0.00  ? 184 TYR B HB3  6  
ATOM   9881  H HD1  . TYR B 2 45  ? -7.525  -6.299  1.032   1.00 0.00  ? 184 TYR B HD1  6  
ATOM   9882  H HD2  . TYR B 2 45  ? -4.116  -8.821  0.293   1.00 0.00  ? 184 TYR B HD2  6  
ATOM   9883  H HE1  . TYR B 2 45  ? -9.030  -8.085  0.181   1.00 0.00  ? 184 TYR B HE1  6  
ATOM   9884  H HE2  . TYR B 2 45  ? -5.621  -10.606 -0.558  1.00 0.00  ? 184 TYR B HE2  6  
ATOM   9885  H HH   . TYR B 2 45  ? -7.763  -10.988 -1.342  1.00 0.00  ? 184 TYR B HH   6  
ATOM   9886  N N    . CYS B 2 46  ? -2.973  -4.792  2.778   1.00 12.49 ? 185 CYS B N    6  
ATOM   9887  C CA   . CYS B 2 46  ? -2.259  -3.576  3.261   1.00 13.07 ? 185 CYS B CA   6  
ATOM   9888  C C    . CYS B 2 46  ? -1.371  -3.021  2.145   1.00 11.90 ? 185 CYS B C    6  
ATOM   9889  O O    . CYS B 2 46  ? -0.504  -3.700  1.632   1.00 11.52 ? 185 CYS B O    6  
ATOM   9890  C CB   . CYS B 2 46  ? -1.393  -3.940  4.468   1.00 13.05 ? 185 CYS B CB   6  
ATOM   9891  S SG   . CYS B 2 46  ? -0.504  -5.480  4.130   1.00 27.90 ? 185 CYS B SG   6  
ATOM   9892  H H    . CYS B 2 46  ? -2.577  -5.347  2.073   1.00 0.00  ? 185 CYS B H    6  
ATOM   9893  H HA   . CYS B 2 46  ? -2.981  -2.827  3.550   1.00 0.00  ? 185 CYS B HA   6  
ATOM   9894  H HB2  . CYS B 2 46  ? -0.683  -3.148  4.654   1.00 0.00  ? 185 CYS B HB2  6  
ATOM   9895  H HB3  . CYS B 2 46  ? -2.023  -4.070  5.335   1.00 0.00  ? 185 CYS B HB3  6  
ATOM   9896  H HG   . CYS B 2 46  ? -0.200  -5.836  4.969   1.00 0.00  ? 185 CYS B HG   6  
ATOM   9897  N N    . LEU B 2 47  ? -1.579  -1.788  1.771   1.00 10.41 ? 186 LEU B N    6  
ATOM   9898  C CA   . LEU B 2 47  ? -0.745  -1.184  0.694   1.00 10.82 ? 186 LEU B CA   6  
ATOM   9899  C C    . LEU B 2 47  ? 0.392   -0.381  1.328   1.00 10.91 ? 186 LEU B C    6  
ATOM   9900  O O    . LEU B 2 47  ? 0.169   0.604   2.003   1.00 11.30 ? 186 LEU B O    6  
ATOM   9901  C CB   . LEU B 2 47  ? -1.612  -0.256  -0.161  1.00 8.57  ? 186 LEU B CB   6  
ATOM   9902  C CG   . LEU B 2 47  ? -0.723  0.522   -1.133  1.00 8.23  ? 186 LEU B CG   6  
ATOM   9903  C CD1  . LEU B 2 47  ? -0.161  -0.432  -2.187  1.00 10.17 ? 186 LEU B CD1  6  
ATOM   9904  C CD2  . LEU B 2 47  ? -1.553  1.609   -1.821  1.00 8.76  ? 186 LEU B CD2  6  
ATOM   9905  H H    . LEU B 2 47  ? -2.282  -1.258  2.201   1.00 0.00  ? 186 LEU B H    6  
ATOM   9906  H HA   . LEU B 2 47  ? -0.334  -1.966  0.074   1.00 0.00  ? 186 LEU B HA   6  
ATOM   9907  H HB2  . LEU B 2 47  ? -2.327  -0.843  -0.717  1.00 0.00  ? 186 LEU B HB2  6  
ATOM   9908  H HB3  . LEU B 2 47  ? -2.135  0.438   0.479   1.00 0.00  ? 186 LEU B HB3  6  
ATOM   9909  H HG   . LEU B 2 47  ? 0.092   0.979   -0.590  1.00 0.00  ? 186 LEU B HG   6  
ATOM   9910  H HD11 . LEU B 2 47  ? 0.075   -1.380  -1.726  1.00 0.00  ? 186 LEU B HD11 6  
ATOM   9911  H HD12 . LEU B 2 47  ? -0.895  -0.584  -2.964  1.00 0.00  ? 186 LEU B HD12 6  
ATOM   9912  H HD13 . LEU B 2 47  ? 0.734   -0.008  -2.616  1.00 0.00  ? 186 LEU B HD13 6  
ATOM   9913  H HD21 . LEU B 2 47  ? -2.587  1.515   -1.524  1.00 0.00  ? 186 LEU B HD21 6  
ATOM   9914  H HD22 . LEU B 2 47  ? -1.181  2.581   -1.533  1.00 0.00  ? 186 LEU B HD22 6  
ATOM   9915  H HD23 . LEU B 2 47  ? -1.474  1.497   -2.893  1.00 0.00  ? 186 LEU B HD23 6  
ATOM   9916  N N    . SER B 2 48  ? 1.612   -0.796  1.122   1.00 10.50 ? 187 SER B N    6  
ATOM   9917  C CA   . SER B 2 48  ? 2.760   -0.060  1.720   1.00 9.18  ? 187 SER B CA   6  
ATOM   9918  C C    . SER B 2 48  ? 3.403   0.842   0.663   1.00 8.50  ? 187 SER B C    6  
ATOM   9919  O O    . SER B 2 48  ? 3.224   0.653   -0.523  1.00 9.53  ? 187 SER B O    6  
ATOM   9920  C CB   . SER B 2 48  ? 3.796   -1.061  2.231   1.00 7.49  ? 187 SER B CB   6  
ATOM   9921  O OG   . SER B 2 48  ? 3.376   -1.569  3.490   1.00 5.18  ? 187 SER B OG   6  
ATOM   9922  H H    . SER B 2 48  ? 1.772   -1.595  0.578   1.00 0.00  ? 187 SER B H    6  
ATOM   9923  H HA   . SER B 2 48  ? 2.409   0.545   2.543   1.00 0.00  ? 187 SER B HA   6  
ATOM   9924  H HB2  . SER B 2 48  ? 3.889   -1.875  1.532   1.00 0.00  ? 187 SER B HB2  6  
ATOM   9925  H HB3  . SER B 2 48  ? 4.753   -0.566  2.332   1.00 0.00  ? 187 SER B HB3  6  
ATOM   9926  H HG   . SER B 2 48  ? 3.015   -2.448  3.348   1.00 0.00  ? 187 SER B HG   6  
ATOM   9927  N N    . VAL B 2 49  ? 4.153   1.821   1.091   1.00 11.78 ? 188 VAL B N    6  
ATOM   9928  C CA   . VAL B 2 49  ? 4.814   2.740   0.122   1.00 12.79 ? 188 VAL B CA   6  
ATOM   9929  C C    . VAL B 2 49  ? 6.277   2.931   0.528   1.00 14.65 ? 188 VAL B C    6  
ATOM   9930  O O    . VAL B 2 49  ? 6.667   2.629   1.639   1.00 14.43 ? 188 VAL B O    6  
ATOM   9931  C CB   . VAL B 2 49  ? 4.099   4.093   0.132   1.00 12.22 ? 188 VAL B CB   6  
ATOM   9932  C CG1  . VAL B 2 49  ? 4.732   5.012   -0.914  1.00 11.34 ? 188 VAL B CG1  6  
ATOM   9933  C CG2  . VAL B 2 49  ? 2.619   3.890   -0.198  1.00 12.23 ? 188 VAL B CG2  6  
ATOM   9934  H H    . VAL B 2 49  ? 4.284   1.951   2.053   1.00 0.00  ? 188 VAL B H    6  
ATOM   9935  H HA   . VAL B 2 49  ? 4.767   2.314   -0.868  1.00 0.00  ? 188 VAL B HA   6  
ATOM   9936  H HB   . VAL B 2 49  ? 4.195   4.543   1.110   1.00 0.00  ? 188 VAL B HB   6  
ATOM   9937  H HG11 . VAL B 2 49  ? 5.074   4.422   -1.752  1.00 0.00  ? 188 VAL B HG11 6  
ATOM   9938  H HG12 . VAL B 2 49  ? 3.999   5.729   -1.254  1.00 0.00  ? 188 VAL B HG12 6  
ATOM   9939  H HG13 . VAL B 2 49  ? 5.570   5.534   -0.476  1.00 0.00  ? 188 VAL B HG13 6  
ATOM   9940  H HG21 . VAL B 2 49  ? 2.519   3.109   -0.937  1.00 0.00  ? 188 VAL B HG21 6  
ATOM   9941  H HG22 . VAL B 2 49  ? 2.086   3.606   0.699   1.00 0.00  ? 188 VAL B HG22 6  
ATOM   9942  H HG23 . VAL B 2 49  ? 2.207   4.809   -0.586  1.00 0.00  ? 188 VAL B HG23 6  
ATOM   9943  N N    . SER B 2 50  ? 7.089   3.430   -0.363  1.00 14.39 ? 189 SER B N    6  
ATOM   9944  C CA   . SER B 2 50  ? 8.526   3.636   -0.026  1.00 13.97 ? 189 SER B CA   6  
ATOM   9945  C C    . SER B 2 50  ? 8.825   5.135   0.052   1.00 14.32 ? 189 SER B C    6  
ATOM   9946  O O    . SER B 2 50  ? 8.221   5.935   -0.635  1.00 13.16 ? 189 SER B O    6  
ATOM   9947  C CB   . SER B 2 50  ? 9.398   2.999   -1.109  1.00 12.52 ? 189 SER B CB   6  
ATOM   9948  O OG   . SER B 2 50  ? 8.705   3.036   -2.350  1.00 13.11 ? 189 SER B OG   6  
ATOM   9949  H H    . SER B 2 50  ? 6.756   3.668   -1.252  1.00 0.00  ? 189 SER B H    6  
ATOM   9950  H HA   . SER B 2 50  ? 8.743   3.176   0.926   1.00 0.00  ? 189 SER B HA   6  
ATOM   9951  H HB2  . SER B 2 50  ? 10.320  3.548   -1.202  1.00 0.00  ? 189 SER B HB2  6  
ATOM   9952  H HB3  . SER B 2 50  ? 9.616   1.975   -0.837  1.00 0.00  ? 189 SER B HB3  6  
ATOM   9953  H HG   . SER B 2 50  ? 8.290   3.898   -2.433  1.00 0.00  ? 189 SER B HG   6  
ATOM   9954  N N    . ASP B 2 51  ? 9.754   5.520   0.883   1.00 17.22 ? 190 ASP B N    6  
ATOM   9955  C CA   . ASP B 2 51  ? 10.093  6.967   1.003   1.00 20.71 ? 190 ASP B CA   6  
ATOM   9956  C C    . ASP B 2 51  ? 11.613  7.134   1.020   1.00 19.82 ? 190 ASP B C    6  
ATOM   9957  O O    . ASP B 2 51  ? 12.342  6.239   1.403   1.00 20.14 ? 190 ASP B O    6  
ATOM   9958  C CB   . ASP B 2 51  ? 9.502   7.522   2.301   1.00 25.05 ? 190 ASP B CB   6  
ATOM   9959  C CG   . ASP B 2 51  ? 9.428   9.048   2.216   1.00 26.93 ? 190 ASP B CG   6  
ATOM   9960  O OD1  . ASP B 2 51  ? 8.880   9.541   1.244   1.00 30.74 ? 190 ASP B OD1  6  
ATOM   9961  O OD2  . ASP B 2 51  ? 9.918   9.697   3.125   1.00 31.13 ? 190 ASP B OD2  6  
ATOM   9962  H H    . ASP B 2 51  ? 10.230  4.858   1.427   1.00 0.00  ? 190 ASP B H    6  
ATOM   9963  H HA   . ASP B 2 51  ? 9.681   7.503   0.161   1.00 0.00  ? 190 ASP B HA   6  
ATOM   9964  H HB2  . ASP B 2 51  ? 8.510   7.120   2.447   1.00 0.00  ? 190 ASP B HB2  6  
ATOM   9965  H HB3  . ASP B 2 51  ? 10.130  7.240   3.133   1.00 0.00  ? 190 ASP B HB3  6  
ATOM   9966  N N    . PHE B 2 52  ? 12.099  8.272   0.607   1.00 21.67 ? 191 PHE B N    6  
ATOM   9967  C CA   . PHE B 2 52  ? 13.573  8.494   0.598   1.00 24.27 ? 191 PHE B CA   6  
ATOM   9968  C C    . PHE B 2 52  ? 13.871  9.938   1.008   1.00 28.02 ? 191 PHE B C    6  
ATOM   9969  O O    . PHE B 2 52  ? 13.037  10.813  0.887   1.00 25.66 ? 191 PHE B O    6  
ATOM   9970  C CB   . PHE B 2 52  ? 14.118  8.239   -0.810  1.00 23.13 ? 191 PHE B CB   6  
ATOM   9971  C CG   . PHE B 2 52  ? 15.574  8.632   -0.868  1.00 21.13 ? 191 PHE B CG   6  
ATOM   9972  C CD1  . PHE B 2 52  ? 16.517  7.955   -0.076  1.00 20.50 ? 191 PHE B CD1  6  
ATOM   9973  C CD2  . PHE B 2 52  ? 15.987  9.675   -1.714  1.00 18.20 ? 191 PHE B CD2  6  
ATOM   9974  C CE1  . PHE B 2 52  ? 17.873  8.321   -0.131  1.00 19.46 ? 191 PHE B CE1  6  
ATOM   9975  C CE2  . PHE B 2 52  ? 17.343  10.040  -1.769  1.00 16.51 ? 191 PHE B CE2  6  
ATOM   9976  C CZ   . PHE B 2 52  ? 18.286  9.363   -0.977  1.00 17.79 ? 191 PHE B CZ   6  
ATOM   9977  H H    . PHE B 2 52  ? 11.495  8.980   0.301   1.00 0.00  ? 191 PHE B H    6  
ATOM   9978  H HA   . PHE B 2 52  ? 14.044  7.817   1.295   1.00 0.00  ? 191 PHE B HA   6  
ATOM   9979  H HB2  . PHE B 2 52  ? 14.018  7.190   -1.049  1.00 0.00  ? 191 PHE B HB2  6  
ATOM   9980  H HB3  . PHE B 2 52  ? 13.558  8.826   -1.524  1.00 0.00  ? 191 PHE B HB3  6  
ATOM   9981  H HD1  . PHE B 2 52  ? 16.199  7.153   0.575   1.00 0.00  ? 191 PHE B HD1  6  
ATOM   9982  H HD2  . PHE B 2 52  ? 15.262  10.195  -2.323  1.00 0.00  ? 191 PHE B HD2  6  
ATOM   9983  H HE1  . PHE B 2 52  ? 18.597  7.799   0.478   1.00 0.00  ? 191 PHE B HE1  6  
ATOM   9984  H HE2  . PHE B 2 52  ? 17.660  10.842  -2.419  1.00 0.00  ? 191 PHE B HE2  6  
ATOM   9985  H HZ   . PHE B 2 52  ? 19.327  9.644   -1.020  1.00 0.00  ? 191 PHE B HZ   6  
ATOM   9986  N N    . ASP B 2 53  ? 15.054  10.195  1.495   1.00 32.66 ? 192 ASP B N    6  
ATOM   9987  C CA   . ASP B 2 53  ? 15.403  11.582  1.913   1.00 38.82 ? 192 ASP B CA   6  
ATOM   9988  C C    . ASP B 2 53  ? 16.744  11.981  1.294   1.00 41.14 ? 192 ASP B C    6  
ATOM   9989  O O    . ASP B 2 53  ? 17.553  11.143  0.949   1.00 38.49 ? 192 ASP B O    6  
ATOM   9990  C CB   . ASP B 2 53  ? 15.506  11.645  3.438   1.00 42.78 ? 192 ASP B CB   6  
ATOM   9991  C CG   . ASP B 2 53  ? 14.105  11.756  4.042   1.00 45.03 ? 192 ASP B CG   6  
ATOM   9992  O OD1  . ASP B 2 53  ? 13.499  10.724  4.276   1.00 46.40 ? 192 ASP B OD1  6  
ATOM   9993  O OD2  . ASP B 2 53  ? 13.662  12.872  4.259   1.00 49.15 ? 192 ASP B OD2  6  
ATOM   9994  H H    . ASP B 2 53  ? 15.715  9.475   1.586   1.00 0.00  ? 192 ASP B H    6  
ATOM   9995  H HA   . ASP B 2 53  ? 14.635  12.262  1.576   1.00 0.00  ? 192 ASP B HA   6  
ATOM   9996  H HB2  . ASP B 2 53  ? 15.987  10.749  3.803   1.00 0.00  ? 192 ASP B HB2  6  
ATOM   9997  H HB3  . ASP B 2 53  ? 16.088  12.508  3.723   1.00 0.00  ? 192 ASP B HB3  6  
ATOM   9998  N N    . ASN B 2 54  ? 16.986  13.255  1.153   1.00 45.91 ? 193 ASN B N    6  
ATOM   9999  C CA   . ASN B 2 54  ? 18.274  13.707  0.557   1.00 50.53 ? 193 ASN B CA   6  
ATOM   10000 C C    . ASN B 2 54  ? 19.406  13.478  1.560   1.00 51.37 ? 193 ASN B C    6  
ATOM   10001 O O    . ASN B 2 54  ? 20.571  13.489  1.210   1.00 52.38 ? 193 ASN B O    6  
ATOM   10002 C CB   . ASN B 2 54  ? 18.184  15.197  0.220   1.00 54.84 ? 193 ASN B CB   6  
ATOM   10003 C CG   . ASN B 2 54  ? 19.235  15.546  -0.836  1.00 60.46 ? 193 ASN B CG   6  
ATOM   10004 O OD1  . ASN B 2 54  ? 19.751  14.675  -1.507  1.00 63.78 ? 193 ASN B OD1  6  
ATOM   10005 N ND2  . ASN B 2 54  ? 19.576  16.794  -1.013  1.00 62.09 ? 193 ASN B ND2  6  
ATOM   10006 H H    . ASN B 2 54  ? 16.319  13.914  1.438   1.00 0.00  ? 193 ASN B H    6  
ATOM   10007 H HA   . ASN B 2 54  ? 18.471  13.146  -0.343  1.00 0.00  ? 193 ASN B HA   6  
ATOM   10008 H HB2  . ASN B 2 54  ? 17.199  15.422  -0.162  1.00 0.00  ? 193 ASN B HB2  6  
ATOM   10009 H HB3  . ASN B 2 54  ? 18.366  15.779  1.112   1.00 0.00  ? 193 ASN B HB3  6  
ATOM   10010 H HD21 . ASN B 2 54  ? 19.157  17.499  -0.468  1.00 0.00  ? 193 ASN B HD21 6  
ATOM   10011 H HD22 . ASN B 2 54  ? 20.251  17.027  -1.690  1.00 0.00  ? 193 ASN B HD22 6  
ATOM   10012 N N    . ALA B 2 55  ? 19.077  13.272  2.806   1.00 51.03 ? 194 ALA B N    6  
ATOM   10013 C CA   . ALA B 2 55  ? 20.137  13.043  3.828   1.00 49.87 ? 194 ALA B CA   6  
ATOM   10014 C C    . ALA B 2 55  ? 19.532  12.339  5.045   1.00 48.78 ? 194 ALA B C    6  
ATOM   10015 O O    . ALA B 2 55  ? 19.849  12.651  6.175   1.00 50.16 ? 194 ALA B O    6  
ATOM   10016 C CB   . ALA B 2 55  ? 20.727  14.387  4.258   1.00 50.70 ? 194 ALA B CB   6  
ATOM   10017 H H    . ALA B 2 55  ? 18.133  13.268  3.069   1.00 0.00  ? 194 ALA B H    6  
ATOM   10018 H HA   . ALA B 2 55  ? 20.917  12.427  3.406   1.00 0.00  ? 194 ALA B HA   6  
ATOM   10019 H HB1  . ALA B 2 55  ? 19.936  15.118  4.343   1.00 0.00  ? 194 ALA B HB1  6  
ATOM   10020 H HB2  . ALA B 2 55  ? 21.218  14.276  5.214   1.00 0.00  ? 194 ALA B HB2  6  
ATOM   10021 H HB3  . ALA B 2 55  ? 21.445  14.718  3.522   1.00 0.00  ? 194 ALA B HB3  6  
ATOM   10022 N N    . LYS B 2 56  ? 18.665  11.390  4.824   1.00 45.35 ? 195 LYS B N    6  
ATOM   10023 C CA   . LYS B 2 56  ? 18.043  10.667  5.969   1.00 41.76 ? 195 LYS B CA   6  
ATOM   10024 C C    . LYS B 2 56  ? 17.748  9.222   5.563   1.00 38.59 ? 195 LYS B C    6  
ATOM   10025 O O    . LYS B 2 56  ? 16.981  8.531   6.203   1.00 39.85 ? 195 LYS B O    6  
ATOM   10026 C CB   . LYS B 2 56  ? 16.739  11.364  6.364   1.00 42.95 ? 195 LYS B CB   6  
ATOM   10027 C CG   . LYS B 2 56  ? 16.925  12.879  6.279   1.00 45.27 ? 195 LYS B CG   6  
ATOM   10028 C CD   . LYS B 2 56  ? 15.720  13.578  6.910   1.00 47.56 ? 195 LYS B CD   6  
ATOM   10029 C CE   . LYS B 2 56  ? 16.191  14.817  7.674   1.00 50.16 ? 195 LYS B CE   6  
ATOM   10030 N NZ   . LYS B 2 56  ? 15.889  14.652  9.124   1.00 50.69 ? 195 LYS B NZ   6  
ATOM   10031 H H    . LYS B 2 56  ? 18.423  11.152  3.904   1.00 0.00  ? 195 LYS B H    6  
ATOM   10032 H HA   . LYS B 2 56  ? 18.721  10.673  6.809   1.00 0.00  ? 195 LYS B HA   6  
ATOM   10033 H HB2  . LYS B 2 56  ? 15.951  11.057  5.693   1.00 0.00  ? 195 LYS B HB2  6  
ATOM   10034 H HB3  . LYS B 2 56  ? 16.478  11.091  7.376   1.00 0.00  ? 195 LYS B HB3  6  
ATOM   10035 H HG2  . LYS B 2 56  ? 17.824  13.162  6.807   1.00 0.00  ? 195 LYS B HG2  6  
ATOM   10036 H HG3  . LYS B 2 56  ? 17.008  13.175  5.243   1.00 0.00  ? 195 LYS B HG3  6  
ATOM   10037 H HD2  . LYS B 2 56  ? 15.028  13.874  6.134   1.00 0.00  ? 195 LYS B HD2  6  
ATOM   10038 H HD3  . LYS B 2 56  ? 15.228  12.902  7.593   1.00 0.00  ? 195 LYS B HD3  6  
ATOM   10039 H HE2  . LYS B 2 56  ? 17.255  14.939  7.539   1.00 0.00  ? 195 LYS B HE2  6  
ATOM   10040 H HE3  . LYS B 2 56  ? 15.678  15.689  7.296   1.00 0.00  ? 195 LYS B HE3  6  
ATOM   10041 H HZ1  . LYS B 2 56  ? 16.240  13.730  9.448   1.00 0.00  ? 195 LYS B HZ1  6  
ATOM   10042 H HZ2  . LYS B 2 56  ? 16.353  15.410  9.662   1.00 0.00  ? 195 LYS B HZ2  6  
ATOM   10043 H HZ3  . LYS B 2 56  ? 14.861  14.700  9.272   1.00 0.00  ? 195 LYS B HZ3  6  
ATOM   10044 N N    . GLY B 2 57  ? 18.353  8.759   4.503   1.00 34.40 ? 196 GLY B N    6  
ATOM   10045 C CA   . GLY B 2 57  ? 18.109  7.358   4.057   1.00 29.38 ? 196 GLY B CA   6  
ATOM   10046 C C    . GLY B 2 57  ? 16.662  7.213   3.585   1.00 25.82 ? 196 GLY B C    6  
ATOM   10047 O O    . GLY B 2 57  ? 16.007  8.181   3.255   1.00 25.14 ? 196 GLY B O    6  
ATOM   10048 H H    . GLY B 2 57  ? 18.970  9.333   4.001   1.00 0.00  ? 196 GLY B H    6  
ATOM   10049 H HA2  . GLY B 2 57  ? 18.779  7.119   3.243   1.00 0.00  ? 196 GLY B HA2  6  
ATOM   10050 H HA3  . GLY B 2 57  ? 18.286  6.682   4.879   1.00 0.00  ? 196 GLY B HA3  6  
ATOM   10051 N N    . LEU B 2 58  ? 16.157  6.010   3.550   1.00 25.09 ? 197 LEU B N    6  
ATOM   10052 C CA   . LEU B 2 58  ? 14.752  5.805   3.097   1.00 24.92 ? 197 LEU B CA   6  
ATOM   10053 C C    . LEU B 2 58  ? 13.960  5.090   4.195   1.00 23.75 ? 197 LEU B C    6  
ATOM   10054 O O    . LEU B 2 58  ? 14.504  4.331   4.972   1.00 23.93 ? 197 LEU B O    6  
ATOM   10055 C CB   . LEU B 2 58  ? 14.747  4.949   1.829   1.00 25.84 ? 197 LEU B CB   6  
ATOM   10056 C CG   . LEU B 2 58  ? 15.641  3.725   2.035   1.00 30.07 ? 197 LEU B CG   6  
ATOM   10057 C CD1  . LEU B 2 58  ? 14.940  2.482   1.483   1.00 29.71 ? 197 LEU B CD1  6  
ATOM   10058 C CD2  . LEU B 2 58  ? 16.965  3.932   1.297   1.00 30.59 ? 197 LEU B CD2  6  
ATOM   10059 H H    . LEU B 2 58  ? 16.703  5.242   3.820   1.00 0.00  ? 197 LEU B H    6  
ATOM   10060 H HA   . LEU B 2 58  ? 14.297  6.761   2.889   1.00 0.00  ? 197 LEU B HA   6  
ATOM   10061 H HB2  . LEU B 2 58  ? 13.737  4.627   1.616   1.00 0.00  ? 197 LEU B HB2  6  
ATOM   10062 H HB3  . LEU B 2 58  ? 15.121  5.530   1.000   1.00 0.00  ? 197 LEU B HB3  6  
ATOM   10063 H HG   . LEU B 2 58  ? 15.831  3.592   3.090   1.00 0.00  ? 197 LEU B HG   6  
ATOM   10064 H HD11 . LEU B 2 58  ? 13.873  2.577   1.625   1.00 0.00  ? 197 LEU B HD11 6  
ATOM   10065 H HD12 . LEU B 2 58  ? 15.157  2.384   0.429   1.00 0.00  ? 197 LEU B HD12 6  
ATOM   10066 H HD13 . LEU B 2 58  ? 15.296  1.606   2.007   1.00 0.00  ? 197 LEU B HD13 6  
ATOM   10067 H HD21 . LEU B 2 58  ? 16.851  4.720   0.567   1.00 0.00  ? 197 LEU B HD21 6  
ATOM   10068 H HD22 . LEU B 2 58  ? 17.732  4.206   2.006   1.00 0.00  ? 197 LEU B HD22 6  
ATOM   10069 H HD23 . LEU B 2 58  ? 17.246  3.017   0.797   1.00 0.00  ? 197 LEU B HD23 6  
ATOM   10070 N N    . ASN B 2 59  ? 12.679  5.326   4.263   1.00 21.78 ? 198 ASN B N    6  
ATOM   10071 C CA   . ASN B 2 59  ? 11.853  4.660   5.309   1.00 19.17 ? 198 ASN B CA   6  
ATOM   10072 C C    . ASN B 2 59  ? 10.705  3.900   4.642   1.00 16.90 ? 198 ASN B C    6  
ATOM   10073 O O    . ASN B 2 59  ? 10.631  3.806   3.433   1.00 15.60 ? 198 ASN B O    6  
ATOM   10074 C CB   . ASN B 2 59  ? 11.282  5.714   6.260   1.00 18.45 ? 198 ASN B CB   6  
ATOM   10075 C CG   . ASN B 2 59  ? 12.384  6.702   6.647   1.00 20.04 ? 198 ASN B CG   6  
ATOM   10076 O OD1  . ASN B 2 59  ? 12.827  6.724   7.778   1.00 23.65 ? 198 ASN B OD1  6  
ATOM   10077 N ND2  . ASN B 2 59  ? 12.848  7.528   5.749   1.00 21.55 ? 198 ASN B ND2  6  
ATOM   10078 H H    . ASN B 2 59  ? 12.259  5.941   3.626   1.00 0.00  ? 198 ASN B H    6  
ATOM   10079 H HA   . ASN B 2 59  ? 12.468  3.967   5.866   1.00 0.00  ? 198 ASN B HA   6  
ATOM   10080 H HB2  . ASN B 2 59  ? 10.478  6.243   5.769   1.00 0.00  ? 198 ASN B HB2  6  
ATOM   10081 H HB3  . ASN B 2 59  ? 10.906  5.231   7.149   1.00 0.00  ? 198 ASN B HB3  6  
ATOM   10082 H HD21 . ASN B 2 59  ? 12.489  7.509   4.833   1.00 0.00  ? 198 ASN B HD21 6  
ATOM   10083 H HD22 . ASN B 2 59  ? 13.556  8.167   5.990   1.00 0.00  ? 198 ASN B HD22 6  
ATOM   10084 N N    . VAL B 2 60  ? 9.809   3.358   5.420   1.00 14.62 ? 199 VAL B N    6  
ATOM   10085 C CA   . VAL B 2 60  ? 8.669   2.605   4.827   1.00 11.82 ? 199 VAL B CA   6  
ATOM   10086 C C    . VAL B 2 60  ? 7.379   2.963   5.568   1.00 10.68 ? 199 VAL B C    6  
ATOM   10087 O O    . VAL B 2 60  ? 7.341   3.006   6.782   1.00 13.24 ? 199 VAL B O    6  
ATOM   10088 C CB   . VAL B 2 60  ? 8.926   1.103   4.955   1.00 9.61  ? 199 VAL B CB   6  
ATOM   10089 C CG1  . VAL B 2 60  ? 7.783   0.329   4.296   1.00 11.94 ? 199 VAL B CG1  6  
ATOM   10090 C CG2  . VAL B 2 60  ? 10.244  0.752   4.260   1.00 10.00 ? 199 VAL B CG2  6  
ATOM   10091 H H    . VAL B 2 60  ? 9.886   3.444   6.393   1.00 0.00  ? 199 VAL B H    6  
ATOM   10092 H HA   . VAL B 2 60  ? 8.570   2.865   3.783   1.00 0.00  ? 199 VAL B HA   6  
ATOM   10093 H HB   . VAL B 2 60  ? 8.986   0.836   6.000   1.00 0.00  ? 199 VAL B HB   6  
ATOM   10094 H HG11 . VAL B 2 60  ? 7.423   0.880   3.440   1.00 0.00  ? 199 VAL B HG11 6  
ATOM   10095 H HG12 . VAL B 2 60  ? 8.139   -0.639  3.978   1.00 0.00  ? 199 VAL B HG12 6  
ATOM   10096 H HG13 . VAL B 2 60  ? 6.979   0.202   5.006   1.00 0.00  ? 199 VAL B HG13 6  
ATOM   10097 H HG21 . VAL B 2 60  ? 10.652  1.637   3.796   1.00 0.00  ? 199 VAL B HG21 6  
ATOM   10098 H HG22 . VAL B 2 60  ? 10.945  0.372   4.988   1.00 0.00  ? 199 VAL B HG22 6  
ATOM   10099 H HG23 . VAL B 2 60  ? 10.063  0.000   3.506   1.00 0.00  ? 199 VAL B HG23 6  
ATOM   10100 N N    . LYS B 2 61  ? 6.320   3.219   4.850   1.00 11.30 ? 200 LYS B N    6  
ATOM   10101 C CA   . LYS B 2 61  ? 5.035   3.571   5.517   1.00 11.14 ? 200 LYS B CA   6  
ATOM   10102 C C    . LYS B 2 61  ? 3.966   2.548   5.125   1.00 8.78  ? 200 LYS B C    6  
ATOM   10103 O O    . LYS B 2 61  ? 3.571   2.457   3.981   1.00 9.63  ? 200 LYS B O    6  
ATOM   10104 C CB   . LYS B 2 61  ? 4.594   4.967   5.073   1.00 11.27 ? 200 LYS B CB   6  
ATOM   10105 C CG   . LYS B 2 61  ? 5.174   6.012   6.028   1.00 16.97 ? 200 LYS B CG   6  
ATOM   10106 C CD   . LYS B 2 61  ? 6.280   6.797   5.319   1.00 21.04 ? 200 LYS B CD   6  
ATOM   10107 C CE   . LYS B 2 61  ? 6.791   7.905   6.240   1.00 28.12 ? 200 LYS B CE   6  
ATOM   10108 N NZ   . LYS B 2 61  ? 7.828   7.352   7.157   1.00 32.40 ? 200 LYS B NZ   6  
ATOM   10109 H H    . LYS B 2 61  ? 6.370   3.178   3.871   1.00 0.00  ? 200 LYS B H    6  
ATOM   10110 H HA   . LYS B 2 61  ? 5.169   3.559   6.588   1.00 0.00  ? 200 LYS B HA   6  
ATOM   10111 H HB2  . LYS B 2 61  ? 4.951   5.155   4.070   1.00 0.00  ? 200 LYS B HB2  6  
ATOM   10112 H HB3  . LYS B 2 61  ? 3.517   5.026   5.089   1.00 0.00  ? 200 LYS B HB3  6  
ATOM   10113 H HG2  . LYS B 2 61  ? 4.392   6.690   6.337   1.00 0.00  ? 200 LYS B HG2  6  
ATOM   10114 H HG3  . LYS B 2 61  ? 5.586   5.518   6.896   1.00 0.00  ? 200 LYS B HG3  6  
ATOM   10115 H HD2  . LYS B 2 61  ? 7.093   6.128   5.071   1.00 0.00  ? 200 LYS B HD2  6  
ATOM   10116 H HD3  . LYS B 2 61  ? 5.887   7.235   4.415   1.00 0.00  ? 200 LYS B HD3  6  
ATOM   10117 H HE2  . LYS B 2 61  ? 7.224   8.697   5.646   1.00 0.00  ? 200 LYS B HE2  6  
ATOM   10118 H HE3  . LYS B 2 61  ? 5.970   8.299   6.820   1.00 0.00  ? 200 LYS B HE3  6  
ATOM   10119 H HZ1  . LYS B 2 61  ? 7.533   6.411   7.487   1.00 0.00  ? 200 LYS B HZ1  6  
ATOM   10120 H HZ2  . LYS B 2 61  ? 8.733   7.274   6.650   1.00 0.00  ? 200 LYS B HZ2  6  
ATOM   10121 H HZ3  . LYS B 2 61  ? 7.941   7.983   7.975   1.00 0.00  ? 200 LYS B HZ3  6  
ATOM   10122 N N    . HIS B 2 62  ? 3.499   1.773   6.065   1.00 7.82  ? 201 HIS B N    6  
ATOM   10123 C CA   . HIS B 2 62  ? 2.464   0.750   5.742   1.00 7.41  ? 201 HIS B CA   6  
ATOM   10124 C C    . HIS B 2 62  ? 1.065   1.347   5.923   1.00 9.79  ? 201 HIS B C    6  
ATOM   10125 O O    . HIS B 2 62  ? 0.739   1.889   6.960   1.00 10.36 ? 201 HIS B O    6  
ATOM   10126 C CB   . HIS B 2 62  ? 2.629   -0.451  6.674   1.00 6.15  ? 201 HIS B CB   6  
ATOM   10127 C CG   . HIS B 2 62  ? 3.895   -1.185  6.327   1.00 5.80  ? 201 HIS B CG   6  
ATOM   10128 N ND1  . HIS B 2 62  ? 3.884   -2.445  5.747   1.00 7.97  ? 201 HIS B ND1  6  
ATOM   10129 C CD2  . HIS B 2 62  ? 5.219   -0.851  6.471   1.00 7.69  ? 201 HIS B CD2  6  
ATOM   10130 C CE1  . HIS B 2 62  ? 5.164   -2.818  5.566   1.00 7.75  ? 201 HIS B CE1  6  
ATOM   10131 N NE2  . HIS B 2 62  ? 6.018   -1.883  5.990   1.00 6.51  ? 201 HIS B NE2  6  
ATOM   10132 H H    . HIS B 2 62  ? 3.834   1.858   6.982   1.00 0.00  ? 201 HIS B H    6  
ATOM   10133 H HA   . HIS B 2 62  ? 2.586   0.429   4.718   1.00 0.00  ? 201 HIS B HA   6  
ATOM   10134 H HB2  . HIS B 2 62  ? 2.681   -0.108  7.697   1.00 0.00  ? 201 HIS B HB2  6  
ATOM   10135 H HB3  . HIS B 2 62  ? 1.785   -1.115  6.559   1.00 0.00  ? 201 HIS B HB3  6  
ATOM   10136 H HD1  . HIS B 2 62  ? 3.089   -2.967  5.511   1.00 0.00  ? 201 HIS B HD1  6  
ATOM   10137 H HD2  . HIS B 2 62  ? 5.585   0.073   6.895   1.00 0.00  ? 201 HIS B HD2  6  
ATOM   10138 H HE1  . HIS B 2 62  ? 5.464   -3.761  5.130   1.00 0.00  ? 201 HIS B HE1  6  
ATOM   10139 N N    . TYR B 2 63  ? 0.235   1.238   4.921   1.00 10.61 ? 202 TYR B N    6  
ATOM   10140 C CA   . TYR B 2 63  ? -1.147  1.785   5.029   1.00 10.61 ? 202 TYR B CA   6  
ATOM   10141 C C    . TYR B 2 63  ? -2.147  0.630   4.953   1.00 10.67 ? 202 TYR B C    6  
ATOM   10142 O O    . TYR B 2 63  ? -2.403  0.088   3.896   1.00 11.97 ? 202 TYR B O    6  
ATOM   10143 C CB   . TYR B 2 63  ? -1.403  2.756   3.875   1.00 10.02 ? 202 TYR B CB   6  
ATOM   10144 C CG   . TYR B 2 63  ? -0.878  4.124   4.241   1.00 10.20 ? 202 TYR B CG   6  
ATOM   10145 C CD1  . TYR B 2 63  ? 0.489   4.413   4.095   1.00 9.08  ? 202 TYR B CD1  6  
ATOM   10146 C CD2  . TYR B 2 63  ? -1.757  5.108   4.723   1.00 10.92 ? 202 TYR B CD2  6  
ATOM   10147 C CE1  . TYR B 2 63  ? 0.978   5.686   4.433   1.00 11.32 ? 202 TYR B CE1  6  
ATOM   10148 C CE2  . TYR B 2 63  ? -1.269  6.382   5.061   1.00 11.72 ? 202 TYR B CE2  6  
ATOM   10149 C CZ   . TYR B 2 63  ? 0.098   6.671   4.916   1.00 12.88 ? 202 TYR B CZ   6  
ATOM   10150 O OH   . TYR B 2 63  ? 0.578   7.921   5.246   1.00 13.22 ? 202 TYR B OH   6  
ATOM   10151 H H    . TYR B 2 63  ? 0.518   0.791   4.098   1.00 0.00  ? 202 TYR B H    6  
ATOM   10152 H HA   . TYR B 2 63  ? -1.260  2.302   5.971   1.00 0.00  ? 202 TYR B HA   6  
ATOM   10153 H HB2  . TYR B 2 63  ? -0.899  2.402   2.989   1.00 0.00  ? 202 TYR B HB2  6  
ATOM   10154 H HB3  . TYR B 2 63  ? -2.463  2.817   3.686   1.00 0.00  ? 202 TYR B HB3  6  
ATOM   10155 H HD1  . TYR B 2 63  ? 1.165   3.656   3.725   1.00 0.00  ? 202 TYR B HD1  6  
ATOM   10156 H HD2  . TYR B 2 63  ? -2.809  4.886   4.834   1.00 0.00  ? 202 TYR B HD2  6  
ATOM   10157 H HE1  . TYR B 2 63  ? 2.028   5.909   4.321   1.00 0.00  ? 202 TYR B HE1  6  
ATOM   10158 H HE2  . TYR B 2 63  ? -1.945  7.138   5.431   1.00 0.00  ? 202 TYR B HE2  6  
ATOM   10159 H HH   . TYR B 2 63  ? 1.428   7.808   5.679   1.00 0.00  ? 202 TYR B HH   6  
ATOM   10160 N N    . LYS B 2 64  ? -2.709  0.243   6.065   1.00 11.16 ? 203 LYS B N    6  
ATOM   10161 C CA   . LYS B 2 64  ? -3.685  -0.882  6.054   1.00 13.85 ? 203 LYS B CA   6  
ATOM   10162 C C    . LYS B 2 64  ? -4.889  -0.518  5.182   1.00 13.44 ? 203 LYS B C    6  
ATOM   10163 O O    . LYS B 2 64  ? -5.540  0.486   5.392   1.00 12.80 ? 203 LYS B O    6  
ATOM   10164 C CB   . LYS B 2 64  ? -4.155  -1.162  7.483   1.00 19.04 ? 203 LYS B CB   6  
ATOM   10165 C CG   . LYS B 2 64  ? -4.558  0.152   8.156   1.00 23.92 ? 203 LYS B CG   6  
ATOM   10166 C CD   . LYS B 2 64  ? -5.624  -0.124  9.216   1.00 29.39 ? 203 LYS B CD   6  
ATOM   10167 C CE   . LYS B 2 64  ? -4.948  -0.483  10.541  1.00 31.37 ? 203 LYS B CE   6  
ATOM   10168 N NZ   . LYS B 2 64  ? -5.051  -1.951  10.770  1.00 36.57 ? 203 LYS B NZ   6  
ATOM   10169 H H    . LYS B 2 64  ? -2.485  0.690   6.908   1.00 0.00  ? 203 LYS B H    6  
ATOM   10170 H HA   . LYS B 2 64  ? -3.208  -1.765  5.655   1.00 0.00  ? 203 LYS B HA   6  
ATOM   10171 H HB2  . LYS B 2 64  ? -5.004  -1.830  7.458   1.00 0.00  ? 203 LYS B HB2  6  
ATOM   10172 H HB3  . LYS B 2 64  ? -3.353  -1.619  8.043   1.00 0.00  ? 203 LYS B HB3  6  
ATOM   10173 H HG2  . LYS B 2 64  ? -3.690  0.597   8.622   1.00 0.00  ? 203 LYS B HG2  6  
ATOM   10174 H HG3  . LYS B 2 64  ? -4.956  0.828   7.415   1.00 0.00  ? 203 LYS B HG3  6  
ATOM   10175 H HD2  . LYS B 2 64  ? -6.236  0.757   9.349   1.00 0.00  ? 203 LYS B HD2  6  
ATOM   10176 H HD3  . LYS B 2 64  ? -6.245  -0.948  8.897   1.00 0.00  ? 203 LYS B HD3  6  
ATOM   10177 H HE2  . LYS B 2 64  ? -3.908  -0.196  10.502  1.00 0.00  ? 203 LYS B HE2  6  
ATOM   10178 H HE3  . LYS B 2 64  ? -5.436  0.043   11.348  1.00 0.00  ? 203 LYS B HE3  6  
ATOM   10179 H HZ1  . LYS B 2 64  ? -5.197  -2.436  9.862   1.00 0.00  ? 203 LYS B HZ1  6  
ATOM   10180 H HZ2  . LYS B 2 64  ? -4.172  -2.297  11.207  1.00 0.00  ? 203 LYS B HZ2  6  
ATOM   10181 H HZ3  . LYS B 2 64  ? -5.854  -2.147  11.401  1.00 0.00  ? 203 LYS B HZ3  6  
ATOM   10182 N N    . ILE B 2 65  ? -5.195  -1.336  4.210   1.00 14.05 ? 204 ILE B N    6  
ATOM   10183 C CA   . ILE B 2 65  ? -6.361  -1.049  3.326   1.00 13.51 ? 204 ILE B CA   6  
ATOM   10184 C C    . ILE B 2 65  ? -7.608  -1.688  3.931   1.00 14.04 ? 204 ILE B C    6  
ATOM   10185 O O    . ILE B 2 65  ? -7.713  -2.893  4.041   1.00 15.82 ? 204 ILE B O    6  
ATOM   10186 C CB   . ILE B 2 65  ? -6.105  -1.632  1.936   1.00 12.30 ? 204 ILE B CB   6  
ATOM   10187 C CG1  . ILE B 2 65  ? -4.988  -0.842  1.251   1.00 11.29 ? 204 ILE B CG1  6  
ATOM   10188 C CG2  . ILE B 2 65  ? -7.381  -1.539  1.097   1.00 14.21 ? 204 ILE B CG2  6  
ATOM   10189 C CD1  . ILE B 2 65  ? -4.552  -1.568  -0.023  1.00 13.89 ? 204 ILE B CD1  6  
ATOM   10190 H H    . ILE B 2 65  ? -4.660  -2.144  4.065   1.00 0.00  ? 204 ILE B H    6  
ATOM   10191 H HA   . ILE B 2 65  ? -6.508  0.018   3.250   1.00 0.00  ? 204 ILE B HA   6  
ATOM   10192 H HB   . ILE B 2 65  ? -5.811  -2.668  2.029   1.00 0.00  ? 204 ILE B HB   6  
ATOM   10193 H HG12 . ILE B 2 65  ? -5.349  0.144   0.998   1.00 0.00  ? 204 ILE B HG12 6  
ATOM   10194 H HG13 . ILE B 2 65  ? -4.144  -0.757  1.920   1.00 0.00  ? 204 ILE B HG13 6  
ATOM   10195 H HG21 . ILE B 2 65  ? -7.969  -0.696  1.430   1.00 0.00  ? 204 ILE B HG21 6  
ATOM   10196 H HG22 . ILE B 2 65  ? -7.120  -1.408  0.058   1.00 0.00  ? 204 ILE B HG22 6  
ATOM   10197 H HG23 . ILE B 2 65  ? -7.956  -2.446  1.213   1.00 0.00  ? 204 ILE B HG23 6  
ATOM   10198 H HD11 . ILE B 2 65  ? -5.384  -2.134  -0.416  1.00 0.00  ? 204 ILE B HD11 6  
ATOM   10199 H HD12 . ILE B 2 65  ? -4.230  -0.845  -0.757  1.00 0.00  ? 204 ILE B HD12 6  
ATOM   10200 H HD13 . ILE B 2 65  ? -3.737  -2.237  0.205   1.00 0.00  ? 204 ILE B HD13 6  
ATOM   10201 N N    . ARG B 2 66  ? -8.550  -0.885  4.336   1.00 15.56 ? 205 ARG B N    6  
ATOM   10202 C CA   . ARG B 2 66  ? -9.786  -1.439  4.947   1.00 13.76 ? 205 ARG B CA   6  
ATOM   10203 C C    . ARG B 2 66  ? -10.617 -2.148  3.886   1.00 13.72 ? 205 ARG B C    6  
ATOM   10204 O O    . ARG B 2 66  ? -10.575 -1.819  2.717   1.00 13.25 ? 205 ARG B O    6  
ATOM   10205 C CB   . ARG B 2 66  ? -10.594 -0.303  5.564   1.00 15.23 ? 205 ARG B CB   6  
ATOM   10206 C CG   . ARG B 2 66  ? -9.677  0.496   6.482   1.00 20.69 ? 205 ARG B CG   6  
ATOM   10207 C CD   . ARG B 2 66  ? -10.513 1.348   7.438   1.00 28.70 ? 205 ARG B CD   6  
ATOM   10208 N NE   . ARG B 2 66  ? -9.794  2.621   7.726   1.00 38.45 ? 205 ARG B NE   6  
ATOM   10209 C CZ   . ARG B 2 66  ? -10.025 3.267   8.836   1.00 41.91 ? 205 ARG B CZ   6  
ATOM   10210 N NH1  . ARG B 2 66  ? -11.150 3.089   9.472   1.00 41.78 ? 205 ARG B NH1  6  
ATOM   10211 N NH2  . ARG B 2 66  ? -9.130  4.090   9.310   1.00 44.96 ? 205 ARG B NH2  6  
ATOM   10212 H H    . ARG B 2 66  ? -8.440  0.084   4.245   1.00 0.00  ? 205 ARG B H    6  
ATOM   10213 H HA   . ARG B 2 66  ? -9.517  -2.145  5.718   1.00 0.00  ? 205 ARG B HA   6  
ATOM   10214 H HB2  . ARG B 2 66  ? -10.978 0.337   4.783   1.00 0.00  ? 205 ARG B HB2  6  
ATOM   10215 H HB3  . ARG B 2 66  ? -11.413 -0.708  6.139   1.00 0.00  ? 205 ARG B HB3  6  
ATOM   10216 H HG2  . ARG B 2 66  ? -9.062  -0.188  7.049   1.00 0.00  ? 205 ARG B HG2  6  
ATOM   10217 H HG3  . ARG B 2 66  ? -9.047  1.136   5.885   1.00 0.00  ? 205 ARG B HG3  6  
ATOM   10218 H HD2  . ARG B 2 66  ? -11.466 1.569   6.983   1.00 0.00  ? 205 ARG B HD2  6  
ATOM   10219 H HD3  . ARG B 2 66  ? -10.669 0.808   8.360   1.00 0.00  ? 205 ARG B HD3  6  
ATOM   10220 H HE   . ARG B 2 66  ? -9.147  2.975   7.080   1.00 0.00  ? 205 ARG B HE   6  
ATOM   10221 H HH11 . ARG B 2 66  ? -11.836 2.458   9.109   1.00 0.00  ? 205 ARG B HH11 6  
ATOM   10222 H HH12 . ARG B 2 66  ? -11.326 3.584   10.324  1.00 0.00  ? 205 ARG B HH12 6  
ATOM   10223 H HH21 . ARG B 2 66  ? -8.268  4.227   8.822   1.00 0.00  ? 205 ARG B HH21 6  
ATOM   10224 H HH22 . ARG B 2 66  ? -9.307  4.584   10.161  1.00 0.00  ? 205 ARG B HH22 6  
ATOM   10225 N N    . LYS B 2 67  ? -11.368 -3.125  4.293   1.00 14.89 ? 206 LYS B N    6  
ATOM   10226 C CA   . LYS B 2 67  ? -12.207 -3.877  3.320   1.00 18.13 ? 206 LYS B CA   6  
ATOM   10227 C C    . LYS B 2 67  ? -13.463 -4.405  4.015   1.00 17.74 ? 206 LYS B C    6  
ATOM   10228 O O    . LYS B 2 67  ? -13.447 -5.452  4.633   1.00 18.39 ? 206 LYS B O    6  
ATOM   10229 C CB   . LYS B 2 67  ? -11.404 -5.053  2.764   1.00 21.97 ? 206 LYS B CB   6  
ATOM   10230 C CG   . LYS B 2 67  ? -12.312 -5.937  1.907   1.00 27.97 ? 206 LYS B CG   6  
ATOM   10231 C CD   . LYS B 2 67  ? -11.502 -7.102  1.338   1.00 32.27 ? 206 LYS B CD   6  
ATOM   10232 C CE   . LYS B 2 67  ? -12.228 -7.686  0.125   1.00 33.99 ? 206 LYS B CE   6  
ATOM   10233 N NZ   . LYS B 2 67  ? -13.004 -8.889  0.541   1.00 35.74 ? 206 LYS B NZ   6  
ATOM   10234 H H    . LYS B 2 67  ? -11.376 -3.366  5.241   1.00 0.00  ? 206 LYS B H    6  
ATOM   10235 H HA   . LYS B 2 67  ? -12.492 -3.223  2.510   1.00 0.00  ? 206 LYS B HA   6  
ATOM   10236 H HB2  . LYS B 2 67  ? -10.590 -4.678  2.163   1.00 0.00  ? 206 LYS B HB2  6  
ATOM   10237 H HB3  . LYS B 2 67  ? -11.007 -5.636  3.582   1.00 0.00  ? 206 LYS B HB3  6  
ATOM   10238 H HG2  . LYS B 2 67  ? -13.118 -6.321  2.516   1.00 0.00  ? 206 LYS B HG2  6  
ATOM   10239 H HG3  . LYS B 2 67  ? -12.721 -5.354  1.095   1.00 0.00  ? 206 LYS B HG3  6  
ATOM   10240 H HD2  . LYS B 2 67  ? -10.526 -6.750  1.039   1.00 0.00  ? 206 LYS B HD2  6  
ATOM   10241 H HD3  . LYS B 2 67  ? -11.393 -7.868  2.091   1.00 0.00  ? 206 LYS B HD3  6  
ATOM   10242 H HE2  . LYS B 2 67  ? -12.902 -6.946  -0.283  1.00 0.00  ? 206 LYS B HE2  6  
ATOM   10243 H HE3  . LYS B 2 67  ? -11.505 -7.967  -0.627  1.00 0.00  ? 206 LYS B HE3  6  
ATOM   10244 H HZ1  . LYS B 2 67  ? -12.358 -9.596  0.942   1.00 0.00  ? 206 LYS B HZ1  6  
ATOM   10245 H HZ2  . LYS B 2 67  ? -13.707 -8.618  1.258   1.00 0.00  ? 206 LYS B HZ2  6  
ATOM   10246 H HZ3  . LYS B 2 67  ? -13.489 -9.291  -0.287  1.00 0.00  ? 206 LYS B HZ3  6  
ATOM   10247 N N    . LEU B 2 68  ? -14.553 -3.697  3.914   1.00 17.31 ? 207 LEU B N    6  
ATOM   10248 C CA   . LEU B 2 68  ? -15.806 -4.169  4.562   1.00 19.33 ? 207 LEU B CA   6  
ATOM   10249 C C    . LEU B 2 68  ? -16.317 -5.403  3.820   1.00 21.64 ? 207 LEU B C    6  
ATOM   10250 O O    . LEU B 2 68  ? -16.451 -5.399  2.612   1.00 21.80 ? 207 LEU B O    6  
ATOM   10251 C CB   . LEU B 2 68  ? -16.864 -3.070  4.491   1.00 19.68 ? 207 LEU B CB   6  
ATOM   10252 C CG   . LEU B 2 68  ? -16.335 -1.803  5.157   1.00 19.58 ? 207 LEU B CG   6  
ATOM   10253 C CD1  . LEU B 2 68  ? -16.959 -0.577  4.488   1.00 16.81 ? 207 LEU B CD1  6  
ATOM   10254 C CD2  . LEU B 2 68  ? -16.700 -1.816  6.643   1.00 16.39 ? 207 LEU B CD2  6  
ATOM   10255 H H    . LEU B 2 68  ? -14.550 -2.859  3.408   1.00 0.00  ? 207 LEU B H    6  
ATOM   10256 H HA   . LEU B 2 68  ? -15.610 -4.420  5.594   1.00 0.00  ? 207 LEU B HA   6  
ATOM   10257 H HB2  . LEU B 2 68  ? -17.094 -2.861  3.458   1.00 0.00  ? 207 LEU B HB2  6  
ATOM   10258 H HB3  . LEU B 2 68  ? -17.757 -3.400  5.001   1.00 0.00  ? 207 LEU B HB3  6  
ATOM   10259 H HG   . LEU B 2 68  ? -15.262 -1.766  5.047   1.00 0.00  ? 207 LEU B HG   6  
ATOM   10260 H HD11 . LEU B 2 68  ? -17.564 -0.893  3.651   1.00 0.00  ? 207 LEU B HD11 6  
ATOM   10261 H HD12 . LEU B 2 68  ? -17.575 -0.052  5.201   1.00 0.00  ? 207 LEU B HD12 6  
ATOM   10262 H HD13 . LEU B 2 68  ? -16.175 0.078   4.137   1.00 0.00  ? 207 LEU B HD13 6  
ATOM   10263 H HD21 . LEU B 2 68  ? -16.694 -2.833  7.006   1.00 0.00  ? 207 LEU B HD21 6  
ATOM   10264 H HD22 . LEU B 2 68  ? -15.980 -1.232  7.196   1.00 0.00  ? 207 LEU B HD22 6  
ATOM   10265 H HD23 . LEU B 2 68  ? -17.686 -1.393  6.775   1.00 0.00  ? 207 LEU B HD23 6  
ATOM   10266 N N    . ASP B 2 69  ? -16.607 -6.457  4.527   1.00 24.31 ? 208 ASP B N    6  
ATOM   10267 C CA   . ASP B 2 69  ? -17.113 -7.681  3.849   1.00 27.33 ? 208 ASP B CA   6  
ATOM   10268 C C    . ASP B 2 69  ? -18.377 -7.330  3.068   1.00 28.23 ? 208 ASP B C    6  
ATOM   10269 O O    . ASP B 2 69  ? -18.574 -7.767  1.951   1.00 28.17 ? 208 ASP B O    6  
ATOM   10270 C CB   . ASP B 2 69  ? -17.437 -8.752  4.894   1.00 32.44 ? 208 ASP B CB   6  
ATOM   10271 C CG   . ASP B 2 69  ? -16.139 -9.389  5.393   1.00 36.84 ? 208 ASP B CG   6  
ATOM   10272 O OD1  . ASP B 2 69  ? -15.107 -9.132  4.794   1.00 40.11 ? 208 ASP B OD1  6  
ATOM   10273 O OD2  . ASP B 2 69  ? -16.198 -10.124 6.365   1.00 41.58 ? 208 ASP B OD2  6  
ATOM   10274 H H    . ASP B 2 69  ? -16.498 -6.441  5.501   1.00 0.00  ? 208 ASP B H    6  
ATOM   10275 H HA   . ASP B 2 69  ? -16.361 -8.052  3.171   1.00 0.00  ? 208 ASP B HA   6  
ATOM   10276 H HB2  . ASP B 2 69  ? -17.958 -8.298  5.725   1.00 0.00  ? 208 ASP B HB2  6  
ATOM   10277 H HB3  . ASP B 2 69  ? -18.060 -9.512  4.449   1.00 0.00  ? 208 ASP B HB3  6  
ATOM   10278 N N    . SER B 2 70  ? -19.236 -6.544  3.651   1.00 30.57 ? 209 SER B N    6  
ATOM   10279 C CA   . SER B 2 70  ? -20.486 -6.158  2.970   1.00 30.81 ? 209 SER B CA   6  
ATOM   10280 C C    . SER B 2 70  ? -20.319 -4.784  2.312   1.00 31.86 ? 209 SER B C    6  
ATOM   10281 O O    . SER B 2 70  ? -21.187 -4.319  1.602   1.00 34.96 ? 209 SER B O    6  
ATOM   10282 C CB   . SER B 2 70  ? -21.587 -6.090  4.017   1.00 29.35 ? 209 SER B CB   6  
ATOM   10283 O OG   . SER B 2 70  ? -21.041 -5.612  5.239   1.00 27.77 ? 209 SER B OG   6  
ATOM   10284 H H    . SER B 2 70  ? -19.064 -6.210  4.549   1.00 0.00  ? 209 SER B H    6  
ATOM   10285 H HA   . SER B 2 70  ? -20.740 -6.894  2.226   1.00 0.00  ? 209 SER B HA   6  
ATOM   10286 H HB2  . SER B 2 70  ? -22.349 -5.420  3.687   1.00 0.00  ? 209 SER B HB2  6  
ATOM   10287 H HB3  . SER B 2 70  ? -22.004 -7.075  4.160   1.00 0.00  ? 209 SER B HB3  6  
ATOM   10288 H HG   . SER B 2 70  ? -21.082 -6.325  5.881   1.00 0.00  ? 209 SER B HG   6  
ATOM   10289 N N    . GLY B 2 71  ? -19.214 -4.126  2.549   1.00 31.91 ? 210 GLY B N    6  
ATOM   10290 C CA   . GLY B 2 71  ? -19.007 -2.781  1.941   1.00 30.37 ? 210 GLY B CA   6  
ATOM   10291 C C    . GLY B 2 71  ? -17.931 -2.857  0.855   1.00 29.39 ? 210 GLY B C    6  
ATOM   10292 O O    . GLY B 2 71  ? -17.953 -3.722  0.004   1.00 32.51 ? 210 GLY B O    6  
ATOM   10293 H H    . GLY B 2 71  ? -18.526 -4.513  3.129   1.00 0.00  ? 210 GLY B H    6  
ATOM   10294 H HA2  . GLY B 2 71  ? -19.935 -2.439  1.505   1.00 0.00  ? 210 GLY B HA2  6  
ATOM   10295 H HA3  . GLY B 2 71  ? -18.692 -2.088  2.706   1.00 0.00  ? 210 GLY B HA3  6  
ATOM   10296 N N    . GLY B 2 72  ? -16.992 -1.949  0.878   1.00 27.09 ? 211 GLY B N    6  
ATOM   10297 C CA   . GLY B 2 72  ? -15.916 -1.957  -0.154  1.00 22.75 ? 211 GLY B CA   6  
ATOM   10298 C C    . GLY B 2 72  ? -14.551 -1.837  0.519   1.00 20.54 ? 211 GLY B C    6  
ATOM   10299 O O    . GLY B 2 72  ? -14.173 -2.654  1.333   1.00 21.66 ? 211 GLY B O    6  
ATOM   10300 H H    . GLY B 2 72  ? -16.998 -1.257  1.572   1.00 0.00  ? 211 GLY B H    6  
ATOM   10301 H HA2  . GLY B 2 72  ? -15.961 -2.877  -0.717  1.00 0.00  ? 211 GLY B HA2  6  
ATOM   10302 H HA3  . GLY B 2 72  ? -16.056 -1.122  -0.822  1.00 0.00  ? 211 GLY B HA3  6  
ATOM   10303 N N    . PHE B 2 73  ? -13.808 -0.820  0.184   1.00 18.17 ? 212 PHE B N    6  
ATOM   10304 C CA   . PHE B 2 73  ? -12.463 -0.636  0.801   1.00 17.54 ? 212 PHE B CA   6  
ATOM   10305 C C    . PHE B 2 73  ? -12.273 0.841   1.149   1.00 15.84 ? 212 PHE B C    6  
ATOM   10306 O O    . PHE B 2 73  ? -12.909 1.704   0.579   1.00 18.26 ? 212 PHE B O    6  
ATOM   10307 C CB   . PHE B 2 73  ? -11.381 -1.070  -0.191  1.00 16.88 ? 212 PHE B CB   6  
ATOM   10308 C CG   . PHE B 2 73  ? -11.757 -2.400  -0.795  1.00 18.16 ? 212 PHE B CG   6  
ATOM   10309 C CD1  . PHE B 2 73  ? -12.736 -2.461  -1.801  1.00 18.25 ? 212 PHE B CD1  6  
ATOM   10310 C CD2  . PHE B 2 73  ? -11.129 -3.576  -0.353  1.00 18.64 ? 212 PHE B CD2  6  
ATOM   10311 C CE1  . PHE B 2 73  ? -13.088 -3.699  -2.364  1.00 18.17 ? 212 PHE B CE1  6  
ATOM   10312 C CE2  . PHE B 2 73  ? -11.481 -4.815  -0.917  1.00 19.59 ? 212 PHE B CE2  6  
ATOM   10313 C CZ   . PHE B 2 73  ? -12.460 -4.876  -1.922  1.00 18.19 ? 212 PHE B CZ   6  
ATOM   10314 H H    . PHE B 2 73  ? -14.137 -0.175  -0.477  1.00 0.00  ? 212 PHE B H    6  
ATOM   10315 H HA   . PHE B 2 73  ? -12.392 -1.231  1.699   1.00 0.00  ? 212 PHE B HA   6  
ATOM   10316 H HB2  . PHE B 2 73  ? -11.292 -0.331  -0.973  1.00 0.00  ? 212 PHE B HB2  6  
ATOM   10317 H HB3  . PHE B 2 73  ? -10.437 -1.164  0.326   1.00 0.00  ? 212 PHE B HB3  6  
ATOM   10318 H HD1  . PHE B 2 73  ? -13.218 -1.557  -2.141  1.00 0.00  ? 212 PHE B HD1  6  
ATOM   10319 H HD2  . PHE B 2 73  ? -10.377 -3.529  0.420   1.00 0.00  ? 212 PHE B HD2  6  
ATOM   10320 H HE1  . PHE B 2 73  ? -13.840 -3.746  -3.138  1.00 0.00  ? 212 PHE B HE1  6  
ATOM   10321 H HE2  . PHE B 2 73  ? -10.998 -5.719  -0.577  1.00 0.00  ? 212 PHE B HE2  6  
ATOM   10322 H HZ   . PHE B 2 73  ? -12.730 -5.827  -2.356  1.00 0.00  ? 212 PHE B HZ   6  
ATOM   10323 N N    . TYR B 2 74  ? -11.406 1.144   2.077   1.00 14.56 ? 213 TYR B N    6  
ATOM   10324 C CA   . TYR B 2 74  ? -11.192 2.570   2.445   1.00 12.35 ? 213 TYR B CA   6  
ATOM   10325 C C    . TYR B 2 74  ? -10.145 2.667   3.556   1.00 12.92 ? 213 TYR B C    6  
ATOM   10326 O O    . TYR B 2 74  ? -10.418 2.401   4.709   1.00 12.14 ? 213 TYR B O    6  
ATOM   10327 C CB   . TYR B 2 74  ? -12.513 3.185   2.926   1.00 12.55 ? 213 TYR B CB   6  
ATOM   10328 C CG   . TYR B 2 74  ? -12.959 2.522   4.210   1.00 14.01 ? 213 TYR B CG   6  
ATOM   10329 C CD1  . TYR B 2 74  ? -13.235 1.144   4.236   1.00 13.18 ? 213 TYR B CD1  6  
ATOM   10330 C CD2  . TYR B 2 74  ? -13.100 3.288   5.380   1.00 13.49 ? 213 TYR B CD2  6  
ATOM   10331 C CE1  . TYR B 2 74  ? -13.650 0.533   5.432   1.00 14.46 ? 213 TYR B CE1  6  
ATOM   10332 C CE2  . TYR B 2 74  ? -13.515 2.678   6.574   1.00 13.06 ? 213 TYR B CE2  6  
ATOM   10333 C CZ   . TYR B 2 74  ? -13.790 1.300   6.601   1.00 15.80 ? 213 TYR B CZ   6  
ATOM   10334 O OH   . TYR B 2 74  ? -14.198 0.699   7.774   1.00 18.90 ? 213 TYR B OH   6  
ATOM   10335 H H    . TYR B 2 74  ? -10.896 0.436   2.528   1.00 0.00  ? 213 TYR B H    6  
ATOM   10336 H HA   . TYR B 2 74  ? -10.843 3.113   1.580   1.00 0.00  ? 213 TYR B HA   6  
ATOM   10337 H HB2  . TYR B 2 74  ? -12.374 4.242   3.100   1.00 0.00  ? 213 TYR B HB2  6  
ATOM   10338 H HB3  . TYR B 2 74  ? -13.271 3.046   2.170   1.00 0.00  ? 213 TYR B HB3  6  
ATOM   10339 H HD1  . TYR B 2 74  ? -13.129 0.554   3.339   1.00 0.00  ? 213 TYR B HD1  6  
ATOM   10340 H HD2  . TYR B 2 74  ? -12.889 4.345   5.361   1.00 0.00  ? 213 TYR B HD2  6  
ATOM   10341 H HE1  . TYR B 2 74  ? -13.861 -0.524  5.452   1.00 0.00  ? 213 TYR B HE1  6  
ATOM   10342 H HE2  . TYR B 2 74  ? -13.621 3.268   7.474   1.00 0.00  ? 213 TYR B HE2  6  
ATOM   10343 H HH   . TYR B 2 74  ? -13.815 1.187   8.507   1.00 0.00  ? 213 TYR B HH   6  
ATOM   10344 N N    . ILE B 2 75  ? -8.946  3.053   3.217   1.00 13.74 ? 214 ILE B N    6  
ATOM   10345 C CA   . ILE B 2 75  ? -7.884  3.174   4.251   1.00 13.80 ? 214 ILE B CA   6  
ATOM   10346 C C    . ILE B 2 75  ? -8.286  4.261   5.254   1.00 14.16 ? 214 ILE B C    6  
ATOM   10347 O O    . ILE B 2 75  ? -7.720  4.372   6.324   1.00 12.50 ? 214 ILE B O    6  
ATOM   10348 C CB   . ILE B 2 75  ? -6.560  3.540   3.571   1.00 10.15 ? 214 ILE B CB   6  
ATOM   10349 C CG1  . ILE B 2 75  ? -5.991  2.296   2.890   1.00 9.57  ? 214 ILE B CG1  6  
ATOM   10350 C CG2  . ILE B 2 75  ? -5.555  4.048   4.609   1.00 8.37  ? 214 ILE B CG2  6  
ATOM   10351 C CD1  . ILE B 2 75  ? -4.968  2.714   1.832   1.00 7.18  ? 214 ILE B CD1  6  
ATOM   10352 H H    . ILE B 2 75  ? -8.747  3.267   2.281   1.00 0.00  ? 214 ILE B H    6  
ATOM   10353 H HA   . ILE B 2 75  ? -7.776  2.231   4.768   1.00 0.00  ? 214 ILE B HA   6  
ATOM   10354 H HB   . ILE B 2 75  ? -6.735  4.307   2.829   1.00 0.00  ? 214 ILE B HB   6  
ATOM   10355 H HG12 . ILE B 2 75  ? -5.513  1.669   3.630   1.00 0.00  ? 214 ILE B HG12 6  
ATOM   10356 H HG13 . ILE B 2 75  ? -6.793  1.746   2.418   1.00 0.00  ? 214 ILE B HG13 6  
ATOM   10357 H HG21 . ILE B 2 75  ? -5.982  4.882   5.147   1.00 0.00  ? 214 ILE B HG21 6  
ATOM   10358 H HG22 . ILE B 2 75  ? -5.320  3.254   5.303   1.00 0.00  ? 214 ILE B HG22 6  
ATOM   10359 H HG23 . ILE B 2 75  ? -4.652  4.368   4.110   1.00 0.00  ? 214 ILE B HG23 6  
ATOM   10360 H HD11 . ILE B 2 75  ? -5.216  3.696   1.462   1.00 0.00  ? 214 ILE B HD11 6  
ATOM   10361 H HD12 . ILE B 2 75  ? -3.982  2.733   2.273   1.00 0.00  ? 214 ILE B HD12 6  
ATOM   10362 H HD13 . ILE B 2 75  ? -4.984  2.006   1.017   1.00 0.00  ? 214 ILE B HD13 6  
ATOM   10363 N N    . THR B 2 76  ? -9.264  5.059   4.919   1.00 15.77 ? 215 THR B N    6  
ATOM   10364 C CA   . THR B 2 76  ? -9.709  6.130   5.852   1.00 18.20 ? 215 THR B CA   6  
ATOM   10365 C C    . THR B 2 76  ? -11.204 6.380   5.655   1.00 17.81 ? 215 THR B C    6  
ATOM   10366 O O    . THR B 2 76  ? -11.779 5.997   4.655   1.00 15.56 ? 215 THR B O    6  
ATOM   10367 C CB   . THR B 2 76  ? -8.930  7.417   5.563   1.00 20.21 ? 215 THR B CB   6  
ATOM   10368 O OG1  . THR B 2 76  ? -9.317  8.420   6.492   1.00 26.81 ? 215 THR B OG1  6  
ATOM   10369 C CG2  . THR B 2 76  ? -9.233  7.890   4.141   1.00 22.31 ? 215 THR B CG2  6  
ATOM   10370 H H    . THR B 2 76  ? -9.711  4.950   4.054   1.00 0.00  ? 215 THR B H    6  
ATOM   10371 H HA   . THR B 2 76  ? -9.528  5.818   6.870   1.00 0.00  ? 215 THR B HA   6  
ATOM   10372 H HB   . THR B 2 76  ? -7.872  7.227   5.657   1.00 0.00  ? 215 THR B HB   6  
ATOM   10373 H HG1  . THR B 2 76  ? -8.519  8.803   6.864   1.00 0.00  ? 215 THR B HG1  6  
ATOM   10374 H HG21 . THR B 2 76  ? -10.133 7.410   3.785   1.00 0.00  ? 215 THR B HG21 6  
ATOM   10375 H HG22 . THR B 2 76  ? -9.373  8.961   4.142   1.00 0.00  ? 215 THR B HG22 6  
ATOM   10376 H HG23 . THR B 2 76  ? -8.407  7.636   3.494   1.00 0.00  ? 215 THR B HG23 6  
ATOM   10377 N N    . SER B 2 77  ? -11.841 7.017   6.599   1.00 18.97 ? 216 SER B N    6  
ATOM   10378 C CA   . SER B 2 77  ? -13.302 7.284   6.466   1.00 18.71 ? 216 SER B CA   6  
ATOM   10379 C C    . SER B 2 77  ? -13.522 8.570   5.665   1.00 18.69 ? 216 SER B C    6  
ATOM   10380 O O    . SER B 2 77  ? -14.314 9.414   6.037   1.00 20.53 ? 216 SER B O    6  
ATOM   10381 C CB   . SER B 2 77  ? -13.919 7.437   7.855   1.00 20.19 ? 216 SER B CB   6  
ATOM   10382 O OG   . SER B 2 77  ? -13.377 6.448   8.722   1.00 22.41 ? 216 SER B OG   6  
ATOM   10383 H H    . SER B 2 77  ? -11.360 7.315   7.399   1.00 0.00  ? 216 SER B H    6  
ATOM   10384 H HA   . SER B 2 77  ? -13.772 6.457   5.953   1.00 0.00  ? 216 SER B HA   6  
ATOM   10385 H HB2  . SER B 2 77  ? -13.694 8.414   8.247   1.00 0.00  ? 216 SER B HB2  6  
ATOM   10386 H HB3  . SER B 2 77  ? -14.993 7.319   7.785   1.00 0.00  ? 216 SER B HB3  6  
ATOM   10387 H HG   . SER B 2 77  ? -13.032 6.894   9.500   1.00 0.00  ? 216 SER B HG   6  
ATOM   10388 N N    . ARG B 2 78  ? -12.834 8.726   4.567   1.00 0.00  ? 217 ARG B N    6  
ATOM   10389 C CA   . ARG B 2 78  ? -13.011 9.957   3.746   1.00 0.00  ? 217 ARG B CA   6  
ATOM   10390 C C    . ARG B 2 78  ? -13.455 9.570   2.333   1.00 0.00  ? 217 ARG B C    6  
ATOM   10391 O O    . ARG B 2 78  ? -14.109 10.332  1.649   1.00 0.00  ? 217 ARG B O    6  
ATOM   10392 C CB   . ARG B 2 78  ? -11.687 10.720  3.676   1.00 0.00  ? 217 ARG B CB   6  
ATOM   10393 C CG   . ARG B 2 78  ? -11.513 11.558  4.945   1.00 0.00  ? 217 ARG B CG   6  
ATOM   10394 C CD   . ARG B 2 78  ? -12.681 12.538  5.076   1.00 0.00  ? 217 ARG B CD   6  
ATOM   10395 N NE   . ARG B 2 78  ? -12.322 13.611  6.044   1.00 0.00  ? 217 ARG B NE   6  
ATOM   10396 C CZ   . ARG B 2 78  ? -13.217 14.489  6.406   1.00 0.00  ? 217 ARG B CZ   6  
ATOM   10397 N NH1  . ARG B 2 78  ? -14.345 14.093  6.931   1.00 0.00  ? 217 ARG B NH1  6  
ATOM   10398 N NH2  . ARG B 2 78  ? -12.985 15.763  6.244   1.00 0.00  ? 217 ARG B NH2  6  
ATOM   10399 H H    . ARG B 2 78  ? -12.203 8.036   4.282   1.00 0.00  ? 217 ARG B H    6  
ATOM   10400 H HA   . ARG B 2 78  ? -13.765 10.585  4.199   1.00 0.00  ? 217 ARG B HA   6  
ATOM   10401 H HB2  . ARG B 2 78  ? -10.870 10.017  3.593   1.00 0.00  ? 217 ARG B HB2  6  
ATOM   10402 H HB3  . ARG B 2 78  ? -11.691 11.371  2.815   1.00 0.00  ? 217 ARG B HB3  6  
ATOM   10403 H HG2  . ARG B 2 78  ? -11.490 10.907  5.806   1.00 0.00  ? 217 ARG B HG2  6  
ATOM   10404 H HG3  . ARG B 2 78  ? -10.587 12.112  4.887   1.00 0.00  ? 217 ARG B HG3  6  
ATOM   10405 H HD2  . ARG B 2 78  ? -12.891 12.978  4.111   1.00 0.00  ? 217 ARG B HD2  6  
ATOM   10406 H HD3  . ARG B 2 78  ? -13.555 12.011  5.429   1.00 0.00  ? 217 ARG B HD3  6  
ATOM   10407 H HE   . ARG B 2 78  ? -11.414 13.659  6.409   1.00 0.00  ? 217 ARG B HE   6  
ATOM   10408 H HH11 . ARG B 2 78  ? -14.524 13.117  7.054   1.00 0.00  ? 217 ARG B HH11 6  
ATOM   10409 H HH12 . ARG B 2 78  ? -15.031 14.766  7.207   1.00 0.00  ? 217 ARG B HH12 6  
ATOM   10410 H HH21 . ARG B 2 78  ? -12.121 16.067  5.843   1.00 0.00  ? 217 ARG B HH21 6  
ATOM   10411 H HH22 . ARG B 2 78  ? -13.670 16.436  6.521   1.00 0.00  ? 217 ARG B HH22 6  
ATOM   10412 N N    . THR B 2 79  ? -13.106 8.392   1.888   1.00 23.45 ? 218 THR B N    6  
ATOM   10413 C CA   . THR B 2 79  ? -13.509 7.964   0.519   1.00 23.59 ? 218 THR B CA   6  
ATOM   10414 C C    . THR B 2 79  ? -13.674 6.441   0.485   1.00 19.84 ? 218 THR B C    6  
ATOM   10415 O O    . THR B 2 79  ? -12.931 5.713   1.113   1.00 20.24 ? 218 THR B O    6  
ATOM   10416 C CB   . THR B 2 79  ? -12.434 8.383   -0.486  1.00 26.45 ? 218 THR B CB   6  
ATOM   10417 O OG1  . THR B 2 79  ? -12.309 9.798   -0.480  1.00 30.31 ? 218 THR B OG1  6  
ATOM   10418 C CG2  . THR B 2 79  ? -12.828 7.907   -1.885  1.00 27.38 ? 218 THR B CG2  6  
ATOM   10419 H H    . THR B 2 79  ? -12.578 7.792   2.454   1.00 0.00  ? 218 THR B H    6  
ATOM   10420 H HA   . THR B 2 79  ? -14.447 8.432   0.258   1.00 0.00  ? 218 THR B HA   6  
ATOM   10421 H HB   . THR B 2 79  ? -11.491 7.937   -0.210  1.00 0.00  ? 218 THR B HB   6  
ATOM   10422 H HG1  . THR B 2 79  ? -13.192 10.174  -0.435  1.00 0.00  ? 218 THR B HG1  6  
ATOM   10423 H HG21 . THR B 2 79  ? -13.066 6.855   -1.853  1.00 0.00  ? 218 THR B HG21 6  
ATOM   10424 H HG22 . THR B 2 79  ? -13.690 8.462   -2.224  1.00 0.00  ? 218 THR B HG22 6  
ATOM   10425 H HG23 . THR B 2 79  ? -12.004 8.070   -2.565  1.00 0.00  ? 218 THR B HG23 6  
ATOM   10426 N N    . GLN B 2 80  ? -14.641 5.958   -0.246  1.00 18.30 ? 219 GLN B N    6  
ATOM   10427 C CA   . GLN B 2 80  ? -14.853 4.483   -0.325  1.00 20.11 ? 219 GLN B CA   6  
ATOM   10428 C C    . GLN B 2 80  ? -14.584 4.009   -1.755  1.00 19.45 ? 219 GLN B C    6  
ATOM   10429 O O    . GLN B 2 80  ? -14.739 4.751   -2.704  1.00 20.30 ? 219 GLN B O    6  
ATOM   10430 C CB   . GLN B 2 80  ? -16.298 4.157   0.058   1.00 20.56 ? 219 GLN B CB   6  
ATOM   10431 C CG   . GLN B 2 80  ? -16.592 4.704   1.456   1.00 23.60 ? 219 GLN B CG   6  
ATOM   10432 C CD   . GLN B 2 80  ? -17.784 3.957   2.056   1.00 19.08 ? 219 GLN B CD   6  
ATOM   10433 O OE1  . GLN B 2 80  ? -17.674 2.802   2.417   1.00 17.99 ? 219 GLN B OE1  6  
ATOM   10434 N NE2  . GLN B 2 80  ? -18.929 4.572   2.179   1.00 17.08 ? 219 GLN B NE2  6  
ATOM   10435 H H    . GLN B 2 80  ? -15.226 6.563   -0.745  1.00 0.00  ? 219 GLN B H    6  
ATOM   10436 H HA   . GLN B 2 80  ? -14.179 3.982   0.353   1.00 0.00  ? 219 GLN B HA   6  
ATOM   10437 H HB2  . GLN B 2 80  ? -16.971 4.611   -0.656  1.00 0.00  ? 219 GLN B HB2  6  
ATOM   10438 H HB3  . GLN B 2 80  ? -16.438 3.087   0.055   1.00 0.00  ? 219 GLN B HB3  6  
ATOM   10439 H HG2  . GLN B 2 80  ? -15.725 4.565   2.086   1.00 0.00  ? 219 GLN B HG2  6  
ATOM   10440 H HG3  . GLN B 2 80  ? -16.826 5.756   1.389   1.00 0.00  ? 219 GLN B HG3  6  
ATOM   10441 H HE21 . GLN B 2 80  ? -19.017 5.508   1.887   1.00 0.00  ? 219 GLN B HE21 6  
ATOM   10442 H HE22 . GLN B 2 80  ? -19.701 4.099   2.564   1.00 0.00  ? 219 GLN B HE22 6  
ATOM   10443 N N    . PHE B 2 81  ? -14.181 2.780   -1.916  1.00 18.96 ? 220 PHE B N    6  
ATOM   10444 C CA   . PHE B 2 81  ? -13.902 2.260   -3.283  1.00 17.73 ? 220 PHE B CA   6  
ATOM   10445 C C    . PHE B 2 81  ? -14.647 0.942   -3.490  1.00 17.76 ? 220 PHE B C    6  
ATOM   10446 O O    . PHE B 2 81  ? -15.038 0.283   -2.547  1.00 19.11 ? 220 PHE B O    6  
ATOM   10447 C CB   . PHE B 2 81  ? -12.398 2.029   -3.443  1.00 14.17 ? 220 PHE B CB   6  
ATOM   10448 C CG   . PHE B 2 81  ? -11.667 3.337   -3.250  1.00 14.07 ? 220 PHE B CG   6  
ATOM   10449 C CD1  . PHE B 2 81  ? -11.922 4.418   -4.109  1.00 14.01 ? 220 PHE B CD1  6  
ATOM   10450 C CD2  . PHE B 2 81  ? -10.731 3.471   -2.210  1.00 12.87 ? 220 PHE B CD2  6  
ATOM   10451 C CE1  . PHE B 2 81  ? -11.243 5.634   -3.929  1.00 11.11 ? 220 PHE B CE1  6  
ATOM   10452 C CE2  . PHE B 2 81  ? -10.051 4.688   -2.031  1.00 13.31 ? 220 PHE B CE2  6  
ATOM   10453 C CZ   . PHE B 2 81  ? -10.308 5.769   -2.889  1.00 13.09 ? 220 PHE B CZ   6  
ATOM   10454 H H    . PHE B 2 81  ? -14.062 2.197   -1.137  1.00 0.00  ? 220 PHE B H    6  
ATOM   10455 H HA   . PHE B 2 81  ? -14.235 2.981   -4.016  1.00 0.00  ? 220 PHE B HA   6  
ATOM   10456 H HB2  . PHE B 2 81  ? -12.063 1.316   -2.705  1.00 0.00  ? 220 PHE B HB2  6  
ATOM   10457 H HB3  . PHE B 2 81  ? -12.195 1.647   -4.432  1.00 0.00  ? 220 PHE B HB3  6  
ATOM   10458 H HD1  . PHE B 2 81  ? -12.642 4.315   -4.908  1.00 0.00  ? 220 PHE B HD1  6  
ATOM   10459 H HD2  . PHE B 2 81  ? -10.534 2.639   -1.550  1.00 0.00  ? 220 PHE B HD2  6  
ATOM   10460 H HE1  . PHE B 2 81  ? -11.440 6.466   -4.590  1.00 0.00  ? 220 PHE B HE1  6  
ATOM   10461 H HE2  . PHE B 2 81  ? -9.332  4.791   -1.231  1.00 0.00  ? 220 PHE B HE2  6  
ATOM   10462 H HZ   . PHE B 2 81  ? -9.785  6.704   -2.752  1.00 0.00  ? 220 PHE B HZ   6  
ATOM   10463 N N    . ASN B 2 82  ? -14.849 0.551   -4.719  1.00 20.00 ? 221 ASN B N    6  
ATOM   10464 C CA   . ASN B 2 82  ? -15.571 -0.724  -4.987  1.00 21.48 ? 221 ASN B CA   6  
ATOM   10465 C C    . ASN B 2 82  ? -14.561 -1.847  -5.239  1.00 22.18 ? 221 ASN B C    6  
ATOM   10466 O O    . ASN B 2 82  ? -14.920 -2.934  -5.647  1.00 24.56 ? 221 ASN B O    6  
ATOM   10467 C CB   . ASN B 2 82  ? -16.461 -0.554  -6.221  1.00 26.12 ? 221 ASN B CB   6  
ATOM   10468 C CG   . ASN B 2 82  ? -17.425 -1.737  -6.322  1.00 28.62 ? 221 ASN B CG   6  
ATOM   10469 O OD1  . ASN B 2 82  ? -17.049 -2.807  -6.760  1.00 32.09 ? 221 ASN B OD1  6  
ATOM   10470 N ND2  . ASN B 2 82  ? -18.662 -1.591  -5.931  1.00 31.44 ? 221 ASN B ND2  6  
ATOM   10471 H H    . ASN B 2 82  ? -14.526 1.097   -5.465  1.00 0.00  ? 221 ASN B H    6  
ATOM   10472 H HA   . ASN B 2 82  ? -16.184 -0.976  -4.135  1.00 0.00  ? 221 ASN B HA   6  
ATOM   10473 H HB2  . ASN B 2 82  ? -17.023 0.364   -6.135  1.00 0.00  ? 221 ASN B HB2  6  
ATOM   10474 H HB3  . ASN B 2 82  ? -15.845 -0.518  -7.107  1.00 0.00  ? 221 ASN B HB3  6  
ATOM   10475 H HD21 . ASN B 2 82  ? -18.965 -0.725  -5.577  1.00 0.00  ? 221 ASN B HD21 6  
ATOM   10476 H HD22 . ASN B 2 82  ? -19.289 -2.347  -5.994  1.00 0.00  ? 221 ASN B HD22 6  
ATOM   10477 N N    . SER B 2 83  ? -13.302 -1.599  -4.999  1.00 20.04 ? 222 SER B N    6  
ATOM   10478 C CA   . SER B 2 83  ? -12.282 -2.660  -5.229  1.00 17.84 ? 222 SER B CA   6  
ATOM   10479 C C    . SER B 2 83  ? -10.907 -2.151  -4.794  1.00 17.08 ? 222 SER B C    6  
ATOM   10480 O O    . SER B 2 83  ? -10.595 -0.983  -4.928  1.00 17.94 ? 222 SER B O    6  
ATOM   10481 C CB   . SER B 2 83  ? -12.245 -3.017  -6.716  1.00 15.42 ? 222 SER B CB   6  
ATOM   10482 O OG   . SER B 2 83  ? -12.023 -1.837  -7.477  1.00 19.15 ? 222 SER B OG   6  
ATOM   10483 H H    . SER B 2 83  ? -13.027 -0.718  -4.670  1.00 0.00  ? 222 SER B H    6  
ATOM   10484 H HA   . SER B 2 83  ? -12.539 -3.537  -4.656  1.00 0.00  ? 222 SER B HA   6  
ATOM   10485 H HB2  . SER B 2 83  ? -11.446 -3.715  -6.901  1.00 0.00  ? 222 SER B HB2  6  
ATOM   10486 H HB3  . SER B 2 83  ? -13.187 -3.469  -6.998  1.00 0.00  ? 222 SER B HB3  6  
ATOM   10487 H HG   . SER B 2 83  ? -12.531 -1.908  -8.288  1.00 0.00  ? 222 SER B HG   6  
ATOM   10488 N N    . LEU B 2 84  ? -10.080 -3.017  -4.275  1.00 17.11 ? 223 LEU B N    6  
ATOM   10489 C CA   . LEU B 2 84  ? -8.725  -2.579  -3.838  1.00 16.96 ? 223 LEU B CA   6  
ATOM   10490 C C    . LEU B 2 84  ? -8.044  -1.835  -4.986  1.00 17.05 ? 223 LEU B C    6  
ATOM   10491 O O    . LEU B 2 84  ? -7.312  -0.886  -4.780  1.00 18.74 ? 223 LEU B O    6  
ATOM   10492 C CB   . LEU B 2 84  ? -7.892  -3.804  -3.455  1.00 15.68 ? 223 LEU B CB   6  
ATOM   10493 C CG   . LEU B 2 84  ? -8.350  -4.328  -2.092  1.00 18.50 ? 223 LEU B CG   6  
ATOM   10494 C CD1  . LEU B 2 84  ? -7.846  -5.760  -1.899  1.00 17.89 ? 223 LEU B CD1  6  
ATOM   10495 C CD2  . LEU B 2 84  ? -7.781  -3.435  -0.987  1.00 17.50 ? 223 LEU B CD2  6  
ATOM   10496 H H    . LEU B 2 84  ? -10.348 -3.954  -4.177  1.00 0.00  ? 223 LEU B H    6  
ATOM   10497 H HA   . LEU B 2 84  ? -8.816  -1.922  -2.984  1.00 0.00  ? 223 LEU B HA   6  
ATOM   10498 H HB2  . LEU B 2 84  ? -8.023  -4.576  -4.201  1.00 0.00  ? 223 LEU B HB2  6  
ATOM   10499 H HB3  . LEU B 2 84  ? -6.851  -3.530  -3.401  1.00 0.00  ? 223 LEU B HB3  6  
ATOM   10500 H HG   . LEU B 2 84  ? -9.429  -4.318  -2.048  1.00 0.00  ? 223 LEU B HG   6  
ATOM   10501 H HD11 . LEU B 2 84  ? -7.502  -6.151  -2.845  1.00 0.00  ? 223 LEU B HD11 6  
ATOM   10502 H HD12 . LEU B 2 84  ? -7.031  -5.762  -1.191  1.00 0.00  ? 223 LEU B HD12 6  
ATOM   10503 H HD13 . LEU B 2 84  ? -8.650  -6.377  -1.526  1.00 0.00  ? 223 LEU B HD13 6  
ATOM   10504 H HD21 . LEU B 2 84  ? -7.004  -2.807  -1.396  1.00 0.00  ? 223 LEU B HD21 6  
ATOM   10505 H HD22 . LEU B 2 84  ? -8.570  -2.816  -0.584  1.00 0.00  ? 223 LEU B HD22 6  
ATOM   10506 H HD23 . LEU B 2 84  ? -7.371  -4.053  -0.202  1.00 0.00  ? 223 LEU B HD23 6  
ATOM   10507 N N    . GLN B 2 85  ? -8.282  -2.256  -6.197  1.00 17.04 ? 224 GLN B N    6  
ATOM   10508 C CA   . GLN B 2 85  ? -7.653  -1.572  -7.362  1.00 17.80 ? 224 GLN B CA   6  
ATOM   10509 C C    . GLN B 2 85  ? -8.133  -0.123  -7.414  1.00 17.42 ? 224 GLN B C    6  
ATOM   10510 O O    . GLN B 2 85  ? -7.369  0.781   -7.683  1.00 17.16 ? 224 GLN B O    6  
ATOM   10511 C CB   . GLN B 2 85  ? -8.049  -2.290  -8.653  1.00 21.63 ? 224 GLN B CB   6  
ATOM   10512 C CG   . GLN B 2 85  ? -6.932  -2.135  -9.688  1.00 27.99 ? 224 GLN B CG   6  
ATOM   10513 C CD   . GLN B 2 85  ? -7.492  -1.471  -10.947 1.00 31.34 ? 224 GLN B CD   6  
ATOM   10514 O OE1  . GLN B 2 85  ? -8.266  -0.539  -10.864 1.00 31.30 ? 224 GLN B OE1  6  
ATOM   10515 N NE2  . GLN B 2 85  ? -7.129  -1.915  -12.119 1.00 33.99 ? 224 GLN B NE2  6  
ATOM   10516 H H    . GLN B 2 85  ? -8.878  -3.021  -6.342  1.00 0.00  ? 224 GLN B H    6  
ATOM   10517 H HA   . GLN B 2 85  ? -6.579  -1.590  -7.252  1.00 0.00  ? 224 GLN B HA   6  
ATOM   10518 H HB2  . GLN B 2 85  ? -8.207  -3.339  -8.447  1.00 0.00  ? 224 GLN B HB2  6  
ATOM   10519 H HB3  . GLN B 2 85  ? -8.959  -1.858  -9.041  1.00 0.00  ? 224 GLN B HB3  6  
ATOM   10520 H HG2  . GLN B 2 85  ? -6.144  -1.521  -9.276  1.00 0.00  ? 224 GLN B HG2  6  
ATOM   10521 H HG3  . GLN B 2 85  ? -6.538  -3.107  -9.941  1.00 0.00  ? 224 GLN B HG3  6  
ATOM   10522 H HE21 . GLN B 2 85  ? -6.501  -2.670  -12.186 1.00 0.00  ? 224 GLN B HE21 6  
ATOM   10523 H HE22 . GLN B 2 85  ? -7.485  -1.495  -12.935 1.00 0.00  ? 224 GLN B HE22 6  
ATOM   10524 N N    . GLN B 2 86  ? -9.391  0.108   -7.156  1.00 17.93 ? 225 GLN B N    6  
ATOM   10525 C CA   . GLN B 2 86  ? -9.909  1.504   -7.186  1.00 17.77 ? 225 GLN B CA   6  
ATOM   10526 C C    . GLN B 2 86  ? -9.134  2.344   -6.170  1.00 14.93 ? 225 GLN B C    6  
ATOM   10527 O O    . GLN B 2 86  ? -8.661  3.422   -6.471  1.00 15.44 ? 225 GLN B O    6  
ATOM   10528 C CB   . GLN B 2 86  ? -11.397 1.507   -6.828  1.00 23.54 ? 225 GLN B CB   6  
ATOM   10529 C CG   . GLN B 2 86  ? -12.226 1.743   -8.092  1.00 32.83 ? 225 GLN B CG   6  
ATOM   10530 C CD   . GLN B 2 86  ? -13.698 1.914   -7.714  1.00 37.70 ? 225 GLN B CD   6  
ATOM   10531 O OE1  . GLN B 2 86  ? -14.024 2.674   -6.823  1.00 41.31 ? 225 GLN B OE1  6  
ATOM   10532 N NE2  . GLN B 2 86  ? -14.608 1.235   -8.358  1.00 38.92 ? 225 GLN B NE2  6  
ATOM   10533 H H    . GLN B 2 86  ? -9.992  -0.634  -6.938  1.00 0.00  ? 225 GLN B H    6  
ATOM   10534 H HA   . GLN B 2 86  ? -9.774  1.917   -8.175  1.00 0.00  ? 225 GLN B HA   6  
ATOM   10535 H HB2  . GLN B 2 86  ? -11.664 0.554   -6.394  1.00 0.00  ? 225 GLN B HB2  6  
ATOM   10536 H HB3  . GLN B 2 86  ? -11.594 2.295   -6.117  1.00 0.00  ? 225 GLN B HB3  6  
ATOM   10537 H HG2  . GLN B 2 86  ? -11.875 2.637   -8.590  1.00 0.00  ? 225 GLN B HG2  6  
ATOM   10538 H HG3  . GLN B 2 86  ? -12.122 0.898   -8.755  1.00 0.00  ? 225 GLN B HG3  6  
ATOM   10539 H HE21 . GLN B 2 86  ? -14.344 0.623   -9.077  1.00 0.00  ? 225 GLN B HE21 6  
ATOM   10540 H HE22 . GLN B 2 86  ? -15.554 1.337   -8.123  1.00 0.00  ? 225 GLN B HE22 6  
ATOM   10541 N N    . LEU B 2 87  ? -8.996  1.854   -4.968  1.00 13.83 ? 226 LEU B N    6  
ATOM   10542 C CA   . LEU B 2 87  ? -8.244  2.619   -3.931  1.00 13.09 ? 226 LEU B CA   6  
ATOM   10543 C C    . LEU B 2 87  ? -6.844  2.940   -4.458  1.00 11.87 ? 226 LEU B C    6  
ATOM   10544 O O    . LEU B 2 87  ? -6.280  3.973   -4.156  1.00 12.13 ? 226 LEU B O    6  
ATOM   10545 C CB   . LEU B 2 87  ? -8.137  1.773   -2.658  1.00 12.56 ? 226 LEU B CB   6  
ATOM   10546 C CG   . LEU B 2 87  ? -7.311  2.515   -1.604  1.00 13.63 ? 226 LEU B CG   6  
ATOM   10547 C CD1  . LEU B 2 87  ? -7.739  2.059   -0.208  1.00 13.34 ? 226 LEU B CD1  6  
ATOM   10548 C CD2  . LEU B 2 87  ? -5.827  2.200   -1.807  1.00 14.36 ? 226 LEU B CD2  6  
ATOM   10549 H H    . LEU B 2 87  ? -9.383  0.980   -4.748  1.00 0.00  ? 226 LEU B H    6  
ATOM   10550 H HA   . LEU B 2 87  ? -8.764  3.539   -3.713  1.00 0.00  ? 226 LEU B HA   6  
ATOM   10551 H HB2  . LEU B 2 87  ? -9.127  1.585   -2.270  1.00 0.00  ? 226 LEU B HB2  6  
ATOM   10552 H HB3  . LEU B 2 87  ? -7.659  0.834   -2.890  1.00 0.00  ? 226 LEU B HB3  6  
ATOM   10553 H HG   . LEU B 2 87  ? -7.472  3.580   -1.698  1.00 0.00  ? 226 LEU B HG   6  
ATOM   10554 H HD11 . LEU B 2 87  ? -8.468  1.267   -0.296  1.00 0.00  ? 226 LEU B HD11 6  
ATOM   10555 H HD12 . LEU B 2 87  ? -6.877  1.697   0.333   1.00 0.00  ? 226 LEU B HD12 6  
ATOM   10556 H HD13 . LEU B 2 87  ? -8.175  2.891   0.325   1.00 0.00  ? 226 LEU B HD13 6  
ATOM   10557 H HD21 . LEU B 2 87  ? -5.717  1.173   -2.121  1.00 0.00  ? 226 LEU B HD21 6  
ATOM   10558 H HD22 . LEU B 2 87  ? -5.420  2.853   -2.564  1.00 0.00  ? 226 LEU B HD22 6  
ATOM   10559 H HD23 . LEU B 2 87  ? -5.296  2.351   -0.879  1.00 0.00  ? 226 LEU B HD23 6  
ATOM   10560 N N    . VAL B 2 88  ? -6.278  2.067   -5.248  1.00 11.28 ? 227 VAL B N    6  
ATOM   10561 C CA   . VAL B 2 88  ? -4.916  2.334   -5.792  1.00 13.23 ? 227 VAL B CA   6  
ATOM   10562 C C    . VAL B 2 88  ? -5.006  3.386   -6.899  1.00 13.64 ? 227 VAL B C    6  
ATOM   10563 O O    . VAL B 2 88  ? -4.091  4.155   -7.114  1.00 15.96 ? 227 VAL B O    6  
ATOM   10564 C CB   . VAL B 2 88  ? -4.331  1.041   -6.365  1.00 9.89  ? 227 VAL B CB   6  
ATOM   10565 C CG1  . VAL B 2 88  ? -2.828  1.216   -6.589  1.00 9.85  ? 227 VAL B CG1  6  
ATOM   10566 C CG2  . VAL B 2 88  ? -4.570  -0.105  -5.379  1.00 9.58  ? 227 VAL B CG2  6  
ATOM   10567 H H    . VAL B 2 88  ? -6.748  1.238   -5.485  1.00 0.00  ? 227 VAL B H    6  
ATOM   10568 H HA   . VAL B 2 88  ? -4.277  2.697   -5.002  1.00 0.00  ? 227 VAL B HA   6  
ATOM   10569 H HB   . VAL B 2 88  ? -4.812  0.815   -7.306  1.00 0.00  ? 227 VAL B HB   6  
ATOM   10570 H HG11 . VAL B 2 88  ? -2.625  2.231   -6.894  1.00 0.00  ? 227 VAL B HG11 6  
ATOM   10571 H HG12 . VAL B 2 88  ? -2.301  1.002   -5.670  1.00 0.00  ? 227 VAL B HG12 6  
ATOM   10572 H HG13 . VAL B 2 88  ? -2.497  0.535   -7.359  1.00 0.00  ? 227 VAL B HG13 6  
ATOM   10573 H HG21 . VAL B 2 88  ? -4.976  0.289   -4.460  1.00 0.00  ? 227 VAL B HG21 6  
ATOM   10574 H HG22 . VAL B 2 88  ? -5.268  -0.809  -5.808  1.00 0.00  ? 227 VAL B HG22 6  
ATOM   10575 H HG23 . VAL B 2 88  ? -3.634  -0.604  -5.175  1.00 0.00  ? 227 VAL B HG23 6  
ATOM   10576 N N    . ALA B 2 89  ? -6.105  3.428   -7.603  1.00 16.21 ? 228 ALA B N    6  
ATOM   10577 C CA   . ALA B 2 89  ? -6.253  4.432   -8.694  1.00 16.05 ? 228 ALA B CA   6  
ATOM   10578 C C    . ALA B 2 89  ? -6.300  5.835   -8.087  1.00 16.38 ? 228 ALA B C    6  
ATOM   10579 O O    . ALA B 2 89  ? -5.575  6.722   -8.492  1.00 17.42 ? 228 ALA B O    6  
ATOM   10580 C CB   . ALA B 2 89  ? -7.549  4.164   -9.462  1.00 17.50 ? 228 ALA B CB   6  
ATOM   10581 H H    . ALA B 2 89  ? -6.833  2.802   -7.412  1.00 0.00  ? 228 ALA B H    6  
ATOM   10582 H HA   . ALA B 2 89  ? -5.413  4.359   -9.368  1.00 0.00  ? 228 ALA B HA   6  
ATOM   10583 H HB1  . ALA B 2 89  ? -7.978  3.231   -9.129  1.00 0.00  ? 228 ALA B HB1  6  
ATOM   10584 H HB2  . ALA B 2 89  ? -8.247  4.967   -9.281  1.00 0.00  ? 228 ALA B HB2  6  
ATOM   10585 H HB3  . ALA B 2 89  ? -7.335  4.105   -10.519 1.00 0.00  ? 228 ALA B HB3  6  
ATOM   10586 N N    . TYR B 2 90  ? -7.146  6.042   -7.117  1.00 17.24 ? 229 TYR B N    6  
ATOM   10587 C CA   . TYR B 2 90  ? -7.236  7.386   -6.484  1.00 15.90 ? 229 TYR B CA   6  
ATOM   10588 C C    . TYR B 2 90  ? -5.864  7.773   -5.928  1.00 15.53 ? 229 TYR B C    6  
ATOM   10589 O O    . TYR B 2 90  ? -5.341  8.829   -6.222  1.00 15.40 ? 229 TYR B O    6  
ATOM   10590 C CB   . TYR B 2 90  ? -8.257  7.348   -5.345  1.00 17.41 ? 229 TYR B CB   6  
ATOM   10591 C CG   . TYR B 2 90  ? -8.878  8.714   -5.177  1.00 19.62 ? 229 TYR B CG   6  
ATOM   10592 C CD1  . TYR B 2 90  ? -9.367  9.406   -6.299  1.00 19.06 ? 229 TYR B CD1  6  
ATOM   10593 C CD2  . TYR B 2 90  ? -8.966  9.294   -3.901  1.00 20.00 ? 229 TYR B CD2  6  
ATOM   10594 C CE1  . TYR B 2 90  ? -9.945  10.678  -6.142  1.00 20.67 ? 229 TYR B CE1  6  
ATOM   10595 C CE2  . TYR B 2 90  ? -9.543  10.565  -3.745  1.00 22.03 ? 229 TYR B CE2  6  
ATOM   10596 C CZ   . TYR B 2 90  ? -10.033 11.257  -4.865  1.00 22.97 ? 229 TYR B CZ   6  
ATOM   10597 O OH   . TYR B 2 90  ? -10.600 12.507  -4.713  1.00 24.81 ? 229 TYR B OH   6  
ATOM   10598 H H    . TYR B 2 90  ? -7.720  5.312   -6.803  1.00 0.00  ? 229 TYR B H    6  
ATOM   10599 H HA   . TYR B 2 90  ? -7.545  8.111   -7.221  1.00 0.00  ? 229 TYR B HA   6  
ATOM   10600 H HB2  . TYR B 2 90  ? -9.028  6.627   -5.577  1.00 0.00  ? 229 TYR B HB2  6  
ATOM   10601 H HB3  . TYR B 2 90  ? -7.763  7.063   -4.428  1.00 0.00  ? 229 TYR B HB3  6  
ATOM   10602 H HD1  . TYR B 2 90  ? -9.299  8.960   -7.280  1.00 0.00  ? 229 TYR B HD1  6  
ATOM   10603 H HD2  . TYR B 2 90  ? -8.589  8.763   -3.039  1.00 0.00  ? 229 TYR B HD2  6  
ATOM   10604 H HE1  . TYR B 2 90  ? -10.320 11.209  -7.004  1.00 0.00  ? 229 TYR B HE1  6  
ATOM   10605 H HE2  . TYR B 2 90  ? -9.612  11.011  -2.763  1.00 0.00  ? 229 TYR B HE2  6  
ATOM   10606 H HH   . TYR B 2 90  ? -11.032 12.533  -3.856  1.00 0.00  ? 229 TYR B HH   6  
ATOM   10607 N N    . TYR B 2 91  ? -5.277  6.925   -5.128  1.00 15.18 ? 230 TYR B N    6  
ATOM   10608 C CA   . TYR B 2 91  ? -3.939  7.248   -4.557  1.00 16.33 ? 230 TYR B CA   6  
ATOM   10609 C C    . TYR B 2 91  ? -2.871  7.146   -5.651  1.00 16.83 ? 230 TYR B C    6  
ATOM   10610 O O    . TYR B 2 91  ? -1.731  7.515   -5.450  1.00 16.71 ? 230 TYR B O    6  
ATOM   10611 C CB   . TYR B 2 91  ? -3.608  6.263   -3.431  1.00 14.52 ? 230 TYR B CB   6  
ATOM   10612 C CG   . TYR B 2 91  ? -4.685  6.316   -2.371  1.00 16.10 ? 230 TYR B CG   6  
ATOM   10613 C CD1  . TYR B 2 91  ? -5.398  7.507   -2.144  1.00 17.17 ? 230 TYR B CD1  6  
ATOM   10614 C CD2  . TYR B 2 91  ? -4.971  5.172   -1.608  1.00 15.88 ? 230 TYR B CD2  6  
ATOM   10615 C CE1  . TYR B 2 91  ? -6.397  7.552   -1.157  1.00 17.84 ? 230 TYR B CE1  6  
ATOM   10616 C CE2  . TYR B 2 91  ? -5.970  5.217   -0.620  1.00 17.12 ? 230 TYR B CE2  6  
ATOM   10617 C CZ   . TYR B 2 91  ? -6.682  6.406   -0.395  1.00 17.32 ? 230 TYR B CZ   6  
ATOM   10618 O OH   . TYR B 2 91  ? -7.663  6.450   0.575   1.00 19.89 ? 230 TYR B OH   6  
ATOM   10619 H H    . TYR B 2 91  ? -5.717  6.077   -4.903  1.00 0.00  ? 230 TYR B H    6  
ATOM   10620 H HA   . TYR B 2 91  ? -3.950  8.252   -4.162  1.00 0.00  ? 230 TYR B HA   6  
ATOM   10621 H HB2  . TYR B 2 91  ? -3.551  5.263   -3.835  1.00 0.00  ? 230 TYR B HB2  6  
ATOM   10622 H HB3  . TYR B 2 91  ? -2.659  6.527   -2.991  1.00 0.00  ? 230 TYR B HB3  6  
ATOM   10623 H HD1  . TYR B 2 91  ? -5.180  8.387   -2.730  1.00 0.00  ? 230 TYR B HD1  6  
ATOM   10624 H HD2  . TYR B 2 91  ? -4.423  4.258   -1.780  1.00 0.00  ? 230 TYR B HD2  6  
ATOM   10625 H HE1  . TYR B 2 91  ? -6.945  8.465   -0.984  1.00 0.00  ? 230 TYR B HE1  6  
ATOM   10626 H HE2  . TYR B 2 91  ? -6.189  4.337   -0.033  1.00 0.00  ? 230 TYR B HE2  6  
ATOM   10627 H HH   . TYR B 2 91  ? -7.849  7.372   0.766   1.00 0.00  ? 230 TYR B HH   6  
ATOM   10628 N N    . SER B 2 92  ? -3.225  6.647   -6.805  1.00 17.92 ? 231 SER B N    6  
ATOM   10629 C CA   . SER B 2 92  ? -2.224  6.525   -7.902  1.00 22.15 ? 231 SER B CA   6  
ATOM   10630 C C    . SER B 2 92  ? -2.025  7.882   -8.579  1.00 22.66 ? 231 SER B C    6  
ATOM   10631 O O    . SER B 2 92  ? -1.076  8.089   -9.308  1.00 24.35 ? 231 SER B O    6  
ATOM   10632 C CB   . SER B 2 92  ? -2.718  5.511   -8.934  1.00 21.66 ? 231 SER B CB   6  
ATOM   10633 O OG   . SER B 2 92  ? -2.248  4.216   -8.583  1.00 28.41 ? 231 SER B OG   6  
ATOM   10634 H H    . SER B 2 92  ? -4.147  6.353   -6.950  1.00 0.00  ? 231 SER B H    6  
ATOM   10635 H HA   . SER B 2 92  ? -1.284  6.189   -7.494  1.00 0.00  ? 231 SER B HA   6  
ATOM   10636 H HB2  . SER B 2 92  ? -3.795  5.505   -8.948  1.00 0.00  ? 231 SER B HB2  6  
ATOM   10637 H HB3  . SER B 2 92  ? -2.348  5.786   -9.912  1.00 0.00  ? 231 SER B HB3  6  
ATOM   10638 H HG   . SER B 2 92  ? -1.288  4.235   -8.597  1.00 0.00  ? 231 SER B HG   6  
ATOM   10639 N N    . LYS B 2 93  ? -2.910  8.812   -8.345  1.00 24.70 ? 232 LYS B N    6  
ATOM   10640 C CA   . LYS B 2 93  ? -2.764  10.152  -8.978  1.00 27.78 ? 232 LYS B CA   6  
ATOM   10641 C C    . LYS B 2 93  ? -2.464  11.197  -7.902  1.00 29.48 ? 232 LYS B C    6  
ATOM   10642 O O    . LYS B 2 93  ? -1.522  11.957  -8.006  1.00 31.78 ? 232 LYS B O    6  
ATOM   10643 C CB   . LYS B 2 93  ? -4.062  10.519  -9.698  1.00 28.95 ? 232 LYS B CB   6  
ATOM   10644 C CG   . LYS B 2 93  ? -3.748  10.956  -11.130 1.00 35.04 ? 232 LYS B CG   6  
ATOM   10645 C CD   . LYS B 2 93  ? -4.274  9.908   -12.113 1.00 42.20 ? 232 LYS B CD   6  
ATOM   10646 C CE   . LYS B 2 93  ? -3.116  9.027   -12.588 1.00 46.43 ? 232 LYS B CE   6  
ATOM   10647 N NZ   . LYS B 2 93  ? -2.985  9.133   -14.068 1.00 50.42 ? 232 LYS B NZ   6  
ATOM   10648 H H    . LYS B 2 93  ? -3.670  8.629   -7.752  1.00 0.00  ? 232 LYS B H    6  
ATOM   10649 H HA   . LYS B 2 93  ? -1.953  10.127  -9.691  1.00 0.00  ? 232 LYS B HA   6  
ATOM   10650 H HB2  . LYS B 2 93  ? -4.719  9.661   -9.717  1.00 0.00  ? 232 LYS B HB2  6  
ATOM   10651 H HB3  . LYS B 2 93  ? -4.545  11.330  -9.174  1.00 0.00  ? 232 LYS B HB3  6  
ATOM   10652 H HG2  . LYS B 2 93  ? -4.222  11.907  -11.329 1.00 0.00  ? 232 LYS B HG2  6  
ATOM   10653 H HG3  . LYS B 2 93  ? -2.679  11.055  -11.251 1.00 0.00  ? 232 LYS B HG3  6  
ATOM   10654 H HD2  . LYS B 2 93  ? -5.015  9.296   -11.621 1.00 0.00  ? 232 LYS B HD2  6  
ATOM   10655 H HD3  . LYS B 2 93  ? -4.720  10.402  -12.963 1.00 0.00  ? 232 LYS B HD3  6  
ATOM   10656 H HE2  . LYS B 2 93  ? -2.200  9.354   -12.120 1.00 0.00  ? 232 LYS B HE2  6  
ATOM   10657 H HE3  . LYS B 2 93  ? -3.312  7.999   -12.317 1.00 0.00  ? 232 LYS B HE3  6  
ATOM   10658 H HZ1  . LYS B 2 93  ? -3.556  9.932   -14.411 1.00 0.00  ? 232 LYS B HZ1  6  
ATOM   10659 H HZ2  . LYS B 2 93  ? -1.987  9.287   -14.317 1.00 0.00  ? 232 LYS B HZ2  6  
ATOM   10660 H HZ3  . LYS B 2 93  ? -3.322  8.256   -14.511 1.00 0.00  ? 232 LYS B HZ3  6  
ATOM   10661 N N    . HIS B 2 94  ? -3.258  11.241  -6.868  1.00 31.24 ? 233 HIS B N    6  
ATOM   10662 C CA   . HIS B 2 94  ? -3.017  12.237  -5.785  1.00 31.51 ? 233 HIS B CA   6  
ATOM   10663 C C    . HIS B 2 94  ? -2.871  11.511  -4.447  1.00 28.20 ? 233 HIS B C    6  
ATOM   10664 O O    . HIS B 2 94  ? -3.672  10.669  -4.095  1.00 29.72 ? 233 HIS B O    6  
ATOM   10665 C CB   . HIS B 2 94  ? -4.195  13.214  -5.708  1.00 33.74 ? 233 HIS B CB   6  
ATOM   10666 C CG   . HIS B 2 94  ? -5.476  12.492  -6.026  1.00 39.30 ? 233 HIS B CG   6  
ATOM   10667 N ND1  . HIS B 2 94  ? -6.280  12.848  -7.097  1.00 40.06 ? 233 HIS B ND1  6  
ATOM   10668 C CD2  . HIS B 2 94  ? -6.104  11.430  -5.423  1.00 39.81 ? 233 HIS B CD2  6  
ATOM   10669 C CE1  . HIS B 2 94  ? -7.335  12.014  -7.108  1.00 41.81 ? 233 HIS B CE1  6  
ATOM   10670 N NE2  . HIS B 2 94  ? -7.278  11.130  -6.109  1.00 42.50 ? 233 HIS B NE2  6  
ATOM   10671 H H    . HIS B 2 94  ? -4.012  10.618  -6.802  1.00 0.00  ? 233 HIS B H    6  
ATOM   10672 H HA   . HIS B 2 94  ? -2.111  12.785  -5.997  1.00 0.00  ? 233 HIS B HA   6  
ATOM   10673 H HB2  . HIS B 2 94  ? -4.253  13.628  -4.712  1.00 0.00  ? 233 HIS B HB2  6  
ATOM   10674 H HB3  . HIS B 2 94  ? -4.047  14.012  -6.420  1.00 0.00  ? 233 HIS B HB3  6  
ATOM   10675 H HD1  . HIS B 2 94  ? -6.109  13.575  -7.733  1.00 0.00  ? 233 HIS B HD1  6  
ATOM   10676 H HD2  . HIS B 2 94  ? -5.742  10.906  -4.551  1.00 0.00  ? 233 HIS B HD2  6  
ATOM   10677 H HE1  . HIS B 2 94  ? -8.131  12.053  -7.836  1.00 0.00  ? 233 HIS B HE1  6  
ATOM   10678 N N    . ALA B 2 95  ? -1.853  11.833  -3.698  1.00 24.22 ? 234 ALA B N    6  
ATOM   10679 C CA   . ALA B 2 95  ? -1.653  11.163  -2.383  1.00 22.83 ? 234 ALA B CA   6  
ATOM   10680 C C    . ALA B 2 95  ? -2.642  11.735  -1.364  1.00 24.43 ? 234 ALA B C    6  
ATOM   10681 O O    . ALA B 2 95  ? -3.015  11.080  -0.411  1.00 23.70 ? 234 ALA B O    6  
ATOM   10682 C CB   . ALA B 2 95  ? -0.224  11.409  -1.897  1.00 19.43 ? 234 ALA B CB   6  
ATOM   10683 H H    . ALA B 2 95  ? -1.219  12.517  -4.001  1.00 0.00  ? 234 ALA B H    6  
ATOM   10684 H HA   . ALA B 2 95  ? -1.820  10.102  -2.490  1.00 0.00  ? 234 ALA B HA   6  
ATOM   10685 H HB1  . ALA B 2 95  ? 0.237   12.172  -2.506  1.00 0.00  ? 234 ALA B HB1  6  
ATOM   10686 H HB2  . ALA B 2 95  ? -0.244  11.733  -0.868  1.00 0.00  ? 234 ALA B HB2  6  
ATOM   10687 H HB3  . ALA B 2 95  ? 0.345   10.493  -1.974  1.00 0.00  ? 234 ALA B HB3  6  
ATOM   10688 N N    . ASP B 2 96  ? -3.068  12.953  -1.556  1.00 27.21 ? 235 ASP B N    6  
ATOM   10689 C CA   . ASP B 2 96  ? -4.030  13.563  -0.598  1.00 29.29 ? 235 ASP B CA   6  
ATOM   10690 C C    . ASP B 2 96  ? -3.371  13.662  0.787   1.00 28.86 ? 235 ASP B C    6  
ATOM   10691 O O    . ASP B 2 96  ? -2.412  14.387  0.967   1.00 29.80 ? 235 ASP B O    6  
ATOM   10692 C CB   . ASP B 2 96  ? -5.296  12.700  -0.536  1.00 35.17 ? 235 ASP B CB   6  
ATOM   10693 C CG   . ASP B 2 96  ? -6.343  13.389  0.339   1.00 40.61 ? 235 ASP B CG   6  
ATOM   10694 O OD1  . ASP B 2 96  ? -5.959  14.218  1.148   1.00 46.14 ? 235 ASP B OD1  6  
ATOM   10695 O OD2  . ASP B 2 96  ? -7.513  13.077  0.187   1.00 45.11 ? 235 ASP B OD2  6  
ATOM   10696 H H    . ASP B 2 96  ? -2.755  13.466  -2.331  1.00 0.00  ? 235 ASP B H    6  
ATOM   10697 H HA   . ASP B 2 96  ? -4.291  14.553  -0.934  1.00 0.00  ? 235 ASP B HA   6  
ATOM   10698 H HB2  . ASP B 2 96  ? -5.689  12.569  -1.534  1.00 0.00  ? 235 ASP B HB2  6  
ATOM   10699 H HB3  . ASP B 2 96  ? -5.055  11.736  -0.116  1.00 0.00  ? 235 ASP B HB3  6  
ATOM   10700 N N    . GLY B 2 97  ? -3.861  12.947  1.765   1.00 27.14 ? 236 GLY B N    6  
ATOM   10701 C CA   . GLY B 2 97  ? -3.241  13.020  3.118   1.00 25.64 ? 236 GLY B CA   6  
ATOM   10702 C C    . GLY B 2 97  ? -2.222  11.890  3.272   1.00 24.14 ? 236 GLY B C    6  
ATOM   10703 O O    . GLY B 2 97  ? -1.927  11.452  4.365   1.00 24.47 ? 236 GLY B O    6  
ATOM   10704 H H    . GLY B 2 97  ? -4.630  12.366  1.614   1.00 0.00  ? 236 GLY B H    6  
ATOM   10705 H HA2  . GLY B 2 97  ? -2.747  13.973  3.236   1.00 0.00  ? 236 GLY B HA2  6  
ATOM   10706 H HA3  . GLY B 2 97  ? -4.007  12.914  3.871   1.00 0.00  ? 236 GLY B HA3  6  
ATOM   10707 N N    . LEU B 2 98  ? -1.682  11.416  2.183   1.00 20.92 ? 237 LEU B N    6  
ATOM   10708 C CA   . LEU B 2 98  ? -0.682  10.313  2.265   1.00 19.13 ? 237 LEU B CA   6  
ATOM   10709 C C    . LEU B 2 98  ? 0.730   10.905  2.301   1.00 18.42 ? 237 LEU B C    6  
ATOM   10710 O O    . LEU B 2 98  ? 0.915   12.101  2.196   1.00 19.85 ? 237 LEU B O    6  
ATOM   10711 C CB   . LEU B 2 98  ? -0.824  9.404   1.042   1.00 19.72 ? 237 LEU B CB   6  
ATOM   10712 C CG   . LEU B 2 98  ? -1.824  8.289   1.352   1.00 21.67 ? 237 LEU B CG   6  
ATOM   10713 C CD1  . LEU B 2 98  ? -2.370  7.716   0.043   1.00 17.09 ? 237 LEU B CD1  6  
ATOM   10714 C CD2  . LEU B 2 98  ? -1.122  7.181   2.140   1.00 22.76 ? 237 LEU B CD2  6  
ATOM   10715 H H    . LEU B 2 98  ? -1.935  11.783  1.310   1.00 0.00  ? 237 LEU B H    6  
ATOM   10716 H HA   . LEU B 2 98  ? -0.854  9.738   3.163   1.00 0.00  ? 237 LEU B HA   6  
ATOM   10717 H HB2  . LEU B 2 98  ? -1.178  9.984   0.203   1.00 0.00  ? 237 LEU B HB2  6  
ATOM   10718 H HB3  . LEU B 2 98  ? 0.134   8.970   0.803   1.00 0.00  ? 237 LEU B HB3  6  
ATOM   10719 H HG   . LEU B 2 98  ? -2.640  8.689   1.937   1.00 0.00  ? 237 LEU B HG   6  
ATOM   10720 H HD11 . LEU B 2 98  ? -2.072  8.349   -0.780  1.00 0.00  ? 237 LEU B HD11 6  
ATOM   10721 H HD12 . LEU B 2 98  ? -1.975  6.722   -0.107  1.00 0.00  ? 237 LEU B HD12 6  
ATOM   10722 H HD13 . LEU B 2 98  ? -3.448  7.672   0.091   1.00 0.00  ? 237 LEU B HD13 6  
ATOM   10723 H HD21 . LEU B 2 98  ? -0.369  7.617   2.780   1.00 0.00  ? 237 LEU B HD21 6  
ATOM   10724 H HD22 . LEU B 2 98  ? -1.847  6.655   2.743   1.00 0.00  ? 237 LEU B HD22 6  
ATOM   10725 H HD23 . LEU B 2 98  ? -0.655  6.491   1.453   1.00 0.00  ? 237 LEU B HD23 6  
ATOM   10726 N N    . CYS B 2 99  ? 1.726   10.076  2.452   1.00 18.29 ? 238 CYS B N    6  
ATOM   10727 C CA   . CYS B 2 99  ? 3.123   10.589  2.499   1.00 17.21 ? 238 CYS B CA   6  
ATOM   10728 C C    . CYS B 2 99  ? 3.722   10.583  1.090   1.00 18.80 ? 238 CYS B C    6  
ATOM   10729 O O    . CYS B 2 99  ? 4.759   11.169  0.845   1.00 19.09 ? 238 CYS B O    6  
ATOM   10730 C CB   . CYS B 2 99  ? 3.960   9.692   3.410   1.00 17.49 ? 238 CYS B CB   6  
ATOM   10731 S SG   . CYS B 2 99  ? 3.802   7.970   2.875   1.00 18.25 ? 238 CYS B SG   6  
ATOM   10732 H H    . CYS B 2 99  ? 1.556   9.115   2.538   1.00 0.00  ? 238 CYS B H    6  
ATOM   10733 H HA   . CYS B 2 99  ? 3.124   11.596  2.887   1.00 0.00  ? 238 CYS B HA   6  
ATOM   10734 H HB2  . CYS B 2 99  ? 4.994   9.990   3.356   1.00 0.00  ? 238 CYS B HB2  6  
ATOM   10735 H HB3  . CYS B 2 99  ? 3.610   9.786   4.428   1.00 0.00  ? 238 CYS B HB3  6  
ATOM   10736 H HG   . CYS B 2 99  ? 3.217   7.520   3.491   1.00 0.00  ? 238 CYS B HG   6  
ATOM   10737 N N    . HIS B 2 100 ? 3.082   9.927   0.162   1.00 17.96 ? 239 HIS B N    6  
ATOM   10738 C CA   . HIS B 2 100 ? 3.621   9.887   -1.228  1.00 18.41 ? 239 HIS B CA   6  
ATOM   10739 C C    . HIS B 2 100 ? 2.581   9.265   -2.162  1.00 18.79 ? 239 HIS B C    6  
ATOM   10740 O O    . HIS B 2 100 ? 1.849   8.371   -1.786  1.00 19.28 ? 239 HIS B O    6  
ATOM   10741 C CB   . HIS B 2 100 ? 4.897   9.044   -1.253  1.00 18.77 ? 239 HIS B CB   6  
ATOM   10742 C CG   . HIS B 2 100 ? 5.780   9.501   -2.382  1.00 18.40 ? 239 HIS B CG   6  
ATOM   10743 N ND1  . HIS B 2 100 ? 5.442   9.304   -3.712  1.00 18.53 ? 239 HIS B ND1  6  
ATOM   10744 C CD2  . HIS B 2 100 ? 6.991   10.146  -2.395  1.00 19.51 ? 239 HIS B CD2  6  
ATOM   10745 C CE1  . HIS B 2 100 ? 6.431   9.822   -4.463  1.00 19.04 ? 239 HIS B CE1  6  
ATOM   10746 N NE2  . HIS B 2 100 ? 7.401   10.348  -3.710  1.00 20.02 ? 239 HIS B NE2  6  
ATOM   10747 H H    . HIS B 2 100 ? 2.248   9.459   0.377   1.00 0.00  ? 239 HIS B H    6  
ATOM   10748 H HA   . HIS B 2 100 ? 3.846   10.891  -1.556  1.00 0.00  ? 239 HIS B HA   6  
ATOM   10749 H HB2  . HIS B 2 100 ? 5.423   9.158   -0.316  1.00 0.00  ? 239 HIS B HB2  6  
ATOM   10750 H HB3  . HIS B 2 100 ? 4.640   8.005   -1.397  1.00 0.00  ? 239 HIS B HB3  6  
ATOM   10751 H HD1  . HIS B 2 100 ? 4.629   8.866   -4.044  1.00 0.00  ? 239 HIS B HD1  6  
ATOM   10752 H HD2  . HIS B 2 100 ? 7.543   10.450  -1.518  1.00 0.00  ? 239 HIS B HD2  6  
ATOM   10753 H HE1  . HIS B 2 100 ? 6.439   9.813   -5.542  1.00 0.00  ? 239 HIS B HE1  6  
ATOM   10754 N N    . ARG B 2 101 ? 2.510   9.731   -3.380  1.00 19.17 ? 240 ARG B N    6  
ATOM   10755 C CA   . ARG B 2 101 ? 1.517   9.164   -4.337  1.00 20.76 ? 240 ARG B CA   6  
ATOM   10756 C C    . ARG B 2 101 ? 2.094   7.907   -4.989  1.00 18.50 ? 240 ARG B C    6  
ATOM   10757 O O    . ARG B 2 101 ? 3.258   7.852   -5.337  1.00 17.06 ? 240 ARG B O    6  
ATOM   10758 C CB   . ARG B 2 101 ? 1.195   10.200  -5.417  1.00 25.30 ? 240 ARG B CB   6  
ATOM   10759 C CG   . ARG B 2 101 ? 0.364   9.544   -6.523  1.00 30.23 ? 240 ARG B CG   6  
ATOM   10760 C CD   . ARG B 2 101 ? 1.262   9.245   -7.722  1.00 37.22 ? 240 ARG B CD   6  
ATOM   10761 N NE   . ARG B 2 101 ? 1.467   10.490  -8.514  1.00 43.41 ? 240 ARG B NE   6  
ATOM   10762 C CZ   . ARG B 2 101 ? 2.510   10.605  -9.290  1.00 45.15 ? 240 ARG B CZ   6  
ATOM   10763 N NH1  . ARG B 2 101 ? 2.786   9.670   -10.157 1.00 46.15 ? 240 ARG B NH1  6  
ATOM   10764 N NH2  . ARG B 2 101 ? 3.279   11.657  -9.199  1.00 46.50 ? 240 ARG B NH2  6  
ATOM   10765 H H    . ARG B 2 101 ? 3.109   10.452  -3.665  1.00 0.00  ? 240 ARG B H    6  
ATOM   10766 H HA   . ARG B 2 101 ? 0.612   8.907   -3.808  1.00 0.00  ? 240 ARG B HA   6  
ATOM   10767 H HB2  . ARG B 2 101 ? 0.635   11.014  -4.979  1.00 0.00  ? 240 ARG B HB2  6  
ATOM   10768 H HB3  . ARG B 2 101 ? 2.113   10.580  -5.838  1.00 0.00  ? 240 ARG B HB3  6  
ATOM   10769 H HG2  . ARG B 2 101 ? -0.062  8.621   -6.153  1.00 0.00  ? 240 ARG B HG2  6  
ATOM   10770 H HG3  . ARG B 2 101 ? -0.429  10.210  -6.826  1.00 0.00  ? 240 ARG B HG3  6  
ATOM   10771 H HD2  . ARG B 2 101 ? 2.215   8.877   -7.372  1.00 0.00  ? 240 ARG B HD2  6  
ATOM   10772 H HD3  . ARG B 2 101 ? 0.794   8.495   -8.342  1.00 0.00  ? 240 ARG B HD3  6  
ATOM   10773 H HE   . ARG B 2 101 ? 0.820   11.223  -8.452  1.00 0.00  ? 240 ARG B HE   6  
ATOM   10774 H HH11 . ARG B 2 101 ? 2.198   8.864   -10.227 1.00 0.00  ? 240 ARG B HH11 6  
ATOM   10775 H HH12 . ARG B 2 101 ? 3.586   9.758   -10.751 1.00 0.00  ? 240 ARG B HH12 6  
ATOM   10776 H HH21 . ARG B 2 101 ? 3.067   12.375  -8.535  1.00 0.00  ? 240 ARG B HH21 6  
ATOM   10777 H HH22 . ARG B 2 101 ? 4.077   11.745  -9.794  1.00 0.00  ? 240 ARG B HH22 6  
ATOM   10778 N N    . LEU B 2 102 ? 1.286   6.900   -5.162  1.00 16.42 ? 241 LEU B N    6  
ATOM   10779 C CA   . LEU B 2 102 ? 1.778   5.645   -5.797  1.00 16.95 ? 241 LEU B CA   6  
ATOM   10780 C C    . LEU B 2 102 ? 2.399   5.979   -7.156  1.00 18.53 ? 241 LEU B C    6  
ATOM   10781 O O    . LEU B 2 102 ? 1.808   6.664   -7.965  1.00 19.32 ? 241 LEU B O    6  
ATOM   10782 C CB   . LEU B 2 102 ? 0.603   4.687   -5.998  1.00 12.02 ? 241 LEU B CB   6  
ATOM   10783 C CG   . LEU B 2 102 ? -0.181  4.541   -4.691  1.00 10.93 ? 241 LEU B CG   6  
ATOM   10784 C CD1  . LEU B 2 102 ? -1.185  3.394   -4.823  1.00 7.07  ? 241 LEU B CD1  6  
ATOM   10785 C CD2  . LEU B 2 102 ? 0.786   4.238   -3.542  1.00 9.30  ? 241 LEU B CD2  6  
ATOM   10786 H H    . LEU B 2 102 ? 0.351   6.969   -4.878  1.00 0.00  ? 241 LEU B H    6  
ATOM   10787 H HA   . LEU B 2 102 ? 2.519   5.184   -5.162  1.00 0.00  ? 241 LEU B HA   6  
ATOM   10788 H HB2  . LEU B 2 102 ? -0.046  5.079   -6.763  1.00 0.00  ? 241 LEU B HB2  6  
ATOM   10789 H HB3  . LEU B 2 102 ? 0.973   3.722   -6.303  1.00 0.00  ? 241 LEU B HB3  6  
ATOM   10790 H HG   . LEU B 2 102 ? -0.712  5.459   -4.485  1.00 0.00  ? 241 LEU B HG   6  
ATOM   10791 H HD11 . LEU B 2 102 ? -1.838  3.583   -5.662  1.00 0.00  ? 241 LEU B HD11 6  
ATOM   10792 H HD12 . LEU B 2 102 ? -0.653  2.467   -4.982  1.00 0.00  ? 241 LEU B HD12 6  
ATOM   10793 H HD13 . LEU B 2 102 ? -1.771  3.322   -3.918  1.00 0.00  ? 241 LEU B HD13 6  
ATOM   10794 H HD21 . LEU B 2 102 ? 1.422   3.409   -3.816  1.00 0.00  ? 241 LEU B HD21 6  
ATOM   10795 H HD22 . LEU B 2 102 ? 1.395   5.108   -3.344  1.00 0.00  ? 241 LEU B HD22 6  
ATOM   10796 H HD23 . LEU B 2 102 ? 0.224   3.983   -2.656  1.00 0.00  ? 241 LEU B HD23 6  
ATOM   10797 N N    . THR B 2 103 ? 3.585   5.502   -7.415  1.00 20.81 ? 242 THR B N    6  
ATOM   10798 C CA   . THR B 2 103 ? 4.234   5.800   -8.723  1.00 20.89 ? 242 THR B CA   6  
ATOM   10799 C C    . THR B 2 103 ? 4.693   4.498   -9.381  1.00 21.74 ? 242 THR B C    6  
ATOM   10800 O O    . THR B 2 103 ? 4.662   4.358   -10.588 1.00 24.76 ? 242 THR B O    6  
ATOM   10801 C CB   . THR B 2 103 ? 5.444   6.711   -8.496  1.00 20.18 ? 242 THR B CB   6  
ATOM   10802 O OG1  . THR B 2 103 ? 6.282   6.142   -7.501  1.00 22.88 ? 242 THR B OG1  6  
ATOM   10803 C CG2  . THR B 2 103 ? 4.968   8.090   -8.039  1.00 19.22 ? 242 THR B CG2  6  
ATOM   10804 H H    . THR B 2 103 ? 4.050   4.952   -6.750  1.00 0.00  ? 242 THR B H    6  
ATOM   10805 H HA   . THR B 2 103 ? 3.527   6.298   -9.369  1.00 0.00  ? 242 THR B HA   6  
ATOM   10806 H HB   . THR B 2 103 ? 5.996   6.812   -9.418  1.00 0.00  ? 242 THR B HB   6  
ATOM   10807 H HG1  . THR B 2 103 ? 7.192   6.342   -7.730  1.00 0.00  ? 242 THR B HG1  6  
ATOM   10808 H HG21 . THR B 2 103 ? 3.986   8.286   -8.445  1.00 0.00  ? 242 THR B HG21 6  
ATOM   10809 H HG22 . THR B 2 103 ? 4.921   8.116   -6.960  1.00 0.00  ? 242 THR B HG22 6  
ATOM   10810 H HG23 . THR B 2 103 ? 5.659   8.844   -8.387  1.00 0.00  ? 242 THR B HG23 6  
ATOM   10811 N N    . THR B 2 104 ? 5.121   3.543   -8.601  1.00 20.71 ? 243 THR B N    6  
ATOM   10812 C CA   . THR B 2 104 ? 5.583   2.255   -9.190  1.00 18.86 ? 243 THR B CA   6  
ATOM   10813 C C    . THR B 2 104 ? 5.264   1.109   -8.229  1.00 18.56 ? 243 THR B C    6  
ATOM   10814 O O    . THR B 2 104 ? 5.037   1.319   -7.055  1.00 18.28 ? 243 THR B O    6  
ATOM   10815 C CB   . THR B 2 104 ? 7.094   2.315   -9.425  1.00 20.42 ? 243 THR B CB   6  
ATOM   10816 O OG1  . THR B 2 104 ? 7.429   3.560   -10.022 1.00 20.70 ? 243 THR B OG1  6  
ATOM   10817 C CG2  . THR B 2 104 ? 7.515   1.173   -10.351 1.00 16.38 ? 243 THR B CG2  6  
ATOM   10818 H H    . THR B 2 104 ? 5.142   3.674   -7.630  1.00 0.00  ? 243 THR B H    6  
ATOM   10819 H HA   . THR B 2 104 ? 5.078   2.087   -10.130 1.00 0.00  ? 243 THR B HA   6  
ATOM   10820 H HB   . THR B 2 104 ? 7.609   2.216   -8.482  1.00 0.00  ? 243 THR B HB   6  
ATOM   10821 H HG1  . THR B 2 104 ? 7.057   4.259   -9.480  1.00 0.00  ? 243 THR B HG1  6  
ATOM   10822 H HG21 . THR B 2 104 ? 6.852   1.137   -11.204 1.00 0.00  ? 243 THR B HG21 6  
ATOM   10823 H HG22 . THR B 2 104 ? 8.527   1.336   -10.688 1.00 0.00  ? 243 THR B HG22 6  
ATOM   10824 H HG23 . THR B 2 104 ? 7.461   0.237   -9.815  1.00 0.00  ? 243 THR B HG23 6  
ATOM   10825 N N    . VAL B 2 105 ? 5.250   -0.101  -8.716  1.00 16.29 ? 244 VAL B N    6  
ATOM   10826 C CA   . VAL B 2 105 ? 4.951   -1.259  -7.828  1.00 16.81 ? 244 VAL B CA   6  
ATOM   10827 C C    . VAL B 2 105 ? 6.260   -1.803  -7.252  1.00 16.74 ? 244 VAL B C    6  
ATOM   10828 O O    . VAL B 2 105 ? 7.336   -1.393  -7.639  1.00 17.40 ? 244 VAL B O    6  
ATOM   10829 C CB   . VAL B 2 105 ? 4.251   -2.354  -8.633  1.00 17.29 ? 244 VAL B CB   6  
ATOM   10830 C CG1  . VAL B 2 105 ? 3.489   -3.280  -7.684  1.00 17.99 ? 244 VAL B CG1  6  
ATOM   10831 C CG2  . VAL B 2 105 ? 3.267   -1.713  -9.615  1.00 17.19 ? 244 VAL B CG2  6  
ATOM   10832 H H    . VAL B 2 105 ? 5.438   -0.248  -9.666  1.00 0.00  ? 244 VAL B H    6  
ATOM   10833 H HA   . VAL B 2 105 ? 4.308   -0.938  -7.021  1.00 0.00  ? 244 VAL B HA   6  
ATOM   10834 H HB   . VAL B 2 105 ? 4.988   -2.925  -9.180  1.00 0.00  ? 244 VAL B HB   6  
ATOM   10835 H HG11 . VAL B 2 105 ? 3.501   -2.862  -6.687  1.00 0.00  ? 244 VAL B HG11 6  
ATOM   10836 H HG12 . VAL B 2 105 ? 2.469   -3.380  -8.020  1.00 0.00  ? 244 VAL B HG12 6  
ATOM   10837 H HG13 . VAL B 2 105 ? 3.961   -4.251  -7.672  1.00 0.00  ? 244 VAL B HG13 6  
ATOM   10838 H HG21 . VAL B 2 105 ? 2.990   -0.732  -9.258  1.00 0.00  ? 244 VAL B HG21 6  
ATOM   10839 H HG22 . VAL B 2 105 ? 3.733   -1.626  -10.585 1.00 0.00  ? 244 VAL B HG22 6  
ATOM   10840 H HG23 . VAL B 2 105 ? 2.384   -2.330  -9.694  1.00 0.00  ? 244 VAL B HG23 6  
ATOM   10841 N N    . CYS B 2 106 ? 6.178   -2.725  -6.333  1.00 15.40 ? 245 CYS B N    6  
ATOM   10842 C CA   . CYS B 2 106 ? 7.420   -3.291  -5.737  1.00 16.70 ? 245 CYS B CA   6  
ATOM   10843 C C    . CYS B 2 106 ? 8.395   -3.690  -6.852  1.00 16.64 ? 245 CYS B C    6  
ATOM   10844 O O    . CYS B 2 106 ? 9.540   -3.285  -6.838  1.00 17.47 ? 245 CYS B O    6  
ATOM   10845 C CB   . CYS B 2 106 ? 7.072   -4.520  -4.895  1.00 15.93 ? 245 CYS B CB   6  
ATOM   10846 S SG   . CYS B 2 106 ? 7.845   -4.371  -3.265  1.00 18.24 ? 245 CYS B SG   6  
ATOM   10847 H H    . CYS B 2 106 ? 5.301   -3.043  -6.032  1.00 0.00  ? 245 CYS B H    6  
ATOM   10848 H HA   . CYS B 2 106 ? 7.886   -2.547  -5.108  1.00 0.00  ? 245 CYS B HA   6  
ATOM   10849 H HB2  . CYS B 2 106 ? 6.000   -4.585  -4.779  1.00 0.00  ? 245 CYS B HB2  6  
ATOM   10850 H HB3  . CYS B 2 106 ? 7.438   -5.408  -5.386  1.00 0.00  ? 245 CYS B HB3  6  
ATOM   10851 H HG   . CYS B 2 106 ? 8.263   -3.507  -3.212  1.00 0.00  ? 245 CYS B HG   6  
ATOM   10852 N N    . PRO B 2 107 ? 7.916   -4.475  -7.789  1.00 18.63 ? 246 PRO B N    6  
ATOM   10853 C CA   . PRO B 2 107 ? 8.737   -4.942  -8.921  1.00 19.52 ? 246 PRO B CA   6  
ATOM   10854 C C    . PRO B 2 107 ? 8.865   -3.840  -9.977  1.00 19.33 ? 246 PRO B C    6  
ATOM   10855 O O    . PRO B 2 107 ? 9.960   -3.328  -10.140 1.00 19.97 ? 246 PRO B O    6  
ATOM   10856 C CB   . PRO B 2 107 ? 7.950   -6.135  -9.469  1.00 18.97 ? 246 PRO B CB   6  
ATOM   10857 C CG   . PRO B 2 107 ? 6.485   -5.942  -9.008  1.00 18.88 ? 246 PRO B CG   6  
ATOM   10858 C CD   . PRO B 2 107 ? 6.522   -4.972  -7.812  1.00 17.74 ? 246 PRO B CD   6  
ATOM   10859 O OXT  . PRO B 2 107 ? 7.867   -3.528  -10.605 1.00 0.00  ? 246 PRO B OXT  6  
ATOM   10860 H HA   . PRO B 2 107 ? 9.708   -5.263  -8.581  1.00 0.00  ? 246 PRO B HA   6  
ATOM   10861 H HB2  . PRO B 2 107 ? 8.005   -6.149  -10.549 1.00 0.00  ? 246 PRO B HB2  6  
ATOM   10862 H HB3  . PRO B 2 107 ? 8.340   -7.055  -9.064  1.00 0.00  ? 246 PRO B HB3  6  
ATOM   10863 H HG2  . PRO B 2 107 ? 5.898   -5.521  -9.813  1.00 0.00  ? 246 PRO B HG2  6  
ATOM   10864 H HG3  . PRO B 2 107 ? 6.067   -6.887  -8.698  1.00 0.00  ? 246 PRO B HG3  6  
ATOM   10865 H HD2  . PRO B 2 107 ? 5.829   -4.158  -7.971  1.00 0.00  ? 246 PRO B HD2  6  
ATOM   10866 H HD3  . PRO B 2 107 ? 6.295   -5.493  -6.897  1.00 0.00  ? 246 PRO B HD3  6  
HETATM 10867 C C    . ACE A 1 1   ? 2.048   0.448   11.314  1.00 14.10 ? 100 ACE A C    7  
HETATM 10868 O O    . ACE A 1 1   ? 2.656   0.238   10.284  1.00 14.64 ? 100 ACE A O    7  
HETATM 10869 C CH3  . ACE A 1 1   ? 2.524   -0.129  12.649  1.00 14.17 ? 100 ACE A CH3  7  
HETATM 10870 H H1   . ACE A 1 1   ? 1.700   -0.621  13.143  1.00 0.00  ? 100 ACE A H1   7  
HETATM 10871 H H2   . ACE A 1 1   ? 3.315   -0.842  12.471  1.00 0.00  ? 100 ACE A H2   7  
HETATM 10872 H H3   . ACE A 1 1   ? 2.894   0.670   13.274  1.00 0.00  ? 100 ACE A H3   7  
HETATM 10873 N N    . PTR A 1 2   ? 0.964   1.174   11.325  1.00 14.28 ? 101 PTR A N    7  
HETATM 10874 C CA   . PTR A 1 2   ? 0.449   1.764   10.056  1.00 13.54 ? 101 PTR A CA   7  
HETATM 10875 C C    . PTR A 1 2   ? 0.376   3.286   10.194  1.00 14.12 ? 101 PTR A C    7  
HETATM 10876 O O    . PTR A 1 2   ? 0.576   3.832   11.260  1.00 13.97 ? 101 PTR A O    7  
HETATM 10877 C CB   . PTR A 1 2   ? -0.946  1.208   9.765   1.00 13.83 ? 101 PTR A CB   7  
HETATM 10878 C CG   . PTR A 1 2   ? -0.846  -0.268  9.460   1.00 12.91 ? 101 PTR A CG   7  
HETATM 10879 C CD1  . PTR A 1 2   ? -0.615  -0.699  8.143   1.00 12.17 ? 101 PTR A CD1  7  
HETATM 10880 C CD2  . PTR A 1 2   ? -0.985  -1.210  10.494  1.00 12.70 ? 101 PTR A CD2  7  
HETATM 10881 C CE1  . PTR A 1 2   ? -0.521  -2.072  7.859   1.00 12.08 ? 101 PTR A CE1  7  
HETATM 10882 C CE2  . PTR A 1 2   ? -0.891  -2.583  10.211  1.00 11.44 ? 101 PTR A CE2  7  
HETATM 10883 C CZ   . PTR A 1 2   ? -0.660  -3.014  8.893   1.00 13.78 ? 101 PTR A CZ   7  
HETATM 10884 O OH   . PTR A 1 2   ? -0.565  -4.412  8.604   1.00 14.51 ? 101 PTR A OH   7  
HETATM 10885 P P    . PTR A 1 2   ? -0.930  -5.502  9.731   1.00 17.94 ? 101 PTR A P    7  
HETATM 10886 O O1P  . PTR A 1 2   ? -2.345  -5.198  10.046  1.00 18.17 ? 101 PTR A O1P  7  
HETATM 10887 O O2P  . PTR A 1 2   ? 0.031   -5.198  10.815  1.00 15.88 ? 101 PTR A O2P  7  
HETATM 10888 O O3P  . PTR A 1 2   ? -0.706  -6.789  9.037   1.00 18.41 ? 101 PTR A O3P  7  
HETATM 10889 H H    . PTR A 1 2   ? 0.486   1.331   12.166  1.00 0.00  ? 101 PTR A H    7  
HETATM 10890 H HA   . PTR A 1 2   ? 1.115   1.507   9.244   1.00 0.00  ? 101 PTR A HA   7  
HETATM 10891 H HB2  . PTR A 1 2   ? -1.579  1.356   10.628  1.00 0.00  ? 101 PTR A HB2  7  
HETATM 10892 H HB3  . PTR A 1 2   ? -1.368  1.722   8.915   1.00 0.00  ? 101 PTR A HB3  7  
HETATM 10893 H HD1  . PTR A 1 2   ? -0.508  0.025   7.349   1.00 0.00  ? 101 PTR A HD1  7  
HETATM 10894 H HD2  . PTR A 1 2   ? -1.163  -0.878  11.506  1.00 0.00  ? 101 PTR A HD2  7  
HETATM 10895 H HE1  . PTR A 1 2   ? -0.344  -2.403  6.847   1.00 0.00  ? 101 PTR A HE1  7  
HETATM 10896 H HE2  . PTR A 1 2   ? -0.998  -3.307  11.004  1.00 0.00  ? 101 PTR A HE2  7  
ATOM   10897 N N    . GLU A 1 3   ? 0.095   3.975   9.122   1.00 15.01 ? 102 GLU A N    7  
ATOM   10898 C CA   . GLU A 1 3   ? 0.011   5.462   9.193   1.00 18.67 ? 102 GLU A CA   7  
ATOM   10899 C C    . GLU A 1 3   ? -1.452  5.897   9.096   1.00 23.30 ? 102 GLU A C    7  
ATOM   10900 O O    . GLU A 1 3   ? -2.355  5.086   9.129   1.00 23.42 ? 102 GLU A O    7  
ATOM   10901 C CB   . GLU A 1 3   ? 0.803   6.072   8.035   1.00 18.41 ? 102 GLU A CB   7  
ATOM   10902 C CG   . GLU A 1 3   ? 2.223   5.502   8.031   1.00 20.30 ? 102 GLU A CG   7  
ATOM   10903 C CD   . GLU A 1 3   ? 3.029   6.129   9.170   1.00 19.75 ? 102 GLU A CD   7  
ATOM   10904 O OE1  . GLU A 1 3   ? 2.417   6.699   10.059  1.00 21.81 ? 102 GLU A OE1  7  
ATOM   10905 O OE2  . GLU A 1 3   ? 4.244   6.029   9.134   1.00 19.69 ? 102 GLU A OE2  7  
ATOM   10906 H H    . GLU A 1 3   ? -0.061  3.516   8.270   1.00 0.00  ? 102 GLU A H    7  
ATOM   10907 H HA   . GLU A 1 3   ? 0.426   5.801   10.131  1.00 0.00  ? 102 GLU A HA   7  
ATOM   10908 H HB2  . GLU A 1 3   ? 0.315   5.834   7.101   1.00 0.00  ? 102 GLU A HB2  7  
ATOM   10909 H HB3  . GLU A 1 3   ? 0.848   7.145   8.156   1.00 0.00  ? 102 GLU A HB3  7  
ATOM   10910 H HG2  . GLU A 1 3   ? 2.181   4.431   8.166   1.00 0.00  ? 102 GLU A HG2  7  
ATOM   10911 H HG3  . GLU A 1 3   ? 2.699   5.729   7.089   1.00 0.00  ? 102 GLU A HG3  7  
ATOM   10912 N N    . GLU A 1 4   ? -1.694  7.175   8.978   1.00 29.30 ? 103 GLU A N    7  
ATOM   10913 C CA   . GLU A 1 4   ? -3.098  7.662   8.881   1.00 35.63 ? 103 GLU A CA   7  
ATOM   10914 C C    . GLU A 1 4   ? -3.201  8.713   7.772   1.00 37.94 ? 103 GLU A C    7  
ATOM   10915 O O    . GLU A 1 4   ? -2.270  9.447   7.511   1.00 40.44 ? 103 GLU A O    7  
ATOM   10916 C CB   . GLU A 1 4   ? -3.515  8.288   10.214  1.00 38.84 ? 103 GLU A CB   7  
ATOM   10917 C CG   . GLU A 1 4   ? -4.076  7.202   11.135  1.00 44.99 ? 103 GLU A CG   7  
ATOM   10918 C CD   . GLU A 1 4   ? -5.356  7.709   11.802  1.00 50.48 ? 103 GLU A CD   7  
ATOM   10919 O OE1  . GLU A 1 4   ? -6.069  8.470   11.169  1.00 53.57 ? 103 GLU A OE1  7  
ATOM   10920 O OE2  . GLU A 1 4   ? -5.602  7.327   12.934  1.00 53.04 ? 103 GLU A OE2  7  
ATOM   10921 H H    . GLU A 1 4   ? -0.950  7.813   8.955   1.00 0.00  ? 103 GLU A H    7  
ATOM   10922 H HA   . GLU A 1 4   ? -3.753  6.834   8.653   1.00 0.00  ? 103 GLU A HA   7  
ATOM   10923 H HB2  . GLU A 1 4   ? -2.653  8.746   10.681  1.00 0.00  ? 103 GLU A HB2  7  
ATOM   10924 H HB3  . GLU A 1 4   ? -4.272  9.037   10.041  1.00 0.00  ? 103 GLU A HB3  7  
ATOM   10925 H HG2  . GLU A 1 4   ? -4.297  6.317   10.555  1.00 0.00  ? 103 GLU A HG2  7  
ATOM   10926 H HG3  . GLU A 1 4   ? -3.348  6.962   11.894  1.00 0.00  ? 103 GLU A HG3  7  
ATOM   10927 N N    . ILE A 1 5   ? -4.330  8.791   7.122   1.00 39.26 ? 104 ILE A N    7  
ATOM   10928 C CA   . ILE A 1 5   ? -4.495  9.795   6.033   1.00 40.91 ? 104 ILE A CA   7  
ATOM   10929 C C    . ILE A 1 5   ? -5.057  11.091  6.621   1.00 42.72 ? 104 ILE A C    7  
ATOM   10930 O O    . ILE A 1 5   ? -6.226  11.185  6.939   1.00 43.33 ? 104 ILE A O    7  
ATOM   10931 C CB   . ILE A 1 5   ? -5.463  9.244   4.980   1.00 40.30 ? 104 ILE A CB   7  
ATOM   10932 C CG1  . ILE A 1 5   ? -4.787  8.102   4.215   1.00 39.28 ? 104 ILE A CG1  7  
ATOM   10933 C CG2  . ILE A 1 5   ? -5.848  10.356  3.999   1.00 41.44 ? 104 ILE A CG2  7  
ATOM   10934 C CD1  . ILE A 1 5   ? -3.670  8.665   3.334   1.00 37.66 ? 104 ILE A CD1  7  
ATOM   10935 H H    . ILE A 1 5   ? -5.069  8.191   7.350   1.00 0.00  ? 104 ILE A H    7  
ATOM   10936 H HA   . ILE A 1 5   ? -3.538  9.992   5.575   1.00 0.00  ? 104 ILE A HA   7  
ATOM   10937 H HB   . ILE A 1 5   ? -6.351  8.875   5.470   1.00 0.00  ? 104 ILE A HB   7  
ATOM   10938 H HG12 . ILE A 1 5   ? -4.369  7.396   4.918   1.00 0.00  ? 104 ILE A HG12 7  
ATOM   10939 H HG13 . ILE A 1 5   ? -5.515  7.603   3.594   1.00 0.00  ? 104 ILE A HG13 7  
ATOM   10940 H HG21 . ILE A 1 5   ? -4.973  10.939  3.755   1.00 0.00  ? 104 ILE A HG21 7  
ATOM   10941 H HG22 . ILE A 1 5   ? -6.252  9.918   3.099   1.00 0.00  ? 104 ILE A HG22 7  
ATOM   10942 H HG23 . ILE A 1 5   ? -6.591  10.995  4.453   1.00 0.00  ? 104 ILE A HG23 7  
ATOM   10943 H HD11 . ILE A 1 5   ? -3.450  9.678   3.636   1.00 0.00  ? 104 ILE A HD11 7  
ATOM   10944 H HD12 . ILE A 1 5   ? -2.785  8.055   3.443   1.00 0.00  ? 104 ILE A HD12 7  
ATOM   10945 H HD13 . ILE A 1 5   ? -3.989  8.657   2.302   1.00 0.00  ? 104 ILE A HD13 7  
ATOM   10946 N N    . GLU A 1 6   ? -4.233  12.093  6.768   1.00 0.00  ? 105 GLU A N    7  
ATOM   10947 C CA   . GLU A 1 6   ? -4.721  13.381  7.336   1.00 0.00  ? 105 GLU A CA   7  
ATOM   10948 C C    . GLU A 1 6   ? -4.451  14.513  6.342   1.00 0.00  ? 105 GLU A C    7  
ATOM   10949 O O    . GLU A 1 6   ? -3.481  15.226  6.539   1.00 0.00  ? 105 GLU A O    7  
ATOM   10950 C CB   . GLU A 1 6   ? -3.991  13.668  8.650   1.00 0.00  ? 105 GLU A CB   7  
ATOM   10951 C CG   . GLU A 1 6   ? -4.365  12.605  9.685   1.00 0.00  ? 105 GLU A CG   7  
ATOM   10952 C CD   . GLU A 1 6   ? -5.006  13.278  10.900  1.00 0.00  ? 105 GLU A CD   7  
ATOM   10953 O OE1  . GLU A 1 6   ? -4.566  14.360  11.253  1.00 0.00  ? 105 GLU A OE1  7  
ATOM   10954 O OE2  . GLU A 1 6   ? -5.927  12.702  11.454  1.00 0.00  ? 105 GLU A OE2  7  
ATOM   10955 O OXT  . GLU A 1 6   ? -5.217  14.645  5.403   1.00 0.00  ? 105 GLU A OXT  7  
ATOM   10956 H H    . GLU A 1 6   ? -3.294  11.998  6.506   1.00 0.00  ? 105 GLU A H    7  
ATOM   10957 H HA   . GLU A 1 6   ? -5.783  13.313  7.522   1.00 0.00  ? 105 GLU A HA   7  
ATOM   10958 H HB2  . GLU A 1 6   ? -2.925  13.648  8.480   1.00 0.00  ? 105 GLU A HB2  7  
ATOM   10959 H HB3  . GLU A 1 6   ? -4.280  14.642  9.017   1.00 0.00  ? 105 GLU A HB3  7  
ATOM   10960 H HG2  . GLU A 1 6   ? -5.065  11.908  9.247   1.00 0.00  ? 105 GLU A HG2  7  
ATOM   10961 H HG3  . GLU A 1 6   ? -3.477  12.077  9.995   1.00 0.00  ? 105 GLU A HG3  7  
ATOM   10962 N N    . MET B 2 1   ? -12.331 -12.030 -18.076 1.00 0.00  ? 140 MET B N    7  
ATOM   10963 C CA   . MET B 2 1   ? -10.967 -12.297 -18.613 1.00 0.00  ? 140 MET B CA   7  
ATOM   10964 C C    . MET B 2 1   ? -9.925  -11.975 -17.542 1.00 0.00  ? 140 MET B C    7  
ATOM   10965 O O    . MET B 2 1   ? -9.009  -12.737 -17.303 1.00 0.00  ? 140 MET B O    7  
ATOM   10966 C CB   . MET B 2 1   ? -10.723 -11.420 -19.843 1.00 0.00  ? 140 MET B CB   7  
ATOM   10967 C CG   . MET B 2 1   ? -11.064 -9.967  -19.510 1.00 0.00  ? 140 MET B CG   7  
ATOM   10968 S SD   . MET B 2 1   ? -11.778 -9.165  -20.966 1.00 0.00  ? 140 MET B SD   7  
ATOM   10969 C CE   . MET B 2 1   ? -13.453 -8.959  -20.312 1.00 0.00  ? 140 MET B CE   7  
ATOM   10970 H H1   . MET B 2 1   ? -12.256 -11.470 -17.203 1.00 0.00  ? 140 MET B H1   7  
ATOM   10971 H H2   . MET B 2 1   ? -12.884 -11.500 -18.778 1.00 0.00  ? 140 MET B H2   7  
ATOM   10972 H H3   . MET B 2 1   ? -12.805 -12.933 -17.870 1.00 0.00  ? 140 MET B H3   7  
ATOM   10973 H HA   . MET B 2 1   ? -10.888 -13.338 -18.892 1.00 0.00  ? 140 MET B HA   7  
ATOM   10974 H HB2  . MET B 2 1   ? -9.685  -11.490 -20.134 1.00 0.00  ? 140 MET B HB2  7  
ATOM   10975 H HB3  . MET B 2 1   ? -11.349 -11.757 -20.656 1.00 0.00  ? 140 MET B HB3  7  
ATOM   10976 H HG2  . MET B 2 1   ? -11.777 -9.942  -18.699 1.00 0.00  ? 140 MET B HG2  7  
ATOM   10977 H HG3  . MET B 2 1   ? -10.166 -9.444  -19.216 1.00 0.00  ? 140 MET B HG3  7  
ATOM   10978 H HE1  . MET B 2 1   ? -13.545 -9.489  -19.379 1.00 0.00  ? 140 MET B HE1  7  
ATOM   10979 H HE2  . MET B 2 1   ? -13.648 -7.907  -20.148 1.00 0.00  ? 140 MET B HE2  7  
ATOM   10980 H HE3  . MET B 2 1   ? -14.167 -9.355  -21.022 1.00 0.00  ? 140 MET B HE3  7  
ATOM   10981 N N    . ASP B 2 2   ? -10.056 -10.851 -16.892 1.00 0.00  ? 141 ASP B N    7  
ATOM   10982 C CA   . ASP B 2 2   ? -9.072  -10.481 -15.836 1.00 0.00  ? 141 ASP B CA   7  
ATOM   10983 C C    . ASP B 2 2   ? -9.716  -10.648 -14.459 1.00 0.00  ? 141 ASP B C    7  
ATOM   10984 O O    . ASP B 2 2   ? -10.924 -10.675 -14.327 1.00 0.00  ? 141 ASP B O    7  
ATOM   10985 C CB   . ASP B 2 2   ? -8.643  -9.025  -16.026 1.00 0.00  ? 141 ASP B CB   7  
ATOM   10986 C CG   . ASP B 2 2   ? -7.478  -8.961  -17.015 1.00 0.00  ? 141 ASP B CG   7  
ATOM   10987 O OD1  . ASP B 2 2   ? -7.738  -8.966  -18.207 1.00 0.00  ? 141 ASP B OD1  7  
ATOM   10988 O OD2  . ASP B 2 2   ? -6.346  -8.907  -16.564 1.00 0.00  ? 141 ASP B OD2  7  
ATOM   10989 H H    . ASP B 2 2   ? -10.802 -10.249 -17.099 1.00 0.00  ? 141 ASP B H    7  
ATOM   10990 H HA   . ASP B 2 2   ? -8.208  -11.124 -15.910 1.00 0.00  ? 141 ASP B HA   7  
ATOM   10991 H HB2  . ASP B 2 2   ? -9.475  -8.453  -16.410 1.00 0.00  ? 141 ASP B HB2  7  
ATOM   10992 H HB3  . ASP B 2 2   ? -8.330  -8.615  -15.078 1.00 0.00  ? 141 ASP B HB3  7  
ATOM   10993 N N    . SER B 2 3   ? -8.920  -10.760 -13.431 1.00 0.00  ? 142 SER B N    7  
ATOM   10994 C CA   . SER B 2 3   ? -9.487  -10.924 -12.063 1.00 0.00  ? 142 SER B CA   7  
ATOM   10995 C C    . SER B 2 3   ? -8.641  -10.136 -11.063 1.00 0.00  ? 142 SER B C    7  
ATOM   10996 O O    . SER B 2 3   ? -7.450  -9.971  -11.235 1.00 0.00  ? 142 SER B O    7  
ATOM   10997 C CB   . SER B 2 3   ? -9.480  -12.405 -11.683 1.00 0.00  ? 142 SER B CB   7  
ATOM   10998 O OG   . SER B 2 3   ? -8.425  -13.062 -12.374 1.00 0.00  ? 142 SER B OG   7  
ATOM   10999 H H    . SER B 2 3   ? -7.948  -10.736 -13.559 1.00 0.00  ? 142 SER B H    7  
ATOM   11000 H HA   . SER B 2 3   ? -10.501 -10.553 -12.048 1.00 0.00  ? 142 SER B HA   7  
ATOM   11001 H HB2  . SER B 2 3   ? -9.326  -12.506 -10.622 1.00 0.00  ? 142 SER B HB2  7  
ATOM   11002 H HB3  . SER B 2 3   ? -10.430 -12.848 -11.950 1.00 0.00  ? 142 SER B HB3  7  
ATOM   11003 H HG   . SER B 2 3   ? -8.439  -13.988 -12.123 1.00 0.00  ? 142 SER B HG   7  
ATOM   11004 N N    . ILE B 2 4   ? -9.247  -9.647  -10.015 1.00 0.00  ? 143 ILE B N    7  
ATOM   11005 C CA   . ILE B 2 4   ? -8.476  -8.871  -9.004  1.00 0.00  ? 143 ILE B CA   7  
ATOM   11006 C C    . ILE B 2 4   ? -7.539  -9.809  -8.238  1.00 0.00  ? 143 ILE B C    7  
ATOM   11007 O O    . ILE B 2 4   ? -6.698  -9.373  -7.477  1.00 0.00  ? 143 ILE B O    7  
ATOM   11008 C CB   . ILE B 2 4   ? -9.446  -8.208  -8.024  1.00 0.00  ? 143 ILE B CB   7  
ATOM   11009 C CG1  . ILE B 2 4   ? -8.654  -7.397  -6.997  1.00 0.00  ? 143 ILE B CG1  7  
ATOM   11010 C CG2  . ILE B 2 4   ? -10.261 -9.285  -7.306  1.00 0.00  ? 143 ILE B CG2  7  
ATOM   11011 C CD1  . ILE B 2 4   ? -9.623  -6.635  -6.090  1.00 0.00  ? 143 ILE B CD1  7  
ATOM   11012 H H    . ILE B 2 4   ? -10.208 -9.791  -9.894  1.00 0.00  ? 143 ILE B H    7  
ATOM   11013 H HA   . ILE B 2 4   ? -7.894  -8.110  -9.503  1.00 0.00  ? 143 ILE B HA   7  
ATOM   11014 H HB   . ILE B 2 4   ? -10.114 -7.552  -8.567  1.00 0.00  ? 143 ILE B HB   7  
ATOM   11015 H HG12 . ILE B 2 4   ? -8.050  -8.066  -6.399  1.00 0.00  ? 143 ILE B HG12 7  
ATOM   11016 H HG13 . ILE B 2 4   ? -8.015  -6.693  -7.507  1.00 0.00  ? 143 ILE B HG13 7  
ATOM   11017 H HG21 . ILE B 2 4   ? -9.909  -10.261 -7.606  1.00 0.00  ? 143 ILE B HG21 7  
ATOM   11018 H HG22 . ILE B 2 4   ? -10.145 -9.171  -6.239  1.00 0.00  ? 143 ILE B HG22 7  
ATOM   11019 H HG23 . ILE B 2 4   ? -11.303 -9.182  -7.569  1.00 0.00  ? 143 ILE B HG23 7  
ATOM   11020 H HD11 . ILE B 2 4   ? -10.636 -6.801  -6.427  1.00 0.00  ? 143 ILE B HD11 7  
ATOM   11021 H HD12 . ILE B 2 4   ? -9.518  -6.988  -5.075  1.00 0.00  ? 143 ILE B HD12 7  
ATOM   11022 H HD13 . ILE B 2 4   ? -9.398  -5.580  -6.129  1.00 0.00  ? 143 ILE B HD13 7  
ATOM   11023 N N    . GLN B 2 5   ? -7.676  -11.093 -8.430  1.00 0.00  ? 144 GLN B N    7  
ATOM   11024 C CA   . GLN B 2 5   ? -6.792  -12.052 -7.708  1.00 0.00  ? 144 GLN B CA   7  
ATOM   11025 C C    . GLN B 2 5   ? -5.419  -12.100 -8.386  1.00 0.00  ? 144 GLN B C    7  
ATOM   11026 O O    . GLN B 2 5   ? -4.544  -12.840 -7.981  1.00 0.00  ? 144 GLN B O    7  
ATOM   11027 C CB   . GLN B 2 5   ? -7.422  -13.446 -7.737  1.00 0.00  ? 144 GLN B CB   7  
ATOM   11028 C CG   . GLN B 2 5   ? -6.744  -14.334 -6.692  1.00 0.00  ? 144 GLN B CG   7  
ATOM   11029 C CD   . GLN B 2 5   ? -6.983  -15.804 -7.038  1.00 0.00  ? 144 GLN B CD   7  
ATOM   11030 O OE1  . GLN B 2 5   ? -7.887  -16.425 -6.515  1.00 0.00  ? 144 GLN B OE1  7  
ATOM   11031 N NE2  . GLN B 2 5   ? -6.206  -16.393 -7.906  1.00 0.00  ? 144 GLN B NE2  7  
ATOM   11032 H H    . GLN B 2 5   ? -8.361  -11.428 -9.046  1.00 0.00  ? 144 GLN B H    7  
ATOM   11033 H HA   . GLN B 2 5   ? -6.675  -11.731 -6.684  1.00 0.00  ? 144 GLN B HA   7  
ATOM   11034 H HB2  . GLN B 2 5   ? -8.477  -13.368 -7.514  1.00 0.00  ? 144 GLN B HB2  7  
ATOM   11035 H HB3  . GLN B 2 5   ? -7.291  -13.881 -8.716  1.00 0.00  ? 144 GLN B HB3  7  
ATOM   11036 H HG2  . GLN B 2 5   ? -5.681  -14.134 -6.684  1.00 0.00  ? 144 GLN B HG2  7  
ATOM   11037 H HG3  . GLN B 2 5   ? -7.157  -14.124 -5.717  1.00 0.00  ? 144 GLN B HG3  7  
ATOM   11038 H HE21 . GLN B 2 5   ? -5.476  -15.894 -8.328  1.00 0.00  ? 144 GLN B HE21 7  
ATOM   11039 H HE22 . GLN B 2 5   ? -6.352  -17.335 -8.134  1.00 0.00  ? 144 GLN B HE22 7  
ATOM   11040 N N    . ALA B 2 6   ? -5.220  -11.319 -9.414  1.00 42.36 ? 145 ALA B N    7  
ATOM   11041 C CA   . ALA B 2 6   ? -3.901  -11.326 -10.110 1.00 39.52 ? 145 ALA B CA   7  
ATOM   11042 C C    . ALA B 2 6   ? -3.603  -9.924  -10.645 1.00 36.36 ? 145 ALA B C    7  
ATOM   11043 O O    . ALA B 2 6   ? -3.486  -9.714  -11.836 1.00 36.34 ? 145 ALA B O    7  
ATOM   11044 C CB   . ALA B 2 6   ? -3.944  -12.318 -11.273 1.00 40.62 ? 145 ALA B CB   7  
ATOM   11045 H H    . ALA B 2 6   ? -5.934  -10.728 -9.728  1.00 0.00  ? 145 ALA B H    7  
ATOM   11046 H HA   . ALA B 2 6   ? -3.128  -11.617 -9.414  1.00 0.00  ? 145 ALA B HA   7  
ATOM   11047 H HB1  . ALA B 2 6   ? -4.299  -13.274 -10.917 1.00 0.00  ? 145 ALA B HB1  7  
ATOM   11048 H HB2  . ALA B 2 6   ? -4.611  -11.948 -12.037 1.00 0.00  ? 145 ALA B HB2  7  
ATOM   11049 H HB3  . ALA B 2 6   ? -2.952  -12.432 -11.685 1.00 0.00  ? 145 ALA B HB3  7  
ATOM   11050 N N    . GLU B 2 7   ? -3.484  -8.959  -9.773  1.00 32.22 ? 146 GLU B N    7  
ATOM   11051 C CA   . GLU B 2 7   ? -3.196  -7.571  -10.229 1.00 28.03 ? 146 GLU B CA   7  
ATOM   11052 C C    . GLU B 2 7   ? -1.686  -7.387  -10.392 1.00 24.38 ? 146 GLU B C    7  
ATOM   11053 O O    . GLU B 2 7   ? -0.898  -8.161  -9.884  1.00 22.48 ? 146 GLU B O    7  
ATOM   11054 C CB   . GLU B 2 7   ? -3.720  -6.575  -9.193  1.00 27.81 ? 146 GLU B CB   7  
ATOM   11055 C CG   . GLU B 2 7   ? -5.099  -7.023  -8.703  1.00 30.44 ? 146 GLU B CG   7  
ATOM   11056 C CD   . GLU B 2 7   ? -5.047  -7.274  -7.195  1.00 31.15 ? 146 GLU B CD   7  
ATOM   11057 O OE1  . GLU B 2 7   ? -3.966  -7.529  -6.693  1.00 34.56 ? 146 GLU B OE1  7  
ATOM   11058 O OE2  . GLU B 2 7   ? -6.092  -7.206  -6.567  1.00 30.91 ? 146 GLU B OE2  7  
ATOM   11059 H H    . GLU B 2 7   ? -3.584  -9.149  -8.817  1.00 0.00  ? 146 GLU B H    7  
ATOM   11060 H HA   . GLU B 2 7   ? -3.683  -7.395  -11.177 1.00 0.00  ? 146 GLU B HA   7  
ATOM   11061 H HB2  . GLU B 2 7   ? -3.037  -6.531  -8.359  1.00 0.00  ? 146 GLU B HB2  7  
ATOM   11062 H HB3  . GLU B 2 7   ? -3.802  -5.596  -9.644  1.00 0.00  ? 146 GLU B HB3  7  
ATOM   11063 H HG2  . GLU B 2 7   ? -5.824  -6.251  -8.917  1.00 0.00  ? 146 GLU B HG2  7  
ATOM   11064 H HG3  . GLU B 2 7   ? -5.382  -7.934  -9.208  1.00 0.00  ? 146 GLU B HG3  7  
ATOM   11065 N N    . GLU B 2 8   ? -1.276  -6.365  -11.093 1.00 21.92 ? 147 GLU B N    7  
ATOM   11066 C CA   . GLU B 2 8   ? 0.182   -6.131  -11.286 1.00 21.70 ? 147 GLU B CA   7  
ATOM   11067 C C    . GLU B 2 8   ? 0.823   -5.782  -9.940  1.00 19.46 ? 147 GLU B C    7  
ATOM   11068 O O    . GLU B 2 8   ? 2.024   -5.853  -9.776  1.00 19.28 ? 147 GLU B O    7  
ATOM   11069 C CB   . GLU B 2 8   ? 0.389   -4.975  -12.268 1.00 26.72 ? 147 GLU B CB   7  
ATOM   11070 C CG   . GLU B 2 8   ? -0.388  -3.749  -11.787 1.00 37.15 ? 147 GLU B CG   7  
ATOM   11071 C CD   . GLU B 2 8   ? -1.271  -3.226  -12.921 1.00 41.71 ? 147 GLU B CD   7  
ATOM   11072 O OE1  . GLU B 2 8   ? -0.728  -2.893  -13.962 1.00 45.02 ? 147 GLU B OE1  7  
ATOM   11073 O OE2  . GLU B 2 8   ? -2.474  -3.166  -12.729 1.00 46.00 ? 147 GLU B OE2  7  
ATOM   11074 H H    . GLU B 2 8   ? -1.928  -5.753  -11.492 1.00 0.00  ? 147 GLU B H    7  
ATOM   11075 H HA   . GLU B 2 8   ? 0.641   -7.025  -11.680 1.00 0.00  ? 147 GLU B HA   7  
ATOM   11076 H HB2  . GLU B 2 8   ? 1.441   -4.736  -12.326 1.00 0.00  ? 147 GLU B HB2  7  
ATOM   11077 H HB3  . GLU B 2 8   ? 0.031   -5.265  -13.244 1.00 0.00  ? 147 GLU B HB3  7  
ATOM   11078 H HG2  . GLU B 2 8   ? -1.007  -4.022  -10.944 1.00 0.00  ? 147 GLU B HG2  7  
ATOM   11079 H HG3  . GLU B 2 8   ? 0.306   -2.977  -11.488 1.00 0.00  ? 147 GLU B HG3  7  
ATOM   11080 N N    . TRP B 2 9   ? 0.028   -5.408  -8.973  1.00 17.10 ? 148 TRP B N    7  
ATOM   11081 C CA   . TRP B 2 9   ? 0.589   -5.058  -7.637  1.00 12.75 ? 148 TRP B CA   7  
ATOM   11082 C C    . TRP B 2 9   ? 0.142   -6.101  -6.611  1.00 12.19 ? 148 TRP B C    7  
ATOM   11083 O O    . TRP B 2 9   ? -0.090  -5.793  -5.458  1.00 11.66 ? 148 TRP B O    7  
ATOM   11084 C CB   . TRP B 2 9   ? 0.090   -3.673  -7.208  1.00 14.42 ? 148 TRP B CB   7  
ATOM   11085 C CG   . TRP B 2 9   ? -1.307  -3.461  -7.701  1.00 13.12 ? 148 TRP B CG   7  
ATOM   11086 C CD1  . TRP B 2 9   ? -1.640  -2.777  -8.820  1.00 13.11 ? 148 TRP B CD1  7  
ATOM   11087 C CD2  . TRP B 2 9   ? -2.559  -3.920  -7.113  1.00 12.81 ? 148 TRP B CD2  7  
ATOM   11088 N NE1  . TRP B 2 9   ? -3.017  -2.787  -8.959  1.00 12.63 ? 148 TRP B NE1  7  
ATOM   11089 C CE2  . TRP B 2 9   ? -3.629  -3.477  -7.933  1.00 13.14 ? 148 TRP B CE2  7  
ATOM   11090 C CE3  . TRP B 2 9   ? -2.869  -4.671  -5.957  1.00 10.52 ? 148 TRP B CE3  7  
ATOM   11091 C CZ2  . TRP B 2 9   ? -4.961  -3.769  -7.619  1.00 13.39 ? 148 TRP B CZ2  7  
ATOM   11092 C CZ3  . TRP B 2 9   ? -4.210  -4.966  -5.638  1.00 12.83 ? 148 TRP B CZ3  7  
ATOM   11093 C CH2  . TRP B 2 9   ? -5.252  -4.515  -6.467  1.00 12.53 ? 148 TRP B CH2  7  
ATOM   11094 H H    . TRP B 2 9   ? -0.939  -5.360  -9.127  1.00 0.00  ? 148 TRP B H    7  
ATOM   11095 H HA   . TRP B 2 9   ? 1.668   -5.050  -7.692  1.00 0.00  ? 148 TRP B HA   7  
ATOM   11096 H HB2  . TRP B 2 9   ? 0.105   -3.604  -6.130  1.00 0.00  ? 148 TRP B HB2  7  
ATOM   11097 H HB3  . TRP B 2 9   ? 0.737   -2.914  -7.625  1.00 0.00  ? 148 TRP B HB3  7  
ATOM   11098 H HD1  . TRP B 2 9   ? -0.945  -2.301  -9.496  1.00 0.00  ? 148 TRP B HD1  7  
ATOM   11099 H HE1  . TRP B 2 9   ? -3.514  -2.361  -9.688  1.00 0.00  ? 148 TRP B HE1  7  
ATOM   11100 H HE3  . TRP B 2 9   ? -2.075  -5.020  -5.315  1.00 0.00  ? 148 TRP B HE3  7  
ATOM   11101 H HZ2  . TRP B 2 9   ? -5.759  -3.422  -8.258  1.00 0.00  ? 148 TRP B HZ2  7  
ATOM   11102 H HZ3  . TRP B 2 9   ? -4.438  -5.541  -4.752  1.00 0.00  ? 148 TRP B HZ3  7  
ATOM   11103 H HH2  . TRP B 2 9   ? -6.278  -4.745  -6.218  1.00 0.00  ? 148 TRP B HH2  7  
ATOM   11104 N N    . TYR B 2 10  ? 0.016   -7.334  -7.020  1.00 11.66 ? 149 TYR B N    7  
ATOM   11105 C CA   . TYR B 2 10  ? -0.417  -8.397  -6.070  1.00 13.63 ? 149 TYR B CA   7  
ATOM   11106 C C    . TYR B 2 10  ? 0.777   -9.288  -5.721  1.00 14.73 ? 149 TYR B C    7  
ATOM   11107 O O    . TYR B 2 10  ? 1.265   -10.038 -6.544  1.00 16.34 ? 149 TYR B O    7  
ATOM   11108 C CB   . TYR B 2 10  ? -1.513  -9.245  -6.720  1.00 12.52 ? 149 TYR B CB   7  
ATOM   11109 C CG   . TYR B 2 10  ? -2.250  -10.020 -5.655  1.00 15.49 ? 149 TYR B CG   7  
ATOM   11110 C CD1  . TYR B 2 10  ? -2.745  -9.359  -4.518  1.00 14.45 ? 149 TYR B CD1  7  
ATOM   11111 C CD2  . TYR B 2 10  ? -2.439  -11.405 -5.800  1.00 19.03 ? 149 TYR B CD2  7  
ATOM   11112 C CE1  . TYR B 2 10  ? -3.430  -10.082 -3.527  1.00 15.99 ? 149 TYR B CE1  7  
ATOM   11113 C CE2  . TYR B 2 10  ? -3.125  -12.129 -4.810  1.00 20.41 ? 149 TYR B CE2  7  
ATOM   11114 C CZ   . TYR B 2 10  ? -3.621  -11.468 -3.674  1.00 21.15 ? 149 TYR B CZ   7  
ATOM   11115 O OH   . TYR B 2 10  ? -4.293  -12.178 -2.700  1.00 23.67 ? 149 TYR B OH   7  
ATOM   11116 H H    . TYR B 2 10  ? 0.208   -7.561  -7.955  1.00 0.00  ? 149 TYR B H    7  
ATOM   11117 H HA   . TYR B 2 10  ? -0.800  -7.941  -5.169  1.00 0.00  ? 149 TYR B HA   7  
ATOM   11118 H HB2  . TYR B 2 10  ? -2.205  -8.599  -7.240  1.00 0.00  ? 149 TYR B HB2  7  
ATOM   11119 H HB3  . TYR B 2 10  ? -1.066  -9.934  -7.421  1.00 0.00  ? 149 TYR B HB3  7  
ATOM   11120 H HD1  . TYR B 2 10  ? -2.599  -8.296  -4.405  1.00 0.00  ? 149 TYR B HD1  7  
ATOM   11121 H HD2  . TYR B 2 10  ? -2.059  -11.913 -6.674  1.00 0.00  ? 149 TYR B HD2  7  
ATOM   11122 H HE1  . TYR B 2 10  ? -3.812  -9.575  -2.654  1.00 0.00  ? 149 TYR B HE1  7  
ATOM   11123 H HE2  . TYR B 2 10  ? -3.271  -13.192 -4.922  1.00 0.00  ? 149 TYR B HE2  7  
ATOM   11124 H HH   . TYR B 2 10  ? -3.657  -12.734 -2.246  1.00 0.00  ? 149 TYR B HH   7  
ATOM   11125 N N    . PHE B 2 11  ? 1.250   -9.215  -4.508  1.00 14.41 ? 150 PHE B N    7  
ATOM   11126 C CA   . PHE B 2 11  ? 2.411   -10.059 -4.109  1.00 13.20 ? 150 PHE B CA   7  
ATOM   11127 C C    . PHE B 2 11  ? 1.903   -11.335 -3.433  1.00 12.95 ? 150 PHE B C    7  
ATOM   11128 O O    . PHE B 2 11  ? 2.444   -12.407 -3.623  1.00 12.44 ? 150 PHE B O    7  
ATOM   11129 C CB   . PHE B 2 11  ? 3.295   -9.283  -3.130  1.00 13.34 ? 150 PHE B CB   7  
ATOM   11130 C CG   . PHE B 2 11  ? 4.598   -8.925  -3.804  1.00 10.91 ? 150 PHE B CG   7  
ATOM   11131 C CD1  . PHE B 2 11  ? 4.591   -8.360  -5.090  1.00 10.43 ? 150 PHE B CD1  7  
ATOM   11132 C CD2  . PHE B 2 11  ? 5.816   -9.155  -3.144  1.00 10.09 ? 150 PHE B CD2  7  
ATOM   11133 C CE1  . PHE B 2 11  ? 5.804   -8.027  -5.718  1.00 9.38  ? 150 PHE B CE1  7  
ATOM   11134 C CE2  . PHE B 2 11  ? 7.029   -8.822  -3.770  1.00 7.94  ? 150 PHE B CE2  7  
ATOM   11135 C CZ   . PHE B 2 11  ? 7.022   -8.258  -5.057  1.00 8.81  ? 150 PHE B CZ   7  
ATOM   11136 H H    . PHE B 2 11  ? 0.842   -8.604  -3.859  1.00 0.00  ? 150 PHE B H    7  
ATOM   11137 H HA   . PHE B 2 11  ? 2.985   -10.320 -4.985  1.00 0.00  ? 150 PHE B HA   7  
ATOM   11138 H HB2  . PHE B 2 11  ? 2.786   -8.380  -2.826  1.00 0.00  ? 150 PHE B HB2  7  
ATOM   11139 H HB3  . PHE B 2 11  ? 3.495   -9.894  -2.263  1.00 0.00  ? 150 PHE B HB3  7  
ATOM   11140 H HD1  . PHE B 2 11  ? 3.655   -8.183  -5.599  1.00 0.00  ? 150 PHE B HD1  7  
ATOM   11141 H HD2  . PHE B 2 11  ? 5.821   -9.589  -2.155  1.00 0.00  ? 150 PHE B HD2  7  
ATOM   11142 H HE1  . PHE B 2 11  ? 5.799   -7.594  -6.706  1.00 0.00  ? 150 PHE B HE1  7  
ATOM   11143 H HE2  . PHE B 2 11  ? 7.965   -8.999  -3.262  1.00 0.00  ? 150 PHE B HE2  7  
ATOM   11144 H HZ   . PHE B 2 11  ? 7.954   -8.001  -5.539  1.00 0.00  ? 150 PHE B HZ   7  
ATOM   11145 N N    . GLY B 2 12  ? 0.869   -11.229 -2.644  1.00 14.57 ? 151 GLY B N    7  
ATOM   11146 C CA   . GLY B 2 12  ? 0.329   -12.433 -1.957  1.00 13.68 ? 151 GLY B CA   7  
ATOM   11147 C C    . GLY B 2 12  ? 0.616   -12.335 -0.459  1.00 15.95 ? 151 GLY B C    7  
ATOM   11148 O O    . GLY B 2 12  ? 0.740   -11.259 0.091   1.00 16.08 ? 151 GLY B O    7  
ATOM   11149 H H    . GLY B 2 12  ? 0.449   -10.357 -2.503  1.00 0.00  ? 151 GLY B H    7  
ATOM   11150 H HA2  . GLY B 2 12  ? -0.738  -12.492 -2.119  1.00 0.00  ? 151 GLY B HA2  7  
ATOM   11151 H HA3  . GLY B 2 12  ? 0.803   -13.319 -2.354  1.00 0.00  ? 151 GLY B HA3  7  
ATOM   11152 N N    . LYS B 2 13  ? 0.724   -13.452 0.204   1.00 14.92 ? 152 LYS B N    7  
ATOM   11153 C CA   . LYS B 2 13  ? 1.004   -13.426 1.668   1.00 16.57 ? 152 LYS B CA   7  
ATOM   11154 C C    . LYS B 2 13  ? 2.517   -13.422 1.897   1.00 15.79 ? 152 LYS B C    7  
ATOM   11155 O O    . LYS B 2 13  ? 3.218   -14.322 1.479   1.00 15.62 ? 152 LYS B O    7  
ATOM   11156 C CB   . LYS B 2 13  ? 0.390   -14.663 2.328   1.00 19.39 ? 152 LYS B CB   7  
ATOM   11157 C CG   . LYS B 2 13  ? 0.665   -14.630 3.832   1.00 26.20 ? 152 LYS B CG   7  
ATOM   11158 C CD   . LYS B 2 13  ? -0.241  -15.641 4.540